[387] | 1 | %'uvmat': function associated with the GUI 'uvmat.fig' for images and data field visualization |
---|
| 2 | %------------------------------------------------------------------------ |
---|
| 3 | % function huvmat=uvmat(input) |
---|
| 4 | % |
---|
[818] | 5 | %OUTPUT |
---|
| 6 | % huvmat=current handles of the GUI uvmat.fig |
---|
| 7 | %% |
---|
[387] | 8 | % |
---|
[818] | 9 | %INPUT: |
---|
| 10 | % input: input file name (if character chain), or input image matrix to |
---|
| 11 | % visualize, or Matlab structure representing netcdf fieldname (with fieldname |
---|
| 12 | % ListVarName....) |
---|
[387] | 13 | % |
---|
[818] | 14 | %AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA |
---|
| 15 | % Copyright 2008-2014, LEGI / CNRS UJF G-INP, Joel.Sommeria@legi.grenoble-inp.fr |
---|
| 16 | %AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA |
---|
| 17 | % This open is part of the toolbox UVMAT. |
---|
| 18 | % |
---|
[387] | 19 | % UVMAT is free software; you can redistribute it and/or modify |
---|
[818] | 20 | % it under the terms of the GNU General Public License as published by |
---|
| 21 | % the Free Software Foundation; either version 2 of the License, or |
---|
| 22 | % (at your option) any later version. |
---|
| 23 | % |
---|
[387] | 24 | % UVMAT is distributed in the hope that it will be useful, |
---|
| 25 | % but WITHOUT ANY WARRANTY; without even the implied warranty of |
---|
| 26 | % MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
---|
[818] | 27 | % GNU General Public License (open UVMAT/COPYING.txt) for more details. |
---|
| 28 | %AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA |
---|
| 29 | % |
---|
[511] | 30 | % Information stored on the interface:(use 'Export/field in workspace' in |
---|
| 31 | % the menu bar of uvmat to retrieve it) |
---|
| 32 | % .OpenParam: structure containing parameters defined when uvmat is opened |
---|
| 33 | % .PosColorbar: position (1x4 vector)of the colorbar (relative to the fig uvmat) |
---|
| 34 | % .PosGeometryCalib: size of set_object |
---|
[591] | 35 | % .NbBuiltin: nbre of functions always displayed in TransformName menu |
---|
[622] | 36 | % .ProjObject: cell array of structures representing the current projection objects, as produced by 'set_object.m'={[]} by default |
---|
[511] | 37 | % .NewSeries: =0/1 flag telling whether a new field series has been opened |
---|
| 38 | % .FileName_1: name of the current second field (used to detect a constant field during file scanning) |
---|
| 39 | % .FileType: current file type, as defined by the fct get_file_type.m) |
---|
| 40 | % .i1_series,.i2_series,.j1_series,.j1_series: series of i1,i2,j1,j2 indices detected in the input dir,set by the fct find_file_series |
---|
| 41 | % .MovieObject: current movie object |
---|
| 42 | % .TimeUnit: unit for time |
---|
[526] | 43 | % .XmlData: cell array of 1 or 2 structures representing the xml files associated with the input fieldname (containing timing and geometry calibration) |
---|
[511] | 44 | % .Field: cell array of 1 or 2 structures representing the current input field(s) |
---|
| 45 | % .PlotAxes: field structure representing the current field plotted on the main axes (used for mouse operations) |
---|
| 46 | % .HistoAxes: idem for histogram axes |
---|
[387] | 47 | |
---|
[713] | 48 | % %%%%%%%%%%%%%%%%%%%%%%%%%%%%%% DATA FLOW (for REFRESH_Callback) %%%%%%%%%%%%%%%%%%%%: |
---|
[387] | 49 | % |
---|
[406] | 50 | % |
---|
[651] | 51 | % 1) Input filenames are determined by MenuBrowse (first field), MenuBrowseCampaign |
---|
[512] | 52 | % (second field), or by the stored file name .FileName_1, or as an input of uvmat. |
---|
| 53 | % 2) These functions call 'uvmat/display_file_name.m' which detects the file series, and fills the file index boxes |
---|
| 54 | % 3) Then 'uvmat/update_rootinfo.m' Updates information about a new field series (indices to scan, timing, calibration from an xml file) |
---|
[526] | 55 | % 4) Then fieldname are opened and visualised by the main sub-function 'uvmat/refresh_field.m' |
---|
[512] | 56 | % The function first reads the name of the input file(s) (one or two) from the edit boxes of the GUI |
---|
| 57 | % It then reads the input file(s) with the function read_field.m and perform the following list of operations: |
---|
[387] | 58 | % |
---|
[512] | 59 | % %%%%%%%% structure of uvmat/refresh_field.m %%%%%%%% |
---|
[387] | 60 | % |
---|
[512] | 61 | % Main input open second input open_1 |
---|
| 62 | % | | |
---|
| 63 | % read_field.m read_field.m |
---|
| 64 | % | | |
---|
| 65 | % Field{1} Field{2} |
---|
| 66 | % | | |
---|
[526] | 67 | % --->transform fct<--- transform (e.g. phys.m) and combine input fieldname |
---|
[512] | 68 | % | |
---|
[581] | 69 | % (tps_coeff_field.m) calculate tps coefficients (for filter projection or spatial derivatives). |
---|
[512] | 70 | % | |
---|
| 71 | % UvData.Field-------------->histogram |
---|
| 72 | % _____________|____________ |
---|
| 73 | % | | |
---|
[595] | 74 | % proj_field.m proj_field.m project the field on the projection objects (use set_field_list.m) |
---|
[512] | 75 | % | | |
---|
| 76 | % UvData.PlotAxes ViewData.PlotAxes (on view_field) |
---|
| 77 | % | | |
---|
[526] | 78 | % plot_field.m (uvmat) plot_field.m (view_field) plot the projected fieldname |
---|
[512] | 79 | % |
---|
| 80 | % |
---|
[387] | 81 | %%%%%%%%%%%%%% SCALARS: %%%%%%%%%%%%??%%% |
---|
| 82 | % scalars are displayed either as an image or countour plot, either as a color of |
---|
| 83 | % velocity vectors. The scalar values in the first case is represented by |
---|
| 84 | % UvData.Field.A, and by UvData.Field.C in the second case. The corresponding set of X |
---|
[782] | 85 | % and Y axes are represented by UvData.Field.Coord_x and UvData.Field.Coord_y, and .X and |
---|
[387] | 86 | % .Y for C (the same as velocity vectors). If A is a nxxny matrix (scalar |
---|
[782] | 87 | % on a regtular grid), then .Coord_x andf.Coord_y contains only two elements, represneting the |
---|
[748] | 88 | % axes of the four image corners. The scalar name is represented by |
---|
[387] | 89 | % the strings .AName and/or .CName. |
---|
| 90 | % If the scalar exists in an input open (image or scalar stored under its |
---|
| 91 | % name in a netcdf open), it is directly read at the level of Field{1}or Field{2}. |
---|
| 92 | % Else only its name AName is recorded in Field{i}, and its field is then calculated |
---|
[650] | 93 | %by the fuction calc_scal after the coordinate transform or after projection on an CheckEditObject |
---|
[387] | 94 | |
---|
| 95 | % Properties attached to plotting figures (standard Matlab properties): |
---|
| 96 | % 'CurrentAxes'= gca or get(gcf,'CurrentAxes'); |
---|
[748] | 97 | % 'CurrentPoint'=get(gcf,'CurrentPoint'): figure axes of the point over which the mouse is positioned |
---|
[387] | 98 | % 'CurrentCharacter'=get(gcf,'CurrentCharacter'): last character typed over the figure where the mouse is positioned |
---|
| 99 | % 'WindowButtonMotionFcn': function permanently called by mouse motion over the figure |
---|
| 100 | % 'KeyPressFcn': function called by pressing a key on the key board |
---|
| 101 | % 'WindowButtonDownFcn': function called by pressing the mouse over the figure |
---|
| 102 | % 'WindowButtonUpFcn': function called by releasing the mouse pressure over the figure |
---|
| 103 | |
---|
| 104 | % Properties attached to plotting axes: |
---|
[748] | 105 | % 'CurrentPoint'=get(gca,'CurrentPoint'); (standard Matlab) same as for the figure, but position in plot axes. |
---|
[387] | 106 | % AxeData:=get(gca,'UserData'); |
---|
| 107 | % AxeData.Drawing = create: create a new object |
---|
| 108 | % = deform: modify an existing object by moving its defining create |
---|
| 109 | % = off: no current drawing action |
---|
| 110 | % = translate: translate an existing object |
---|
| 111 | % = calibration: move a calibration point |
---|
| 112 | % = CheckZoom: isolate a subregion for CheckZoom in=1 if an object is being currently drawn, 0 else (set to 0 by releasing mouse button) |
---|
[650] | 113 | % .CurrentOrigin: Origin of a curently drawn CheckEditObject |
---|
[387] | 114 | % .CurrentLine: currently drawn menuline (A REVOIR) |
---|
[650] | 115 | % .CurrentObject: handle of the currently drawn CheckEditObject |
---|
[387] | 116 | % .CurrentRectZoom: current rectangle used for CheckZoom |
---|
| 117 | |
---|
| 118 | % Properties attached to projection objects (create, menuline, menuplane...): |
---|
| 119 | % 'Tag'='proj_object': for all projection objects |
---|
| 120 | % ObjectData.Type=...: style of projection object: |
---|
| 121 | % .ProjMode |
---|
[748] | 122 | % .Coordinates: defines the position of the object |
---|
[387] | 123 | % .XMin,YMin.... |
---|
| 124 | % .XMax,YMax.... |
---|
| 125 | % .DX,DY,DZ |
---|
| 126 | % .Phi, .Theta, .Psi : Euler angles |
---|
| 127 | % .X,.Y,.U,.V.... : field data projected on the object |
---|
[622] | 128 | % .IndexObj: index in the list of UvData.ProjObject |
---|
[387] | 129 | %during plotting |
---|
| 130 | % .plotaxes: handles of the current axes used to plot the result of field projection on the object |
---|
| 131 | % .plothandle: vector of handle(s) of the object graphic represnetation in all the opened plotting axes |
---|
| 132 | % To each projection object #iobj, corresponds an axis |
---|
| 133 | % Object{iobj}.plotaxes and nbobj representation graphs Object{iobj}.plothandles(:) (where nbobj is the |
---|
| 134 | % nbre of current objects opened in uvmat. Note that Object{iobj}.plothandles(iobj)=[] : an object is not represented in its own projection field; |
---|
| 135 | |
---|
| 136 | %------------------------------------------------------------------------ |
---|
| 137 | %------------------------------------------------------------------------ |
---|
[406] | 138 | % I - MAIN FUNCTION uvmat |
---|
[387] | 139 | %------------------------------------------------------------------------ |
---|
| 140 | %------------------------------------------------------------------------ |
---|
| 141 | function varargout = uvmat(varargin) |
---|
| 142 | |
---|
| 143 | % Begin initialization code - DO NOT EDIT |
---|
| 144 | gui_Singleton = 1; |
---|
| 145 | gui_State = struct('gui_Name', mfilename, ... |
---|
| 146 | 'gui_Singleton', gui_Singleton, ... |
---|
| 147 | 'gui_OpeningFcn', @uvmat_OpeningFcn, ... |
---|
| 148 | 'gui_OutputFcn', @uvmat_OutputFcn, ... |
---|
| 149 | 'gui_LayoutFcn', [], ... |
---|
| 150 | 'gui_Callback', []); |
---|
| 151 | if nargin && ischar(varargin{1})&& ~isempty(regexp(varargin{1},'_Callback','once')) |
---|
| 152 | gui_State.gui_Callback = str2func(varargin{1}); |
---|
| 153 | end |
---|
| 154 | |
---|
| 155 | if nargout |
---|
| 156 | varargout{1:nargout} = gui_mainfcn(gui_State, varargin{:}); |
---|
| 157 | else |
---|
| 158 | gui_mainfcn(gui_State, varargin{:}); |
---|
| 159 | end |
---|
| 160 | % End initialization code - DO NOT EDIT |
---|
| 161 | |
---|
| 162 | %------------------------------------------------------------------------ |
---|
| 163 | % --- Executes just before the GUI uvmat is made visible. |
---|
| 164 | function uvmat_OpeningFcn(hObject, eventdata, handles, input ) |
---|
| 165 | %------------------------------------------------------------------------ |
---|
| 166 | |
---|
| 167 | %% Choose default command menuline output for uvmat (standard GUI) |
---|
| 168 | handles.output = hObject; |
---|
| 169 | |
---|
| 170 | %% Update handles structure (standard GUI) |
---|
| 171 | guidata(hObject, handles); |
---|
| 172 | |
---|
[507] | 173 | %% add the path to uvmat (useful if uvmat has been opened in the working directory and a working directory change occured) |
---|
| 174 | path_uvmat=fileparts(which('uvmat')); |
---|
| 175 | |
---|
[609] | 176 | %% set the position of the GUI, colorbar and ancillary GUIs: |
---|
| 177 | set(hObject,'Units','pixels')% |
---|
| 178 | set(0,'Units','pixels'); |
---|
| 179 | ScreenSize=get(0,'ScreenSize');%size of the current screen |
---|
| 180 | Width=1050; |
---|
| 181 | Height=700; |
---|
| 182 | %adjust to screen size (reduced by a min margin) |
---|
| 183 | RescaleFactor=min((ScreenSize(3)-80)/Width,(ScreenSize(4)-80)/Height); |
---|
| 184 | if RescaleFactor>1 |
---|
| 185 | RescaleFactor=RescaleFactor/2+1/2; %reduce the rescale factor to provide an increased margin for a big screen |
---|
| 186 | end |
---|
| 187 | Width=Width*RescaleFactor; |
---|
| 188 | Height=Height*RescaleFactor; |
---|
| 189 | LeftX=80*RescaleFactor;%position of the left fig side, in pixels (put to the left side, with some margin) |
---|
| 190 | LowY=round(ScreenSize(4)/2-Height/2); % put at the middle height on the screen |
---|
| 191 | set(hObject,'Position',[LeftX LowY Width Height]) |
---|
[781] | 192 | UvData.PosColorbar=[0.80 0.02 0.018 0.445]; |
---|
[387] | 193 | AxeData.LimEditBox=1; %initialise AxeData |
---|
[511] | 194 | set(handles.PlotAxes,'UserData',AxeData) |
---|
[387] | 195 | |
---|
| 196 | %% set functions for the mouse and keyboard |
---|
[681] | 197 | set(hObject,'WindowKeyPressFcn',{'keyboard_callback',handles})%set keyboard action function |
---|
[387] | 198 | set(hObject,'WindowButtonMotionFcn',{'mouse_motion',handles})%set mouse action functio |
---|
| 199 | set(hObject,'WindowButtonDownFcn',{'mouse_down'})%set mouse click action function |
---|
| 200 | set(hObject,'WindowButtonUpFcn',{'mouse_up',handles}) |
---|
| 201 | set(hObject,'DeleteFcn',{@closefcn})% |
---|
[644] | 202 | set(hObject,'ResizeFcn',{@ResizeFcn,handles})% |
---|
[387] | 203 | |
---|
[511] | 204 | %% initialisation |
---|
[526] | 205 | set(handles.FieldName,'Value',1) |
---|
| 206 | set(handles.FieldName,'string',{''}) |
---|
[622] | 207 | UvData.ProjObject={[]}; |
---|
[387] | 208 | |
---|
| 209 | %% TRANSFORM menu: builtin fcts |
---|
[515] | 210 | transform_menu={'';'sub_field';'phys';'phys_polar'}; |
---|
[507] | 211 | UvData.OpenParam.NbBuiltin=numel(transform_menu); %number of functions |
---|
| 212 | transform_path=fullfile(path_uvmat,'transform_field'); |
---|
[528] | 213 | path_list=cell(UvData.OpenParam.NbBuiltin,1); |
---|
[507] | 214 | path_list{1}=''; |
---|
[523] | 215 | for ilist=2:UvData.OpenParam.NbBuiltin |
---|
| 216 | path_list{ilist}=transform_path; % set transform_path to the path_list |
---|
| 217 | end |
---|
[387] | 218 | |
---|
[591] | 219 | %% load the list of previously browsed files in menus Open, Open_1 and TransformName |
---|
[671] | 220 | dir_perso=prefdir; % path to the directory .matlab containing the personal data of the current user |
---|
| 221 | profil_perso=fullfile(dir_perso,'uvmat_perso.mat');% personal data file uvmat_perso.mat' in .matlab |
---|
| 222 | if exist(profil_perso,'file')% if the file exists |
---|
| 223 | h=load (profil_perso); % open the personal file |
---|
| 224 | if isfield(h,'MenuFile')% load the saved menu of previously opened files |
---|
| 225 | for ifile=1:min(length(h.MenuFile),5) |
---|
| 226 | set(handles.(['MenuFile_' num2str(ifile)]),'Label',h.MenuFile{ifile}); |
---|
| 227 | end |
---|
| 228 | end |
---|
| 229 | if isfield(h,'MenuCampaign')% load the saved menu of previously opened campaigns |
---|
| 230 | for ifile=1:min(length(h.MenuCampaign),5) |
---|
| 231 | set(handles.(['MenuCampaign_' num2str(ifile)]),'Label',h.MenuCampaign{ifile}); |
---|
| 232 | end |
---|
| 233 | end |
---|
| 234 | if isfield(h,'RootPath') |
---|
| 235 | set(handles.RootPath,'UserData',h.RootPath); %store the previous campaign in the UserData of RootPath |
---|
| 236 | end |
---|
| 237 | if isfield(h,'transform_fct') && iscell(h.transform_fct) % load the menu of transform fct set by user |
---|
| 238 | for ilist=1:length(h.transform_fct); |
---|
| 239 | if exist(h.transform_fct{ilist},'file') |
---|
| 240 | [path,file]=fileparts(h.transform_fct{ilist}); |
---|
| 241 | transform_menu=[transform_menu; {file}]; |
---|
| 242 | path_list=[path_list; {path}]; |
---|
| 243 | end |
---|
| 244 | end |
---|
| 245 | end |
---|
| 246 | end |
---|
[523] | 247 | transform_menu=[transform_menu;{'more...'}];%append the option more.. to the menu |
---|
[591] | 248 | set(handles.TransformName,'String',transform_menu)% display the menu of transform fcts |
---|
| 249 | set(handles.TransformName,'UserData',path_list)% store the corresponding list of path in UserData of uicontrol transform_fct |
---|
| 250 | set(handles.TransformPath,'String','') |
---|
| 251 | set(handles.TransformPath,'UserData',[]) |
---|
[387] | 252 | |
---|
| 253 | %% case of an input argument for uvmat |
---|
| 254 | testinputfield=0; |
---|
| 255 | inputfile=[]; |
---|
| 256 | Field=[]; |
---|
| 257 | if exist('input','var') |
---|
| 258 | if ishandle(handles.UVMAT_title) |
---|
| 259 | delete(handles.UVMAT_title) |
---|
| 260 | end |
---|
| 261 | if isstruct(input) |
---|
| 262 | if isfield(input,'InputFile') |
---|
| 263 | inputfile=input.InputFile; |
---|
| 264 | end |
---|
| 265 | if isfield(input,'TimeIndex') |
---|
| 266 | set(handles.i1,num2str(input.TimeIndex)) |
---|
| 267 | end |
---|
| 268 | if isfield(input,'FieldsString') |
---|
| 269 | UvData.FieldsString=input.FieldsString; |
---|
| 270 | end |
---|
| 271 | elseif ischar(input)% file name introduced as input |
---|
| 272 | inputfile=input; |
---|
| 273 | elseif isnumeric(input)%simple matrix introduced as input |
---|
| 274 | sizinput=size(input); |
---|
| 275 | if sizinput(1)<=1 || sizinput(2)<=1 |
---|
| 276 | msgbox_uvmat('ERROR','bad input for uvmat: file name, structure or numerical matrix accepted') |
---|
| 277 | return |
---|
| 278 | end |
---|
| 279 | UvData.Field.ListVarName={'A','coord_y','coord_x'}; |
---|
| 280 | UvData.Field.VarDimName={{'coord_y','coord_x'},'cord_y','coord_x'}; |
---|
| 281 | UvData.Field.A=input; |
---|
| 282 | UvData.Field.coord_x=[0.5 size(input,2)-0.5]; |
---|
| 283 | UvData.Field.coord_y=[size(input,1)-0.5 0.5]; |
---|
| 284 | testinputfield=1; |
---|
| 285 | end |
---|
| 286 | else |
---|
[476] | 287 | %% check the path and date of modification of all functions in uvmat |
---|
| 288 | path_to_uvmat=which ('uvmat');% check the path detected for source file uvmat |
---|
| 289 | [infomsg,date_str,svn_info]=check_files;%check the path of the functions called by uvmat.m |
---|
| 290 | date_str=['last modification: ' date_str]; |
---|
| 291 | if ishandle(handles.UVMAT_title) |
---|
| 292 | set(handles.UVMAT_title,'String',... |
---|
[818] | 293 | [{'Copyright LEGI UMR 5519 /CNRS-UJF-Grenoble INP, 2010'};... |
---|
| 294 | {'GNU General Public License'};... |
---|
[476] | 295 | {path_to_uvmat};... |
---|
| 296 | {date_str};... |
---|
| 297 | infomsg]); |
---|
| 298 | end |
---|
[387] | 299 | end |
---|
| 300 | set(handles.uvmat,'UserData',UvData) |
---|
| 301 | if ~isempty(inputfile) |
---|
| 302 | %%%%% display the input field %%%%%%% |
---|
[406] | 303 | display_file_name(handles,inputfile) |
---|
[387] | 304 | %%%%%%% |
---|
| 305 | end |
---|
| 306 | |
---|
| 307 | set_vec_col_bar(handles) %update the display of color code for vectors |
---|
| 308 | |
---|
| 309 | %------------------------------------------------------------------------ |
---|
| 310 | % --- Outputs from this function are returned to the command menuline. |
---|
| 311 | function varargout = uvmat_OutputFcn(hObject, eventdata, handles) |
---|
[710] | 312 | %------------------------------------------------------------------------ |
---|
[387] | 313 | varargout{1} = handles.output;% the only output argument is the handle to the GUI figure |
---|
| 314 | |
---|
| 315 | %------------------------------------------------------------------------ |
---|
[402] | 316 | % --- executed when closing uvmat: delete or desactivate the associated figures if exist |
---|
| 317 | function closefcn(gcbo,eventdata) |
---|
[387] | 318 | %------------------------------------------------------------------------ |
---|
[710] | 319 | % delete GUI 'view_field' if detected |
---|
[402] | 320 | hh=findobj(allchild(0),'tag','view_field'); |
---|
| 321 | if ~isempty(hh) |
---|
| 322 | delete(hh) |
---|
| 323 | end |
---|
[710] | 324 | % delete GUI 'geometry_calib' if detected |
---|
[402] | 325 | hh=findobj(allchild(0),'tag','geometry_calib'); |
---|
| 326 | if ~isempty(hh) |
---|
| 327 | delete(hh) |
---|
| 328 | end |
---|
[710] | 329 | % desable set_object editing action if detected |
---|
[735] | 330 | hh=findobj(allchild(0),'name','set_object'); |
---|
[402] | 331 | if ~isempty(hh) |
---|
| 332 | hhh=findobj(hh,'tag','PLOT'); |
---|
| 333 | set(hhh,'enable','off') |
---|
| 334 | end |
---|
[710] | 335 | %delete the bowser if detected |
---|
| 336 | hh=findobj(allchild(0),'tag','browser'); |
---|
| 337 | if ~isempty(hh) |
---|
| 338 | delete(hh) |
---|
| 339 | end |
---|
[402] | 340 | |
---|
| 341 | %------------------------------------------------------------------------ |
---|
[644] | 342 | %--- activated when resizing the GUI view_field |
---|
| 343 | function ResizeFcn(gcbo,eventdata,handles) |
---|
| 344 | %------------------------------------------------------------------------ |
---|
| 345 | set(handles.uvmat,'Units','pixels') |
---|
| 346 | size_fig=get(handles.uvmat,'Position'); |
---|
| 347 | ColumnWidth=max(150,0.18*size_fig(3)); |
---|
| 348 | ColumnWidth=min(ColumnWidth,250); % width of the right side display column, between 150 and 250, depending on the fig width |
---|
| 349 | |
---|
| 350 | %% position of panel InputFile |
---|
[646] | 351 | set(handles.InputFile,'Units','pixels') |
---|
[644] | 352 | pos_InputFile=get(handles.InputFile,'Position');% [lower x lower y width height] for text_display |
---|
| 353 | pos_InputFile(1)=0; |
---|
| 354 | pos_InputFile(2)=size_fig(4)-pos_InputFile(4); % set frame InputFile to the top of the fig |
---|
| 355 | pos_InputFile(3)=size_fig(3); |
---|
| 356 | set(handles.InputFile,'Position',pos_InputFile);% [lower x lower y width height] for text_display |
---|
| 357 | |
---|
[690] | 358 | %% reset position of text_display and TableDisplay |
---|
[784] | 359 | set(handles.text_display,'Units','pixels') |
---|
| 360 | pos_1=get(handles.text_display,'Position');% [lower x lower y width height] for text_display |
---|
| 361 | pos_1(3)=1.2*ColumnWidth; |
---|
| 362 | pos_1(1)=size_fig(3)-pos_1(3); % set text display to the right of the fig |
---|
| 363 | pos_1(2)=size_fig(4)-pos_InputFile(4)-pos_1(4); % set text display to the top of the fig |
---|
| 364 | set(handles.text_display,'Position',pos_1) |
---|
| 365 | set(handles.TableDisplay,'Position',pos_1) |
---|
| 366 | % reset position of CheckTable |
---|
| 367 | set(handles.CheckTable,'Units','pixels') |
---|
[690] | 368 | pos_CheckTable=get(handles.CheckTable,'Position');% [lower x lower y width height] for CheckHold |
---|
| 369 | pos_CheckTable(1)=pos_1(1)-pos_CheckTable(3); % set 'CheckHold' to the right of the fig |
---|
| 370 | pos_CheckTable(2)=pos_InputFile(2)-pos_CheckTable(4); % set 'CheckHold' to the lower edge of text display |
---|
| 371 | set(handles.CheckTable,'Position',pos_CheckTable) |
---|
[644] | 372 | |
---|
| 373 | %% reset position of CheckHold |
---|
| 374 | % pos_CheckHold=get(handles.CheckHold,'Position');% [lower x lower y width height] for CheckHold |
---|
| 375 | % pos_CheckHold(1)=size_fig(3)-pos_CheckHold(3); % set 'CheckHold' to the right of the fig |
---|
| 376 | % pos_CheckHold(2)=pos_1(2)-pos_CheckHold(4); % set 'CheckHold' to the lower edge of text display |
---|
| 377 | % set(handles.CheckHold,'Position',pos_CheckHold) |
---|
| 378 | |
---|
[748] | 379 | %% reset position of Coordinates panel |
---|
[646] | 380 | set(handles.Coordinates,'Units','pixels') |
---|
[644] | 381 | pos_2=get(handles.Coordinates,'Position');% [lower x lower y width height] for frame 'Coordinates' |
---|
| 382 | pos_2(3)=ColumnWidth; |
---|
| 383 | pos_2(1)=size_fig(3)-pos_2(3); % set 'Coordinates' to the right of the fig |
---|
| 384 | pos_2(2)=pos_1(2)-pos_2(4); % set 'Coordinates' to the lower edge of text display, allowing a margin for CheckHold |
---|
| 385 | set(handles.Coordinates,'Position',pos_2) |
---|
| 386 | |
---|
[748] | 387 | %% reset position of Axes panel |
---|
| 388 | set(handles.Axes,'Units','pixels') |
---|
| 389 | pos_3=get(handles.Axes,'Position');% [lower x lower y width height] for frame 'Coordinates' |
---|
| 390 | pos_3(3)=ColumnWidth; |
---|
| 391 | pos_3(1)=size_fig(3)-pos_3(3); % set 'Coordinates' to the right of the fig |
---|
| 392 | pos_3(2)=pos_2(2)-pos_3(4); % set 'Coordinates' to the lower edge of text display, allowing a margin for CheckHold |
---|
| 393 | set(handles.Axes,'Position',pos_3) |
---|
| 394 | |
---|
[644] | 395 | %% reset position of Scalar |
---|
[646] | 396 | set(handles.Scalar,'Units','pixels') |
---|
[748] | 397 | pos_4=get(handles.Scalar,'Position'); % [lower x lower y width height] for frame 'Scalar' |
---|
| 398 | pos_4(3)=ColumnWidth; |
---|
| 399 | pos_4(1)=size_fig(3)-pos_4(3); % set 'Scalar' to the right of the fig |
