| 1 | %'msgbox_uvmat': associated with GUI msgbox_uvmat.fig to display message boxes, for error, warning or input calls
|
|---|
| 2 | % msgbox_uvmat(title,display)
|
|---|
| 3 | %
|
|---|
| 4 | % OUTPUT:
|
|---|
| 5 | % answer (text string)= 'yes', 'No', 'cancel', or the text string introduced as input
|
|---|
| 6 | %
|
|---|
| 7 | %INPUT:
|
|---|
| 8 | % title: string indicating the type of message box:
|
|---|
| 9 | % title= 'INPUT_TXT','CONFIMATION' ,'ERROR', 'WARNING', 'INPUT_Y-N', default = 'INPUT_TXT' (the title is displayed in the upper bar of the fig).
|
|---|
| 10 | % if title='INPUT_TXT', input data is asked in an edit box
|
|---|
| 11 | % if title='CONFIMATION'', 'ERROR', 'WARNING', the figure remains opened until a button 'OK' is pressed
|
|---|
| 12 | % if title='INPUT_Y-N', an answer Yes/No is requested
|
|---|
| 13 | % display, displayed text
|
|---|
| 14 | % default_answer: default answer in the edit box (only used with title='INPUT_TXT')
|
|---|
| 15 |
|
|---|
| 16 | function varargout = msgbox_uvmat(varargin)
|
|---|
| 17 |
|
|---|
| 18 | % Last Modified by GUIDE v2.5 24-Oct-2009 21:55:17
|
|---|
| 19 |
|
|---|
| 20 | % Begin initialization code - DO NOT EDIT
|
|---|
| 21 | gui_Singleton = 1;
|
|---|
| 22 | gui_State = struct('gui_Name', mfilename, ...
|
|---|
| 23 | 'gui_Singleton', gui_Singleton, ...
|
|---|
| 24 | 'gui_OpeningFcn', @msgbox_uvmat_OpeningFcn, ...
|
|---|
| 25 | 'gui_OutputFcn', @msgbox_uvmat_OutputFcn, ...
|
|---|
| 26 | 'gui_LayoutFcn', [] , ...
|
|---|
| 27 | 'gui_Callback', []);
|
|---|
| 28 | if nargin && ischar(varargin{1}) && ~isempty(regexp(varargin{1},'_Callback','once'))
|
|---|
| 29 | gui_State.gui_Callback = str2func(varargin{1});%for running msgbox_uvmat from a Callback
|
|---|
| 30 | end
|
|---|
| 31 |
|
|---|
| 32 | if nargout
|
|---|
| 33 | [varargout{1:nargout}] = gui_mainfcn(gui_State, varargin{:});
|
|---|
| 34 | else
|
|---|
| 35 | gui_mainfcn(gui_State, varargin{:});
|
|---|
| 36 | end
|
|---|
| 37 | % End initialization code - DO NOT EDIT
|
|---|
| 38 |
|
|---|
| 39 | % --- Executes just before msgbox_uvmat is made visible.
|
|---|
| 40 | function msgbox_uvmat_OpeningFcn(hObject, eventdata, handles,title,display_str,default_answer,Position)
|
|---|
| 41 | % This function has no output args, see OutputFcn.