---|
[644] | 400 | if strcmp(get(handles.Scalar,'Visible'),'on') |
---|
[748] | 401 | pos_4(2)=pos_3(2)-pos_4(4); % set 'Scalar' to the lower edge of frame 'Coordinates' if visible |
---|
[644] | 402 | else |
---|
[748] | 403 | pos_4(2)=pos_3(2);% set 'Scalar' to the lower edge of frame 'text display' if unvisible |
---|
[644] | 404 | end |
---|
[748] | 405 | set(handles.Scalar,'Position',pos_4) |
---|
[644] | 406 | |
---|
| 407 | %% reset position of Vectors |
---|
| 408 | set(handles.Vectors,'Units','pixels') |
---|
[748] | 409 | pos_5=get(handles.Vectors,'Position'); |
---|
| 410 | pos_5(3)=ColumnWidth; |
---|
| 411 | pos_5(1)=size_fig(3)-pos_5(3); |
---|
[644] | 412 | if strcmp(get(handles.Vectors,'visible'),'on') |
---|
[748] | 413 | pos_5(2)=pos_4(2)-pos_5(4); |
---|
[644] | 414 | else |
---|
[748] | 415 | pos_5(2)=pos_4(2); |
---|
[644] | 416 | end |
---|
[748] | 417 | set(handles.Vectors,'Position',pos_5) |
---|
[644] | 418 | |
---|
| 419 | %% reset position and scale of axis |
---|
| 420 | pos(1)=0.2*size_fig(3)+35; |
---|
| 421 | pos(2)=35; |
---|
| 422 | pos(3)=0.77*size_fig(3)-1.2*ColumnWidth; |
---|
| 423 | pos(4)=size_fig(4)-60; |
---|
[646] | 424 | set(handles.PlotAxes,'Units','pixels') |
---|
[644] | 425 | set(handles.PlotAxes,'Position',pos) |
---|
[713] | 426 | set(handles.PlotAxes,'Units','normalized') |
---|
[644] | 427 | |
---|
| 428 | |
---|
[784] | 429 | |
---|
[402] | 430 | %------------------------------------------------------------------------ |
---|
[644] | 431 | %------------------------------------------------------------------------ |
---|
[784] | 432 | % II - TOOLS FROM THE UPPER MENU BAR |
---|
[387] | 433 | %------------------------------------------------------------------------ |
---|
| 434 | %------------------------------------------------------------------------ |
---|
[784] | 435 | |
---|
| 436 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 437 | % Open Menu Callbacks |
---|
| 438 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 439 | |
---|
| 440 | %------------------------------------------------------------------------ |
---|
[387] | 441 | % --- Executes on the menu Open/Browse... |
---|
| 442 | % search the files, recognize their type according to their name and fill the rootfile input windows |
---|
| 443 | function MenuBrowse_Callback(hObject, eventdata, handles) |
---|
| 444 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes(handles); |
---|
[609] | 445 | oldfile=[fullfile(RootPath,SubDir,RootFile) FileIndices FileExt]; |
---|
[576] | 446 | if isempty(oldfile) %loads the previously stored file name and set it as default in the file_input box |
---|
| 447 | oldfile=get(handles.RootPath,'UserData'); |
---|
[387] | 448 | end |
---|
[651] | 449 | fileinput=uigetfile_uvmat('pick an input file',oldfile); |
---|
[704] | 450 | hh=dir(fileinput); |
---|
| 451 | if numel(hh)>1 |
---|
| 452 | msgbox_uvmat('ERROR','invalid input, probably a broken link'); |
---|
| 453 | else |
---|
[611] | 454 | |
---|
[710] | 455 | %% display the selected field and related information |
---|
| 456 | if ~isempty(fileinput) |
---|
| 457 | set(handles.SubField,'Value',0) |
---|
| 458 | desable_subfield(handles) |
---|
| 459 | display_file_name(handles,fileinput) |
---|
| 460 | end |
---|
[606] | 461 | end |
---|
[387] | 462 | |
---|
| 463 | % ----------------------------------------------------------------------- |
---|
[651] | 464 | % --- Open again the file whose name has been recorded in MenuFile_1 |
---|
| 465 | function MenuFile_Callback(hObject, eventdata, handles) |
---|
| 466 | %------------------------------------------------------------------------ |
---|
| 467 | fileinput=get(hObject,'Label'); |
---|
[714] | 468 | set(handles.SubField,'Value',0) |
---|
| 469 | desable_subfield(handles) |
---|
| 470 | errormsg=display_file_name( handles,fileinput); |
---|
| 471 | if ~isempty(errormsg) |
---|
| 472 | set(hObject,'Label','') |
---|
| 473 | MenuFile=[{get(handles.MenuFile_1,'Label')};{get(handles.MenuFile_2,'Label')};... |
---|
| 474 | {get(handles.MenuFile_3,'Label')};{get(handles.MenuFile_4,'Label')};{get(handles.MenuFile_5,'Label')}]; |
---|
| 475 | str_find=strcmp(get(hObject,'Label'),MenuFile); |
---|
| 476 | MenuFile(str_find)=[];% suppress the input file to the list |
---|
| 477 | for ifile=1:numel(MenuFile) |
---|
| 478 | set(handles.(['MenuFile_' num2str(ifile)]),'Label',MenuFile{ifile}); |
---|
| 479 | end |
---|
| 480 | end |
---|
[651] | 481 | |
---|
| 482 | % ----------------------------------------------------------------------- |
---|
[569] | 483 | % --- Executes on the menu Open/Browse campaign... |
---|
[651] | 484 | % --- search the file inside a campaign, using the GUI browse_data |
---|
| 485 | % ----------------------------------------------------------------------- |
---|
[569] | 486 | function MenuBrowseCampaign_Callback(hObject, eventdata, handles) |
---|
[651] | 487 | set(handles.MenuOpenCampaign,'ForegroundColor',[1 1 0]) |
---|
| 488 | drawnow |
---|
[576] | 489 | RootPath=get(handles.RootPath,'String'); |
---|
| 490 | if isempty(RootPath) |
---|
| 491 | RootPath=get(handles.RootPath,'UserData');%use Rootpath recored from the personal file at uvmat opening |
---|
| 492 | end |
---|
| 493 | CampaignPath=fileparts(fileparts(RootPath)); |
---|
[651] | 494 | DirFull=uigetfile_uvmat('define this path as the Campaign folder:',CampaignPath,'uigetdir'); |
---|
| 495 | %DirFull = uigetdir(CampaignPath,'Select a Campaign dir, then press OK'); |
---|
| 496 | if isempty(DirFull) |
---|
[569] | 497 | return |
---|
| 498 | end |
---|
[827] | 499 | OutPut=browse_data(DirFull,'on');% open the GUI browse_data to get select a campaign dir, experiment and device |
---|
[569] | 500 | if ~isfield(OutPut,'Campaign') |
---|
| 501 | return |
---|
| 502 | end |
---|
[745] | 503 | fileinput=uigetfile_uvmat('pick an input file',fullfile(OutPut.Campaign,OutPut.Experiment{1},OutPut.DataSeries{1})); |
---|
| 504 | hh=dir(fileinput); |
---|
| 505 | if numel(hh)>1 |
---|
| 506 | msgbox_uvmat('ERROR','invalid input, probably a broken link'); |
---|
[651] | 507 | return |
---|
| 508 | end |
---|
[569] | 509 | |
---|
[651] | 510 | %% update the list of campaigns in the menubar |
---|
| 511 | MenuCampaign=[{get(handles.MenuCampaign_1,'Label')};{get(handles.MenuCampaign_2,'Label')};... |
---|
| 512 | {get(handles.MenuCampaign_3,'Label')};{get(handles.MenuCampaign_4,'Label')};{get(handles.MenuCampaign_5,'Label')}]; |
---|
| 513 | check_dir=isempty(find(strcmp(DirFull,MenuCampaign))); |
---|
| 514 | if check_dir %insert the new campaign in the list if it is not found |
---|
| 515 | MenuCampaign(end)=[]; %suppress the last item |
---|
| 516 | MenuCampaign=[{DirFull};MenuCampaign];%insert the new campaign |
---|
| 517 | for ilist=1:numel(MenuCampaign) |
---|
| 518 | set(handles.(['MenuCampaign_' num2str(ilist)]),'Label',MenuCampaign{ilist}) |
---|
| 519 | end |
---|
| 520 | % save the list for future opening: |
---|
| 521 | dir_perso=prefdir; |
---|
| 522 | profil_perso=fullfile(dir_perso,'uvmat_perso.mat'); |
---|
| 523 | if exist(profil_perso,'file') |
---|
| 524 | save (profil_perso,'MenuCampaign','RootPath','-append'); %store the file names for future opening of uvmat |
---|
| 525 | else |
---|
| 526 | save (profil_perso,'MenuCampaign','RootPath','-V6'); %store the file names for future opening of uvmat |
---|
| 527 | end |
---|
| 528 | end |
---|
| 529 | |
---|
[569] | 530 | %% display the selected field and related information |
---|
[745] | 531 | %display_file_name( handles,fullfile(DirName,FileName)) |
---|
| 532 | display_file_name( handles,fileinput) |
---|
[651] | 533 | set(handles.MenuOpenCampaign,'ForegroundColor',[0 0 0]) |
---|
[387] | 534 | |
---|
| 535 | % ----------------------------------------------------------------------- |
---|
[651] | 536 | % --- Open again as second field the file whose name has been recorded in MenuFile_1 |
---|
[387] | 537 | % ----------------------------------------------------------------------- |
---|
[651] | 538 | function MenuCampaign_Callback(hObject, eventdata, handles) |
---|
[387] | 539 | |
---|
[651] | 540 | set(handles.MenuOpenCampaign,'ForegroundColor',[1 1 0]) |
---|
[827] | 541 | OutPut=browse_data(get(hObject,'Label'),'on');% open the GUI browse_data to get select a campaign dir, experiment and device |
---|
[784] | 542 | if isfield(OutPut,'Campaign') |
---|
| 543 | fileinput=uigetfile_uvmat('pick an input file',fullfile(OutPut.Campaign,OutPut.Experiment{1},OutPut.DataSeries{1})); |
---|
| 544 | hh=dir(fileinput); |
---|
| 545 | if numel(hh)>1 |
---|
| 546 | msgbox_uvmat('ERROR','invalid input, probably a broken link'); |
---|
| 547 | else |
---|
| 548 | display_file_name(handles,fileinput) |
---|
| 549 | end |
---|
| 550 | end |
---|
| 551 | set(handles.MenuOpenCampaign,'ForegroundColor',[0 0 0]) |
---|
| 552 | |
---|
| 553 | |
---|
| 554 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 555 | % Export Menu Callbacks |
---|
| 556 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 557 | %------------------------------------------------------------------------ |
---|
| 558 | % --- Executes on button press in Menu/Export/field in workspace. |
---|
| 559 | function MenuExportField_Callback(hObject, eventdata, handles) |
---|
| 560 | %------------------------------------------------------------------------ |
---|
| 561 | global Data_uvmat |
---|
| 562 | Data_uvmat=get(handles.uvmat,'UserData'); |
---|
| 563 | evalin('base','global Data_uvmat')%make CurData global in the workspace |
---|
| 564 | disp('Data_uvmat.Field=') |
---|
| 565 | evalin('base','Data_uvmat.Field') %display CurData in the workspace |
---|
| 566 | commandwindow; %brings the Matlab command window to the front |
---|
| 567 | |
---|
| 568 | %------------------------------------------------------------------------ |
---|
| 569 | % --- Executes on button press in Menu/Export/extract figure. |
---|
| 570 | function MenuExportFigure_Callback(hObject, eventdata, handles) |
---|
| 571 | %------------------------------------------------------------------------ |
---|
| 572 | hfig=figure; |
---|
| 573 | hc=copyobj(handles.PlotAxes,hfig); |
---|
| 574 | set(hc,'Position',[0.1 0.1 0.8 0.8]) |
---|
| 575 | h=findobj(handles.PlotAxes,'tag','ima'); %look for image in the plot |
---|
| 576 | if ~isempty(h) |
---|
| 577 | map=colormap(handles.PlotAxes); |
---|
| 578 | colormap(map);%transmit the current colormap to the new fig |
---|
| 579 | colorbar |
---|
| 580 | end |
---|
| 581 | |
---|
| 582 | % -------------------------------------------------------------------- |
---|
| 583 | function MenuExportAxis_Callback(hObject, eventdata, handles) |
---|
| 584 | % -------------------------------------------------------------------- |
---|
| 585 | ListFig=findobj(allchild(0),'Type','figure'); |
---|
| 586 | nb_option=0; |
---|
| 587 | menu={}; |
---|
| 588 | for ilist=1:numel(ListFig) |
---|
| 589 | FigName=get(ListFig(ilist),'name'); |
---|
| 590 | if isempty(FigName) |
---|
| 591 | FigName=['figure ' num2str(ListFig(ilist))]; |
---|
| 592 | end |
---|
| 593 | if ~strcmp(FigName,'uvmat') |
---|
| 594 | ListAxes=findobj(ListFig(ilist),'Type','axes'); |
---|
| 595 | ListTags=get(ListAxes,'Tag'); |
---|
| 596 | if ~isempty(ListTags) && ~isempty(find(~strcmp('Colorbar',ListTags), 1)) |
---|
| 597 | ListAxes=ListAxes(~strcmp('Colorbar',ListTags)); |
---|
| 598 | if numel(ListAxes)==1 |
---|
| 599 | nb_option=nb_option+1; |
---|
| 600 | menu{nb_option}=FigName ; |
---|
| 601 | AxesHandle(nb_option)=ListAxes; |
---|
| 602 | else |
---|
| 603 | nb_axis=0; |
---|
| 604 | for iaxes=1:numel(ListAxes) |
---|
| 605 | nb_axis=nb_axis+1; |
---|
| 606 | nb_option=nb_option+1; |
---|
| 607 | menu{nb_option}=[FigName '_' num2str(nb_axis)]; |
---|
| 608 | AxesHandle(nb_option)=ListAxes(nb_axis); |
---|
| 609 | end |
---|
| 610 | end |
---|
| 611 | end |
---|
| 612 | end |
---|
| 613 | end |
---|
| 614 | if isempty(menu) |
---|
| 615 | answer=msgbox_uvmat('INPUT_Y-N','no existing plotting axes available, create new figure?'); |
---|
| 616 | if strcmp(answer,'Yes') |
---|
| 617 | hfig=figure; |
---|
| 618 | copyobj(handles.PlotAxes,hfig); |
---|
| 619 | else |
---|
| 620 | return |
---|
| 621 | end |
---|
| 622 | map=colormap(handles.PlotAxes); |
---|
| 623 | colormap(map);%transmit the current colormap to the zoom fig |
---|
| 624 | colorbar |
---|
| 625 | else |
---|
| 626 | answer=msgbox_uvmat('INPUT_MENU','select a figure/axis on which the current uvmat plot will be exported',menu); |
---|
| 627 | if isempty(answer) |
---|
| 628 | return |
---|
| 629 | else |
---|
| 630 | axes(AxesHandle(answer)) |
---|
| 631 | hold on |
---|
| 632 | hchild=get(handles.PlotAxes,'children'); |
---|
| 633 | copyobj(hchild,gca); |
---|
| 634 | end |
---|
| 635 | end |
---|
| 636 | |
---|
| 637 | |
---|
| 638 | %------------------------------------------------------------------------ |
---|
| 639 | % -------------------------------------------------------------------- |
---|
| 640 | function MenuExportMovie_Callback(hObject, eventdata, handles) |
---|
| 641 | % -------------------------------------------------------------------- |
---|
| 642 | set(handles.MenuExportMovie,'BusyAction','queue')% activate the button |
---|
| 643 | |
---|
| 644 | [RootPath,SubDir,RootFile,FileIndex,FileExt]=read_file_boxes(handles); |
---|
| 645 | FileBase=fullfile(RootPath,RootFile); |
---|
| 646 | |
---|
| 647 | %% create a fig and axis for movies |
---|
| 648 | figure_movie=findobj(allchild(0),'name','figure_movie'); |
---|
| 649 | |
---|
| 650 | if ~isempty(figure_movie) |
---|
| 651 | delete(figure_movie)%delete existing figure_movie |
---|
| 652 | end |
---|
| 653 | figure_movie=figure; |
---|
[831] | 654 | nbpix=[640 480];% resolution VGA |
---|
[784] | 655 | set(figure_movie,'name','figure_movie','Position',[1 1 nbpix]) |
---|
| 656 | newaxes=copyobj(handles.PlotAxes,figure_movie);%new plotting axes in the new figure |
---|
| 657 | set(newaxes,'Tag','movieaxes') |
---|
| 658 | |
---|
| 659 | %% display time if defined in uvmat |
---|
| 660 | time_str=get(handles.TimeValue,'String'); |
---|
| 661 | if ~isempty(time_str) |
---|
[831] | 662 | htitle=get(newaxes,'Title'); |
---|
[784] | 663 | set(htitle,'String',['t=' time_str]) |
---|
| 664 | end |
---|
| 665 | map=colormap(handles.PlotAxes); |
---|
| 666 | colormap(map);%transmit the current colormap to the zoom fig |
---|
| 667 | colorbar |
---|
| 668 | |
---|
| 669 | %% create the GUI set_movie |
---|
| 670 | %set(0,'Units','points') |
---|
| 671 | %ScreenSize=get(0,'ScreenSize');% get the size of the screen, to put the fig on the upper right |
---|
| 672 | Position=get(figure_movie,'Position'); |
---|
| 673 | Position(2)=Position(2)+1.2*Position(4); |
---|
| 674 | Position(3)=1.5*Position(3); |
---|
| 675 | Position(4)=Position(4)/2; |
---|
| 676 | hfig=findobj(allchild(0),'Tag','set_movie'); |
---|
| 677 | if ~isempty(hfig),delete(hfig), end; %delete existing version of the GUI |
---|
| 678 | hfig=figure('name','set_movie','tag','set_movie','MenuBar','none','NumberTitle','off','Units','pixels',... |
---|
| 679 | 'Position',Position); |
---|
| 680 | BackgroundColor=get(hfig,'Color'); |
---|
| 681 | hh=0.14; % box height (relative) |
---|
| 682 | % first raw of the GUI |
---|
| 683 | uicontrol('Style','text','Units','normalized', 'Position', [0.05 0.95-hh/2 0.9 hh/2],'BackgroundColor',BackgroundColor,... |
---|
| 684 | 'String','movie name:','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
| 685 | uicontrol('Style','edit','Units','normalized', 'Position', [0.05 0.95-1.5*hh 0.9 hh],'tag','MovieName','BackgroundColor',[1 1 1],... |
---|
| 686 | 'String',fullfile(RootPath,[SubDir '.movie'], [RootFile '.avi']),'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''MovieName'': name (with path) of the movie to create');%edit box |
---|
[831] | 687 | uicontrol('Style','text','Units','normalized', 'Position', [0.05 0.95-2.5*hh 0.33 hh/2],'BackgroundColor',BackgroundColor,... |
---|
[784] | 688 | 'String','frames per second:','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
[831] | 689 | uicontrol('Style','text','Units','normalized', 'Position', [0.3 0.95-2.5*hh 0.33 hh/2],'BackgroundColor',BackgroundColor,... |
---|
| 690 | 'String','resolution:','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
| 691 | uicontrol('Style','text','Units','normalized', 'Position', [0.55 0.95-2.5*hh 0.33 hh/2],'BackgroundColor',BackgroundColor,... |
---|
[784] | 692 | 'String','total nbre of frames:','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
| 693 | uicontrol('Style','edit','Units','normalized', 'Position', [0.05 0.95-3.5*hh 0.3 hh],'tag','num_FramePerSecond','BackgroundColor',[1 1 1],... |
---|
| 694 | 'String','10','FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''num_FramePerSecond'': nbre of frames per second');%edit box |
---|
[831] | 695 | |
---|
| 696 | uicontrol('Style','listbox','Units','normalized', 'Position', [0.35 0.15 0.3 3*hh],'tag','MovieSize','BackgroundColor',[1 1 1],... |
---|
| 697 | 'Callback',@(hObject,eventdata)set_movie_size_Callback(hObject,eventdata),'String',{'640x480(VGA)';'720x480(mpeg2 16/9)';'1280x720(HD)'},... |
---|
| 698 | 'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''MovieSize'': resolution of the movie');%menu |
---|
| 699 | |
---|
[784] | 700 | uicontrol('Style','edit','Units','normalized', 'Position', [0.65 0.95-3.5*hh 0.3 hh],'tag','num_FrameNumber','BackgroundColor',[1 1 1],... |
---|
| 701 | 'String','10','FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''num_FrameNumber'': total nbre of frames');%edit box |
---|
[831] | 702 | |
---|
[784] | 703 | uicontrol('Style','pushbutton','Units','normalized', 'Position', [0.05 0.15 0.25 hh],'BackgroundColor',[1 0 0],'String','START','Callback',@(hObject,eventdata)set_movie_START_Callback(hObject,eventdata),... |
---|
| 704 | 'FontWeight','bold','FontUnits','points','FontSize',12,'TooltipString','''APPLY'': apply the output to the current field series in uvmat'); |
---|
| 705 | uicontrol('Style','pushbutton','Units','normalized', 'Position', [0.7 0.15 0.25 hh],'Callback',@(hObject,eventdata)set_movie_Cancel_Callback(hObject,eventdata),... |
---|
| 706 | 'String','Cancel','FontWeight','bold','FontUnits','points','FontSize',12,'TooltipString','''Cancel'': quit GUI without action'); |
---|
| 707 | uicontrol('Style','text','Units','normalized', 'Position', [0.05 0.05 0.9 hh/2],'BackgroundColor',BackgroundColor,... |
---|
| 708 | 'String','will extract the result of ++> on uvmat: adjust figure_movie with its Matlab edit menu, then press ''START ''','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
| 709 | drawnow |
---|
| 710 | |
---|
| 711 | %------------------------------------------------------------------------ |
---|
[831] | 712 | % function called by selecting movie size in the GUI set_movie |
---|
| 713 | function set_movie_size_Callback(hObject,eventdata) |
---|
| 714 | hset_movie=get(hObject,'parent'); |
---|
| 715 | hMovieSize=findobj(hset_movie,'Tag','MovieSize'); |
---|
| 716 | nbpix=[640 480; 720 480; 1280 720]; |
---|
| 717 | SizeOption=get(hMovieSize,'Value'); |
---|
| 718 | nbpix=nbpix(SizeOption,:); |
---|
| 719 | |
---|
| 720 | %% look for movie fig |
---|
| 721 | figure_movie=findobj(allchild(0),'name','figure_movie'); |
---|
| 722 | if isempty(figure_movie) |
---|
| 723 | figure_movie=figure; |
---|
| 724 | set(figure_movie,'name','figure_movie','Position',[1 1 nbpix]) |
---|
| 725 | huvmat=findobj(allchild(0),'tag','uvmat'); |
---|
| 726 | hhuvmat=guidata(huvmat); |
---|
| 727 | newaxes=copyobj(hhuvmat.PlotAxes,figure_movie);%new plotting axes in the new figure |
---|
| 728 | set(newaxes,'Tag','movieaxes') |
---|
| 729 | |
---|
| 730 | %% display time if defined in uvmat |
---|
| 731 | time_str=get(hhuvmat.TimeValue,'String'); |
---|
| 732 | if ~isempty(time_str) |
---|
| 733 | htitle=get(newaxes,'Title'); |
---|
| 734 | set(htitle,'String',['t=' time_str]) |
---|
| 735 | end |
---|
| 736 | map=colormap(handles.PlotAxes); |
---|
| 737 | colormap(map);%transmit the current colormap to the zoom fig |
---|
| 738 | colorbar |
---|
| 739 | else |
---|
| 740 | Pos=get(figure_movie,'Position'); |
---|
| 741 | set(figure_movie,'Position',[Pos(1) Pos(2) nbpix]) |
---|
| 742 | end |
---|
| 743 | |
---|
| 744 | |
---|
| 745 | %------------------------------------------------------------------------ |
---|
| 746 | % function called by pressing APPLY in the GUI set_movie |
---|
[784] | 747 | function set_movie_START_Callback(hObject,eventdata) |
---|
| 748 | %------------------------------------------------------------------------ |
---|
| 749 | %% read info from the GUI set_movie |
---|
| 750 | hset_movie=get(hObject,'parent'); |
---|
| 751 | hMovieName=findobj(hset_movie,'Tag','MovieName'); |
---|
| 752 | MovieName=get(hMovieName,'String'); |
---|
| 753 | hFramePerSecond=findobj(hset_movie,'Tag','num_FramePerSecond'); |
---|
| 754 | fps=str2double(get(hFramePerSecond,'String')); |
---|
| 755 | hFrameNumber=findobj(hset_movie,'Tag','num_FrameNumber'); |
---|
| 756 | FrameNumber=str2double(get(hFrameNumber,'String'));% total nbre of frames |
---|
| 757 | |
---|
| 758 | %% create the movie file |
---|
| 759 | MovieDir=fileparts(MovieName); |
---|
| 760 | if ~exist(MovieDir,'dir') |
---|
| 761 | [success,message]=mkdir(MovieDir); |
---|
| 762 | if ~isequal(success,1) |
---|
| 763 | msgbox_uvmat('ERROR',message) |
---|
| 764 | return |
---|
| 765 | end |
---|
| 766 | [success,message] = fileattrib(MovieDir,'+w','g','s');% allow writing access for the group of users, recursively in the folder |
---|
| 767 | if success==0 |
---|
| 768 | msgbox_uvmat('WARNING',{['unable to set group write access to ' MovieDir ':']; message});%error message for directory creation |
---|
| 769 | end |
---|
| 770 | end |
---|
| 771 | if exist(MovieName,'file') |
---|
| 772 | backup=MovieName; |
---|
| 773 | testexist=2; |
---|
| 774 | while testexist==2 |
---|
| 775 | backup=[backup '~']; |
---|
| 776 | testexist=exist(backup,'file'); |
---|
| 777 | end |
---|
| 778 | [success,message]=copyfile(MovieName,backup);%make backup of the existing file |
---|
| 779 | if isequal(success,1) |
---|
| 780 | delete(MovieName)%delete existing file |
---|
| 781 | else |
---|
| 782 | msgbox_uvmat('ERROR',message) |
---|
| 783 | return |
---|
| 784 | end |
---|
| 785 | end |
---|
| 786 | %create avi open |
---|
| 787 | aviobj=avifile(MovieName,'Compression','None','fps',fps); |
---|
| 788 | |
---|
| 789 | %% get info from uvmat and adjust it |
---|
| 790 | huvmat=findobj(allchild(0),'Tag','uvmat'); |
---|
| 791 | hhuvmat=guidata(huvmat); |
---|
| 792 | increment=str2num(get(hhuvmat.num_IndexIncrement,'String')); %get the field increment from uvmat |
---|
| 793 | set(hhuvmat.STOP,'Visible','on') |
---|
| 794 | set(hhuvmat.speed,'Visible','on') |
---|
| 795 | set(hhuvmat.speed_txt,'Visible','on') |
---|
| 796 | set(hhuvmat.Movie,'BusyAction','queue') |
---|
| 797 | set(hhuvmat.speed,'Value',1) |
---|
| 798 | figure_movie=findobj(allchild(0),'name','figure_movie'); |
---|
| 799 | hhuvmat.PlotAxes=findobj(figure_movie,'Tag','movieaxes');% the axis in the new figure becomes the current main plotting axes |
---|
| 800 | for i=1:FrameNumber |
---|
| 801 | if get(hhuvmat.speed,'Value')~=0 && isequal(get(hhuvmat.MenuExportMovie,'BusyAction'),'queue') % enable STOP command |
---|
| 802 | runpm(hObject,eventdata,hhuvmat,increment)% run plus |
---|
| 803 | drawnow |
---|
| 804 | time_str=get(hhuvmat.TimeValue,'String'); |
---|
| 805 | htitle=get(hhuvmat.PlotAxes,'Title'); |
---|
| 806 | Title=get(htitle,'String'); |
---|
| 807 | set(htitle,'String',regexprep(Title,'t=\d+.\d*',['t=' time_str])) |
---|
| 808 | mov=getframe(figure_movie); |
---|
| 809 | aviobj=addframe(aviobj,mov); |
---|
| 810 | end |
---|
| 811 | end |
---|
| 812 | aviobj=close(aviobj); |
---|
| 813 | msgbox_uvmat('CONFIRMATION',{['movie ' MovieName ' created '];['with ' num2str(FrameNumber) ' frames']}) |
---|
| 814 | |
---|
| 815 | %------------------------------------------------------------------------ |
---|
| 816 | % function called by pressing APPLY in the GUI set_slices |
---|
| 817 | function set_movie_Cancel_Callback(hObject,eventdata) |
---|
| 818 | %------------------------------------------------------------------------ |
---|
| 819 | delete(hObject) |
---|
| 820 | |
---|
| 821 | |
---|
| 822 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 823 | % Projection Objects Menu Callbacks |
---|
| 824 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 825 | |
---|
| 826 | % ----------------------------------------------------------------------- |
---|
| 827 | function Menupoints_Callback(hObject, eventdata, handles) |
---|
| 828 | %------------------------------------------------------------------------ |
---|
| 829 | data.Type='points'; |
---|
| 830 | data.ProjMode='projection';%default |
---|