|
|---|
| 42 |
|
|---|
| 43 | % Choose default command line output for msgbox_uvmat
|
|---|
| 44 | handles.output = 'Cancel';
|
|---|
| 45 | set(handles.figure1,'Units','pixels')
|
|---|
| 46 | FigPos=[100 150 500 50];%default position
|
|---|
| 47 | if exist('Position','var') && numel(Position)>=2
|
|---|
| 48 | FigPos(1)=Position(1);
|
|---|
| 49 | FigPos(2)=Position(2)-FigPos(4);% upper left corner set by input Position
|
|---|
| 50 | set(handles.figure1,'Position',FigPos)
|
|---|
| 51 | end
|
|---|
| 52 | set(handles.OK,'Units','pixels')
|
|---|
| 53 | set(handles.OK,'Position',[100 2 60 30])
|
|---|
| 54 | set(handles.OK,'FontSize',15)
|
|---|
| 55 | set(handles.No,'Units','pixels')
|
|---|
| 56 | set(handles.No,'Position',[200 2 60 30])
|
|---|
| 57 | set(handles.No,'FontSize',15)
|
|---|
| 58 | set(handles.Cancel,'Units','pixels')
|
|---|
| 59 | set(handles.Cancel,'Position',[300 2 60 30])
|
|---|
| 60 | set(handles.Cancel,'FontSize',15)
|
|---|
| 61 |
|
|---|
| 62 |
|
|---|
| 63 | % Update handles structure
|
|---|
| 64 | guidata(hObject, handles);
|
|---|
| 65 | testNo=0;
|
|---|
| 66 | testCancel=0;
|
|---|
| 67 | testinputstring=0;
|
|---|
| 68 | icontype='quest';%default question icon (text input asked)
|
|---|
| 69 | if exist('title','var')
|
|---|
| 70 | set(hObject, 'Name', title);
|
|---|
| 71 | switch title
|
|---|
| 72 | case {'CONFIRMATION'}
|
|---|
| 73 | icontype='';
|
|---|
| 74 | case 'ERROR'
|
|---|
| 75 | icontype='error';
|
|---|
| 76 | if exist('display_str','var')
|
|---|
| 77 | disp(display_str); %display the error message in the Matlab command window
|
|---|
| 78 | end
|
|---|
| 79 | case 'WARNING'
|
|---|
| 80 | icontype='warn';
|
|---|
| 81 | case 'INPUT_Y-N'
|
|---|
| 82 | icontype='quest';
|
|---|
| 83 | testCancel=1; %no cancel button
|
|---|
| 84 | testNo=1; % button No activated
|
|---|
| 85 | case {'RULER'}
|
|---|
| 86 | icontype='';
|
|---|
| 87 | testinputstring=1;
|
|---|
| 88 | case 'INPUT_TXT'
|
|---|
| 89 | testinputstring=1;
|
|---|
| 90 | testCancel=1; %no cancel button
|
|---|
| 91 | otherwise
|
|---|
| 92 | % testinputstring=1;
|
|---|
| 93 | icontype='';
|
|---|
| 94 | testinputstring=exist('default_answer','var');
|
|---|
| 95 | end
|
|---|
| 96 | end
|
|---|
| 97 | if exist('display_str','var')
|
|---|
| 98 | set(handles.text1, 'String', display_str);
|
|---|
| 99 | end
|
|---|
| 100 | % if testinputstring
|
|---|
| 101 | % set(handles.edit_box, 'Visible', 'on');
|
|---|
| 102 | % else
|
|---|
| 103 | % set(handles.text1, 'Position', [0.15 0.3 0.85 0.7]);
|
|---|
| 104 | % end
|
|---|
| 105 | if testinputstring
|
|---|
| 106 | % set(handles.figure1,'Position',[40,80,20*length(default_answer),50])
|
|---|
| 107 | set(handles.edit_box, 'Visible', 'on');
|
|---|
| 108 | if ~exist('default_answer','var');
|
|---|
| 109 | default_answer='';
|
|---|
| 110 | end
|
|---|
| 111 | set(handles.edit_box, 'String', default_answer);
|
|---|
| 112 | if exist('Position','var')
|
|---|
| 113 | if iscell(default_answer)
|
|---|
| 114 | widthstring=max(cellfun('length',default_answer),length(display_str));
|
|---|
| 115 | heightstring=size(default_answer,1);
|
|---|
| 116 | set(handles.edit_box,'Max',2);
|
|---|
| 117 | else
|
|---|
| 118 | widthstring=max(length(default_answer),length(display_str));
|
|---|
| 119 | heightstring=1;
|
|---|
| 120 | end
|