| 831 | data.ProjModeMenu={};% do not restrict ProjMode menus |
---|
| 832 | create_object(data,handles) |
---|
| 833 | |
---|
| 834 | % ----------------------------------------------------------------------- |
---|
| 835 | % --- Callback of the Menu command line |
---|
| 836 | %------------------------------------------------------------------------ |
---|
| 837 | function Menuline_Callback(hObject, eventdata, handles) |
---|
| 838 | %------------------------------------------------------------------------ |
---|
| 839 | data.Type='line'; |
---|
| 840 | data.ProjMode='projection';%default |
---|
| 841 | data.ProjModeMenu={};% do not restrict ProjMode menus |
---|
| 842 | create_object(data,handles) |
---|
| 843 | |
---|
| 844 | % ----------------------------------------------------------------------- |
---|
| 845 | % --- Callback of the Menu command line_x |
---|
| 846 | %------------------------------------------------------------------------ |
---|
| 847 | function Menuline_x_Callback(hObject, eventdata, handles) |
---|
| 848 | |
---|
| 849 | data.Type='line_x'; |
---|
| 850 | data.ProjMode='projection';%default |
---|
| 851 | data.ProjModeMenu={};% do not restrict ProjMode menus |
---|
| 852 | create_object(data,handles) |
---|
| 853 | |
---|
| 854 | % ----------------------------------------------------------------------- |
---|
| 855 | % --- Callback of the Menu command line_y |
---|
| 856 | % ----------------------------------------------------------------------- |
---|
| 857 | function Menuline_y_Callback(hObject, eventdata, handles) |
---|
| 858 | |
---|
| 859 | data.Type='line_y'; |
---|
| 860 | data.ProjMode='projection';%default |
---|
| 861 | data.ProjModeMenu={};% do not restrict ProjMode menus |
---|
| 862 | create_object(data,handles) |
---|
| 863 | |
---|
| 864 | %------------------------------------------------------------------------ |
---|
| 865 | function Menupolyline_Callback(hObject, eventdata, handles) |
---|
| 866 | %------------------------------------------------------------------------ |
---|
| 867 | data.Type='polyline'; |
---|
| 868 | data.ProjMode='projection';%default |
---|
| 869 | data.ProjModeMenu={};% do not restrict ProjMode menus |
---|
| 870 | create_object(data,handles) |
---|
| 871 | |
---|
| 872 | %------------------------------------------------------------------------ |
---|
| 873 | function Menupolygon_Callback(hObject, eventdata, handles) |
---|
| 874 | %------------------------------------------------------------------------ |
---|
| 875 | data.Type='polygon'; |
---|
| 876 | data.ProjMode='inside';%default |
---|
| 877 | data.ProjModeMenu={};% do not restrict ProjMode menus |
---|
| 878 | create_object(data,handles) |
---|
| 879 | |
---|
| 880 | %------------------------------------------------------------------------ |
---|
| 881 | function Menurectangle_Callback(hObject, eventdata, handles) |
---|
| 882 | %------------------------------------------------------------------------ |
---|
| 883 | data.Type='rectangle'; |
---|
| 884 | data.ProjMode='inside';%default |
---|
| 885 | data.ProjModeMenu={};% do not restrict ProjMode menus |
---|
| 886 | create_object(data,handles) |
---|
| 887 | |
---|
| 888 | %------------------------------------------------------------------------ |
---|
| 889 | function Menuellipse_Callback(hObject, eventdata, handles) |
---|
| 890 | %------------------------------------------------------------------------ |
---|
| 891 | data.Type='ellipse'; |
---|
| 892 | data.ProjMode='inside';%default |
---|
| 893 | data.ProjModeMenu={};% do not restrict ProjMode menus |
---|
| 894 | create_object(data,handles) |
---|
| 895 | |
---|
| 896 | %------------------------------------------------------------------------ |
---|
| 897 | function MenuMaskObject_Callback(hObject, eventdata, handles) |
---|
| 898 | %------------------------------------------------------------------------ |
---|
| 899 | data.Type='polygon'; |
---|
| 900 | data.TypeMenu={'polygon'}; |
---|
| 901 | data.ProjMode='mask_inside';%default |
---|
| 902 | data.ProjModeMenu={'mask_inside';'mask_outside'}; |
---|
| 903 | create_object(data,handles) |
---|
| 904 | |
---|
| 905 | %------------------------------------------------------------------------ |
---|
| 906 | function Menuplane_Callback(hObject, eventdata, handles) |
---|
| 907 | %------------------------------------------------------------------------ |
---|
| 908 | data.Type='plane'; |
---|
| 909 | data.ProjMode='projection';%default |
---|
| 910 | data.ProjModeMenu={};% do not restrict ProjMode menus |
---|
| 911 | create_object(data,handles) |
---|
| 912 | |
---|
| 913 | %------------------------------------------------------------------------ |
---|
| 914 | function Menuvolume_Callback(hObject, eventdata, handles) |
---|
| 915 | %------------------------------------------------------------------------ |
---|
| 916 | data.Type='volume'; |
---|
| 917 | data.ProjMode='interp_lin';%default |
---|
| 918 | data.ProjModeMenu={}; |
---|
| 919 | % set(handles.create,'Visible','on') |
---|
| 920 | % set(handles.create,'Value',1) |
---|
| 921 | % VOLUME_Callback(hObject,eventdata,handles)data.ProjModeMenu={}; |
---|
| 922 | create_object(data,handles) |
---|
| 923 | |
---|
| 924 | %------------------------------------------------------------------------ |
---|
| 925 | % --- generic function used for the creation of a projection object |
---|
| 926 | function create_object(data,handles) |
---|
| 927 | %------------------------------------------------------------------------ |
---|
| 928 | %% desactivate concurrent tools |
---|
| 929 | set(handles.MenuRuler,'checked','off')%desactivate ruler |
---|
| 930 | hgeometry_calib=findobj(allchild(0),'tag','geometry_calib');% search the GUI geometric calibration |
---|
| 931 | if ishandle(hgeometry_calib) |
---|
| 932 | hhgeometry_calib=guidata(hgeometry_calib); |
---|
| 933 | set(hhgeometry_calib.CheckEnableMouse,'Value',0)% desactivate mouse action in geometry_calib |
---|
| 934 | set(hhgeometry_calib.CheckEnableMouse,'BackgroundColor',[0.7 0.7 0.7]) |
---|
| 935 | end |
---|
| 936 | set(handles.CheckEditObject,'Value',0) %desactivate the object edit mode |
---|
| 937 | CheckEditObject_Callback([],[],handles) |
---|
| 938 | set(handles.CheckViewObject,'Value',0) % desactivate view_object (new object created) |
---|
| 939 | set(handles.CheckZoomFig,'Value',0) %desactivate zoom sub fig |
---|
| 940 | set(handles.CheckZoom,'Value',0) %desactivate the zoom action |
---|
| 941 | set(handles.MenuObject,'checked','on')% indicate object creation for mouse pointer display |
---|
| 942 | if ishandle(handles.UVMAT_title) |
---|
| 943 | delete(handles.UVMAT_title) %delete the initial display of uvmat if no field has been entered yet |
---|
| 944 | end |
---|
| 945 | |
---|
| 946 | %% initiate the new projection object |
---|
| 947 | UvData=get(handles.uvmat,'UserData'); |
---|
| 948 | data.Name=data.Type;% default name=type |
---|
| 949 | data.Coord=[0 0]; %default |
---|
| 950 | check_plot=0; |
---|
| 951 | if isfield(UvData,'Field') |
---|
| 952 | Field=UvData.Field; |
---|
| 953 | if isfield(Field,'NbDim')&& isequal(Field.NbDim,3) |
---|
| 954 | data.Coord=[0 0 0]; %default |
---|
| 955 | end |
---|
| 956 | if isfield(Field,'CoordUnit') |
---|
| 957 | data.CoordUnit=Field.CoordUnit; |
---|
| 958 | end |
---|
| 959 | if isfield(UvData.Field,'CoordMesh')&&~isempty(UvData.Field.CoordMesh) |
---|
| 960 | data.RangeX=[UvData.Field.XMin UvData.Field.XMax]; |
---|
| 961 | switch data.Type |
---|
| 962 | case {'line','polyline','points'} |
---|
| 963 | data.RangeY=UvData.Field.CoordMesh; |
---|
| 964 | case 'line_x' |
---|
| 965 | check_plot=1; %plot the line directly when set_object is opened |
---|
| 966 | data.Type='line'; |
---|
| 967 | data.RangeX=UvData.Field.XMin ; |
---|
| 968 | data.RangeY=UvData.Field.CoordMesh; |
---|
| 969 | data.Coord=[UvData.Field.XMin (UvData.Field.YMin +UvData.Field.YMax)/2;... |
---|
| 970 | UvData.Field.XMax (UvData.Field.YMin +UvData.Field.YMax)/2];% put line at the middle of the y axis |
---|
| 971 | case 'line_y' |
---|
| 972 | check_plot=1; %plot the line directly when set_object is opened |
---|
| 973 | data.Type='line'; |
---|
| 974 | data.RangeX=UvData.Field.YMin ; |
---|
| 975 | data.RangeY=UvData.Field.CoordMesh; |
---|
| 976 | data.Coord=[(UvData.Field.XMin+UvData.Field.XMax)/2 UvData.Field.YMin;... |
---|
| 977 | (UvData.Field.XMin +UvData.Field.XMax)/2 UvData.Field.YMax];% put line at the middle of the y axis |
---|
| 978 | case {'rectangle','ellipse'} |
---|
| 979 | data.RangeY=[UvData.Field.YMin UvData.Field.YMax]; |
---|
| 980 | data.RangeX=UvData.Field.CoordMesh; |
---|
| 981 | data.RangeY=UvData.Field.CoordMesh; |
---|
| 982 | otherwise |
---|
| 983 | data.RangeY=[UvData.Field.YMin UvData.Field.YMax]; |
---|
| 984 | end |
---|
| 985 | data.DX=UvData.Field.CoordMesh; |
---|
| 986 | data.DY=UvData.Field.CoordMesh; |
---|
| 987 | end |
---|
| 988 | end |
---|
| 989 | |
---|
| 990 | hset_object=set_object(data,handles);% call the GUI set_object |
---|
| 991 | hchild=get(hset_object,'children'); |
---|
| 992 | set(hchild,'enable','on') |
---|
| 993 | set(handles.DeleteObject,'Visible','on')% make the object delete button visible |
---|
| 994 | if check_plot |
---|
| 995 | hhset_object=guidata(hset_object); |
---|
| 996 | set_object('REFRESH_Callback',1,[],hhset_object);% call the GUI set_object |
---|
| 997 | end |
---|
| 998 | set(handles.CheckViewField,'Visible','on') |
---|
| 999 | set(handles.DeleteObject,'Visible','on') |
---|
| 1000 | set(handles.ListObject_1,'Visible','on') |
---|
| 1001 | set(handles.ListObject_1_title,'Visible','on') |
---|
| 1002 | |
---|
| 1003 | %------------------------------------------------------------------------ |
---|
| 1004 | function MenuBrowseObject_Callback(hObject, eventdata, handles) |
---|
| 1005 | %------------------------------------------------------------------------ |
---|
| 1006 | %get the object file |
---|
| 1007 | fileinput=uigetfile_uvmat('pick an xml object file:',get(handles.RootPath,'String'),'.xml'); |
---|
| 1008 | if ~isempty(fileinput) |
---|
| 1009 | %read the file |
---|
| 1010 | [data,heading]=xml2struct(fileinput); |
---|
| 1011 | if ~strcmp(heading,'ProjObject') |
---|
| 1012 | msgbox_uvmat('WARNING','The xml file does not have the heading ProjObject for projection objects') |
---|
| 1013 | end |
---|
| 1014 | ListObject=get(handles.ListObject,'String'); |
---|
| 1015 | ListObject=[ListObject;{data.Name}]; |
---|
| 1016 | IndexObj=length(ListObject); |
---|
| 1017 | UvData=get(handles.uvmat,'UserData'); |
---|
| 1018 | UvData.ProjObject{IndexObj}=[]; %create a new empty object |
---|
| 1019 | UvData.ProjObject{IndexObj}.DisplayHandle.uvmat=[]; %no plot handle before plot_field operation |
---|
| 1020 | UvData.ProjObject{IndexObj}.DisplayHandle.view_field=[]; %no plot handle before plot_field operation |
---|
| 1021 | set(handles.uvmat,'UserData',UvData) |
---|
| 1022 | set(handles.CheckViewObject,'Value',1) |
---|
| 1023 | set(handles.CheckViewField,'Value',1) |
---|
| 1024 | hset_object=set_object(data);% call the set_object interface |
---|
| 1025 | hhset_object=guidata(hset_object); |
---|
| 1026 | set_object('REFRESH_Callback',hObject,eventdata,hhset_object);% plot projection |
---|
| 1027 | set(handles.CheckEditObject,'Value',0); %suppress the object edit mode |
---|
| 1028 | CheckEditObject_Callback([],[],handles) |
---|
| 1029 | set(handles.DeleteObject,'Visible','on') |
---|
| 1030 | end |
---|
| 1031 | |
---|
| 1032 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 1033 | % MenuTools Callbacks |
---|
| 1034 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 1035 | %------------------------------------------------------------------------ |
---|
| 1036 | function MenuCalib_Callback(hObject, eventdata, handles) |
---|
| 1037 | %------------------------------------------------------------------------ |
---|
| 1038 | %% suppress the second field if exists |
---|
| 1039 | if get(handles.SubField,'Value') |
---|
| 1040 | set(handles.SubField,'Value',0) |
---|
| 1041 | SubField_Callback(hObject, eventdata, handles) |
---|
| 1042 | end |
---|
| 1043 | UvData=get(handles.uvmat,'UserData');%read UvData properties stored on the uvmat interface |
---|
| 1044 | |
---|
| 1045 | %% suppress competing tools |
---|
| 1046 | set(handles.MenuRuler,'checked','off')%desactivate ruler |
---|
| 1047 | set(handles.CheckZoom,'Value',0) |
---|
| 1048 | set(handles.CheckZoom,'BackgroundColor',[0.7 0.7 0.7]) |
---|
| 1049 | set(handles.ListObject,'Value',1) |
---|
| 1050 | |
---|
| 1051 | %% initiate display of the GUI geometry_calib |
---|
| 1052 | data=[]; %default |
---|
| 1053 | if isfield(UvData,'CoordType') |
---|
| 1054 | data.CoordType=UvData.CoordType; |
---|
| 1055 | end |
---|
| 1056 | [RootPath,SubDir,RootFile,FileIndex,FileExt]=read_file_boxes(handles); |
---|
| 1057 | FileName=[fullfile(RootPath,SubDir,RootFile) FileIndex FileExt]; |
---|
| 1058 | set(handles.view_xml,'BackgroundColor',[1 1 0])%indicate the reading of the current xml file by geometry_calib |
---|
| 1059 | geometry_calib(FileName);% call the geometry_calib interface |
---|
| 1060 | set(handles.view_xml,'BackgroundColor',[1 1 1])%indicate the end of reading of the current xml file by geometry_calib |
---|
| 1061 | set(handles.MenuCalib,'checked','on')% indicate that MenuCalib is activated, test used by mouse action |
---|
| 1062 | |
---|
| 1063 | |
---|
| 1064 | % -------------------------------------------------------------------- |
---|
| 1065 | % --- set the slice plane ro the set of slice planes when volume scan is used |
---|
| 1066 | function MenuSetSlice_Callback(hObject, eventdata, handles) |
---|
| 1067 | % -------------------------------------------------------------------- |
---|
| 1068 | %% suppress the second input field if exists |
---|
| 1069 | if get(handles.SubField,'Value') |
---|
| 1070 | set(handles.SubField,'Value',0) |
---|
| 1071 | SubField_Callback(hObject, eventdata, handles) |
---|
| 1072 | end |
---|
| 1073 | |
---|
| 1074 | UvData=get(handles.uvmat,'UserData');%read UvData properties stored on the uvmat interface |
---|
| 1075 | check=0; |
---|
| 1076 | if isfield(UvData,'XmlData')&&isfield(UvData.XmlData{1},'GeometryCalib')&& isfield(UvData.XmlData{1}.GeometryCalib,'SliceCoord') |
---|
| 1077 | GeometryCalib=UvData.XmlData{1}.GeometryCalib; |
---|
| 1078 | else |
---|
| 1079 | msgbox_uvmat('ERROR','3D geometric calibration needed before defining slices') |
---|
[569] | 1080 | return |
---|
[784] | 1081 | end |
---|
| 1082 | SliceCoord=GeometryCalib.SliceCoord; |
---|
| 1083 | InterfaceCoord=min(SliceCoord(:,3)); |
---|
| 1084 | if isfield(GeometryCalib,'InterfaceCoord') |
---|
| 1085 | InterfaceCoord=GeometryCalib.InterfaceCoord(1,3); |
---|
[569] | 1086 | end |
---|
[784] | 1087 | NbSlice=size(SliceCoord,1); |
---|
| 1088 | CheckVolumeScan=0; |
---|
| 1089 | if isfield(GeometryCalib,'CheckVolumeScan') |
---|
| 1090 | CheckVolumeScan=GeometryCalib.CheckVolumeScan; |
---|
| 1091 | end |
---|
| 1092 | RefractionIndex=1.33; |
---|
| 1093 | if isfield(GeometryCalib,'RefractionIndex') |
---|
| 1094 | RefractionIndex=GeometryCalib.RefractionIndex; |
---|
| 1095 | end |
---|
| 1096 | SliceAngle=[0 0 0]; |
---|
| 1097 | if isfield(GeometryCalib,'SliceAngle') |
---|
| 1098 | SliceAngle=GeometryCalib.SliceAngle; |
---|
| 1099 | end |
---|
| 1100 | |
---|
| 1101 | %% create the GUI set_slice |
---|
| 1102 | set(0,'Units','points') |
---|
| 1103 | ScreenSize=get(0,'ScreenSize');% get the size of the screen, to put the fig on the upper right |
---|
| 1104 | Width=350;% fig width in points (1/72 inch) |
---|
| 1105 | Height=min(0.8*ScreenSize(4),300); |
---|
| 1106 | Left=ScreenSize(3)- Width-40; %right edge close to the right, with margin=40 |
---|
| 1107 | Bottom=ScreenSize(4)-Height-40; %put fig at top right |
---|
| 1108 | hfig=findobj(allchild(0),'Tag','set_slice'); |
---|
| 1109 | if ~isempty(hfig),delete(hfig), end; %delete existing version of the GUI |
---|
| 1110 | hfig=figure('name','set_slices','tag','set_slice','MenuBar','none','NumberTitle','off','Units','pixels','Position',[Left,Bottom,Width,Height],'UserData',GeometryCalib); |
---|
| 1111 | BackgroundColor=get(hfig,'Color'); |
---|
| 1112 | hh=0.14; % box height (relative) |
---|
| 1113 | ii=0.01; % gap between uicontrols |
---|
| 1114 | |
---|
| 1115 | ww=(1-5*ii)/4; % box width (relative) |
---|
| 1116 | % first raw of the GUI |
---|
| 1117 | uicontrol('Style','text','Units','normalized', 'Position', [2*ii+ww 0.95-ii-0.25*hh ww hh/2],'BackgroundColor',BackgroundColor,... |
---|
| 1118 | 'String','first','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
| 1119 | uicontrol('Style','text','Units','normalized', 'Position', [3*ii+2*ww 0.95-ii-0.25*hh ww hh/2],'BackgroundColor',BackgroundColor,... |
---|
| 1120 | 'String','last','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
| 1121 | uicontrol('Style','text','Units','normalized', 'Position', [4*ii+3*ww 0.95-ii-0.25*hh ww hh/2],'BackgroundColor',BackgroundColor,... |
---|
| 1122 | 'String','surface','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
| 1123 | % raw 2 of the GUI |
---|
| 1124 | uicontrol('Style','text','Units','normalized', 'Position', [ii 0.95-2*ii-0.75*hh ww hh/2],'BackgroundColor',BackgroundColor,... |
---|
| 1125 | 'String','Z','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','right');%title |
---|
| 1126 | uicontrol('Style','edit','Units','normalized', 'Position', [2*ii+ww 0.95-2*ii-hh ww hh],'tag','num_Z_1','BackgroundColor',[1 1 1],... |
---|
| 1127 | 'String',num2str(SliceCoord(1,3)),'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''num_Z_1'': z position of first slice');%edit box |
---|
| 1128 | uicontrol('Style','edit','Units','normalized', 'Position', [3*ii+2*ww 0.95-2*ii-hh ww hh],'tag','num_Z_2','BackgroundColor',[1 1 1],... |
---|
| 1129 | 'String',num2str(SliceCoord(end,3)),'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''num_Z_2'': z position of last slice');%edit box |
---|
| 1130 | uicontrol('Style','edit','Units','normalized', 'Position', [4*ii+3*ww 0.95-2*ii-hh ww hh],'tag','num_H','BackgroundColor',[1 1 1],... |
---|
| 1131 | 'String',num2str(InterfaceCoord),'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''num_H'': z position of the water surface (=Z_1 in air)');%edit box |
---|
| 1132 | % raw 3 of the GUI |
---|
| 1133 | uicontrol('Style','text','Units','normalized', 'Position', [2*ii+ww 0.95-3*ii-1.75*hh 2*ww hh/2],'BackgroundColor',BackgroundColor,'Tag','Refraction_title',... |
---|
| 1134 | 'String','refraction index','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','right');%title |
---|
| 1135 | uicontrol('Style','edit','Units','normalized', 'Position', [4*ii+3*ww 0.95-3*ii-2*hh ww hh],'tag','num_RefractionIndex','BackgroundColor',[1 1 1],... |
---|
| 1136 | 'String',num2str(RefractionIndex),'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''num_RefractionIndex'': refraction index of water'); |
---|
| 1137 | % raw 4 of the GUI |
---|
| 1138 | uicontrol('Style','text','Units','normalized', 'Position', [ii 0.95-4*ii-3.25*hh ww hh],'BackgroundColor',BackgroundColor,'Tag','NbSlice_title',... |
---|
| 1139 | 'String','NbSlice','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','right');%title |
---|
| 1140 | uicontrol('Style','edit','Units','normalized', 'Position', [2*ii+ww 0.95-4*ii-3*hh ww hh],'tag','num_NbSlice','BackgroundColor',[1 1 1],... |
---|
| 1141 | 'String',num2str(NbSlice),'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''num_NbSlice'':number of slices');%edit box |
---|
| 1142 | uicontrol('Style','checkbox','Units','normalized', 'Position', [3*ii+2*ww 0.95-4*ii-3*hh 2*ww hh],'tag','CheckVolumeScan','BackgroundColor',BackgroundColor,... |
---|
| 1143 | 'String','volume scan','Value',CheckVolumeScan,'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''CheckVolumeScan'':=1 for volume scan (z varies with j index)'); |
---|
| 1144 | % raw 5 of the GUI |
---|
| 1145 | uicontrol('Style','text','Units','normalized', 'Position', [2*ii+2*ww 0.95-5*ii-4.2*hh ww hh/2],'BackgroundColor',BackgroundColor,'Tag','Angle_title_1',... |
---|
| 1146 | 'String','x axis','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
| 1147 | uicontrol('Style','text','Units','normalized', 'Position', [3*ii+3*ww 0.95-5*ii-4.2*hh ww hh/2],'BackgroundColor',BackgroundColor,'Tag','Angle_title_2',... |
---|
| 1148 | 'String','y axis','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','center');%title |
---|
| 1149 | % raw 6 of the GUI |
---|
| 1150 | uicontrol('Style','text','Units','normalized', 'Position', [ii 0.95-5*ii-4.75*hh 2*ww hh/2],'BackgroundColor',BackgroundColor,'Tag','NbSlice_title',... |
---|
| 1151 | 'String','tilt angle','FontUnits','points','FontSize',12,'FontWeight','bold','ForegroundColor','blue','HorizontalAlignment','right');%title |
---|
| 1152 | uicontrol('Style','edit','Units','normalized', 'Position', [3*ii+2*ww 0.95-5*ii-5*hh ww hh],'tag','num_SliceAngle_1','BackgroundColor',[1 1 1],... |
---|
| 1153 | 'String',num2str(SliceAngle(1)),'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''num_SliceAngle_1'':slice angle of inclination around the x axis');%edit box |
---|
| 1154 | uicontrol('Style','edit','Units','normalized', 'Position', [4*ii+3*ww 0.95-5*ii-5*hh ww hh],'tag','num_SliceAngle_2','BackgroundColor',[1 1 1],... |
---|
| 1155 | 'String',num2str(SliceAngle(2)),'FontUnits','points','FontSize',12,'FontWeight','bold','TooltipString','''num_SliceAngle_1'':slice angle of inclination around the y axis');%edit box |
---|
| 1156 | % raw 7 of the GUI: pushbuttons |
---|
| 1157 | wwp=(1-4*ii)/3; %width of the push buttons |
---|
| 1158 | uicontrol('Style','pushbutton','Units','normalized', 'Position', [ii ii wwp hh],'BackgroundColor',[1 0 0],'String','APPLY','Callback',@(hObject,eventdata)set_slice_APPLY_Callback(hObject,eventdata),... |
---|
| 1159 | 'FontWeight','bold','FontUnits','points','FontSize',12,'TooltipString','''APPLY'': apply the output to the current field series in uvmat'); |
---|
| 1160 | uicontrol('Style','pushbutton','Units','normalized', 'Position', [2*ii+wwp ii wwp hh],'BackgroundColor',[1 0 0],'String','REPLICATE','Callback',@(hObject,eventdata)set_slice_REPLICATE_Callback(hObject,eventdata),... |
---|
| 1161 | 'FontWeight','bold','FontUnits','points','FontSize',12,'TooltipString','''REPLICATE'': replicate the output for a series of experiments'); |
---|
| 1162 | uicontrol('Style','pushbutton','Units','normalized', 'Position', [3*ii+2*wwp ii wwp hh],'Callback',@(hObject,eventdata)set_slice_Cancel_Callback(hObject,eventdata),... |
---|
| 1163 | 'String','Cancel','FontWeight','bold','FontUnits','points','FontSize',12,'TooltipString','''Cancel'': quit GUI without action'); |
---|
| 1164 | drawnow |
---|
| 1165 | |
---|
| 1166 | %------------------------------------------------------------------------ |
---|
| 1167 | % function called by pressing APPLY in the GUI set_slices |
---|
| 1168 | function set_slice_APPLY_Callback(hObject,eventdata) |
---|
| 1169 | %------------------------------------------------------------------------ |
---|
| 1170 | |
---|
| 1171 | %% get the uvmat GUI data and read the current xml file |
---|
| 1172 | huvmat=findobj(allchild(0),'Tag','uvmat'); |
---|
| 1173 | hhuvmat=guidata(huvmat); |
---|
| 1174 | [RootPath,SubDir,RootFile,FileIndex,FileExt]=read_file_boxes(hhuvmat); |
---|
| 1175 | FileName=[fullfile(RootPath,SubDir,RootFile) FileIndex FileExt];%name of the xml file for calibration |
---|
| 1176 | [RootPath,SubDir,RootFile,tild,tild,tild,tild,FileExt]=fileparts_uvmat(FileName); |
---|
| 1177 | XmlFile=find_imadoc(RootPath,SubDir,RootFile,FileExt); |
---|
| 1178 | [s,errormsg]=imadoc2struct(XmlFile,'GeometryCalib'); |
---|
[818] | 1179 | if~isempty(errormsg) |
---|
[784] | 1180 | msgbox_uvmat('ERROR',errormsg) |
---|
[745] | 1181 | return |
---|
[569] | 1182 | end |
---|
[784] | 1183 | GeometryCalib=s.GeometryCalib; |
---|
[569] | 1184 | |
---|
[784] | 1185 | %% read the content of the GUI set_slice |
---|
| 1186 | SliceData=read_GUI(get(hObject,'parent')); |
---|
| 1187 | GeometryCalib.NbSlice=SliceData.NbSlice; |
---|
| 1188 | GeometryCalib.CheckVolumeScan=SliceData.CheckVolumeScan; |
---|
| 1189 | Z_plane=linspace(SliceData.Z(1),SliceData.Z(2),SliceData.NbSlice); |
---|
| 1190 | GeometryCalib.SliceCoord=Z_plane'*[0 0 1]; |
---|
| 1191 | GeometryCalib.SliceAngle=zeros(GeometryCalib.NbSlice,3); |
---|
| 1192 | GeometryCalib.SliceAngle(:,1)=SliceData.SliceAngle(1)*ones(GeometryCalib.NbSlice,1);%rotation around x axis (to generalise) |
---|
| 1193 | GeometryCalib.SliceAngle(:,2)=SliceData.SliceAngle(2)*ones(GeometryCalib.NbSlice,1);%rotation around y axis (to generalise) |
---|
| 1194 | GeometryCalib.SliceAngle(:,3)=0; |
---|
| 1195 | GeometryCalib.InterfaceCoord=[0 0 SliceData.H]; |
---|
| 1196 | GeometryCalib.RefractionIndex=SliceData.RefractionIndex; |