|---|
| 121 | widthstring=max(widthstring,length(title)+20);
|
|---|
| 122 | boxsize=[10*widthstring 20*heightstring];%size of the display edit box
|
|---|
| 123 | set(handles.edit_box,'Units','pixels')
|
|---|
| 124 | set(handles.edit_box,'FontUnits','pixels')
|
|---|
| 125 | set(handles.edit_box,'FontSize',12)
|
|---|
| 126 | set(handles.edit_box,'Position',[5,34,boxsize(1),boxsize(2)])
|
|---|
| 127 | FigPos(3)=10+boxsize(1);
|
|---|
| 128 | FigPos(4)=56+boxsize(2);
|
|---|
| 129 | FigPos(2)=Position(2)-FigPos(4)-25;
|
|---|
| 130 | set(handles.figure1,'Position',FigPos)
|
|---|
| 131 | end
|
|---|
| 132 | % set(handles.figure1,'Position',[40,40,20*length(default_answer),50])
|
|---|
| 133 | else
|
|---|
| 134 | set(handles.text1, 'Position', [0.15 0.3 0.85 0.7]);
|
|---|
| 135 | end
|
|---|
| 136 | % Determine the position of the dialog - centered on the screen
|
|---|
| 137 | % FigPos=get(0,'DefaultFigurePosition');
|
|---|
| 138 | % OldUnits = get(hObject, 'Units');
|
|---|
| 139 | % set(hObject, 'Units', 'pixels');
|
|---|
| 140 | % OldPos = get(hObject,'Position');
|
|---|
| 141 | % FigWidth = OldPos(3);
|
|---|
| 142 | % FigHeight = OldPos(4);
|
|---|
| 143 | % ScreenUnits=get(0,'Units');
|
|---|
| 144 | % set(0,'Units','pixels');
|
|---|
| 145 | % ScreenSize=get(0,'ScreenSize');
|
|---|
| 146 | % set(0,'Units',ScreenUnits);
|
|---|
| 147 | %
|
|---|
| 148 | % FigPos(1)=1/2*(ScreenSize(3)-FigWidth);
|
|---|
| 149 | % FigPos(2)=2/3*(ScreenSize(4)-FigHeight);
|
|---|
| 150 | % FigPos(3:4)=[FigWidth FigHeight];
|
|---|
| 151 | % set(hObject, 'Position', FigPos);
|
|---|
| 152 | % set(hObject, 'Units', OldUnits);
|
|---|
| 153 |
|
|---|
| 154 | % Show a question icon from dialogicons.mat - variables questIconData and questIconMap
|
|---|
| 155 | if isequal(icontype,'')
|
|---|
| 156 | hima=findobj(handles.axes1,'Type','image');
|
|---|
| 157 | if ~isempty(hima)
|
|---|
| 158 | delete(hima)
|
|---|
| 159 | end
|
|---|
| 160 | else
|
|---|
| 161 | load dialogicons.mat
|
|---|
| 162 | eval(['IconData=' icontype 'IconData;'])
|
|---|
| 163 | eval(['IconCMap=' icontype 'IconMap;'])
|
|---|
| 164 | questIconMap(256,:) = get(handles.figure1, 'Color');
|
|---|
| 165 | Img=image(IconData, 'Parent', handles.axes1);
|
|---|
| 166 | set(handles.figure1, 'Colormap', IconCMap);
|
|---|
| 167 | set(handles.axes1, ...
|
|---|
| 168 | 'Visible', 'off', ...
|
|---|
| 169 | 'YDir' , 'reverse' , ...
|
|---|
| 170 | 'XLim' , get(Img,'XData'), ...
|
|---|
| 171 | 'YLim' , get(Img,'YData') ...
|
|---|
| 172 | );
|
|---|
| 173 | end
|
|---|
| 174 | if testCancel
|
|---|
| 175 | set(handles.Cancel,'Visible','on')
|
|---|
| 176 | else
|
|---|
| 177 | set(handles.Cancel,'Visible','off')
|
|---|
| 178 | end
|
|---|
| 179 | if testNo
|
|---|
| 180 | set(handles.No,'Visible','on')
|
|---|
| 181 | else
|
|---|
| 182 | set(handles.No,'Visible','off')
|
|---|
| 183 | end
|
|---|
| 184 | set(handles.figure1,'Units','normalized')
|
|---|
| 185 | set(handles.edit_box,'Units','normalized')
|
|---|
| 186 |
|
|---|
| 187 | set(handles.figure1,'WindowStyle','modal')% Make% Make the GUI modal
|
|---|
| 188 | % UIWAIT makes msgbox_uvmat wait for user response (see UIRESUME)
|
|---|
| 189 | uiwait(handles.figure1);
|
|---|
| 190 |
|
|---|
| 191 |
|
|---|
| 192 | % --- Outputs from this function are returned to the command line.