---|
| 1197 | |
---|
| 1198 | %% store the result in the xml file used for calibration |
---|
| 1199 | errormsg=update_imadoc(GeometryCalib,XmlFile,'GeometryCalib');% introduce the calibration data in the xml file |
---|
| 1200 | if strcmp(errormsg,'') |
---|
| 1201 | msgbox_uvmat('CONFIRMATION',['slice positions saved in ' XmlFile]); |
---|
| 1202 | else |
---|
| 1203 | msgbox_uvmat('ERROR',errormsg); |
---|
| 1204 | end |
---|
| 1205 | |
---|
| 1206 | %% display image with new calibration in the currently opened uvmat interface |
---|
| 1207 | set(hhuvmat.CheckFixLimits,'Value',0)% put FixedLimits option to 'off' to plot the whole image |
---|
| 1208 | uvmat('InputFileREFRESH_Callback',huvmat,[],hhuvmat); %file input with xml reading in uvmat, show the image in phys coordinates |
---|
| 1209 | |
---|
[402] | 1210 | %------------------------------------------------------------------------ |
---|
[784] | 1211 | % function called by pressing REPLICATE in the GUI set_slices |
---|
| 1212 | function set_slice_REPLICATE_Callback(hObject,eventdata) |
---|
| 1213 | %------------------------------------------------------------------------ |
---|
| 1214 | |
---|
| 1215 | %% read the GUI set_slice |
---|
| 1216 | SliceData=read_GUI(get(hObject,'parent')); |
---|
| 1217 | |
---|
| 1218 | %% get info on the GUI uvmat |
---|
| 1219 | huvmat=findobj(allchild(0),'Tag','uvmat'); |
---|
| 1220 | hhuvmat=guidata(huvmat); |
---|
| 1221 | [RootPath,SubDir,RootFile,FileIndex,FileExt]=read_file_boxes(hhuvmat); |
---|
| 1222 | |
---|
| 1223 | %% open the GUI browse_data |
---|
| 1224 | answer=msgbox_uvmat('INPUT_TXT','Campaign to calibrate with slice position?',fileparts(RootPath)); |
---|
| 1225 | if strcmp(answer,'Cancel') |
---|
| 1226 | return |
---|
| 1227 | end |
---|
| 1228 | OutPut=browse_data(answer); |
---|
| 1229 | nbcalib=0; |
---|
| 1230 | for ilist=1:numel(OutPut.Experiment) |
---|
| 1231 | SubDirBase=regexprep(OutPut.DataSeries{1},'\..+$',''); |
---|
| 1232 | XmlFile=fullfile(OutPut.Campaign,OutPut.Experiment{ilist},[SubDirBase '.xml']); |
---|
| 1233 | |
---|
| 1234 | % read the current xml file |
---|
| 1235 | [s,errormsg]=imadoc2struct(XmlFile,'GeometryCalib'); |
---|
| 1236 | if ~isempty(errormsg) |
---|
| 1237 | msgbox_uvmat('ERROR',['error in reading ' XmlFile ': ' errormsg]) |
---|
| 1238 | return |
---|
| 1239 | end |
---|
| 1240 | GeometryCalib=s.GeometryCalib; |
---|
| 1241 | GeometryCalib.NbSlice=SliceData.NbSlice; |
---|
| 1242 | GeometryCalib.VolumeScan=SliceData.CheckVolumeScan; |
---|
| 1243 | Z_plane=linspace(SliceData.Z(1),SliceData.Z(2),SliceData.NbSlice); |
---|
| 1244 | GeometryCalib.SliceCoord=Z_plane'*[0 0 1]; |
---|
| 1245 | GeometryCalib.SliceAngle=zeros(GeometryCalib.NbSlice,3); |
---|
| 1246 | GeometryCalib.SliceAngle(:,1)=SliceData.SliceAngle(1)*ones(GeometryCalib.NbSlice,1);%rotation around x axis (to generalise) |
---|
| 1247 | GeometryCalib.SliceAngle(:,2)=SliceData.SliceAngle(2)*ones(GeometryCalib.NbSlice,1);%rotation around y axis (to generalise) |
---|
| 1248 | GeometryCalib.SliceAngle(:,3)=0; |
---|
| 1249 | GeometryCalib.InterfaceCoord=[0 0 SliceData.H]; |
---|
| 1250 | GeometryCalib.RefractionIndex=SliceData.RefractionIndex; |
---|
| 1251 | |
---|
| 1252 | % update the current xml file |
---|
| 1253 | errormsg=update_imadoc(GeometryCalib,XmlFile,'GeometryCalib');% introduce the calibration data in the xml file |
---|
| 1254 | if ~strcmp(errormsg,'') |
---|
| 1255 | msgbox_uvmat('ERROR',errormsg); |
---|
| 1256 | else |
---|
| 1257 | display([XmlFile ' updated with slice positions']) |
---|
| 1258 | nbcalib=nbcalib+1; |
---|
| 1259 | end |
---|
| 1260 | end |
---|
| 1261 | msgbox_uvmat('CONFIMATION',[SubDirBase ' calibrated with slice positions for ' num2str(nbcalib) ' experiments']); |
---|
| 1262 | |
---|
| 1263 | %------------------------------------------------------------------------ |
---|
| 1264 | % function called by pressing Cancel in the GUI set_slices |
---|
| 1265 | function set_slice_Cancel_Callback(hObject,eventdata) |
---|
| 1266 | %------------------------------------------------------------------------ |
---|
| 1267 | hfig=get(hObject,'parent'); |
---|
| 1268 | delete(hfig) |
---|
| 1269 | |
---|
| 1270 | %----------------------------------------------------------------------- |
---|
| 1271 | function MenuLIFCalib_Callback(hObject, eventdata, handles) |
---|
| 1272 | %------------------------------------------------------------------------ |
---|
| 1273 | %% read UvData properties stored on the uvmat interface |
---|
| 1274 | UvData=get(handles.uvmat,'UserData'); |
---|
| 1275 | if isfield(UvData,'XmlData')&& isfield(UvData.XmlData{1},'GeometryCalib') |
---|
| 1276 | XmlData=UvData.XmlData{1}; |
---|
| 1277 | else |
---|
| 1278 | msgbox_uvmat('ERROR','geometric calibration needed: use Tools/geometric calibration in the menu bar'); |
---|
| 1279 | return |
---|
| 1280 | end |
---|
| 1281 | |
---|
| 1282 | %% read lines currently drawn |
---|
| 1283 | ListObj=UvData.ProjObject; |
---|
| 1284 | select=zeros(1,numel(ListObj)); |
---|
| 1285 | for iobj=1:numel(ListObj); |
---|
| 1286 | if isfield(ListObj{iobj},'Type') && strcmp(ListObj{iobj}.Type,'line') |
---|
| 1287 | select(iobj)=1; |
---|
| 1288 | end |
---|
| 1289 | end |
---|
| 1290 | val=find(select); |
---|
| 1291 | if numel(val)<2 |
---|
| 1292 | msgbox_uvmat('ERROR','light rays must be defined by at least two lines created by Projection object/line in the menu bar'); |
---|
| 1293 | return |
---|
| 1294 | else |
---|
| 1295 | set(handles.ListObject,'Value',val);% show the selected lines on the list |
---|
| 1296 | ObjectData=UvData.ProjObject(val); |
---|
| 1297 | for iobj=1:length(ObjectData) |
---|
| 1298 | xA(iobj)=ObjectData{iobj}.Coord(1,1); |
---|
| 1299 | yA(iobj)=ObjectData{iobj}.Coord(1,2); |
---|
| 1300 | xB(iobj)=ObjectData{iobj}.Coord(2,1); |
---|
| 1301 | yB(iobj)=ObjectData{iobj}.Coord(2,2); |
---|
| 1302 | end |
---|
| 1303 | end |
---|
| 1304 | |
---|
| 1305 | %% find the origin as intersection of the two first lines (see http://www.ahristov.com/tutorial/geometry-games/intersection-lines.html ) |
---|
| 1306 | x1=xA(1);x2=xB(1); |
---|
| 1307 | x3=xA(2);x4=xB(2); |
---|
| 1308 | y1=yA(1);y2=yB(1); |
---|
| 1309 | y3=yA(2);y4=yB(2); |
---|
| 1310 | D = (x1-x2)*(y3-y4) -(y1-y2)*(x3-x4); |
---|
| 1311 | if D==0 |
---|
| 1312 | msgbox_uvmat('ERROR','the two lines are parallel'); |
---|
| 1313 | return |
---|
| 1314 | end |
---|
| 1315 | x0=((x3-x4)*(x1*y2-y1*x2)-(x1-x2)*(x3*y4-y3*x4))/D; |
---|
| 1316 | y0=((y3-y4)*(x1*y2-y1*x2)-(y1-y2)*(x3*y4-y3*x4))/D; |
---|
| 1317 | XmlData.Illumination.Origin=[x0 y0]; |
---|
| 1318 | XmlData.PolarCentre=[x0 y0]; |
---|
| 1319 | |
---|
| 1320 | %% display the current image in polar axes with origin at the illumination source |
---|
| 1321 | currentdir=pwd; |
---|
| 1322 | uvmatpath=fileparts(which('uvmat')); |
---|
| 1323 | cd(fullfile(uvmatpath,'transform_field')); |
---|
| 1324 | phys_polar=str2func('phys_polar'); |
---|
| 1325 | cd(currentdir) |
---|
| 1326 | DataOut=phys_polar(UvData.Field,XmlData); |
---|
| 1327 | view_field(DataOut); |
---|
| 1328 | |
---|
| 1329 | %% use the third line for reference luminosity |
---|
| 1330 | if numel(val)==3 |
---|
| 1331 | x_ref=linspace(ObjectData{3}.Coord(1,1),ObjectData{3}.Coord(2,1),10); |
---|
| 1332 | y_ref=linspace(ObjectData{3}.Coord(1,2),ObjectData{3}.Coord(2,2),10); |
---|
| 1333 | x_ref=x_ref-x0; |
---|
| 1334 | y_ref=y_ref-y0; |
---|
| 1335 | [theta_ref,r_ref] = cart2pol(x_ref,y_ref);%theta_ref and r_ref are the polar coordinates of the points on the line |
---|
| 1336 | theta_ref=theta_ref*180/pi; |
---|
| 1337 | figure |
---|
| 1338 | plot(theta_ref,r_ref) |
---|
| 1339 | azimuth_ima=linspace(DataOut.Coord_y(1),DataOut.Coord_y(2),size(DataOut.A,1));%profile of x index on the transformed image |
---|
| 1340 | dist_source = interp1(theta_ref,r_ref,azimuth_ima); |
---|
| 1341 | dist_source_pixel=round(size(DataOut.A,2)*(dist_source-DataOut.Coord_x(1))/(DataOut.Coord_x(2)-DataOut.Coord_x(1))); |
---|
| 1342 | line_nan= isnan(dist_source_pixel); |
---|
| 1343 | dist_source_pixel(line_nan)=1; |
---|
| 1344 | width=20; %number of pixels used for reference |
---|
| 1345 | DataOut.A=double(DataOut.A); |
---|
| 1346 | Anorm=zeros(size(DataOut.A)); |
---|
| 1347 | Aval=mean(mean(DataOut.A)); |
---|
| 1348 | for iline=1:size(DataOut.A,1) |
---|
| 1349 | lum(iline)=mean(DataOut.A(iline,dist_source_pixel(iline):dist_source_pixel(iline)+width)); |
---|
| 1350 | Anorm(iline,:)=uint16(Aval*DataOut.A(iline,:)/lum(iline)); |
---|
| 1351 | end |
---|
| 1352 | lum(line_nan)=NaN; |
---|
| 1353 | figure |
---|
| 1354 | plot(1:size(DataOut.A,1),lum) |
---|
| 1355 | end |
---|
| 1356 | ImaName=regexprep([get(handles.RootFile,'String') get(handles.FileIndex,'String')],'//',''); |
---|
| 1357 | NewImageName=fullfile(get(handles.RootPath,'String'),'polar',[ImaName get(handles.FileExt,'String')]); |
---|
| 1358 | imwrite(Anorm,NewImageName,'BitDepth',16) |
---|
| 1359 | |
---|
| 1360 | %% record the origin in the xml file |
---|
| 1361 | XmlFileName=find_imadoc(get(handles.RootPath,'String'),get(handles.SubDir,'String'),get(handles.RootFile,'String'),get(handles.FileExt,'String')); |
---|
| 1362 | answer=msgbox_uvmat('INPUT_Y-N','save the illumination origin in the current xml file?'); |
---|
| 1363 | if strcmp(answer,'Yes') |
---|
| 1364 | t=xmltree(XmlFileName); %read the file |
---|
| 1365 | title=get(t,1,'name'); |
---|
| 1366 | if ~strcmp(title,'ImaDoc') |
---|
| 1367 | msgbox_uvmat('ERROR','wrong xml file'); |
---|
| 1368 | return |
---|
| 1369 | end |
---|
| 1370 | % backup the output file if it already exist, and read it |
---|
| 1371 | backupfile=XmlFileName; |
---|
| 1372 | testexist=2; |
---|
| 1373 | while testexist==2 |
---|
| 1374 | backupfile=[backupfile '~']; |
---|
| 1375 | testexist=exist(backupfile,'file'); |
---|
| 1376 | end |
---|
| 1377 | [success,message]=copyfile(XmlFileName,backupfile);%make backup |
---|
| 1378 | if success~=1 |
---|
| 1379 | errormsg=['errror in xml file backup: ' message]; |
---|
| 1380 | return |
---|
| 1381 | end |
---|
| 1382 | uid_illumination=find(t,'ImaDoc/Illumination'); |
---|
| 1383 | if isempty(uid_illumination) %if GeometryCalib does not already exists, create it |
---|
| 1384 | [t,uid_illumination]=add(t,1,'element','Illumination'); |
---|
| 1385 | end |
---|
| 1386 | uid_origin=find(t,'ImaDoc/Illumination/Origin'); |
---|
| 1387 | if ~isempty(uid_origin) %if GeometryCalib does not already exists, create it |
---|
| 1388 | t=delete(t,uid_origin); |
---|
| 1389 | end |
---|
| 1390 | % save the illumination origin |
---|
| 1391 | t=struct2xml(XmlData.Illumination,t,uid_illumination); |
---|
| 1392 | save(t,XmlFileName); |
---|
| 1393 | end |
---|
| 1394 | |
---|
| 1395 | |
---|
| 1396 | |
---|
| 1397 | %------------------------------------------------------------------------ |
---|
| 1398 | function MenuMask_Callback(hObject, eventdata, handles) |
---|
| 1399 | %------------------------------------------------------------------------ |
---|
| 1400 | UvData=get(handles.uvmat,'UserData');%read UvData properties stored on the uvmat interface |
---|
| 1401 | ListObj=UvData.ProjObject; |
---|
| 1402 | select=zeros(1,numel(ListObj)); |
---|
| 1403 | for iobj=1:numel(ListObj); |
---|
| 1404 | if strcmp(ListObj{iobj}.ProjMode,'mask_inside')||strcmp(ListObj{iobj}.ProjMode,'mask_outside') |
---|
| 1405 | select(iobj)=1; |
---|
| 1406 | end |
---|
| 1407 | end |
---|
| 1408 | val=find(select); |
---|
| 1409 | if isempty(val) |
---|
| 1410 | msgbox_uvmat('ERROR','polygons must be first created by Projection object/mask polygon in the menu bar'); |
---|
| 1411 | return |
---|
| 1412 | else |
---|
| 1413 | set(handles.ListObject,'Value',val); |
---|
| 1414 | flag=1; |
---|
| 1415 | if ~isfield(UvData.Field,'A') |
---|
| 1416 | msgbox_uvmat('ERROR','an image needs to be opened to set the mask size'); |
---|
| 1417 | return |
---|
| 1418 | end |
---|
| 1419 | npx=size(UvData.Field.A,2); |
---|
| 1420 | npy=size(UvData.Field.A,1); |
---|
| 1421 | xi=0.5:npx-0.5; |
---|
| 1422 | yi=0.5:npy-0.5; |
---|
| 1423 | [Xi,Yi]=meshgrid(xi,yi); |
---|
| 1424 | for iobj=1:length(UvData.ProjObject) |
---|
| 1425 | ObjectData=UvData.ProjObject{iobj}; |
---|
| 1426 | if isfield(ObjectData,'ProjMode') &&(isequal(ObjectData.ProjMode,'mask_inside')||isequal(ObjectData.ProjMode,'mask_outside')); |
---|
| 1427 | flagobj=1; |
---|
| 1428 | testphys=0; %coordinates in pixels by default |
---|
| 1429 | if isfield(ObjectData,'CoordUnit') && ~isequal(ObjectData.CoordUnit,'pixel') |
---|
| 1430 | if isfield(UvData,'XmlData')&& isfield(UvData.XmlData{1},'GeometryCalib') |
---|
| 1431 | Calib=UvData.XmlData{1}.GeometryCalib; |
---|
| 1432 | testphys=1; |
---|
| 1433 | end |
---|
| 1434 | end |
---|
| 1435 | if isfield(ObjectData,'Coord')&& isfield(ObjectData,'Type') |
---|
| 1436 | if isequal(ObjectData.Type,'polygon') |
---|
| 1437 | X=ObjectData.Coord(:,1); |
---|
| 1438 | Y=ObjectData.Coord(:,2); |
---|
| 1439 | if testphys |
---|
| 1440 | pos=[X Y zeros(size(X))]; |
---|
| 1441 | if isfield(Calib,'SliceCoord') && length(Calib.SliceCoord)>=3 |
---|
| 1442 | if isfield(Calib,'SliceAngle')&&~isequal(Calib.SliceAngle,[0 0 0]) |
---|
| 1443 | om=norm(Calib.SliceAngle);%norm of rotation angle in radians |
---|
| 1444 | OmAxis=Calib.SliceAngle/om; %unit vector marking the rotation axis |
---|
| 1445 | cos_om=cos(pi*om/180); |
---|
| 1446 | sin_om=sin(pi*om/180); |
---|
| 1447 | pos=cos_om*pos+sin_om*cross(OmAxis,pos)+(1-cos_om)*(OmAxis*pos')*OmAxis; |
---|
| 1448 | end |
---|
| 1449 | pos(:,1)=pos(:,1)+Calib.SliceCoord(1); |
---|
| 1450 | pos(:,2)=pos(:,2)+Calib.SliceCoord(2); |
---|
| 1451 | pos(:,3)=pos(:,3)+Calib.SliceCoord(3); |
---|
| 1452 | end |
---|
| 1453 | [X,Y]=px_XYZ(Calib,pos(:,1),pos(:,2),pos(:,3)); |
---|
| 1454 | end |
---|
| 1455 | flagobj=~inpolygon(Xi,Yi,X',Y');%=0 inside the polygon, 1 outside |
---|
| 1456 | elseif isequal(ObjectData.Type,'ellipse') |
---|
| 1457 | if testphys |
---|
| 1458 | %[X,Y]=px_XYZ(Calib,X,Y,0);% TODO:create a polygon boundary and transform to phys |
---|
| 1459 | end |
---|
| 1460 | RangeX=max(ObjectData.RangeX); |
---|
| 1461 | RangeY=max(ObjectData.RangeY); |
---|
| 1462 | X2Max=RangeX*RangeX; |
---|
| 1463 | Y2Max=RangeY*RangeY; |
---|
| 1464 | distX=(Xi-ObjectData.Coord(1,1)); |
---|
| 1465 | distY=(Yi-ObjectData.Coord(1,2)); |
---|
| 1466 | flagobj=(distX.*distX/X2Max+distY.*distY/Y2Max)>1; |
---|
| 1467 | elseif isequal(ObjectData.Type,'rectangle') |
---|
| 1468 | if testphys |
---|
| 1469 | %[X,Y]=px_XYZ(Calib,X,Y,0);% TODO:create a polygon boundary and transform to phys |
---|
| 1470 | end |
---|
| 1471 | distX=abs(Xi-ObjectData.Coord(1,1)); |
---|
| 1472 | distY=abs(Yi-ObjectData.Coord(1,2)); |
---|
| 1473 | flagobj=distX>max(ObjectData.RangeX) | distY>max(ObjectData.RangeY); |
---|
| 1474 | end |
---|
| 1475 | if isequal(ObjectData.ProjMode,'mask_outside') |
---|
| 1476 | flagobj=~flagobj; |
---|
| 1477 | end |
---|
| 1478 | flag=flag & flagobj; |
---|
| 1479 | end |
---|
| 1480 | end |
---|
| 1481 | end |
---|
| 1482 | %mask name |
---|
| 1483 | RootPath=get(handles.RootPath,'String'); |
---|
| 1484 | SubDir=get(handles.SubDir,'String'); |
---|
| 1485 | RootFile=get(handles.RootFile,'String'); |
---|
| 1486 | if ~isempty(RootFile)&&(isequal(RootFile(1),'/')|| isequal(RootFile(1),'\')) |
---|
| 1487 | RootFile(1)=[]; |
---|
| 1488 | end |
---|
| 1489 | list=get(handles.masklevel,'String'); |
---|
| 1490 | masknumber=num2str(length(list)); |
---|
| 1491 | maskindex=get(handles.masklevel,'Value'); |
---|
| 1492 | mask_name=fullfile_uvmat(RootPath,[SubDir '.mask'],'mask','.png','_1',maskindex); |
---|
| 1493 | imflag=uint8(255*(0.392+0.608*flag));% =100 for flag=0 (vectors not computed when 20<imflag<200) |
---|
| 1494 | imflag=flipdim(imflag,1); |
---|
| 1495 | |
---|
| 1496 | %display the mask |
---|
| 1497 | hfigmask=figure; |
---|
| 1498 | set(hfigmask,'Name','mask image') |
---|
| 1499 | vec=linspace(0,1,256);%define a linear greyscale colormap |
---|
| 1500 | map=[vec' vec' vec']; |
---|
| 1501 | colormap(map) |
---|
| 1502 | image(imflag); |
---|
| 1503 | answer=msgbox_uvmat('INPUT_TXT','mask file name:', mask_name); |
---|
| 1504 | if ~strcmp(answer,'Cancel') |
---|
| 1505 | mask_dir=fileparts(answer); |
---|
| 1506 | if ~exist(mask_dir,'dir') |
---|
| 1507 | [success,msg]=mkdir(mask_dir); |
---|
| 1508 | if success==0 |
---|
| 1509 | msgbox_uvmat('ERROR',['cannot create ' mask_dir ': ' msg]);%error message for directory creation |
---|
| 1510 | return |
---|
| 1511 | end |
---|
| 1512 | [success,msg] = fileattrib(mask_dir,'+w','g','s');% allow writing access for the group of users, recursively in the folder |
---|
| 1513 | if success==0 |
---|
| 1514 | msgbox_uvmat('WARNING',{['unable to set group write access to ' mask_dir ':']; msg});%error message for directory creation |
---|
| 1515 | end |
---|
| 1516 | end |
---|
| 1517 | imwrite(imflag,answer,'BitDepth',8); |
---|
| 1518 | end |
---|
| 1519 | set(handles.ListObject,'Value',1) |
---|
| 1520 | end |
---|
| 1521 | |
---|
| 1522 | %------------------------------------------------------------------------ |
---|
| 1523 | %-- open the GUI set_grid.fig to create grid |
---|
| 1524 | function MenuGrid_Callback(hObject, eventdata, handles) |
---|
| 1525 | %------------------------------------------------------------------------ |
---|
| 1526 | %suppress the other options if grid is chosen |
---|
| 1527 | set(handles.edit_vect,'Value',0) |
---|
| 1528 | edit_vect_Callback(hObject, eventdata, handles) |
---|
| 1529 | set(handles.ListObject,'Value',1) |
---|
| 1530 | |
---|
| 1531 | %prepare display of the set_grid GUI |
---|
| 1532 | [RootPath,SubDir,RootFile,FileIndex,FileExt]=read_file_boxes(handles); |
---|
| 1533 | FileName=[fullfile(RootPath,SubDir,RootFile) FileIndex FileExt]; |
---|
| 1534 | UvData=get(handles.uvmat,'UserData'); |
---|
| 1535 | % CoordList=get(handles.TransformName,'String'); |
---|
| 1536 | % val=get(handles.TransformName,'Value'); |
---|
| 1537 | set_grid(FileName,UvData.Field);% call the set_object interface |
---|
| 1538 | |
---|
| 1539 | |
---|
| 1540 | %------------------------------------------------------------------------ |
---|
| 1541 | function MenuRuler_Callback(hObject, eventdata, handles) |
---|
| 1542 | %------------------------------------------------------------------------ |
---|
| 1543 | if strcmp(get(handles.MenuRuler,'checked'),'on') |
---|
| 1544 | set(handles.MenuRuler,'checked','off')%desactivate if activated |
---|
| 1545 | else |
---|
| 1546 | set(handles.MenuRuler,'checked','on')%activate if selected |
---|
| 1547 | set(handles.CheckZoom,'Value',0) |
---|
| 1548 | CheckZoom_Callback(handles.uvmat, [], handles) |
---|
| 1549 | UvData=get(handles.uvmat,'UserData'); |
---|
| 1550 | UvData.MouseAction='ruler'; |
---|
| 1551 | set(handles.uvmat,'UserData',UvData); |
---|
| 1552 | end |
---|
| 1553 | |
---|
| 1554 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 1555 | % MenuRun Callbacks |
---|
| 1556 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 1557 | |
---|
| 1558 | %------------------------------------------------------------------------ |
---|
| 1559 | % open the GUI 'series' |
---|
| 1560 | function MenuSeries_Callback(hObject, eventdata, handles) |
---|
| 1561 | %------------------------------------------------------------------------ |
---|
| 1562 | Param=read_GUI(handles.uvmat); |
---|
| 1563 | Param.HiddenData=get(handles.uvmat,'UserData'); |
---|
| 1564 | series(Param); %run the series interface |
---|
| 1565 | |
---|
| 1566 | % -------------------------------------------------------------------- |
---|
| 1567 | function MenuPIV_Callback(hObject, eventdata, handles) |
---|
| 1568 | Param=read_GUI(handles.uvmat); |
---|
| 1569 | Param.HiddenData=get(handles.uvmat,'UserData'); |
---|
| 1570 | hseries=series(Param); |
---|
| 1571 | hhseries=guidata(hseries); |
---|
| 1572 | ActionMenu=get(hhseries.ActionName,'String'); |
---|
| 1573 | index_action=find(strcmp('civ_series',ActionMenu)); |
---|
| 1574 | set(hhseries.ActionName,'Value',index_action); |
---|
| 1575 | series('ActionName_Callback',hObject,eventdata,hhseries); %file input with xml reading in uvmat, show the image in phys coordinates |
---|
| 1576 | |
---|
| 1577 | %------------------------------------------------------------------------ |
---|
| 1578 | % -- open the GUI civ.fig for PIV |
---|
| 1579 | function MenuCIVx_Callback(hObject, eventdata, handles) |
---|
| 1580 | %------------------------------------------------------------------------ |
---|
| 1581 | [RootPath,SubDir,RootFile,FileIndex,FileExt]=read_file_boxes(handles); |
---|
| 1582 | FileName=[fullfile(RootPath,SubDir,RootFile) FileIndex FileExt]; |
---|
| 1583 | civ(FileName);% interface de civ(not in the uvmat file) |
---|
| 1584 | |
---|
| 1585 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 1586 | % MenuHelp Callback |
---|
| 1587 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 1588 | % -------------------------------------------------------------------- |
---|
| 1589 | function MenuHelp_Callback(hObject, eventdata, handles) |
---|
| 1590 | % -------------------------------------------------------------------- |
---|
| 1591 | web('http://servforge.legi.grenoble-inp.fr/projects/soft-uvmat/wiki/UvmatHelp') |
---|
| 1592 | |
---|
| 1593 | |
---|
| 1594 | |
---|
| 1595 | |
---|
| 1596 | |
---|
| 1597 | |
---|
| 1598 | |
---|
| 1599 | |
---|
| 1600 | |
---|
| 1601 | |
---|
| 1602 | %------------------------------------------------------------------------ |
---|
[402] | 1603 | % --- Called by action in FileIndex edit box |
---|
| 1604 | function FileIndex_Callback(hObject, eventdata, handles) |
---|
| 1605 | %------------------------------------------------------------------------ |
---|
| 1606 | [tild,tild,tild,i1,i2,j1,j2]=fileparts_uvmat(get(handles.FileIndex,'String')); |
---|
[764] | 1607 | set(handles.i1,'String',num2str(i1));%update the counters |
---|
[402] | 1608 | set(handles.i2,'String',num2str(i2)); |
---|
| 1609 | set(handles.j1,'String',num2str(j1)); |
---|
| 1610 | set(handles.j2,'String',num2str(j2)); |
---|
| 1611 | |
---|
| 1612 | |
---|
| 1613 | %------------------------------------------------------------------------ |
---|
| 1614 | % --- Called by action in NomType edit box |
---|
| 1615 | function NomType_Callback(hObject, eventdata, handles) |
---|
| 1616 | %------------------------------------------------------------------------ |
---|
| 1617 | i1=str2num(get(handles.i1,'String')); |
---|
| 1618 | i2=str2num(get(handles.i2,'String')); |
---|
| 1619 | j1=str2num(get(handles.j1,'String')); |
---|
| 1620 | j2=str2num(get(handles.j2,'String')); |
---|
| 1621 | FileIndex=fullfile_uvmat('','','','',get(handles.NomType,'String'),i1,i2,j1,j2); |
---|
| 1622 | set(handles.FileIndex,'String',FileIndex) |
---|
[764] | 1623 | % refresh the current settings and refresh the field view |
---|
[402] | 1624 | RootPath_Callback(hObject,eventdata,handles) |
---|
| 1625 | |
---|
| 1626 | %------------------------------------------------------------------------ |
---|
| 1627 | % --- Called by action in NomType edit box |
---|
| 1628 | function NomType_1_Callback(hObject, eventdata, handles) |
---|
| 1629 | %------------------------------------------------------------------------ |
---|
| 1630 | i1=str2num(get(handles.i1,'String')); |
---|
| 1631 | i2=str2num(get(handles.i2,'String')); |
---|
| 1632 | j1=str2num(get(handles.j1,'String')); |
---|
| 1633 | j2=str2num(get(handles.j2,'String')); |
---|
| 1634 | FileIndex=fullfile_uvmat('','','','',get(handles.NomType_1,'String'),i1,i2,j1,j2); |
---|
| 1635 | set(handles.FileIndex_1,'String',FileIndex) |
---|
[713] | 1636 | % inputfilerefresh the current settings and inputfilerefresh the field view |
---|
[402] | 1637 | RootPath_1_Callback(hObject,eventdata,handles) |
---|
| 1638 | |
---|
[710] | 1639 | %------------------------------------------------------------------------ |
---|
[713] | 1640 | % --- Executes on button press in InputFileREFRESH. |
---|
| 1641 | function InputFileREFRESH_Callback(hObject, eventdata, handles) |
---|
[778] | 1642 | %------------------------------------------------------------------------ |
---|
[713] | 1643 | set(handles.InputFileREFRESH,'BackgroundColor',[1 1 0])% set button color to yellow to indicate that refresh is under action |
---|
[714] | 1644 | set(handles.uvmat,'Pointer','watch') % set the mouse pointer to 'watch' |
---|
| 1645 | drawnow |
---|
[710] | 1646 | % read the current input file name: |
---|
| 1647 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes(handles); |
---|
| 1648 | % detect the file type, get the movie object if relevant, and look for the corresponding file series: |
---|
[783] | 1649 | [RootPath,SubDir,RootFile,i1_series,i2_series,j1_series,j2_series,tild,FileInfo,MovieObject]=find_file_series(fullfile(RootPath,SubDir),[RootFile FileIndices FileExt]); |
---|
[778] | 1650 | if isempty(i1_series) |
---|
| 1651 | fileinput=uigetfile_uvmat('pick an input file',fullfile(RootPath,SubDir)); |
---|
| 1652 | hh=dir(fileinput); |
---|
| 1653 | if numel(hh)>1 |
---|
| 1654 | msgbox_uvmat('ERROR','invalid input, probably a broken link'); |
---|
| 1655 | else |
---|
| 1656 | %% display the selected field and related information |
---|
| 1657 | if isempty(fileinput) |
---|
| 1658 | errormsg='aborted'; |
---|
| 1659 | else |
---|
| 1660 | display_file_name(handles,fileinput,1) |
---|
| 1661 | end |
---|
| 1662 | end |
---|
| 1663 | else |
---|
| 1664 | % initiate the input file series and refresh the current field view: |
---|
| 1665 | errormsg=update_rootinfo(handles,i1_series,i2_series,j1_series,j2_series,FileInfo,MovieObject,1); |
---|
| 1666 | end |
---|
| 1667 | |
---|
| 1668 | %% refresh the second series if relevant |
---|
| 1669 | if ~isempty(errormsg) && get(handles.SubField,'Value') |
---|
[710] | 1670 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes_1(handles); |
---|
| 1671 | % detect the file type, get the movie object if relevant, and look for the corresponding file series: |
---|
[783] | 1672 | [RootPath,SubDir,RootFile,i1_series,i2_series,j1_series,j2_series,tild,FileInfo,MovieObject]=find_file_series(fullfile(RootPath,SubDir),[RootFile FileIndices FileExt]); |
---|
[778] | 1673 | if isempty(i1_series) |
---|
| 1674 | fileinput=uigetfile_uvmat('pick an input file for the second line',fullfile(RootPath,SubDir)); |
---|
| 1675 | hh=dir(fileinput); |
---|
| 1676 | if numel(hh)>1 |
---|
| 1677 | msgbox_uvmat('ERROR','invalid input, probably a broken link'); |
---|
| 1678 | else |
---|
| 1679 | %% display the selected field and related information |
---|
| 1680 | if isempty(fileinput) |
---|
| 1681 | errormsg='aborted'; |
---|
| 1682 | else |
---|
| 1683 | display_file_name(handles,fileinput,2) |
---|
| 1684 | end |
---|
| 1685 | end |
---|
| 1686 | else |
---|
| 1687 | % initiate the input file series and inputfilerefresh the current field view: |
---|
| 1688 | errormsg=update_rootinfo(handles,i1_series,i2_series,j1_series,j2_series,FileInfo,MovieObject,2); |
---|
| 1689 | end |
---|
[710] | 1690 | end |
---|
[778] | 1691 | if ~isempty(errormsg) |
---|
| 1692 | set(handles.InputFileREFRESH,'BackgroundColor',[1 0 1])% put back button color to magenta, input not succesfull |
---|
[710] | 1693 | end |
---|
[714] | 1694 | set(handles.uvmat,'Pointer','arrow')% set back the mouse pointer to arrow |
---|
[710] | 1695 | |
---|
[387] | 1696 | %------------------------------------------------------------------------ |
---|
| 1697 | % --- Fills the edit boxes RootPath, RootFile,NomType...from an input file name 'fileinput' |
---|
[714] | 1698 | function errormsg=display_file_name(handles,fileinput,index) |
---|
[387] | 1699 | %------------------------------------------------------------------------ |
---|
| 1700 | %% look for the input file existence |
---|
[714] | 1701 | errormsg='';%default |
---|
[387] | 1702 | if ~exist(fileinput,'file') |
---|
[714] | 1703 | errormsg=['input file ' fileinput ' does not exist']; |
---|
| 1704 | msgbox_uvmat('ERROR',errormsg) |
---|
[387] | 1705 | return |
---|
| 1706 | end |
---|
| 1707 | |
---|
[406] | 1708 | %% define the relevant handles for the first field series (index=1) or the second file series (index=2) |
---|
[387] | 1709 | if ~exist('index','var') |
---|
| 1710 | index=1; |
---|
| 1711 | end |
---|
| 1712 | if index==1 |
---|
| 1713 | handles_RootPath=handles.RootPath; |
---|
| 1714 | handles_SubDir=handles.SubDir; |
---|
| 1715 | handles_RootFile=handles.RootFile; |
---|
| 1716 | handles_FileIndex=handles.FileIndex; |
---|
| 1717 | handles_NomType=handles.NomType; |
---|
| 1718 | handles_FileExt=handles.FileExt; |
---|
| 1719 | elseif index==2 |
---|
| 1720 | handles_RootPath=handles.RootPath_1; |
---|
| 1721 | handles_SubDir=handles.SubDir_1; |
---|
| 1722 | handles_RootFile=handles.RootFile_1; |
---|
| 1723 | handles_FileIndex=handles.FileIndex_1; |
---|
| 1724 | handles_NomType=handles.NomType_1; |
---|
| 1725 | handles_FileExt=handles.FileExt_1; |
---|
| 1726 | set(handles.RootPath_1,'Visible','on') |
---|
| 1727 | set(handles.RootFile_1,'Visible','on') |
---|
| 1728 | set(handles.SubDir_1,'Visible','on'); |
---|
| 1729 | set(handles.FileIndex_1,'Visible','on'); |
---|
| 1730 | set(handles.FileExt_1,'Visible','on'); |
---|
| 1731 | set(handles.NomType_1,'Visible','on'); |
---|
[674] | 1732 | set(handles.TimeName_1,'Visible','on') |
---|
| 1733 | set(handles.TimeValue_1,'Visible','on') |
---|
[387] | 1734 | end |
---|
[713] | 1735 | set(handles.InputFileREFRESH,'BackgroundColor',[1 1 0])% paint REFRESH button to yellow to visualise root file input |
---|
[674] | 1736 | set(handles.uvmat,'Pointer','watch') % set the mouse pointer to 'watch' |
---|
| 1737 | drawnow |
---|
[387] | 1738 | |
---|
[674] | 1739 | %% detect root name, nomenclature and indices in the input file name: |
---|
| 1740 | [FilePath,FileName,FileExt]=fileparts(fileinput); |
---|
| 1741 | % detect the file type, get the movie object if relevant, and look for the corresponding file series: |
---|
| 1742 | % the root name and indices may be corrected by including the first index i1 if a corresponding xml file exists |
---|
[783] | 1743 | [RootPath,SubDir,RootFile,i1_series,i2_series,j1_series,j2_series,NomType,FileInfo,MovieObject,i1,i2,j1,j2]=find_file_series(FilePath,[FileName FileExt]); |
---|
| 1744 | FileType=FileInfo.FileType; |
---|
[674] | 1745 | if strcmp(FileType,'txt') |
---|
[688] | 1746 | try |
---|
| 1747 | edit(fileinput) |
---|
| 1748 | catch ME |
---|
| 1749 | msgbox_uvmat('ERROR','invalid intput file') |
---|
| 1750 | end |
---|
[674] | 1751 | return |
---|
| 1752 | elseif strcmp(FileType,'xml') |
---|
| 1753 | editxml(fileinput) |
---|
| 1754 | return |
---|
| 1755 | elseif strcmp(FileType,'figure') |
---|
| 1756 | open(fileinput) |
---|
| 1757 | return |
---|
| 1758 | end |
---|
| 1759 | |
---|
[387] | 1760 | %% open the file or fill the GUI uvmat according to the detected file type |
---|
| 1761 | switch FileType |
---|
| 1762 | case '' |
---|
| 1763 | msgbox_uvmat('ERROR','invalid input file type') |
---|
| 1764 | case 'txt' |
---|
| 1765 | edit(fileinput) |
---|
| 1766 | case 'figure' %display matlab figure |
---|
| 1767 | hfig=open(fileinput); |
---|
| 1768 | set(hfig,'WindowButtonMotionFcn','mouse_motion')%set mouse action functio |
---|
| 1769 | set(hfig,'WindowButtonUpFcn','mouse_up')%set mouse click action function |
---|
| 1770 | set(hfig,'WindowButtonUpFcn','mouse_down')%set mouse click action function |
---|
[503] | 1771 | case 'xml' % edit xml files |
---|
[507] | 1772 | t=xmltree(fileinput); |
---|
[508] | 1773 | % the xml file marks a project or project link, open datatree_browser |
---|
[507] | 1774 | if strcmp(get(t,1,'name'),'Project')&& exist(regexprep(fileinput,'.xml$',''),'dir') |
---|
[503] | 1775 | datatree_browser(fileinput) |
---|
[508] | 1776 | else % other xml file, open the xml editor |
---|
[503] | 1777 | editxml(fileinput); |
---|
| 1778 | end |
---|
[508] | 1779 | case 'xls'% Excel file opended by editxml |
---|
[387] | 1780 | editxml(fileinput); |
---|
| 1781 | otherwise |
---|
| 1782 | set(handles_RootPath,'String',RootPath); |
---|
| 1783 | rootname=fullfile(RootPath,SubDir,RootFile); |
---|
| 1784 | set(handles_SubDir,'String',['/' SubDir]); |
---|
| 1785 | set(handles_RootFile,'String',['/' RootFile]); %display the separator |
---|
| 1786 | indices=fileinput(length(rootname)+1:end); |
---|
| 1787 | indices(end-length(FileExt)+1:end)=[]; %remove extension |
---|
| 1788 | set(handles_FileIndex,'String',indices); |
---|
| 1789 | set(handles_NomType,'String',NomType); |
---|
| 1790 | set(handles_FileExt,'String',FileExt); |
---|
| 1791 | if index==1 |
---|
| 1792 | % fill file index counters if the first file series is opened |
---|
| 1793 | set(handles.i1,'String',num2str(i1)); |
---|
| 1794 | set(handles.i2,'String',num2str(i2)); |
---|
| 1795 | set(handles.j1,'String',num2stra(j1,NomType)); |
---|
| 1796 | set(handles.j2,'String',num2stra(j2,NomType)); |
---|
[515] | 1797 | else %read the current field index to synchronise with the first series |
---|
| 1798 | i1_s=str2num(get(handles.i1,'String')); |
---|
| 1799 | i2_0=str2num(get(handles.i2,'String')); |
---|
| 1800 | if ~isempty(i2_0) |
---|
| 1801 | i2_s=i2_0; |
---|
| 1802 | else |
---|
| 1803 | i2_s=i2; |
---|
| 1804 | end |
---|
| 1805 | j1_0=stra2num(get(handles.j1,'String')); |
---|
| 1806 | if ~isempty(j1_0) |
---|
| 1807 | j1_s=j1_0; |
---|
| 1808 | else |
---|
| 1809 | j1_s=j1; |
---|
| 1810 | end |
---|
| 1811 | j2_0=stra2num(get(handles.j2,'String')); |
---|
| 1812 | if ~isempty(j2_0) |
---|
| 1813 | j2_s=j2_0; |
---|
| 1814 | else |
---|
| 1815 | j2_s=j2; |
---|
| 1816 | end |
---|
[387] | 1817 | end |
---|
| 1818 | |
---|
| 1819 | % synchronise indices of the second input file if it exists |
---|
| 1820 | if get(handles.SubField,'Value')==1% if the subfield button is activated, update the field numbers |
---|
| 1821 | Input=read_GUI(handles.InputFile); |
---|
| 1822 | if ~isfield(Input,'RootPath_1')||strcmp(Input.RootPath_1,'"') |
---|
| 1823 | Input.RootPath_1=Input.RootPath; |
---|
| 1824 | end |
---|
| 1825 | if ~isfield(Input,'SubDir_1')||strcmp(Input.SubDir_1,'"') |
---|
| 1826 | Input.SubDir_1=Input.SubDir; |
---|
| 1827 | end |
---|
| 1828 | if ~isfield(Input,'RootFile_1')||strcmp(Input.RootFile_1,'"') |
---|
| 1829 | Input.RootFile_1=Input.RootFile; |
---|
| 1830 | end |
---|
[405] | 1831 | if ~isfield(Input,'FileExt_1')||strcmp(Input.FileExt_1,'"') |
---|
| 1832 | Input.FileExt_1=Input.FileExt; |
---|
| 1833 | end |
---|
| 1834 | if ~isfield(Input,'NomType_1')||strcmp(Input.NomType_1,'"') |
---|
| 1835 | Input.NomType_1=Input.NomType; |
---|
| 1836 | end |
---|
[387] | 1837 | %updtate the indices of the second field series to correspond to the newly opened one |
---|
[515] | 1838 | FileName_1=fullfile_uvmat(Input.RootPath_1,Input.SubDir_1,Input.RootFile_1,Input.FileExt_1,Input.NomType_1,i1_s,i2_s,j1_s,j2_s); |
---|
[387] | 1839 | if exist(FileName_1,'file') |
---|
[515] | 1840 | FileIndex_1=fullfile_uvmat('','','','',Input.NomType_1,i1_s,i2_s,j1_s,j2_s); |
---|
| 1841 | else |
---|
[387] | 1842 | FileIndex_1=fullfile_uvmat('','','','',Input.NomType_1,i1,i2,j1,j2); |
---|
[408] | 1843 | msgbox_uvmat('WARNING','unable to synchronise the indices of the two series') |
---|
[387] | 1844 | end |
---|
[515] | 1845 | set(handles.FileIndex_1,'String',FileIndex_1) |
---|
[387] | 1846 | end |
---|
| 1847 | |
---|
| 1848 | %enable other menus |
---|
[651] | 1849 | set(handles.MenuOpenCampaign,'Enable','on') |
---|
[387] | 1850 | set(handles.MenuExport,'Enable','on') |
---|
| 1851 | set(handles.MenuExportFigure,'Enable','on') |
---|
| 1852 | set(handles.MenuExportMovie,'Enable','on') |
---|
| 1853 | set(handles.MenuTools,'Enable','on') |
---|
[503] | 1854 | |
---|
[713] | 1855 | % initiate input file series and inputfilerefresh the current field view: |
---|
[773] | 1856 | update_rootinfo(handles,i1_series,i2_series,j1_series,j2_series,FileInfo,MovieObject,index); |
---|
[387] | 1857 | |
---|
| 1858 | end |
---|
| 1859 | |
---|
[503] | 1860 | %% update list of recent files in the menubar and save it for future opening |
---|
| 1861 | MenuFile=[{get(handles.MenuFile_1,'Label')};{get(handles.MenuFile_2,'Label')};... |
---|
| 1862 | {get(handles.MenuFile_3,'Label')};{get(handles.MenuFile_4,'Label')};{get(handles.MenuFile_5,'Label')}]; |
---|
| 1863 | str_find=strcmp(fileinput,MenuFile); |
---|
| 1864 | if isempty(find(str_find,1)) |
---|
| 1865 | MenuFile=[{fileinput};MenuFile];%insert the current file if not already in the list |
---|
| 1866 | end |
---|
| 1867 | for ifile=1:min(length(MenuFile),5) |
---|
[576] | 1868 | set(handles.(['MenuFile_' num2str(ifile)]),'Label',MenuFile{ifile}); |
---|
[651] | 1869 | %set(handles.(['MenuFile_' num2str(ifile) '_1']),'Label',MenuFile{ifile}); |
---|
[503] | 1870 | end |
---|
| 1871 | dir_perso=prefdir; |
---|
| 1872 | profil_perso=fullfile(dir_perso,'uvmat_perso.mat'); |
---|
| 1873 | if exist(profil_perso,'file') |
---|
[576] | 1874 | save (profil_perso,'MenuFile','RootPath','-append'); %store the file names for future opening of uvmat |
---|
[503] | 1875 | else |
---|
[576] | 1876 | save (profil_perso,'MenuFile','RootPath','-V6'); %store the file names for future opening of uvmat |
---|
[503] | 1877 | end |
---|
| 1878 | |
---|
[713] | 1879 | set(handles.InputFileREFRESH,'BackgroundColor',[1 0 0])% paint back button to red to indicate update is finished |
---|
[674] | 1880 | set(handles.uvmat,'Pointer','arrow')% set back the mouse pointer to arrow |
---|
[387] | 1881 | |
---|
| 1882 | |
---|
| 1883 | %------------------------------------------------------------------------ |
---|
| 1884 | % --- Update information about a new field series (indices to scan, timing, |
---|
[713] | 1885 | % calibration from an xml file, then inputfilerefresh current plots |
---|
[773] | 1886 | function errormsg=update_rootinfo(handles,i1_series,i2_series,j1_series,j2_series,FileInfo,VideoObject,index) |
---|
[387] | 1887 | %------------------------------------------------------------------------ |
---|
[710] | 1888 | errormsg=''; %default error msg |
---|
[784] | 1889 | |
---|
[387] | 1890 | %% define the relevant handles depending on the index (1=first file series, 2= second file series) |
---|
| 1891 | if ~exist('index','var') |
---|
| 1892 | index=1; |
---|
| 1893 | end |
---|
| 1894 | if index==1 |
---|
[526] | 1895 | handles_Fields=handles.FieldName; |
---|
[387] | 1896 | elseif index==2 |
---|
[526] | 1897 | handles_Fields=handles.FieldName_1; |
---|
[387] | 1898 | end |
---|
[784] | 1899 | set(handles.FixVelType,'Value',0); %desactivate fixed veltype by default |
---|
[387] | 1900 | |
---|
[784] | 1901 | %% record info in UserData of the figure uvmat |
---|
[387] | 1902 | UvData=get(handles.uvmat,'UserData');%huvmat=handles of the uvmat interface |
---|
[713] | 1903 | UvData.NewSeries=1; %flag for REFRESH: begin a new series |
---|
[511] | 1904 | UvData.FileName_1='';% name of the current second field (used to detect a constant field during file scanning) |
---|
[773] | 1905 | UvData.FileType{index}=FileInfo.FileType; |
---|
| 1906 | UvData.FileInfo{index}=FileInfo; |
---|
[784] | 1907 | UvData.MovieObject{index}=VideoObject; |
---|
[387] | 1908 | UvData.i1_series{index}=i1_series; |
---|
| 1909 | UvData.i2_series{index}=i2_series; |
---|
| 1910 | UvData.j1_series{index}=j1_series; |
---|
| 1911 | UvData.j2_series{index}=j2_series; |
---|
| 1912 | |
---|
[784] | 1913 | %% read timing and total frame number from the current file (e.g. movie files) |
---|
[674] | 1914 | TimeUnit='';%default |
---|
| 1915 | TimeName='';%default |
---|
[387] | 1916 | XmlData.Time=[];%default |
---|
| 1917 | ColorType='falsecolor'; %default |
---|
[784] | 1918 | if isfield(FileInfo,'FrameRate')% frame rate given in the file (case of video data) |
---|
[387] | 1919 | TimeUnit='s'; |
---|
[494] | 1920 | if isempty(j1_series); %frame index along i |
---|
[784] | 1921 | XmlData.Time=zeros(FileInfo.NumberOfFrames+1,2); |
---|
| 1922 | XmlData.Time(:,2)=(0:1/FileInfo.FrameRate:(FileInfo.NumberOfFrames)/FileInfo.FrameRate)'; |
---|
[494] | 1923 | else |
---|
[784] | 1924 | XmlData.Time=[0;ones(size(i1_series,3)-1,1)]*(0:1/FileInfo.FrameRate:(FileInfo.NumberOfFrames)/FileInfo.FrameRate); |
---|
[494] | 1925 | end |
---|
[784] | 1926 | if strcmp(FileInfo.FileType,'rdvision') |
---|
| 1927 | TimeName='timestamp'; |
---|
| 1928 | else |
---|
[674] | 1929 | TimeName='video'; |
---|
[387] | 1930 | end |
---|
| 1931 | end |
---|
[784] | 1932 | if isfield(FileInfo,'ColorType') |
---|
| 1933 | ColorType=FileInfo.ColorType;%='truecolor' for color images |
---|
[387] | 1934 | end |
---|
| 1935 | set(handles.CheckBW,'Value',strcmp(ColorType,'grayscale'))% select handles.CheckBW if grayscale image |
---|
| 1936 | |
---|
| 1937 | %% read parameters (time, geometric calibration..) from a documentation file (.xml advised) |
---|
[674] | 1938 | XmlData.GeometryCalib=[];%default |
---|
[784] | 1939 | if index==1 |
---|
| 1940 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes(handles); |
---|
| 1941 | else |
---|
| 1942 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes_1(handles); |
---|
| 1943 | end |
---|
[469] | 1944 | XmlFileName=find_imadoc(RootPath,SubDir,RootFile,FileExt); |
---|
| 1945 | [tild,tild,DocExt]=fileparts(XmlFileName); |
---|
[387] | 1946 | warntext='';%default warning message |
---|
| 1947 | NbSlice=1;%default |
---|
[611] | 1948 | ImaDoc_str=''; |
---|
[469] | 1949 | if ~isempty(XmlFileName) |
---|
[387] | 1950 | set(handles.view_xml,'Visible','on') |
---|
[611] | 1951 | set(handles.view_xml,'BackgroundColor',[1 1 0])% paint to yellow color to indicate reading of the xml file |
---|
[387] | 1952 | set(handles.view_xml,'String','view .xml') |
---|
| 1953 | drawnow |
---|
[469] | 1954 | [XmlDataRead,warntext]=imadoc2struct(XmlFileName); |
---|
[688] | 1955 | if ~isempty(warntext) |
---|
| 1956 | msgbox_uvmat('WARNING',warntext) |
---|
| 1957 | end |
---|
[611] | 1958 | if ~isempty(XmlDataRead) |
---|
[688] | 1959 | ImaDoc_str=['view ' DocExt]; % DocExt= '.xml' or .civ (obsolete case) |
---|
| 1960 | if isfield(XmlDataRead,'TimeUnit')&& ~isempty(XmlDataRead.TimeUnit) |
---|
| 1961 | TimeUnit=XmlDataRead.TimeUnit; |
---|
| 1962 | end |
---|
| 1963 | if isfield(XmlDataRead,'Time')&& ~isempty(XmlDataRead.Time) |
---|
| 1964 | XmlData.Time=XmlDataRead.Time; |
---|
| 1965 | end |
---|
[683] | 1966 | set(handles.view_xml,'BackgroundColor',[1 1 1])% paint back to white |
---|
[456] | 1967 | drawnow |
---|
[683] | 1968 | if isfield(XmlDataRead, 'GeometryCalib') && ~isempty(XmlDataRead.GeometryCalib) |
---|
| 1969 | XmlData.GeometryCalib=XmlDataRead.GeometryCalib; |
---|
[745] | 1970 | if isfield(XmlData.GeometryCalib,'CheckVolumeScan') && isequal(XmlData.GeometryCalib.CheckVolumeScan,1) |
---|
[589] | 1971 | set (handles.slices,'String','volume') |
---|
[456] | 1972 | end |
---|
[688] | 1973 | % check whether the GUI geometry_calib is opened |
---|
[456] | 1974 | hgeometry_calib=findobj('tag','geometry_calib'); |
---|
[683] | 1975 | if ~isempty(hgeometry_calib) % check whether the display of the GUI geometry_calib is consistent with the current calib param |
---|
[456] | 1976 | GUserData=get(hgeometry_calib,'UserData'); |
---|
[469] | 1977 | if ~(isfield(GUserData,'XmlInputFile') && strcmp(GUserData.XmlInputFile,XmlFileName)) |
---|
[683] | 1978 | answer=msgbox_uvmat('INPUT_Y-N','refresh the display of the GUI geometry_calib with the new input data?'); |
---|
[456] | 1979 | if strcmp(answer,'Yes') |
---|
[469] | 1980 | geometry_calib(XmlFileName);%diplay the new calibration points and parameters in geometry_calib |
---|
[456] | 1981 | end |
---|
[387] | 1982 | end |
---|
| 1983 | end |
---|
| 1984 | end |
---|
[441] | 1985 | end |
---|
[387] | 1986 | end |
---|
[674] | 1987 | if isempty(ImaDoc_str) |
---|
| 1988 | set(handles.view_xml,'Visible','off') % no .xml (or .civ) file detected |
---|
[648] | 1989 | else |
---|
[674] | 1990 | set(handles.view_xml,'String',ImaDoc_str)% indicate that a xml file has been detected |
---|
[494] | 1991 | end |
---|
[674] | 1992 | |
---|
| 1993 | %% Define timing |
---|
| 1994 | % time not set by the input file: images or civ data: indicate that time is read from the xml file |
---|
[773] | 1995 | FileType=FileInfo.FileType; |
---|
[674] | 1996 | if isfield(XmlData,'Time')&& ~isempty(XmlData.Time) && ... |
---|
[747] | 1997 | (strcmp(FileType,'image')|| strcmp(FileType,'multimage'))%||strcmp(FileType,'civdata')||strcmp(FileType,'civx')) |
---|
[674] | 1998 | TimeName='xml'; |
---|
[675] | 1999 | elseif strcmp(FileType,'civdata') |
---|
| 2000 | TimeName='civdata'; |
---|
| 2001 | elseif strcmp(FileType,'civx') |
---|
| 2002 | TimeName='civx'; |
---|
[674] | 2003 | end |
---|
| 2004 | if index==1 |
---|
| 2005 | set(handles.TimeName,'String',TimeName) |
---|
[611] | 2006 | else |
---|
[674] | 2007 | set(handles.TimeName_1,'String',TimeName) |
---|
| 2008 | set(handles.TimeName_1,'Visible','on') |
---|
[611] | 2009 | end |
---|
[387] | 2010 | |
---|
[648] | 2011 | %% store last index in handles.MaxIndex_i and .MaxIndex_j |
---|
[496] | 2012 | nbfield=max(max(max(i2_series))); |
---|
[387] | 2013 | if isempty(nbfield) |
---|
[496] | 2014 | nbfield=max(max(max(i1_series))); |
---|
[387] | 2015 | end |
---|
[496] | 2016 | nbfield_j=max(max(max(j2_series))); |
---|
[387] | 2017 | if isempty(nbfield_j) |
---|
[552] | 2018 | nbfield_j=max(max(max(j1_series))); |
---|
[387] | 2019 | end |
---|
[674] | 2020 | if isfield(XmlData,'Time')&& ~isempty(XmlData.Time) |
---|
[387] | 2021 | %transform .Time to a column vector if it is a line vector the nomenclature uses a single index |
---|
[441] | 2022 | if isequal(size(XmlData.Time,1),1) |
---|
[456] | 2023 | XmlData.Time=(XmlData.Time)'; |
---|
[387] | 2024 | end |
---|
| 2025 | end |
---|
[648] | 2026 | last_i_cell=get(handles.MaxIndex_i,'String'); |
---|
[387] | 2027 | if isempty(nbfield) |
---|
[552] | 2028 | last_i_cell{index}=''; |
---|
[387] | 2029 | else |
---|
[552] | 2030 | last_i_cell{index}=num2str(nbfield); |
---|
[387] | 2031 | end |
---|
[648] | 2032 | set(handles.MaxIndex_i,'String',last_i_cell) |
---|
| 2033 | last_j_cell=get(handles.MaxIndex_j,'String'); |
---|
[387] | 2034 | if isempty(nbfield_j) |
---|
[552] | 2035 | last_j_cell{index}=''; |
---|
[387] | 2036 | else |
---|
[552] | 2037 | last_j_cell{index}=num2str(nbfield_j); |
---|
[387] | 2038 | end |
---|
[648] | 2039 | set(handles.MaxIndex_j,'String',last_j_cell); |
---|
[387] | 2040 | |
---|
| 2041 | %% store geometric calibration in UvData |
---|
| 2042 | if isfield(XmlData,'GeometryCalib') |
---|
| 2043 | GeometryCalib=XmlData.GeometryCalib; |
---|
| 2044 | if isempty(GeometryCalib) |
---|
[689] | 2045 | set(handles.pxcmx,'String','') |
---|
| 2046 | set(handles.pxcmy,'String','') |
---|
| 2047 | set(handles.pxcmx,'Visible','off') |
---|
| 2048 | set(handles.pxcmy,'Visible','off') |
---|
[591] | 2049 | set(handles.TransformName,'Value',1); % no transform by default |
---|
[387] | 2050 | else |
---|
[689] | 2051 | set(handles.pxcmx,'Visible','on') |
---|
| 2052 | set(handles.pxcmy,'Visible','on') |
---|
[387] | 2053 | if (isfield(GeometryCalib,'R')&& ~isequal(GeometryCalib.R(2,1),0) && ~isequal(GeometryCalib.R(1,2),0)) ||... |
---|
| 2054 | (isfield(GeometryCalib,'kappa1')&& ~isequal(GeometryCalib.kappa1,0)) |
---|
[689] | 2055 | set(handles.pxcmx,'String','var') |
---|
| 2056 | set(handles.pxcmy,'String','var') |
---|
[387] | 2057 | elseif isfield(GeometryCalib,'fx_fy') |
---|
| 2058 | pixcmx=GeometryCalib.fx_fy(1);%*GeometryCalib.R(1,1)*GeometryCalib.sx/(GeometryCalib.Tz*GeometryCalib.dpx); |
---|
| 2059 | pixcmy=GeometryCalib.fx_fy(2);%*GeometryCalib.R(2,2)/(GeometryCalib.Tz*GeometryCalib.dpy); |
---|
[689] | 2060 | set(handles.pxcmx,'String',num2str(pixcmx)) |
---|
| 2061 | set(handles.pxcmy,'String',num2str(pixcmy)) |
---|
[387] | 2062 | end |
---|
| 2063 | if ~get(handles.CheckFixLimits,'Value') |
---|
[591] | 2064 | set(handles.TransformName,'Value',3); % phys transform by default if fixedLimits is off |
---|
[387] | 2065 | end |
---|
[508] | 2066 | if isfield(GeometryCalib,'SliceCoord') |
---|
[387] | 2067 | siz=size(GeometryCalib.SliceCoord); |
---|
| 2068 | if siz(1)>1 |
---|
| 2069 | NbSlice=siz(1); |
---|
| 2070 | set(handles.slices,'Visible','on') |
---|
| 2071 | set(handles.slices,'Value',1) |
---|
| 2072 | end |
---|
[745] | 2073 | if isfield(GeometryCalib,'CheckVolumeScan') && isequal(GeometryCalib.CheckVolumeScan,1) |
---|
[589] | 2074 | set(handles.num_NbSlice,'Visible','off') |
---|
[387] | 2075 | else |
---|
[589] | 2076 | set(handles.num_NbSlice,'Visible','on') |
---|
[497] | 2077 | set(handles.num_NbSlice,'String',num2str(NbSlice)) |
---|
[387] | 2078 | end |
---|
| 2079 | slices_Callback([],[], handles) |
---|
| 2080 | end |
---|
| 2081 | end |
---|
| 2082 | end |
---|
| 2083 | |
---|
| 2084 | %% update the data attached to the uvmat interface |
---|
[675] | 2085 | if ~isempty(TimeUnit) |
---|
| 2086 | if index==2 && isfield(UvData,'TimeUnit') && ~strcmp(UvData.TimeUnit,TimeUnit) |
---|
[688] | 2087 | msgbox_uvmat('WARNING',['time unit for second file series ' TimeUnit ' inconsistent with first series']) |
---|
[675] | 2088 | else |
---|
| 2089 | UvData.TimeUnit=TimeUnit; |
---|
| 2090 | end |
---|
| 2091 | end |
---|
[387] | 2092 | UvData.XmlData{index}=XmlData; |
---|
| 2093 | UvData.NewSeries=1; |
---|
| 2094 | |
---|
| 2095 | %display warning message |
---|
[688] | 2096 | if ~isequal(warntext,'') |
---|
[387] | 2097 | msgbox_uvmat('WARNING',warntext); |
---|
| 2098 | end |
---|
| 2099 | |
---|
[526] | 2100 | %% set default options in menu 'FieldName' |
---|
[517] | 2101 | switch FileType |