|
|---|
| 193 | function varargout = msgbox_uvmat_OutputFcn(hObject, eventdata, handles)
|
|---|
| 194 |
|
|---|
| 195 | % Get default command line output from handles structure
|
|---|
| 196 | if isfield(handles,'output')
|
|---|
| 197 | if isequal(handles.output,'Cancel')
|
|---|
| 198 | varargout{1}='Cancel';
|
|---|
| 199 | elseif isequal(handles.output,'No')
|
|---|
| 200 | varargout{1}='No';
|
|---|
| 201 | else
|
|---|
| 202 | varargout{1}=get(handles.edit_box,'String');
|
|---|
| 203 | if isempty(varargout{1}) || isequal(varargout{1},'')
|
|---|
| 204 | varargout{1}='Yes';
|
|---|
| 205 | end
|
|---|
| 206 | end
|
|---|
| 207 | % The figure can be deleted now
|
|---|
| 208 | end
|
|---|
| 209 | delete(handles.figure1);
|
|---|
| 210 |
|
|---|
| 211 | % --- Executes on button press in OK.
|
|---|
| 212 | function OK_Callback(hObject, eventdata, handles)
|
|---|
| 213 | handles.output = get(hObject,'String');
|
|---|
| 214 | guidata(hObject, handles);% Update handles structure
|
|---|
| 215 | uiresume(handles.figure1);
|
|---|
| 216 |
|
|---|
| 217 | % --- Executes on button press in No.
|
|---|
| 218 | function No_Callback(hObject, eventdata, handles)
|
|---|
| 219 | handles.output='No';
|
|---|
| 220 | guidata(hObject, handles);
|
|---|
| 221 | uiresume(handles.figure1);
|
|---|
| 222 |
|
|---|
| 223 | % --- Executes on button press in Cancel.
|
|---|
| 224 | function Cancel_Callback(hObject, eventdata, handles)
|
|---|
| 225 | handles.output = get(hObject,'String');
|
|---|
| 226 | %handles.output = 'Cancel'
|
|---|
| 227 | guidata(hObject, handles); % Update handles structure
|
|---|
| 228 | % Use UIRESUME instead of delete because the OutputFcn needs
|
|---|
| 229 | % to get the updated handles structure.
|
|---|
| 230 | uiresume(handles.figure1);
|
|---|
| 231 |
|
|---|
| 232 |
|
|---|
| 233 | % --- Executes when user attempts to close figure1.
|
|---|
| 234 | function figure1_CloseRequestFcn(hObject, eventdata, handles)
|
|---|
| 235 | if isequal(get(handles.figure1, 'waitstatus'), 'waiting')
|
|---|
| 236 | % The GUI is still in UIWAIT, us UIRESUME
|
|---|
| 237 | uiresume(handles.figure1);
|
|---|
| 238 | else
|
|---|
| 239 | % The GUI is no longer waiting, just close it
|
|---|
| 240 | delete(handles.figure1);
|
|---|
| 241 | end
|
|---|
| 242 |
|
|---|
| 243 | % --- Executes on key press over figure1 with no controls selected.
|
|---|
| 244 | function figure1_KeyPressFcn(hObject, eventdata, handles)
|
|---|
| 245 | % Check for "enter" or "escape"
|
|---|
| 246 | if isequal(get(hObject,'CurrentKey'),'escape')
|
|---|
| 247 | % User said no by hitting escape
|
|---|
| 248 | handles.output = 'No';
|
|---|
| 249 |
|
|---|
| 250 | % Update handles structure
|
|---|
| 251 | guidata(hObject, handles);
|
|---|
| 252 |
|
|---|
| 253 | uiresume(handles.figure1);
|
|---|
| 254 | end
|
|---|
| 255 | if isequal(get(hObject,'CurrentKey'),'return')
|
|---|
| 256 | uiresume(handles.figure1);
|
|---|
| 257 | end
|
|---|
| 258 |
|
|---|
| 259 |
|
|---|
| 260 |
|
|---|
| 261 |
|
|---|
| 262 |
|
|---|