---|
| 2102 | case {'civx','civdata'} |
---|
[581] | 2103 | [FieldList,ColorList]=set_field_list('U','V','C'); |
---|
[525] | 2104 | set(handles_Fields,'String',[{'image'};FieldList;{'get_field...'}]);%standard menu for civx data |
---|
| 2105 | set(handles_Fields,'Value',2) % set menu to 'velocity |
---|
[580] | 2106 | if index==1 |
---|
| 2107 | set(handles.FieldName_1,'Value',1); |
---|
| 2108 | set(handles.FieldName_1,'String',[{''};{'image'};FieldList;{'get_field...'}]);%standard menu for civx data reproduced for the second field |
---|
| 2109 | end |
---|
[525] | 2110 | set(handles.ColorScalar,'Value',1) |
---|
| 2111 | set(handles.ColorScalar,'String',ColorList) |
---|
| 2112 | set(handles.Vectors,'Visible','on') |
---|
[747] | 2113 | %set(handles.Coord_x,'Value',1); |
---|
[646] | 2114 | set(handles.Coord_x,'String','X'); |
---|
[747] | 2115 | set(handles.Coord_y,'String','Y'); |
---|
[517] | 2116 | case 'netcdf' |
---|
[387] | 2117 | set(handles_Fields,'Value',1) |
---|
| 2118 | set(handles_Fields,'String',{'get_field...'}) |
---|
[713] | 2119 | if index==1 |
---|
| 2120 | FieldName_Callback([],[], handles) |
---|
| 2121 | else |
---|
| 2122 | FieldName_1_Callback([],[], handles) |
---|
| 2123 | end |
---|
[517] | 2124 | otherwise |
---|
| 2125 | set(handles_Fields,'Value',1) % set menu to 'image' |
---|
| 2126 | set(handles_Fields,'String',{'image'}) |
---|
[747] | 2127 | %set(handles.Coord_x,'Value',1); |
---|
[782] | 2128 | set(handles.Coord_x,'String','Coord_x'); |
---|
| 2129 | set(handles.Coord_y,'String','Coord_y'); |
---|
[387] | 2130 | end |
---|
| 2131 | set(handles.uvmat,'UserData',UvData) |
---|
| 2132 | |
---|
[747] | 2133 | %% set index navigation options |
---|
[387] | 2134 | scan_option='i';%default |
---|
| 2135 | state_j='off'; %default |
---|
| 2136 | if index==2 |
---|
| 2137 | if get(handles.scan_j,'Value') |
---|
[494] | 2138 | scan_option='j'; %keep the scan option for the second file series |
---|
[387] | 2139 | end |
---|
| 2140 | if strcmp(get(handles.j1,'Visible'),'on') |
---|
| 2141 | state_j='on'; |
---|
| 2142 | end |
---|
| 2143 | end |
---|
[515] | 2144 | [ref_j,ref_i]=find(squeeze(i1_series(1,:,:))); |
---|
[387] | 2145 | if ~isempty(j1_series) |
---|
| 2146 | state_j='on'; |
---|
[494] | 2147 | if index==1 |
---|
[515] | 2148 | if isequal(ref_i,ref_i(1)*ones(size(ref_j)))% if ref_i is always equal to its first value |
---|
[494] | 2149 | scan_option='j'; %scan j indext |
---|
| 2150 | end |
---|
| 2151 | end |
---|
[387] | 2152 | end |
---|
| 2153 | if isequal(scan_option,'i') |
---|
[494] | 2154 | diff_ref_i=diff(ref_i,1); |
---|
| 2155 | if isempty(diff_ref_i) |
---|
| 2156 | diff_ref_i=1; |
---|
| 2157 | end |
---|
| 2158 | if isequal (diff_ref_i,diff_ref_i(1)*ones(size(diff_ref_i))) |
---|
[511] | 2159 | set(handles.num_IndexIncrement,'String',num2str(diff_ref_i(1))) |
---|
[494] | 2160 | end |
---|
[387] | 2161 | set(handles.scan_i,'Value',1) |
---|
| 2162 | scan_i_Callback([],[], handles); |
---|
| 2163 | else |
---|
[494] | 2164 | diff_ref_j=diff(ref_j); |
---|
| 2165 | if isempty(diff_ref_j) |
---|
| 2166 | diff_ref_j=1; |
---|
| 2167 | end |
---|
| 2168 | if isequal (diff_ref_j,diff_ref_j(1)*ones(size(diff_ref_j))) |
---|
[511] | 2169 | set(handles.num_IndexIncrement,'String',num2str(diff_ref_j(1))) |
---|
[494] | 2170 | end |
---|
[387] | 2171 | set(handles.scan_j,'Value',1) |
---|
| 2172 | scan_j_Callback([],[], handles); |
---|
| 2173 | end |
---|
| 2174 | set(handles.scan_j,'Visible',state_j) |
---|
| 2175 | set(handles.j1,'Visible',state_j) |
---|
| 2176 | set(handles.j2,'Visible',state_j) |
---|
[648] | 2177 | set(handles.MaxIndex_j,'Visible',state_j); |
---|
[387] | 2178 | set(handles.j_text,'Visible',state_j); |
---|
| 2179 | if ~isempty(i2_series)||~isempty(j2_series) |
---|
| 2180 | set(handles.CheckFixPair,'Visible','on') |
---|
| 2181 | elseif index==1 |
---|
| 2182 | set(handles.CheckFixPair,'Visible','off') |
---|
| 2183 | end |
---|
| 2184 | |
---|
[508] | 2185 | %% apply the effect of the transform fct and view the field |
---|
[591] | 2186 | transform=get(handles.TransformPath,'UserData'); |
---|
[515] | 2187 | if index==2 && (~isa(transform,'function_handle')||nargin(transform)<3) |
---|
[591] | 2188 | set(handles.TransformName,'value',2); % set transform to sub_field if the current fct doe not accept two input fields |
---|
[515] | 2189 | end |
---|
[714] | 2190 | set(handles.InputFileREFRESH,'BackgroundColor',[1 0 0])% set button color to red to indicate that refresh has been updated |
---|
| 2191 | TransformName_Callback([],[],handles)% callback for the selection of transform function, then refresh the current plot |
---|
[387] | 2192 | mask_test=get(handles.CheckMask,'value'); |
---|
| 2193 | if mask_test |
---|
| 2194 | MaskData=get(handles.CheckMask,'UserData'); |
---|
| 2195 | if isfield(MaskData,'maskhandle') && ishandle(MaskData.maskhandle) |
---|
| 2196 | delete(MaskData.maskhandle) %delete old mask |
---|
| 2197 | end |
---|
| 2198 | CheckMask_Callback([],[],handles) |
---|
| 2199 | end |
---|
| 2200 | |
---|
| 2201 | %------------------------------------------------------------------------ |
---|
| 2202 | % --- switch file index scanning options scan_i and scan_j in an exclusive way |
---|
[667] | 2203 | %------------------------------------------------------------------------ |
---|
[387] | 2204 | function scan_i_Callback(hObject, eventdata, handles) |
---|
[667] | 2205 | |
---|
[387] | 2206 | if get(handles.scan_i,'Value')==1 |
---|
| 2207 | set(handles.scan_j,'Value',0) |
---|
| 2208 | else |
---|
| 2209 | set(handles.scan_j,'Value',1) |
---|
| 2210 | end |
---|
| 2211 | scan_j_Callback(hObject, eventdata, handles) |
---|
| 2212 | |
---|
| 2213 | %------------------------------------------------------------------------ |
---|
| 2214 | % --- switch file index scanning options scan_i and scan_j in an exclusive way |
---|
[667] | 2215 | %------------------------------------------------------------------------ |
---|
[387] | 2216 | function scan_j_Callback(hObject, eventdata, handles) |
---|
[667] | 2217 | |
---|
[387] | 2218 | if get(handles.scan_j,'Value')==1 |
---|
| 2219 | set(handles.scan_i,'Value',0) |
---|
| 2220 | else |
---|
| 2221 | set(handles.scan_i,'Value',1) |
---|
| 2222 | set(handles.CheckFixPair,'Visible','off') |
---|
| 2223 | end |
---|
| 2224 | |
---|
| 2225 | %------------------------------------------------------------------------ |
---|
| 2226 | function i1_Callback(hObject, eventdata, handles) |
---|
| 2227 | %------------------------------------------------------------------------ |
---|
[515] | 2228 | update_ij(handles,1) |
---|
[387] | 2229 | |
---|
| 2230 | %------------------------------------------------------------------------ |
---|
| 2231 | function i2_Callback(hObject, eventdata, handles) |
---|
| 2232 | %------------------------------------------------------------------------ |
---|
[515] | 2233 | update_ij(handles,2) |
---|
[387] | 2234 | |
---|
| 2235 | %------------------------------------------------------------------------ |
---|
| 2236 | function j1_Callback(hObject, eventdata, handles) |
---|
| 2237 | %------------------------------------------------------------------------ |
---|
[515] | 2238 | update_ij(handles,3) |
---|
[387] | 2239 | |
---|
| 2240 | %------------------------------------------------------------------------ |
---|
| 2241 | function j2_Callback(hObject, eventdata, handles) |
---|
| 2242 | %------------------------------------------------------------------------ |
---|
[515] | 2243 | update_ij(handles,4) |
---|
[387] | 2244 | |
---|
| 2245 | %------------------------------------------------------------------------ |
---|
[515] | 2246 | %--- update the index display after action on edit boxes i1, i2, j1 or j2 |
---|
[675] | 2247 | %------------------------------------------------------------------------ |
---|
[515] | 2248 | function update_ij(handles,index_rank) |
---|
[675] | 2249 | |
---|
[515] | 2250 | NomType=get(handles.NomType,'String'); |
---|
| 2251 | indices=get(handles.FileIndex,'String'); |
---|
| 2252 | [tild,tild,tild,i1,i2,j1,j2]=fileparts_uvmat(indices);% the indices for the second series taken from FileIndex |
---|
| 2253 | switch index_rank |
---|
| 2254 | case 1 |
---|
| 2255 | indices=fullfile_uvmat('','','','',NomType,stra2num(get(handles.i1,'String')),i2,j1,j2); |
---|
[764] | 2256 | % set(handles.i1,'BackgroundColor',[0.7 0.7 0.7])% mark the edit box in grey, then RUN0 will mark it in white for confirmation |
---|
[515] | 2257 | case 2 |
---|
| 2258 | indices=fullfile_uvmat('','','','',NomType,i1,stra2num(get(handles.i2,'String')),j1,j2); |
---|
[764] | 2259 | % set(handles.i2,'BackgroundColor',[0.7 0.7 0.7])% mark the edit box in grey, then RUN0 will mark it in white for confirmation |
---|
[515] | 2260 | case 3 |
---|
| 2261 | indices=fullfile_uvmat('','','','',NomType,i1,i2,stra2num(get(handles.j1,'String')),j2); |
---|
[764] | 2262 | % set(handles.j1,'BackgroundColor',[0.7 0.7 0.7])% mark the edit box in grey, then RUN0 will mark it in white for confirmation |
---|
[515] | 2263 | case 4 |
---|
| 2264 | indices=fullfile_uvmat('','','','',NomType,i1,i2,j1,stra2num(get(handles.j2,'String'))); |
---|
[764] | 2265 | % set(handles.j2,'BackgroundColor',[0.7 0.7 0.7])% mark the edit box in grey, then RUN0 will mark it in white for confirmation |
---|
[515] | 2266 | end |
---|
| 2267 | set(handles.FileIndex,'String',indices) |
---|
[764] | 2268 | %set(handles.FileIndex,'BackgroundColor',[0.7 0.7 0.7])% mark the edit box in grey, then RUN0 will mark it in white for confirmation |
---|
[515] | 2269 | % update the second index if relevant |
---|
| 2270 | if strcmp(get(handles.FileIndex_1,'Visible'),'on') |
---|
| 2271 | NomType_1=get(handles.NomType_1,'String'); |
---|
| 2272 | indices_1=get(handles.FileIndex_1,'String'); |
---|
| 2273 | [tild,tild,tild,i1_1,i2_1,j1_1,j2_1]=fileparts_uvmat(indices_1);% the indices for the second series taken from FileIndex_1 |
---|
| 2274 | switch index_rank |
---|
| 2275 | case 1 |
---|
| 2276 | indices_1=fullfile_uvmat('','','','',NomType_1,stra2num(get(handles.i1,'String')),i2_1,j1_1,j2_1); |
---|
| 2277 | case 2 |
---|
| 2278 | indices_1=fullfile_uvmat('','','','',NomType_1,i1_1,stra2num(get(handles.i2,'String')),j1_1,j2_1); |
---|
| 2279 | case 3 |
---|
| 2280 | indices_1=fullfile_uvmat('','','','',NomType_1,i1_1,i2_1,stra2num(get(handles.j1,'String')),j2_1); |
---|
| 2281 | case 4 |
---|
| 2282 | indices_1=fullfile_uvmat('','','','',NomType_1,i1_1,i2_1,j1_1,stra2num(get(handles.j2,'String'))); |
---|
| 2283 | end |
---|
| 2284 | set(handles.FileIndex_1,'String',indices_1) |
---|
| 2285 | set(handles.FileIndex_1,'BackgroundColor',[0.7 0.7 0.7])% mark the edit box in grey, then RUN0 will mark it in white for confirmation |
---|
| 2286 | end |
---|
| 2287 | |
---|
| 2288 | %------------------------------------------------------------------------ |
---|
| 2289 | |
---|
| 2290 | %------------------------------------------------------------------------ |
---|
[387] | 2291 | function slices_Callback(hObject, eventdata, handles) |
---|
| 2292 | %------------------------------------------------------------------------ |
---|
[589] | 2293 | if strcmp(get(handles.slices,'String'),'slices') |
---|
| 2294 | if get(handles.slices,'Value')==1 |
---|
| 2295 | set(handles.num_NbSlice,'Visible','on') |
---|
| 2296 | set(handles.z_text,'Visible','on') |
---|
| 2297 | set(handles.z_index,'Visible','on') |
---|
| 2298 | num_NbSlice_Callback(hObject, eventdata, handles) |
---|
| 2299 | else |
---|
| 2300 | set(handles.num_NbSlice,'Visible','off') |
---|
| 2301 | set(handles.z_text,'Visible','off') |
---|
| 2302 | set(handles.z_index,'Visible','off') |
---|
| 2303 | set(handles.masklevel,'Value',1) |
---|
| 2304 | set(handles.masklevel,'String',{'1'}) |
---|
| 2305 | end |
---|
[387] | 2306 | end |
---|
| 2307 | |
---|
| 2308 | %------------------------------------------------------------------------ |
---|
[497] | 2309 | function num_NbSlice_Callback(hObject, eventdata, handles) |
---|
[387] | 2310 | %------------------------------------------------------------------------ |
---|
[589] | 2311 | mode=get(handles.slices,'String'); |
---|
[497] | 2312 | nb_slice_str=get(handles.num_NbSlice,'String'); |
---|
[589] | 2313 | if strcmp(mode,'volume') |
---|
| 2314 | z=stra2num(get(handles.j1,'String')); |
---|
[387] | 2315 | else |
---|
| 2316 | num=str2double(get(handles.i1,'String')); |
---|
[497] | 2317 | nbslice=str2double(get(handles.num_NbSlice,'String')); |
---|
[589] | 2318 | z=mod(num-1,nbslice)+1; |
---|
[387] | 2319 | end |
---|
| 2320 | set(handles.z_index,'String',num2str(z)) |
---|
| 2321 | for ilist=1:nbslice |
---|
| 2322 | list_index{ilist,1}=num2str(ilist); |
---|
| 2323 | end |
---|
| 2324 | set(handles.masklevel,'String',list_index) |
---|
| 2325 | set(handles.masklevel,'Value',z) |
---|
| 2326 | |
---|
| 2327 | %------------------------------------------------------------------------ |
---|
| 2328 | % --- Executes on button press in view_xml. |
---|
[674] | 2329 | %------------------------------------------------------------------------ |
---|
[387] | 2330 | function view_xml_Callback(hObject, eventdata, handles) |
---|
[674] | 2331 | |
---|
| 2332 | % if TimeName defined, open the xml file corresponding to the first file |
---|
| 2333 | % series, else open the xml file corresponding to the second series |
---|
| 2334 | if isempty(get(handles.TimeName,'String'))% open the xml file corresponding to the secodn file series |
---|
| 2335 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes_1(handles); |
---|
| 2336 | else |
---|
| 2337 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes(handles); |
---|
| 2338 | end |
---|
[387] | 2339 | option=get(handles.view_xml,'String'); |
---|
[674] | 2340 | if isequal(option,'view .xml') |
---|
[494] | 2341 | FileXml=fullfile(RootPath,[SubDir '.xml']); |
---|
| 2342 | if ~exist(FileXml,'file')% case of civ files , removes the extension for subdir |
---|
| 2343 | FileXml=fullfile(RootPath,[regexprep(SubDir,'\..+$','') '.xml']); |
---|
| 2344 | end |
---|
[387] | 2345 | heditxml=editxml(FileXml); |
---|
| 2346 | end |
---|
| 2347 | |
---|
| 2348 | %------------------------------------------------------------------------ |
---|
| 2349 | % --- Executes on button press in CheckMask. |
---|
| 2350 | function CheckMask_Callback(hObject, eventdata, handles) |
---|
| 2351 | %------------------------------------------------------------------------ |
---|
| 2352 | %case of view mask selection |
---|
| 2353 | if isequal(get(handles.CheckMask,'Value'),1) |
---|
[641] | 2354 | [RootPath,SubDir]=read_file_boxes(handles); |
---|
| 2355 | MaskSubDir=regexprep(SubDir,'\..*','');%take the root part of SubDir, before the first dot '.' |
---|
| 2356 | MaskPath=fullfile(RootPath,[MaskSubDir '.mask']); |
---|
[387] | 2357 | mdetect=0; |
---|
[641] | 2358 | if exist(MaskPath,'dir') |
---|
| 2359 | ListStruct=dir(MaskPath);%look for a mask file |
---|
| 2360 | ListCells=struct2cell(ListStruct);% transform dir struct to a cell arrray |
---|
| 2361 | check_dir=cell2mat(ListCells(4,:));% =1 for directories, =0 for files |
---|
[667] | 2362 | ListFiles=ListCells(1,:);%list of file and dri names |
---|
| 2363 | ListFiles=ListFiles(~check_dir);%list of file names (excluding dir) |
---|
[641] | 2364 | if ~isempty(ListFiles) |
---|
[675] | 2365 | for ifile=1:numel(ListFiles) |
---|
| 2366 | [tild,tild,MaskExt]=fileparts(ListFiles{1}); |
---|
[783] | 2367 | [tild,tild,MaskFile{ifile},i1_series,i2_series,j1_series,j2_series,MaskNomType,MaskFileInfo]=find_file_series(MaskPath,ListFiles{ifile},0); |
---|
| 2368 | MaskFileType=MaskFileInfo.FileType; |
---|
[675] | 2369 | if strcmp(MaskFileType,'image') && isempty(i2_series) && isempty(j2_series) |
---|
| 2370 | mdetect=1; |
---|
| 2371 | end |
---|
| 2372 | if ~strcmp(MaskFile{ifile},MaskFile{1}) |
---|
| 2373 | mdetect=0;% cancel detection test in case of multiple masks, use the brower for selection |
---|
| 2374 | break |
---|
| 2375 | end |
---|
[387] | 2376 | end |
---|
| 2377 | end |
---|
[675] | 2378 | RootPath=MaskPath; |
---|
[648] | 2379 | end |
---|
| 2380 | if mdetect==0 |
---|
[667] | 2381 | MaskFullName=uigetfile_uvmat('pick a mask image file:',RootPath,'image'); |
---|
[648] | 2382 | if isempty(MaskFullName) |
---|
| 2383 | set(handles.CheckMask,'Value',0) |
---|
[387] | 2384 | end |
---|
[648] | 2385 | [MaskPath,MaskName,MaskExt]=fileparts(MaskFullName); |
---|
[667] | 2386 | [tild,tild,MaskFile,i1_series,i2_series,j1_series,j2_series,MaskNomType]=find_file_series(MaskPath,[MaskName MaskExt],0); |
---|
[648] | 2387 | if ~(isempty(i2_series) && isempty(j2_series)) |
---|
| 2388 | MaskNomType='*'; |
---|
| 2389 | end |
---|
[387] | 2390 | end |
---|
[648] | 2391 | Mask.Path=MaskPath; |
---|
[710] | 2392 | if isempty(MaskFile) |
---|
| 2393 | Mask.File=''; |
---|
[735] | 2394 | elseif ischar(MaskFile) |
---|
| 2395 | Mask.File=MaskFile; |
---|
[710] | 2396 | else |
---|
| 2397 | Mask.File=MaskFile{1}; |
---|
| 2398 | end |
---|
[648] | 2399 | Mask.Ext=MaskExt; |
---|
| 2400 | Mask.NomType=MaskNomType; |
---|
| 2401 | set(handles.CheckMask,'UserData',Mask); |
---|
| 2402 | errormsg=update_mask(handles); |
---|
[387] | 2403 | else % desactivate mask display |
---|
| 2404 | MaskData=get(handles.CheckMask,'UserData'); |
---|
| 2405 | if isfield(MaskData,'maskhandle') && ishandle(MaskData.maskhandle) |
---|
[641] | 2406 | delete(MaskData.maskhandle) |
---|
[387] | 2407 | end |
---|
[641] | 2408 | set(handles.CheckMask,'UserData',[]) |
---|
[387] | 2409 | UvData=get(handles.uvmat,'UserData'); |
---|
| 2410 | if isfield(UvData,'MaskName') |
---|
| 2411 | UvData=rmfield(UvData,'MaskName'); |
---|
| 2412 | set(handles.uvmat,'UserData',UvData) |
---|
| 2413 | end |
---|
| 2414 | set(handles.CheckMask,'BackgroundColor',[0.7 0.7 0.7]) |
---|
| 2415 | end |
---|
| 2416 | |
---|
| 2417 | %------------------------------------------------------------------------ |
---|
[641] | 2418 | function errormsg=update_mask(handles) |
---|
[387] | 2419 | %------------------------------------------------------------------------ |
---|
| 2420 | errormsg=[];%default |
---|
[641] | 2421 | Mask=get(handles.CheckMask,'UserData'); |
---|
| 2422 | MaskIndex=1; |
---|
| 2423 | if strcmp(get(handles.z_index,'Visible'),'on') |
---|
| 2424 | MaskIndex=str2num(get(handles.z_index,'String')); |
---|
[387] | 2425 | end |
---|
[641] | 2426 | if isfield(Mask,'maskhandle')&& ishandle(Mask.maskhandle) |
---|
| 2427 | uistack(Mask.maskhandle,'top'); |
---|
| 2428 | end |
---|
| 2429 | MaskName=fullfile_uvmat(Mask.Path,'',Mask.File,Mask.Ext,Mask.NomType,MaskIndex); |
---|
[387] | 2430 | UvData=get(handles.uvmat,'UserData'); |
---|
[641] | 2431 | |
---|
| 2432 | %% update mask image if the mask is new |
---|
[387] | 2433 | if ~ (isfield(UvData,'MaskName') && isequal(UvData.MaskName,MaskName)) |
---|
| 2434 | UvData.MaskName=MaskName; %update the recorded name on UvData |
---|
| 2435 | set(handles.uvmat,'UserData',UvData); |
---|
| 2436 | if ~exist(MaskName,'file') |
---|
[641] | 2437 | if isfield(Mask,'maskhandle')&& ishandle(Mask.maskhandle) |
---|
| 2438 | delete(Mask.maskhandle) |
---|
[387] | 2439 | end |
---|
| 2440 | else |
---|
| 2441 | %read mask image |
---|
[641] | 2442 | [MaskField,tild,errormsg] = read_field(MaskName,'image'); |
---|
[542] | 2443 | if ~isempty(errormsg) |
---|
| 2444 | return |
---|
| 2445 | end |
---|
[641] | 2446 | npxy=size(MaskField.A); |
---|
[387] | 2447 | if length(npxy)>2 |
---|
| 2448 | errormsg=[MaskName ' is not a grey scale image']; |
---|
| 2449 | return |
---|
[641] | 2450 | elseif ~isa(MaskField.A,'uint8') |
---|
[387] | 2451 | errormsg=[MaskName ' is not a 8 bit grey level image']; |
---|
| 2452 | return |
---|
| 2453 | end |
---|
[641] | 2454 | MaskField.ZIndex=MaskIndex; |
---|
[387] | 2455 | %px to phys or other transform on field |
---|
[591] | 2456 | menu_transform=get(handles.TransformName,'String'); |
---|
| 2457 | choice_value=get(handles.TransformName,'Value'); |
---|
[387] | 2458 | transform_name=menu_transform{choice_value};%name of the transform fct given by the menu 'transform_fct' |
---|
[591] | 2459 | transform=get(handles.TransformPath,'UserData'); |
---|
[387] | 2460 | if ~isequal(transform_name,'') && ~isequal(transform_name,'px') |
---|
| 2461 | if isfield(UvData,'XmlData') && isfield(UvData.XmlData{1},'GeometryCalib')%use geometry calib recorded from the ImaDoc xml file as first priority |
---|
| 2462 | Calib=UvData.XmlData{1}.GeometryCalib; |
---|
[641] | 2463 | MaskField=transform(MaskField,UvData.XmlData{1}); |
---|
[387] | 2464 | end |
---|
| 2465 | end |
---|
[641] | 2466 | flagmask=MaskField.A < 200; |
---|
[387] | 2467 | |
---|
| 2468 | %make brown color image |
---|
| 2469 | imflag(:,:,1)=0.9*flagmask; |
---|
| 2470 | imflag(:,:,2)=0.7*flagmask; |
---|
| 2471 | imflag(:,:,3)=zeros(size(flagmask)); |
---|
| 2472 | |
---|
| 2473 | %update mask image |
---|
| 2474 | hmask=[]; %default |
---|
[641] | 2475 | if isfield(Mask,'maskhandle')&& ishandle(Mask.maskhandle) |
---|
| 2476 | hmask=Mask.maskhandle; |
---|
[387] | 2477 | end |
---|
| 2478 | if ~isempty(hmask) |
---|
| 2479 | set(hmask,'CData',imflag) |
---|
| 2480 | set(hmask,'AlphaData',flagmask*0.6) |
---|
[782] | 2481 | set(hmask,'XData',MaskField.Coord_x); |
---|
| 2482 | set(hmask,'YData',MaskField.Coord_y); |
---|
[387] | 2483 | % uistack(hmask,'top') |
---|
| 2484 | else |
---|
[511] | 2485 | axes(handles.PlotAxes) |
---|
[387] | 2486 | hold on |
---|
[782] | 2487 | Mask.maskhandle=image(MaskField.Coord_x,MaskField.Coord_y,imflag,'Tag','mask','HitTest','off','AlphaData',0.6*ones(size(flagmask))); |
---|
[641] | 2488 | set(handles.CheckMask,'UserData',Mask) |
---|
[387] | 2489 | end |
---|
| 2490 | end |
---|
| 2491 | end |
---|
| 2492 | |
---|
| 2493 | %------------------------------------------------------------------------ |
---|
| 2494 | %------------------------------------------------------------------------ |
---|
[713] | 2495 | % III - MAIN InputFileREFRESH FUNCTIONS : 'FRAME PLOT' |
---|
[387] | 2496 | %------------------------------------------------------------------------ |
---|
| 2497 | |
---|
| 2498 | %------------------------------------------------------------------------ |
---|
| 2499 | % --- Executes on button press in runplus: make one step forward and call |
---|
[713] | 2500 | % --- InputFileREFRESH. The step forward is along the fieldname series 1 or 2 depending on |
---|
[387] | 2501 | % --- the scan_i and scan_j check box (exclusive each other) |
---|
| 2502 | function runplus_Callback(hObject, eventdata, handles) |
---|
| 2503 | %------------------------------------------------------------------------ |
---|
[635] | 2504 | |
---|
[387] | 2505 | set(handles.runplus,'BackgroundColor',[1 1 0])%paint the command button in yellow |
---|
| 2506 | drawnow |
---|
[635] | 2507 | increment=str2double(get(handles.num_IndexIncrement,'String')); %get the field increment d |
---|
| 2508 | if isnan(increment)% case of free increment: move to next available field index |
---|
| 2509 | increment='+'; |
---|
| 2510 | end |
---|
[387] | 2511 | errormsg=runpm(hObject,eventdata,handles,increment); |
---|
| 2512 | if ~isempty(errormsg) |
---|
| 2513 | msgbox_uvmat('ERROR',errormsg); |
---|
| 2514 | end |
---|
| 2515 | |
---|
| 2516 | %------------------------------------------------------------------------ |
---|
| 2517 | % --- Executes on button press in runmin: make one step backward and call |
---|
[713] | 2518 | % --- InputFileREFRESH. The step backward is along the fieldname series 1 or 2 depending on |
---|
[387] | 2519 | % --- the scan_i and scan_j check box (exclusive each other) |
---|
| 2520 | function runmin_Callback(hObject, eventdata, handles) |
---|
| 2521 | %------------------------------------------------------------------------ |
---|
[635] | 2522 | |
---|
[387] | 2523 | set(handles.runmin,'BackgroundColor',[1 1 0])%paint the command button in yellow |
---|
| 2524 | drawnow |
---|
[635] | 2525 | increment=-str2double(get(handles.num_IndexIncrement,'String')); %get the field increment d |
---|
| 2526 | if isnan(increment)% case of free increment: move to previous available field index |
---|
| 2527 | increment='-'; |
---|
| 2528 | end |
---|
[387] | 2529 | errormsg=runpm(hObject,eventdata,handles,increment); |
---|
| 2530 | if ~isempty(errormsg) |
---|
| 2531 | msgbox_uvmat('ERROR',errormsg); |
---|
| 2532 | end |
---|
| 2533 | |
---|
| 2534 | %------------------------------------------------------------------------ |
---|
| 2535 | % -- Executes on button press in Movie: make a series of +> steps |
---|
| 2536 | function Movie_Callback(hObject, eventdata, handles) |
---|
| 2537 | %------------------------------------------------------------------------ |
---|
[635] | 2538 | |
---|
[387] | 2539 | set(handles.Movie,'BackgroundColor',[1 1 0])%paint the command button in yellow |
---|
| 2540 | drawnow |
---|
[635] | 2541 | increment=str2double(get(handles.num_IndexIncrement,'String')); %get the field increment d |
---|
| 2542 | if isnan(increment)% case of free increment: move to next available field index |
---|
| 2543 | increment='+'; |
---|
| 2544 | end |
---|
[387] | 2545 | set(handles.STOP,'Visible','on') |
---|
| 2546 | set(handles.speed,'Visible','on') |
---|
| 2547 | set(handles.speed_txt,'Visible','on') |
---|
| 2548 | set(handles.Movie,'BusyAction','queue') |
---|
| 2549 | UvData=get(handles.uvmat,'UserData'); |
---|
| 2550 | |
---|
[435] | 2551 | while get(handles.Movie,'Value')==1 && get(handles.speed,'Value')~=0 && isequal(get(handles.Movie,'BusyAction'),'queue') % enable STOP command |
---|
[387] | 2552 | errormsg=runpm(hObject,eventdata,handles,increment); |
---|
| 2553 | if ~isempty(errormsg) |
---|
| 2554 | set(handles.Movie,'BackgroundColor',[1 0 0])%paint the command buttonback to red |
---|
| 2555 | return |
---|
| 2556 | end |
---|
| 2557 | pause(1.02-get(handles.speed,'Value'))% wait for next image |
---|
| 2558 | end |
---|
| 2559 | if isfield(UvData,'aviobj') && ~isempty( UvData.aviobj), |
---|
| 2560 | UvData.aviobj=close(UvData.aviobj); |
---|
| 2561 | set(handles.uvmat,'UserData',UvData); |
---|
| 2562 | end |
---|
| 2563 | set(handles.Movie,'BackgroundColor',[1 0 0])%paint the command buttonback to red |
---|
| 2564 | |
---|
| 2565 | %------------------------------------------------------------------------ |
---|
| 2566 | % -- Executes on button press in Movie: make a series of <- steps |
---|
| 2567 | function MovieBackward_Callback(hObject, eventdata, handles) |
---|
| 2568 | %------------------------------------------------------------------------ |
---|
| 2569 | set(handles.MovieBackward,'BackgroundColor',[1 1 0])%paint the command button in yellow |
---|
| 2570 | drawnow |
---|
[635] | 2571 | increment=-str2double(get(handles.num_IndexIncrement,'String')); %get the field increment d |
---|
| 2572 | if isnan(increment)% case of free increment: move to next available field index |
---|
| 2573 | increment='-'; |
---|
| 2574 | end |
---|
[387] | 2575 | set(handles.STOP,'Visible','on') |
---|
| 2576 | set(handles.speed,'Visible','on') |
---|
| 2577 | set(handles.speed_txt,'Visible','on') |
---|
| 2578 | set(handles.MovieBackward,'BusyAction','queue') |
---|
| 2579 | UvData=get(handles.uvmat,'UserData'); |
---|
| 2580 | |
---|
[435] | 2581 | while get(handles.MovieBackward,'Value')==1 && get(handles.speed,'Value')~=0 && isequal(get(handles.MovieBackward,'BusyAction'),'queue') % enable STOP command |
---|
[387] | 2582 | errormsg=runpm(hObject,eventdata,handles,increment); |
---|
| 2583 | if ~isempty(errormsg) |
---|
| 2584 | set(handles.MovieBackward,'BackgroundColor',[1 0 0])%paint the command buttonback to red |
---|
| 2585 | return |
---|
| 2586 | end |
---|
| 2587 | pause(1.02-get(handles.speed,'Value'))% wait for next image |
---|
| 2588 | end |
---|
| 2589 | if isfield(UvData,'aviobj') && ~isempty( UvData.aviobj), |
---|
| 2590 | UvData.aviobj=close(UvData.aviobj); |
---|
| 2591 | set(handles.uvmat,'UserData',UvData); |
---|
| 2592 | end |
---|
| 2593 | set(handles.MovieBackward,'BackgroundColor',[1 0 0])%paint the command buttonback to red |
---|
| 2594 | |
---|
| 2595 | %------------------------------------------------------------------------ |
---|
| 2596 | function STOP_Callback(hObject, eventdata, handles) |
---|
| 2597 | %------------------------------------------------------------------------ |
---|
| 2598 | set(handles.movie_pair,'BusyAction','Cancel') |
---|
| 2599 | set(handles.movie_pair,'value',0) |
---|
| 2600 | set(handles.Movie,'BusyAction','Cancel') |
---|
| 2601 | set(handles.MovieBackward,'BusyAction','Cancel') |
---|
| 2602 | set(handles.MenuExportMovie,'BusyAction','Cancel') |
---|
[675] | 2603 | %set(handles.movie_pair,'BackgroundColor',[1 0 0])%paint the command buttonback to red |
---|
[387] | 2604 | set(handles.Movie,'BackgroundColor',[1 0 0])%paint the command buttonback to red |
---|
| 2605 | set(handles.MovieBackward,'BackgroundColor',[1 0 0])%paint the command buttonback to red |
---|
| 2606 | |
---|
| 2607 | %------------------------------------------------------------------------ |
---|
| 2608 | % --- function activated by runplus and run minus |
---|
| 2609 | function errormsg=runpm(hObject,eventdata,handles,increment) |
---|
| 2610 | %------------------------------------------------------------------------ |
---|
| 2611 | errormsg='';%default |
---|
| 2612 | %% check for movie pair status |
---|
| 2613 | movie_status=get(handles.movie_pair,'Value'); |
---|
[764] | 2614 | if movie_status |
---|
[387] | 2615 | STOP_Callback(hObject, eventdata, handles)%interrupt movie pair if active |
---|
| 2616 | end |
---|
| 2617 | |
---|
| 2618 | %% read the current input file name(s) and field indices |
---|
| 2619 | InputFile=read_GUI(handles.InputFile); |
---|
| 2620 | InputFile.RootFile=regexprep(InputFile.RootFile,'^[\\/]|[\\/]$','');%suppress possible / or \ separator at the beginning or the end of the string |
---|
| 2621 | InputFile.SubDir=regexprep(InputFile.SubDir,'^[\\/]|[\\/]$','');%suppress possible / or \ separator at the beginning or the end of the string |
---|
| 2622 | FileExt=InputFile.FileExt; |
---|
[675] | 2623 | NomType=InputFile.NomType; |
---|
| 2624 | [tild,tild,tild,i1,i2,j1,j2]=fileparts_uvmat(InputFile.FileIndex);% check back the indices used |
---|
[683] | 2625 | if isempty(i1) |
---|
| 2626 | i1=str2num(get(handles.i1,'String'));%read the field indices (for movie, it is not given by the file name) |
---|
| 2627 | elseif isempty(j1) && strcmp(get(handles.j1,'Visible'),'on') |
---|
| 2628 | j1=str2num(get(handles.j1,'String'));%case of indexed movie |
---|
| 2629 | end |
---|
[764] | 2630 | if movie_status% we read the second index from the edit box |
---|
| 2631 | i2=str2num(get(handles.i2,'String'));%read the field indices (for movie, it is not given by the file name) |
---|
| 2632 | if strcmp(get(handles.j2,'Visible'),'on') |
---|
| 2633 | j2=str2num(get(handles.j2,'String'));% |
---|
| 2634 | end |
---|
| 2635 | end |
---|
[387] | 2636 | sub_value= get(handles.SubField,'Value'); |
---|
[683] | 2637 | if sub_value % a second input file has been entered |
---|
| 2638 | [InputFile.RootPath_1,InputFile.SubDir_1,InputFile.RootFile_1,InputFile.FileIndex_1,InputFile.FileExt_1,InputFile.NomType_1]=read_file_boxes_1(handles); |
---|
[515] | 2639 | [tild,tild,tild,i1_1,i2_1,j1_1,j2_1]=fileparts_uvmat(InputFile.FileIndex_1);% the indices for the second series taken from FileIndex_1 |
---|
[683] | 2640 | if isempty(i1_1) |
---|
| 2641 | i1_1=str2num(get(handles.i1,'String'));%read the field indices (for movie, it is not given by the file name) |
---|
| 2642 | elseif isempty(j1_1) && strcmp(get(handles.j1,'Visible'),'on') |
---|
| 2643 | j1_1=str2num(get(handles.j1,'String'));%case of indexed movie |
---|
| 2644 | end |
---|
[387] | 2645 | else |
---|
| 2646 | filename_1=[]; |
---|
[683] | 2647 | end |
---|
[387] | 2648 | |
---|
| 2649 | %% increment (or decrement) the field indices and update the input filename(s) |
---|
[635] | 2650 | if ~isnumeric(increment)% undefined increment value |
---|
[387] | 2651 | set(handles.CheckFixPair,'Value',0) |
---|
| 2652 | end |
---|
| 2653 | CheckFixPair=get(handles.CheckFixPair,'Value')||(isempty(i2)&&isempty(j2)); |
---|
[427] | 2654 | |
---|
| 2655 | % the pair i1-i2 or j1-j2 is imposed (check box CheckFixPair selected) |
---|
[635] | 2656 | if CheckFixPair && isnumeric(increment) |
---|
[387] | 2657 | if get(handles.scan_i,'Value')==1% case of scanning along index i |
---|
| 2658 | i1=i1+increment; |
---|
| 2659 | i2=i2+increment; |
---|
| 2660 | if sub_value |
---|
| 2661 | i1_1=i1_1+increment; |
---|
| 2662 | i2_1=i2_1+increment; |
---|
[675] | 2663 | end |
---|
[387] | 2664 | else % case of scanning along index j (burst numbers) |
---|
| 2665 | j1=j1+increment; |
---|
| 2666 | j2=j2+increment; |
---|
| 2667 | if sub_value |
---|
| 2668 | j1_1=j1_1+increment; |
---|
| 2669 | j2_1=j2_1+increment; |
---|
| 2670 | end |
---|
| 2671 | end |
---|
[427] | 2672 | |
---|
[764] | 2673 | % the pair i1-i2 or j1-j2 is free (check box CheckFixPair not selected): the list of existing indices recorded in UvData is used |
---|
[387] | 2674 | else |
---|
| 2675 | UvData=get(handles.uvmat,'UserData'); |
---|
| 2676 | ref_i=i1; |
---|
| 2677 | if ~isempty(i2) |
---|
[427] | 2678 | ref_i=floor((i1+i2)/2);% current reference index i |
---|
[387] | 2679 | end |
---|
| 2680 | ref_j=1; |
---|
| 2681 | if ~isempty(j1) |
---|
| 2682 | ref_j=j1; |
---|
| 2683 | if ~isempty(j2) |
---|
[427] | 2684 | ref_j=floor((j1+j2)/2);% current reference index j |
---|
[387] | 2685 | end |
---|
| 2686 | end |
---|
[635] | 2687 | if isnumeric(increment) |
---|
[387] | 2688 | if get(handles.scan_i,'Value')==1% case of scanning along index i |
---|
[427] | 2689 | ref_i=ref_i+increment;% increment the current reference index i |
---|
[387] | 2690 | else % case of scanning along index j (burst numbers) |
---|
[427] | 2691 | ref_j=ref_j+increment;% increment the current reference index j if scan_j option is used |
---|
[387] | 2692 | end |
---|
[388] | 2693 | else % free increment |
---|
[747] | 2694 | % runaction=get(gcbo,'tag'); |
---|
[635] | 2695 | if strcmp(increment,'+')% if runplus or movie is activated |
---|
[387] | 2696 | step=1; |
---|
| 2697 | else |
---|
| 2698 | step=-1; |
---|
| 2699 | end |
---|
| 2700 | if get(handles.scan_i,'Value')==1% case of scanning along index i |
---|
| 2701 | ref_i=ref_i+step; |
---|
[512] | 2702 | while ref_i>=0 && size(UvData.i1_series{1},3)>=ref_i+1 && UvData.i1_series{1}(1,ref_j+1,ref_i+1)==0 |
---|
[387] | 2703 | ref_i=ref_i+step; |
---|
| 2704 | end |
---|
| 2705 | else % case of scanning along index j (burst numbers) |
---|
| 2706 | ref_j=ref_j+step; |
---|
[512] | 2707 | while ref_j>=0 && size(UvData.i1_series{1},2)>=ref_j+1 && UvData.i1_series{1}(1,ref_j+1,ref_i+1)==0 |
---|
[387] | 2708 | ref_j=ref_j+step; |
---|
| 2709 | end |
---|
| 2710 | end |
---|
| 2711 | end |
---|
| 2712 | if ref_i<0 |
---|
| 2713 | errormsg='minimum i index reached'; |
---|
| 2714 | elseif ref_j<0 |
---|
| 2715 | errormsg='minimum j index reached'; |
---|
[512] | 2716 | elseif ref_i+1>size(UvData.i1_series{1},3) |
---|
[511] | 2717 | errormsg='maximum i index reached (reload the input file to update the index bound)'; |
---|
[387] | 2718 | elseif ref_j+1>size(UvData.i1_series{1},2) |
---|
[511] | 2719 | errormsg='maximum j index reached (reload the input file to update the index bound)'; |
---|
[387] | 2720 | end |
---|
[511] | 2721 | if ~isempty(errormsg),return,end |
---|
[512] | 2722 | siz=size(UvData.i1_series{1}); |
---|
[515] | 2723 | ref_indices=ref_i*siz(1)*siz(2)+ref_j*siz(1)+1:ref_i*siz(1)*siz(2)+(ref_j+1)*siz(1); |
---|
[512] | 2724 | i1_subseries=UvData.i1_series{1}(ref_indices); |
---|
| 2725 | ref_indices=ref_indices(i1_subseries>0); |
---|
| 2726 | if isempty(ref_indices)% case of pairs (free index i) |
---|
[515] | 2727 | ref_indices=ref_i*siz(1)*siz(2)+1:(ref_i+1)*siz(1)*siz(2); |
---|
[512] | 2728 | i1_subseries=UvData.i1_series{1}(ref_indices); |
---|
| 2729 | ref_indices=ref_indices(i1_subseries>0); |
---|
[511] | 2730 | end |
---|
[512] | 2731 | if isempty(ref_indices),errormsg='no next frame: set num_IndexIncrement =''*'' to reach the next existing file';return |
---|
[387] | 2732 | end |
---|
[512] | 2733 | i1=UvData.i1_series{1}(ref_indices(end)); |
---|
[387] | 2734 | if ~isempty(UvData.i2_series{1}) |
---|
[512] | 2735 | i2=UvData.i2_series{1}(ref_indices(end)); |
---|
[387] | 2736 | end |
---|
| 2737 | if ~isempty(UvData.j1_series{1}) |
---|
[512] | 2738 | j1=UvData.j1_series{1}(ref_indices(end)); |
---|
[387] | 2739 | end |
---|
| 2740 | if ~isempty(UvData.j2_series{1}) |
---|
[512] | 2741 | j2=UvData.j2_series{1}(ref_indices(end)); |
---|
[515] | 2742 | end |
---|
| 2743 | |
---|
[675] | 2744 | % case of a second file series |
---|
[515] | 2745 | if sub_value |
---|
| 2746 | ref_i_1=i1_1; |
---|
| 2747 | if ~isempty(i2_1) |
---|
| 2748 | ref_i_1=floor((i1_1+i2_1)/2);% current reference index i |
---|
| 2749 | end |
---|
| 2750 | ref_j_1=1; |
---|
| 2751 | if ~isempty(j1_1) |
---|
| 2752 | ref_j_1=j1_1; |
---|
| 2753 | if ~isempty(j2_1) |
---|
| 2754 | ref_j_1=floor((j1_1+j2_1)/2);% current reference index j |
---|
| 2755 | end |
---|
| 2756 | end |
---|
[635] | 2757 | if isnumeric(increment) |
---|
[515] | 2758 | if get(handles.scan_i,'Value')==1% case of scanning along index i |
---|
| 2759 | ref_i_1=ref_i_1+increment;% increment the current reference index i |
---|
| 2760 | else % case of scanning along index j (burst numbers) |
---|
| 2761 | ref_j_1=ref_j_1+increment;% increment the current reference index j if scan_j option is used |
---|
| 2762 | end |
---|
| 2763 | else % free increment, synchronise the ref indices with the first series |
---|
| 2764 | ref_i_1=ref_i; |
---|
[675] | 2765 | ref_j_1=ref_j; |
---|
[515] | 2766 | end |
---|
| 2767 | if numel(UvData.i1_series)==1 |
---|
| 2768 | UvData.i1_series{2}=UvData.i1_series{1}; |
---|
| 2769 | UvData.j1_series{2}=UvData.j1_series{1}; |
---|
| 2770 | UvData.i2_series{2}=UvData.i2_series{1}; |
---|
| 2771 | UvData.j2_series{2}=UvData.j2_series{1}; |
---|
| 2772 | end |
---|
| 2773 | if ref_i_1<0 |
---|
| 2774 | errormsg='minimum i index reached'; |
---|
| 2775 | elseif ref_j_1<0 |
---|
| 2776 | errormsg='minimum j index reached'; |
---|
| 2777 | elseif ref_i_1+1>size(UvData.i1_series{2},3) |
---|
| 2778 | errormsg='maximum i index reached for the second series (reload the input file to update the index bound)'; |
---|
| 2779 | elseif ref_j_1+1>size(UvData.i1_series{2},2) |
---|
| 2780 | errormsg='maximum j index reached for the second series(reload the input file to update the index bound)'; |
---|
| 2781 | end |
---|
| 2782 | if ~isempty(errormsg),return,end |
---|
| 2783 | siz=size(UvData.i1_series{2}); |
---|
| 2784 | ref_indices=ref_i_1*siz(1)*siz(2)+ref_j_1*siz(1)+1:ref_i_1*siz(1)*siz(2)+(ref_j_1+1)*siz(1); |
---|
| 2785 | i1_subseries=UvData.i1_series{2}(ref_indices); |
---|
| 2786 | ref_indices=ref_indices(i1_subseries>0); |
---|
| 2787 | if isempty(ref_indices)% case of pairs (free index i) |
---|
| 2788 | ref_indices=ref_i_1*siz(1)*siz(2)+1:(ref_i_1+1)*siz(1)*siz(2); |
---|
| 2789 | i1_subseries=UvData.i1_series{2}(ref_indices); |
---|
| 2790 | ref_indices=ref_indices(i1_subseries>0); |
---|
| 2791 | end |
---|
| 2792 | i1_1=UvData.i1_series{2}(ref_indices(end)); |
---|
[427] | 2793 | if ~isempty(UvData.i2_series{2}) |
---|
[515] | 2794 | i2_1=UvData.i2_series{2}(ref_indices(end)); |
---|
[427] | 2795 | end |
---|
| 2796 | if ~isempty(UvData.j1_series{2}) |
---|
[515] | 2797 | j1_1=UvData.j1_series{2}(ref_indices(end)); |
---|
[427] | 2798 | end |
---|
| 2799 | if ~isempty(UvData.j2_series{2}) |
---|
[515] | 2800 | j2_1=UvData.j2_series{1}(ref_indices(end)); |
---|
[675] | 2801 | end |
---|
[515] | 2802 | else% the second series (if needed) is the same file as the first |
---|
| 2803 | i1_1=i1; |
---|
| 2804 | i2_1=i2; |
---|
| 2805 | j1_1=j1; |
---|
| 2806 | j2_1=j2; |
---|
[387] | 2807 | end |
---|
| 2808 | end |
---|
| 2809 | filename=fullfile_uvmat(InputFile.RootPath,InputFile.SubDir,InputFile.RootFile,FileExt,NomType,i1,i2,j1,j2); |
---|
[675] | 2810 | |
---|
[747] | 2811 | %% refresh plots |
---|
[387] | 2812 | if sub_value |
---|
[428] | 2813 | filename_1=fullfile_uvmat(InputFile.RootPath_1,InputFile.SubDir_1,InputFile.RootFile_1,InputFile.FileExt_1,InputFile.NomType_1,i1_1,i2_1,j1_1,j2_1); |
---|
[675] | 2814 | errormsg=refresh_field(handles,filename,filename_1,i1,i2,j1,j2,i1_1,i2_1,j1_1,j2_1); |
---|
| 2815 | else |
---|
| 2816 | errormsg=refresh_field(handles,filename,filename_1,i1,i2,j1,j2); |
---|
[387] | 2817 | end |
---|
[713] | 2818 | set(handles.InputFileREFRESH,'BackgroundColor',[1 0 0]) |
---|
[764] | 2819 | set(handles.runplus,'BackgroundColor',[1 0 0]) |
---|
| 2820 | set(handles.runmin,'BackgroundColor',[1 0 0]) |
---|
[387] | 2821 | |
---|
| 2822 | %% update the index counters if the index move is successfull |
---|
[764] | 2823 | |
---|
[387] | 2824 | if isempty(errormsg) |
---|
| 2825 | set(handles.i1,'String',num2stra(i1,NomType,1)); |
---|
| 2826 | if isequal(i2,i1) |
---|
| 2827 | set(handles.i2,'String',''); |
---|
| 2828 | else |
---|
| 2829 | set(handles.i2,'String',num2stra(i2,NomType,1)); |
---|
| 2830 | end |
---|
| 2831 | set(handles.j1,'String',num2stra(j1,NomType,2)); |
---|
| 2832 | if isequal(j2,j1) |
---|
| 2833 | set(handles.j2,'String',''); |
---|
| 2834 | else |
---|
| 2835 | set(handles.j2,'String',num2stra(j2,NomType,2)); |
---|
| 2836 | end |
---|
| 2837 | indices=fullfile_uvmat('','','','',NomType,i1,i2,j1,j2); |
---|
| 2838 | set(handles.FileIndex,'String',indices); |
---|
| 2839 | if ~isempty(filename_1) |
---|
[428] | 2840 | indices_1=fullfile_uvmat('','','','',InputFile.NomType_1,i1_1,i2_1,j1_1,j2_1); |
---|
[387] | 2841 | set(handles.FileIndex_1,'String',indices_1); |
---|
| 2842 | end |
---|
| 2843 | if isequal(movie_status,1) |
---|
| 2844 | set(handles.movie_pair,'Value',1) |
---|
| 2845 | movie_pair_Callback(hObject, eventdata, handles); %reactivate moviepair if it was activated |
---|
[675] | 2846 | else |
---|
| 2847 | if isempty(i2), set(handles.i2,'String',''); end % suppress the second index display if not used |
---|
| 2848 | if isempty(j2), set(handles.j2,'String',''); end |
---|
[387] | 2849 | end |
---|
| 2850 | end |
---|
| 2851 | |
---|
| 2852 | %------------------------------------------------------------------------ |
---|
| 2853 | % --- Executes on button press in movie_pair: create an alternating movie with two view |
---|
| 2854 | function movie_pair_Callback(hObject, eventdata, handles) |
---|
| 2855 | %------------------------------------------------------------------------ |
---|
[622] | 2856 | |
---|
[387] | 2857 | %% stop movie action if the movie_pair button is off |
---|
| 2858 | if ~get(handles.movie_pair,'value') |
---|
| 2859 | set(handles.movie_pair,'BusyAction','Cancel')%stop movie pair if button is 'off' |
---|
[764] | 2860 | set(handles.i2,'String','')% the second i index display is suppressed |
---|
| 2861 | set(handles.j2,'String','')% the second j index display is suppressed |
---|
| 2862 | set(handles.Dt_txt,'String','')% the time interval indication is suppressed |
---|
[387] | 2863 | return |
---|
| 2864 | end |
---|
[764] | 2865 | |
---|
| 2866 | %% check the input file indexing: |
---|
| 2867 | [RootPath,SubDir,RootFile,FileIndex,FileExt]=read_file_boxes(handles); |
---|
| 2868 | NomType=get(handles.NomType,'String'); |
---|
| 2869 | if ~isempty(find(regexp(NomType,'-'))) |
---|
| 2870 | msgbox_uvmat('ERROR','The movie pair requires file series with a single index on the first input line') |
---|
| 2871 | return |
---|
| 2872 | end |
---|
| 2873 | filename=[fullfile(RootPath,SubDir,RootFile) FileIndex FileExt];% build the input file name (first line) |
---|
[387] | 2874 | |
---|
[764] | 2875 | set(handles.movie_pair,'BusyAction','queue')% |
---|
| 2876 | set(handles.CheckFixPair,'Value',1)% impose fixed pair (needed for function runpm) |
---|
| 2877 | set(handles.REFRESH,'BackgroundColor',[1 1 0])%paint the command button in yellow to indicate its activity |
---|
| 2878 | set(handles.movie_pair,'BackgroundColor',[1 1 0])%paint the command button in yellow to indicate its activity |
---|
[387] | 2879 | drawnow |
---|
[764] | 2880 | % list_fields=get(handles.FieldName,'String');% list menu fields |
---|
| 2881 | % index_fields=get(handles.FieldName,'Value');% selected string index |
---|
| 2882 | % FieldName=list_fields{index_fields}; % selected field |
---|
| 2883 | |
---|
| 2884 | |
---|
| 2885 | % if isequal(FieldName,'image') |
---|
| 2886 | % index=1; |
---|
| 2887 | |
---|
| 2888 | % else |
---|
| 2889 | % list_fields=get(handles.FieldName_1,'String');% list menu fields |
---|
| 2890 | % index_fields=get(handles.FieldName_1,'Value');% selected string index |
---|
| 2891 | % FieldName=list_fields{index_fields}; % selected field |
---|
| 2892 | % if isequal(FieldName,'image') |
---|
| 2893 | % index=2; |
---|
| 2894 | % [RootPath,SubDir,RootFile,FileIndex_1,Ext,NomType]=read_file_boxes_1(handles);% get info from the second input line |
---|
| 2895 | % else |
---|
| 2896 | % msgbox_uvmat('ERROR','an image or movie must be first introduced as input') |
---|
| 2897 | % set(handles.movie_pair,'BackgroundColor',[1 0 0])%paint the command button in red |
---|
| 2898 | % set(handles.movie_pair,'Value',0) |
---|
| 2899 | % return |
---|
| 2900 | % end |
---|
| 2901 | % end |
---|
[387] | 2902 | num_i1=str2num(get(handles.i1,'String')); |
---|
| 2903 | num_j1=stra2num(get(handles.j1,'String')); |
---|
| 2904 | num_i2=str2num(get(handles.i2,'String')); |
---|
| 2905 | num_j2=stra2num(get(handles.j2,'String')); |
---|
[764] | 2906 | |
---|
| 2907 | %% determine the name 'imaname_1' of the second file in the pair |
---|
[582] | 2908 | imaname_1=''; |
---|
[764] | 2909 | if isempty(num_j2)% no second j index indicated |
---|
[582] | 2910 | if isempty(num_i2) |
---|
| 2911 | if strcmp(get(handles.j2,'Visible'),'on') %if the j box is visible |
---|
[764] | 2912 | imaname_1=fullfile_uvmat(RootPath,SubDir,RootFile,FileExt,NomType,num_i1,[],num_j1+1); |
---|
[582] | 2913 | end |
---|
| 2914 | if exist(imaname_1,'file') |
---|
[598] | 2915 | num_j2=num_j1+1;% look by default for the next j index as the second file |
---|
| 2916 | set(handles.j2,'String',num2stra(num_j2,NomType)); |
---|
[582] | 2917 | else |
---|
[764] | 2918 | imaname_1=fullfile_uvmat(RootPath,SubDir,RootFile,FileExt,NomType,num_i1+1,[],num_j1); |
---|
[582] | 2919 | if exist(imaname_1,'file') |
---|
| 2920 | num_i2=num_i1+1; |
---|
| 2921 | set(handles.i2,'String',num2str(num_i2)); |
---|
| 2922 | else |
---|
| 2923 | msgbox_uvmat('ERROR', 'a second image index i2 or j2 is needed to show the pair as a movie') |
---|
| 2924 | set(handles.movie_pair,'BackgroundColor',[1 0 0])%paint the command button in red |
---|
| 2925 | set(handles.movie_pair,'Value',0) |
---|
| 2926 | return |
---|
| 2927 | end |
---|
| 2928 | end |
---|
[387] | 2929 | else |
---|
| 2930 | num_j2=num_j1;%repeat the index i1 by default |
---|
| 2931 | end |
---|
| 2932 | end |
---|
| 2933 | if isempty(num_i2) |
---|
| 2934 | num_i2=num_i1;%repeat the index i1 by default |
---|
| 2935 | end |
---|
[709] | 2936 | if isempty(num_j1) |
---|
| 2937 | num_j1=1; |
---|
| 2938 | end |
---|
| 2939 | if isempty(num_j2) |
---|
| 2940 | num_j2=num_j1;%repeat the index i1 by default |
---|
| 2941 | end |
---|
[764] | 2942 | imaname_1=fullfile_uvmat(RootPath,SubDir,RootFile,FileExt,NomType,num_i2,[],num_j2); |
---|
[512] | 2943 | if strcmp(NomType,'*') |
---|
| 2944 | num_frame=num_i2; |
---|
| 2945 | else |
---|
| 2946 | num_frame=num_j2; |
---|
| 2947 | end |
---|
[387] | 2948 | if ~exist(imaname_1,'file') |
---|
| 2949 | msgbox_uvmat('ERROR',['second input open (-) ' imaname_1 ' not found']); |
---|
| 2950 | set(handles.movie_pair,'BackgroundColor',[1 0 0])%paint the command button in red |
---|
| 2951 | set(handles.movie_pair,'Value',0) |
---|
| 2952 | return |
---|
| 2953 | end |
---|
| 2954 | |
---|
[764] | 2955 | %% display the first field in the pair (including possibly a background field from second line input filename_1) |
---|
| 2956 | filename_1='';%default |
---|
| 2957 | FileIndex_1=''; |
---|
| 2958 | if get(handles.SubField,'Value') |
---|
| 2959 | [RootPath_1,SubDir_1,RootFile_1,FileIndex_1,FileExt_1]=read_file_boxes_1(handles); |
---|
| 2960 | filename_1=[fullfile(RootPath_1,SubDir_1,RootFile_1) FileIndex_1 FileExt_1]; |
---|
| 2961 | end |
---|
| 2962 | % num_i1=stra2num(get(handles.i1,'String')); |
---|
| 2963 | % num_i2=stra2num(get(handles.i2,'String')); |
---|
| 2964 | % num_j1=stra2num(get(handles.j1,'String')); |
---|
| 2965 | % num_j2=stra2num(get(handles.j2,'String')); |
---|
| 2966 | [tild,tild,tild,i1_1,i2_1,j1_1,j2_1]=fileparts_uvmat(FileIndex_1);% get the indices of the second series from the string FileIndex_1 |
---|
| 2967 | if isempty(j1_1)% case of movies, the index is not given by file index |
---|
| 2968 | j1_1=num_j1; |
---|
| 2969 | end |
---|
| 2970 | |
---|
| 2971 | errormsg=refresh_field(handles,filename,filename_1,num_i1,num_i2,num_j1,num_j2,i1_1,i2_1,j1_1,j2_1); |
---|
| 2972 | |
---|
| 2973 | if isempty(errormsg) |
---|
| 2974 | set(handles.REFRESH,'BackgroundColor',[1 0 0])% set button color to red, update successfull |
---|
| 2975 | else |
---|
| 2976 | msgbox_uvmat('ERROR',errormsg); |
---|
| 2977 | set(handles.REFRESH,'BackgroundColor',[1 0 1])% keep button color magenta, input not succesfull |
---|
| 2978 | end |
---|
| 2979 | UvData=get(handles.uvmat,'UserData'); |
---|
| 2980 | Field_a=UvData.Field;% movie on the field defined by the second input line |
---|
| 2981 | |
---|
[675] | 2982 | %% display time interval for the image pair |
---|
[684] | 2983 | if isfield(UvData,'XmlData')&&isfield(UvData.XmlData{1},'Time')... |
---|
| 2984 | && size(UvData.XmlData{1}.Time,1)>=num_i2+1 && size(UvData.XmlData{1}.Time,2)>=num_j2+1 |
---|
[675] | 2985 | dt=(UvData.XmlData{1}.Time(num_i2+1,num_j2+1)-UvData.XmlData{1}.Time(num_i1+1,num_j1+1)); |
---|
| 2986 | if isfield(UvData,'TimeUnit') |
---|
| 2987 | set(handles.Dt_txt,'String',['Dt=' num2str(1000*dt,3) ' m' UvData.TimeUnit] ) |
---|
| 2988 | else |
---|
| 2989 | set(handles.Dt_txt,'String',['Dt=' num2str(1000*dt,3) ' 10^(-3)'] ) |
---|
| 2990 | end |
---|
| 2991 | else |
---|
| 2992 | set(handles.Dt_txt,'String','') |
---|
| 2993 | end |
---|
| 2994 | |
---|
[764] | 2995 | %% read the second field |
---|
| 2996 | if isempty(UvData.MovieObject) |
---|
| 2997 | [Field_b,ParamOut,errormsg] = read_field(imaname_1,UvData.FileType{index},[],num_frame); |
---|
[387] | 2998 | else |
---|
[764] | 2999 | [Field_b,ParamOut,errormsg] = read_field(imaname_1,UvData.FileType{1},UvData.MovieObject{1},num_frame); |
---|
[387] | 3000 | end |
---|
[764] | 3001 | if ~isempty(errormsg) |
---|
| 3002 | msgbox_uvmat('ERROR',['Error in reading second image: ' errormsg]) |
---|
| 3003 | return |
---|
[387] | 3004 | end |
---|
| 3005 | |
---|
[764] | 3006 | %% apply phys or other transform on the two input fields |
---|
[591] | 3007 | transform=get(handles.TransformPath,'UserData'); |
---|
[512] | 3008 | if ~isempty(transform) |
---|
[764] | 3009 | if isfield(UvData,'XmlData') && ~isempty(UvData.XmlData) %use geometry calib recorded from the ImaDoc xml file as first priority |
---|
[701] | 3010 | if nargin(transform)>=2 |
---|
[764] | 3011 | Field_b=transform(Field_b,UvData.XmlData{1}); |
---|
[701] | 3012 | else |
---|
[764] | 3013 | Field_b=transform(Field_b); |
---|
[701] | 3014 | end |
---|
[387] | 3015 | end |
---|
| 3016 | end |
---|
| 3017 | |
---|
[764] | 3018 | %% make movie until movie speed is set to 0 or STOP is activated |
---|
[511] | 3019 | hima=findobj(handles.PlotAxes,'Tag','ima');% %handles.PlotAxes =main plotting window (A GENERALISER) |
---|
[387] | 3020 | set(handles.STOP,'Visible','on') |
---|
| 3021 | set(handles.speed,'Visible','on') |
---|
| 3022 | set(handles.speed_txt,'Visible','on') |
---|
[710] | 3023 | while get(handles.speed,'Value')~=0 && isequal(get(handles.movie_pair,'BusyAction'),'queue') % enable STOP command |
---|
[387] | 3024 | % read and plot the series of images in non erase mode |
---|
[764] | 3025 | set(hima,'CData',Field_b.A); %TODO: generalise to other kinds of fields |
---|
[387] | 3026 | pause(1.02-get(handles.speed,'Value'));% wait for next image |
---|
| 3027 | set(hima,'CData',Field_a.A); |
---|
| 3028 | pause(1.02-get(handles.speed,'Value'));% wait for next image |
---|
| 3029 | end |
---|
| 3030 | set(handles.movie_pair,'BackgroundColor',[1 0 0])%paint the command button in red |
---|
[675] | 3031 | set(handles.movie_pair,'Value',0) |
---|
| 3032 | set(handles.Dt_txt,'String','') |
---|
[387] | 3033 | |
---|
| 3034 | %------------------------------------------------------------------------ |
---|
[713] | 3035 | % --- Executes on button press in InputFileREFRESH. |
---|
| 3036 | function REFRESH_Callback(hObject, eventdata, handles) |
---|
[387] | 3037 | %------------------------------------------------------------------------ |
---|
[764] | 3038 | set(handles.REFRESH,'BackgroundColor',[1 1 0])%paint the REFRESH button in yellow to indicate its activity |
---|
[387] | 3039 | drawnow |
---|
[764] | 3040 | [RootPath,SubDir,RootFile,FileIndex,FileExt]=read_file_boxes(handles);%read the features of the input file name (first line) |
---|
[675] | 3041 | [tild,tild,tild,i1,i2,j1,j2]=fileparts_uvmat(FileIndex);% check back the indices used |
---|
[764] | 3042 | if isempty(i2), set(handles.i2,'String',''); end % suppress the second i index display if not used |
---|
| 3043 | if isempty(j2), set(handles.j2,'String',''); end % suppress the second j index display if not used |
---|
| 3044 | filename=[fullfile(RootPath,SubDir,RootFile) FileIndex FileExt];% build the input file name (first line) |
---|
| 3045 | filename_1='';%default second file name |
---|
[515] | 3046 | FileIndex_1=''; |
---|
[764] | 3047 | if get(handles.SubField,'Value')% if a second file is introduced |
---|
| 3048 | [RootPath_1,SubDir_1,RootFile_1,FileIndex_1,FileExt_1]=read_file_boxes_1(handles);%read the features of the input file name (second line) |
---|
| 3049 | filename_1=[fullfile(RootPath_1,SubDir_1,RootFile_1) FileIndex_1 FileExt_1]; %build the input file name (second line) |
---|
[387] | 3050 | end |
---|
| 3051 | num_i1=stra2num(get(handles.i1,'String')); |
---|
| 3052 | num_i2=stra2num(get(handles.i2,'String')); |
---|
| 3053 | num_j1=stra2num(get(handles.j1,'String')); |
---|
| 3054 | num_j2=stra2num(get(handles.j2,'String')); |
---|
[609] | 3055 | [tild,tild,tild,i1_1,i2_1,j1_1,j2_1]=fileparts_uvmat(FileIndex_1);% get the indices of the second series from the string FileIndex_1 |
---|
| 3056 | if isempty(j1_1)% case of movies, the index is not given by file index |
---|
| 3057 | j1_1=num_j1; |
---|
| 3058 | end |
---|
[764] | 3059 | % in case of movies the index is set by edit boxes i1 or j1 (case of movies indexed by index i) |
---|
[515] | 3060 | errormsg=refresh_field(handles,filename,filename_1,num_i1,num_i2,num_j1,num_j2,i1_1,i2_1,j1_1,j2_1); |
---|
[781] | 3061 | ResizeFcn(handles.uvmat,[],handles) |
---|
[764] | 3062 | if isempty(errormsg) |
---|
| 3063 | set(handles.REFRESH,'BackgroundColor',[1 0 0])% set button color to red, update successfull |
---|
[387] | 3064 | else |
---|
[764] | 3065 | msgbox_uvmat('ERROR',errormsg); |
---|
| 3066 | set(handles.REFRESH,'BackgroundColor',[1 0 1])% keep button color magenta, input not succesfull |
---|
| 3067 | end |
---|
[387] | 3068 | |
---|
| 3069 | %------------------------------------------------------------------------ |
---|
[713] | 3070 | % --- read the input files and inputfilerefresh all the plots, including projection. |
---|
[387] | 3071 | % OUTPUT: |
---|
| 3072 | % errormsg: error message char string =[] by default |
---|
| 3073 | % INPUT: |
---|
[675] | 3074 | % FileName: first input file (=[] in the absence of input file) |
---|
| 3075 | % FileName_1: second input file (=[] in the asbsence of second input file) |
---|
[387] | 3076 | % num_i1,num_i2,num_j1,num_j2; frame indices |
---|
[675] | 3077 | % i1_1,i2_1,j1_1,j2_1: frame indices for the second input file (needed if FileName_1 is not empty) |
---|
| 3078 | %------------------------------------------------------------------------ |
---|
[515] | 3079 | function errormsg=refresh_field(handles,FileName,FileName_1,num_i1,num_i2,num_j1,num_j2,i1_1,i2_1,j1_1,j2_1) |
---|
[387] | 3080 | %------------------------------------------------------------------------ |
---|
| 3081 | |
---|
| 3082 | %% initialisation |
---|
[714] | 3083 | pointer=get(handles.uvmat,'Pointer'); |
---|
[726] | 3084 | if strcmp(pointer,'watch')% reinitialise the mouse if stuck to 'watch' |
---|
| 3085 | set(handles.CheckZoom,'Value',0) |
---|
| 3086 | pointer='arrow'; |
---|
| 3087 | end |
---|
[714] | 3088 | set(handles.uvmat,'Pointer','watch') |
---|
| 3089 | drawnow |
---|
[387] | 3090 | if ~exist('Field','var') |
---|
| 3091 | Field={}; |
---|
| 3092 | end |
---|
| 3093 | UvData=get(handles.uvmat,'UserData'); |
---|
| 3094 | if ishandle(handles.UVMAT_title) %remove title panel on uvmat |
---|
| 3095 | delete(handles.UVMAT_title) |
---|
| 3096 | end |
---|
| 3097 | |
---|
| 3098 | %% determine the main input file information for action |
---|
[450] | 3099 | if ~exist(FileName,'file') |
---|
| 3100 | errormsg=['input file ' FileName ' does not exist']; |
---|
[387] | 3101 | return |
---|
| 3102 | end |
---|
| 3103 | NomType=get(handles.NomType,'String'); |
---|
[494] | 3104 | NomType_1=''; |
---|
| 3105 | if strcmp(get(handles.NomType_1,'Visible'),'on') |
---|
| 3106 | NomType_1=get(handles.NomType_1,'String'); |
---|
| 3107 | end |
---|
[387] | 3108 | %update the z position index |
---|
[589] | 3109 | mode_slice=get(handles.slices,'String'); |
---|
| 3110 | if strcmp(mode_slice,'volume') |
---|
[387] | 3111 | z_index=num_j1; |
---|
| 3112 | set(handles.z_index,'String',num2str(z_index)) |
---|
| 3113 | else |
---|
[589] | 3114 | nbslice=str2num(get(handles.num_NbSlice,'String')); |
---|
[387] | 3115 | z_index=mod(num_i1-1,nbslice)+1; |
---|
| 3116 | set(handles.z_index,'String',num2str(z_index)) |
---|
| 3117 | end |
---|
[713] | 3118 | % inputfilerefresh menu for save_mask if relevant |
---|
[387] | 3119 | masknumber=get(handles.masklevel,'String'); |
---|
| 3120 | if length(masknumber)>=z_index |
---|
| 3121 | set(handles.masklevel,'Value',z_index) |
---|
| 3122 | end |
---|
| 3123 | |
---|
[515] | 3124 | %% test for need of tps |
---|
| 3125 | check_proj_tps=0; |
---|
| 3126 | if (strcmp(UvData.FileType{1},'civdata')||strcmp(UvData.FileType{1},'civx')) |
---|
[622] | 3127 | for iobj=1:numel(UvData.ProjObject) |
---|
| 3128 | if isfield(UvData.ProjObject{iobj},'ProjMode')&& strcmp(UvData.ProjObject{iobj}.ProjMode,'interp_tps') |
---|
[515] | 3129 | check_proj_tps=1; |
---|
| 3130 | break |
---|
| 3131 | end |
---|
| 3132 | end |
---|
| 3133 | end |
---|
| 3134 | |
---|
[507] | 3135 | %% read the first input field |
---|
[421] | 3136 | ParamIn.ColorVar='';%default variable name for vector color |
---|
[445] | 3137 | frame_index=1;%default |
---|
[507] | 3138 | FieldName='';%default |
---|
| 3139 | VelType='';%default |
---|
| 3140 | switch UvData.FileType{1} |
---|
| 3141 | case {'civx','civdata','netcdf'}; |
---|
[526] | 3142 | list_fields=get(handles.FieldName,'String');% list menu fields |
---|
| 3143 | FieldName= list_fields{get(handles.FieldName,'Value')}; % selected field |
---|
[507] | 3144 | if ~strcmp(FieldName,'get_field...') |
---|
| 3145 | if get(handles.FixVelType,'Value') |
---|
| 3146 | VelTypeList=get(handles.VelType,'String'); |
---|
| 3147 | VelType=VelTypeList{get(handles.VelType,'Value')}; |
---|
[387] | 3148 | end |
---|
[507] | 3149 | end |
---|
[576] | 3150 | % case of input vector field, get the scalar used for vector color |
---|
[517] | 3151 | if ~isempty(regexp(FieldName,'^vec(')) |
---|
[507] | 3152 | list_code=get(handles.ColorCode,'String');% list menu fields |
---|
| 3153 | index_code=get(handles.ColorCode,'Value');% selected string index |
---|
| 3154 | if ~strcmp(list_code{index_code},'black') && ~strcmp(list_code{index_code},'white') |
---|
| 3155 | list_code=get(handles.ColorScalar,'String');% list menu fields |
---|
| 3156 | index_code=get(handles.ColorScalar,'Value');% selected string index |
---|
| 3157 | ParamIn.ColorVar= list_code{index_code}; % selected field |
---|
[387] | 3158 | end |
---|
[507] | 3159 | end |
---|
[784] | 3160 | case {'video','mmreader','rdvision'} |
---|
[747] | 3161 | ParamIn=UvData.MovieObject{1}; % movie object |
---|
[683] | 3162 | if strcmp(NomType,'*') |
---|
| 3163 | frame_index=num_i1;%frame index from a single movies or multimage |
---|
[507] | 3164 | else |
---|
[683] | 3165 | frame_index=num_j1;% frame index from a set of indexed movies |
---|
[507] | 3166 | end |
---|
| 3167 | case 'multimage' |
---|
| 3168 | if ~strcmp(NomType,'*') |
---|
[783] | 3169 | MaxIndex_j_cell=get(handles.MaxIndex_j,'String'); |
---|
| 3170 | if num_j1>str2num(MaxIndex_j_cell{1}) |
---|
| 3171 | errormsg='specified frame index exceeds file content'; |
---|
| 3172 | return |
---|
| 3173 | else |
---|
[507] | 3174 | frame_index=num_j1;%frame index for movies or multimage |
---|
[783] | 3175 | end |
---|
[507] | 3176 | else |
---|
[783] | 3177 | MaxIndex_i_cell=get(handles.MaxIndex_i,'String'); |
---|
| 3178 | if num_i1>str2num(MaxIndex_i_cell{1}) |
---|
| 3179 | errormsg='specified frame index exceeds file content'; |
---|
| 3180 | return |
---|
| 3181 | else |
---|
[507] | 3182 | frame_index=num_i1; |
---|
[783] | 3183 | end |
---|
[507] | 3184 | end |
---|
| 3185 | case 'vol' %TODO: update |
---|
| 3186 | if isfield(UvData.XmlData,'Npy') && isfield(UvData.XmlData,'Npx') |
---|
| 3187 | ParamIn.Npy=UvData.XmlData.Npy; |
---|
| 3188 | ParamIn.Npx=UvData.XmlData.Npx; |
---|
| 3189 | else |
---|
| 3190 | errormsg='Npx and Npy need to be defined in the xml file for volume images .vol'; |
---|
| 3191 | return |
---|
| 3192 | end |
---|
[387] | 3193 | end |
---|
[507] | 3194 | if isstruct (ParamIn) |
---|
[517] | 3195 | ParamIn.FieldName=FieldName; |
---|
| 3196 | ParamIn.VelType=VelType; |
---|
[648] | 3197 | ParamIn.Coord_x=get(handles.Coord_x,'String'); |
---|
[747] | 3198 | ParamIn.Coord_y=get(handles.Coord_y,'String'); |
---|
| 3199 | ParamIn.Coord_z=get(handles.Coord_z,'String'); |
---|
| 3200 | TimeName=get(handles.TimeName,'String'); |
---|
| 3201 | r=regexp(TimeName,'^(?<type>(dim:)|(var:))','names');%look for 'var:' or 'dim:' at the beginning of time name |
---|
| 3202 | if ~isempty(r) |
---|
| 3203 | frame_index=num_i1;%time index chosen by i1 |
---|
| 3204 | if strcmp(r.type,'dim:') |
---|
| 3205 | ParamIn.TimeDimName=TimeName(5:end); |
---|
| 3206 | elseif strcmp(r.type,'var:') |
---|
| 3207 | ParamIn.TimeVarName=TimeName(5:end); |
---|
| 3208 | end |
---|
| 3209 | end |
---|
[507] | 3210 | end |
---|
[747] | 3211 | % check_tps = 0; |
---|
| 3212 | % if strcmp(UvData.FileType{1},'civdata')&&~strcmp(ParamIn.FieldName,'velocity')&&~strcmp(ParamIn.FieldName,'get_field...') |
---|
| 3213 | % check_tps=1;%tps needed to get the requested field |
---|
| 3214 | % end |
---|
[507] | 3215 | [Field{1},ParamOut,errormsg] = read_field(FileName,UvData.FileType{1},ParamIn,frame_index); |
---|
| 3216 | if ~isempty(errormsg) |
---|
[527] | 3217 | errormsg=['uvmat / refresh_field / read_field( ' FileName ') / ' errormsg]; |
---|
[507] | 3218 | return |
---|
| 3219 | end |
---|
| 3220 | if isfield(ParamOut,'Npx')&& isfield(ParamOut,'Npy') |
---|
| 3221 | set(handles.num_Npx,'String',num2str(ParamOut.Npx));% display image size on the interface |
---|
| 3222 | set(handles.num_Npy,'String',num2str(ParamOut.Npy)); |
---|
| 3223 | end |
---|
| 3224 | Field{1}.ZIndex=z_index; %used for multiplane 3D calibration |
---|
[387] | 3225 | |
---|
[450] | 3226 | %% choose and read a second field FileName_1 if defined |
---|
[387] | 3227 | VelType_1=[];%default |
---|
| 3228 | FieldName_1=[]; |
---|
[496] | 3229 | ParamIn_1=[]; |
---|
[387] | 3230 | ParamOut_1=[]; |
---|
[445] | 3231 | frame_index_1=1; |
---|
[450] | 3232 | if ~isempty(FileName_1) |
---|
| 3233 | if ~exist(FileName_1,'file') |
---|
| 3234 | errormsg=['second file ' FileName_1 ' does not exist']; |
---|
[387] | 3235 | return |
---|
| 3236 | end |
---|
[404] | 3237 | switch UvData.FileType{2} |
---|
[387] | 3238 | case {'civx','civdata','netcdf'}; |
---|
[526] | 3239 | list_fields=get(handles.FieldName_1,'String');% list menu fields |
---|
[520] | 3240 | if ischar(list_fields),list_fields={list_fields};end |
---|
[526] | 3241 | FieldName_1= list_fields{get(handles.FieldName_1,'Value')}; % selected field |
---|
[387] | 3242 | if ~strcmp(FieldName,'get_field...') |
---|
[389] | 3243 | if get(handles.FixVelType,'Value') |
---|
| 3244 | VelTypeList=get(handles.VelType_1,'String'); |
---|
| 3245 | VelType_1=VelTypeList{get(handles.VelType_1,'Value')};% read the velocity type. |
---|
[387] | 3246 | end |
---|
| 3247 | end |
---|
[405] | 3248 | if strcmp(FieldName_1,'velocity')&& strcmp(get(handles.ColorCode,'Visible'),'on') |
---|
| 3249 | list_code=get(handles.ColorCode,'String');% list menu fields |
---|
| 3250 | index_code=get(handles.ColorCode,'Value');% selected string index |
---|
[387] | 3251 | if ~strcmp(list_code{index_code},'black') && ~strcmp(list_code{index_code},'white') |
---|
[405] | 3252 | list_code=get(handles.ColorScalar,'String');% list menu fields |
---|
| 3253 | index_code=get(handles.ColorScalar,'Value');% selected string index |
---|
| 3254 | ParamIn_1.ColorVar= list_code{index_code}; % selected field for vector color display |
---|
[387] | 3255 | end |
---|
| 3256 | end |
---|
[435] | 3257 | case {'video','mmreader'} |
---|
[450] | 3258 | ParamIn_1=UvData.MovieObject{2}; |
---|
[747] | 3259 | if ~strcmp(NomType_1,'*') |
---|
[515] | 3260 | frame_index_1=j1_1;%frame index for movies or multimage |
---|
[445] | 3261 | else |
---|
[515] | 3262 | frame_index_1=i1_1; |
---|
[445] | 3263 | end |
---|
| 3264 | case 'multimage' |
---|
[609] | 3265 | if strcmp(NomType_1,'*')%frame index for movies or multimage |
---|
| 3266 | frame_index_1=i1_1; |
---|
[445] | 3267 | else |
---|
[609] | 3268 | frame_index_1=j1_1; |
---|
[445] | 3269 | end |
---|
[387] | 3270 | case 'vol' %TODO: update |
---|
| 3271 | if isfield(UvData.XmlData,'Npy') && isfield(UvData.XmlData,'Npx') |
---|
[405] | 3272 | ParamIn_1.Npy=UvData.XmlData.Npy; |
---|
| 3273 | ParamIn_1.Npx=UvData.XmlData.Npx; |
---|
[387] | 3274 | else |
---|
| 3275 | errormsg='Npx and Npy need to be defined in the xml file for volume images .vol'; |
---|
| 3276 | return |
---|
| 3277 | end |
---|
| 3278 | end |
---|
[428] | 3279 | if isequal(get(handles.NomType_1,'Visible'),'on') |
---|
[747] | 3280 | NomType_1=get(handles.NomType_1,'String'); |
---|
[428] | 3281 | else |
---|
| 3282 | NomType_1=get(handles.NomType,'String'); |
---|
| 3283 | end |
---|
[387] | 3284 | test_keepdata_1=0;% test for keeping the previous stored data if the input files are unchanged |
---|
[515] | 3285 | if ~isequal(NomType_1,'*')&& isfield(UvData,'FileName_1') |
---|
[580] | 3286 | test_keepdata_1= strcmp(FileName_1,UvData.FileName_1) ; |
---|
[387] | 3287 | end |
---|
| 3288 | if test_keepdata_1 |
---|
[389] | 3289 | Field{2}=UvData.Field_1;% keep the stored field |
---|
[427] | 3290 | ParamOut_1=UvData.ParamOut_1; |
---|
[387] | 3291 | else |
---|
[496] | 3292 | if isempty(ParamIn_1) || isstruct(ParamIn_1) |
---|
[405] | 3293 | ParamIn_1.FieldName=FieldName_1; |
---|
| 3294 | ParamIn_1.VelType=VelType_1; |
---|
[713] | 3295 | ParamIn_1.Coord_x=get(handles.Coord_x,'String'); |
---|
[747] | 3296 | ParamIn_1.Coord_y=get(handles.Coord_y,'String'); |
---|
[515] | 3297 | end |
---|
[580] | 3298 | [Field{2},ParamOut_1,errormsg] = read_field(FileName_1,UvData.FileType{2},ParamIn_1,frame_index_1); |
---|
[387] | 3299 | if ~isempty(errormsg) |
---|
[450] | 3300 | errormsg=['error in reading ' FieldName_1 ' in ' FileName_1 ': ' errormsg]; |
---|
[387] | 3301 | return |
---|
| 3302 | end |
---|
[515] | 3303 | if isstruct(ParamOut_1)&&~strcmp(ParamOut_1.FieldName,'get_field...')&& (strcmp(UvData.FileType{2},'civdata')||strcmp(UvData.FileType{2},'civx'))... |
---|
| 3304 | &&~strcmp(ParamOut_1.FieldName,'velocity') && ~strcmp(ParamOut_1.FieldName,'get_field...') |
---|
| 3305 | if ~check_proj_tps |
---|
| 3306 | end |
---|
| 3307 | end |
---|
[387] | 3308 | end |
---|
[507] | 3309 | Field{2}.ZIndex=z_index;%used for multi-plane 3D calibration |
---|
[387] | 3310 | end |
---|
| 3311 | |
---|
| 3312 | %% update uvmat interface |
---|
| 3313 | if isfield(ParamOut,'Npx') |
---|
| 3314 | set(handles.num_Npx,'String',num2str(ParamOut.Npx));% display image size on the interface |
---|
| 3315 | set(handles.num_Npy,'String',num2str(ParamOut.Npy)); |
---|
| 3316 | elseif isfield(ParamOut_1,'Npx') |
---|
| 3317 | set(handles.num_Npx,'String',num2str(ParamOut_1.Npx));% display image size on the interface |
---|
| 3318 | set(handles.num_Npy,'String',num2str(ParamOut_1.Npy)); |
---|
| 3319 | end |
---|
| 3320 | |
---|
| 3321 | %% update the display menu for the first velocity type (first menuline) |
---|
| 3322 | test_veltype=0; |
---|
[404] | 3323 | if (strcmp(UvData.FileType{1},'civx')||strcmp(UvData.FileType{1},'civdata'))&& ~strcmp(FieldName,'get_field...') |
---|
[387] | 3324 | test_veltype=1; |
---|
| 3325 | set(handles.VelType,'Visible','on') |
---|
| 3326 | set(handles.VelType_1,'Visible','on') |
---|
| 3327 | set(handles.FixVelType,'Visible','on') |
---|
[404] | 3328 | menu=set_veltype_display(ParamOut.CivStage,UvData.FileType{1}); |
---|
[387] | 3329 | index_menu=strcmp(ParamOut.VelType,menu);%look for VelType in the menu |
---|
| 3330 | index_val=find(index_menu,1); |
---|
| 3331 | if isempty(index_val) |
---|
| 3332 | index_val=1; |
---|
| 3333 | end |
---|
| 3334 | set(handles.VelType,'Value',index_val) |
---|
| 3335 | if ~get(handles.SubField,'value') |
---|
| 3336 | set(handles.VelType,'String',menu) |
---|
| 3337 | set(handles.VelType_1,'Value',1) |
---|
| 3338 | set(handles.VelType_1,'String',[{''};menu]) |
---|
| 3339 | end |
---|
| 3340 | else |
---|
| 3341 | set(handles.VelType,'Visible','off') |
---|
| 3342 | end |
---|
| 3343 | |
---|
| 3344 | %% update the display menu for the second velocity type (second menuline) |
---|
| 3345 | test_veltype_1=0; |
---|
[450] | 3346 | if isempty(FileName_1) |
---|
[405] | 3347 | elseif ~test_keepdata_1 |
---|
[713] | 3348 | if (strcmp(UvData.FileType{2},'civx')||strcmp(UvData.FileType{2},'civdata'))&& ~strcmp(FieldName_1,'get_field...') |
---|
[387] | 3349 | test_veltype_1=1; |
---|
| 3350 | set(handles.VelType_1,'Visible','on') |
---|
[515] | 3351 | menu=set_veltype_display(ParamOut_1.CivStage,UvData.FileType{2}); |
---|
[494] | 3352 | index_menu=strcmp(ParamOut_1.VelType,menu); |
---|
| 3353 | set(handles.VelType_1,'Value',1+find(index_menu,1)) |
---|
| 3354 | set(handles.VelType_1,'String',[{''};menu]) |
---|
[713] | 3355 | else |
---|
| 3356 | set(handles.VelType_1,'Visible','off') |
---|
[387] | 3357 | end |
---|
[405] | 3358 | % update the second field menu: the same quantity |
---|
[494] | 3359 | if isstruct(ParamOut_1) |
---|
[580] | 3360 | % display the FieldName menu from the input file and pick the selected one: |
---|
| 3361 | FieldList=get(handles.FieldName_1,'String'); |
---|
| 3362 | field_index=strcmp(ParamOut_1.FieldName,FieldList); |
---|
| 3363 | if ~isempty(field_index) |
---|
| 3364 | set(handles.FieldName_1,'Value',find(field_index,1)) |
---|
| 3365 | end |
---|
[494] | 3366 | end |
---|
[387] | 3367 | end |
---|
| 3368 | if test_veltype||test_veltype_1 |
---|
[580] | 3369 | set(handles.FixVelType,'Visible','on') |
---|
[387] | 3370 | else |
---|
[580] | 3371 | set(handles.FixVelType,'Visible','off') |
---|
[387] | 3372 | end |
---|
| 3373 | |
---|
| 3374 | %% introduce w as background image by default for a new series (only for nbdim=2) |
---|
| 3375 | if ~isfield(UvData,'NewSeries') |
---|
| 3376 | UvData.NewSeries=1; |
---|
| 3377 | end |
---|
| 3378 | %put W as background image by default if NbDim=2: |
---|
| 3379 | if UvData.NewSeries && isequal(get(handles.SubField,'Value'),0) && isfield(Field{1},'W') && ~isempty(Field{1}.W) && ~isequal(Field{1}.NbDim,3); |
---|
| 3380 | set(handles.SubField,'Value',1); |
---|
| 3381 | set(handles.RootPath_1,'String','"') |
---|
| 3382 | set(handles.RootFile_1,'String','"') |
---|
| 3383 | set(handles.SubDir_1,'String','"'); |
---|
| 3384 | indices=fullfile_uvmat('','','','',NomType,num_i1,num_i2,num_j1,num_j2); |
---|
| 3385 | set(handles.FileIndex_1,'String',indices) |
---|
| 3386 | set(handles.FileExt_1,'String','"'); |
---|
[526] | 3387 | set(handles.FieldName_1,'Visible','on'); |
---|
| 3388 | set(handles.FieldName_1,'Visible','on'); |
---|
[387] | 3389 | set(handles.RootPath_1,'Visible','on') |
---|
| 3390 | set(handles.RootFile_1,'Visible','on') |
---|
| 3391 | set(handles.SubDir_1,'Visible','on'); |
---|
| 3392 | set(handles.FileIndex_1,'Visible','on'); |
---|
| 3393 | set(handles.FileExt_1,'Visible','on'); |
---|
[526] | 3394 | set(handles.FieldName_1,'Visible','on'); |
---|
[387] | 3395 | Field{1}.AName='w'; |
---|
| 3396 | end |
---|
| 3397 | |
---|
[674] | 3398 | %% display time value of the current file |
---|
[615] | 3399 | abstime=[];%default inputs |
---|
| 3400 | dt=[]; |
---|
[415] | 3401 | TimeUnit=''; |
---|
[674] | 3402 | if isfield(UvData,'TimeUnit') |
---|
[747] | 3403 | TimeUnit=UvData.TimeUnit;%retrieve info from update_rootinfo |
---|
[674] | 3404 | end |
---|
[747] | 3405 | TimeName=get(handles.TimeName,'String'); |
---|
| 3406 | |
---|
[615] | 3407 | % time from xml file or video movie |
---|
[674] | 3408 | if strcmp(TimeName,'xml')||strcmp(TimeName,'video') |
---|
[415] | 3409 | if isempty(num_i2)||isnan(num_i2) |
---|
| 3410 | num_i2=num_i1; |
---|
| 3411 | end |
---|
| 3412 | if isempty(num_j1)||isnan(num_j1) |
---|
| 3413 | num_j1=1; |
---|
| 3414 | end |
---|
| 3415 | if isempty(num_j2)||isnan(num_j2) |
---|
| 3416 | num_j2=num_j1; |
---|
| 3417 | end |
---|
| 3418 | siz=size(UvData.XmlData{1}.Time); |
---|
[615] | 3419 | if ~isempty(num_i1)&& ~isempty(num_i2) && num_i1>=0 &&siz(1)>=max(num_i1+1,num_i2+1) && siz(2)>=max(num_j1+1,num_j2+1) |
---|
[611] | 3420 | abstime=(UvData.XmlData{1}.Time(num_i1+1,num_j1+1)+UvData.XmlData{1}.Time(num_i2+1,num_j2+1))/2;%overset the time read from files |
---|
| 3421 | dt=(UvData.XmlData{1}.Time(num_i2+1,num_j2+1)-UvData.XmlData{1}.Time(num_i1+1,num_j1+1)); |
---|
[415] | 3422 | Field{1}.Dt=dt; |
---|
| 3423 | if isfield(UvData.XmlData{1},'TimeUnit') |
---|
| 3424 | TimeUnit=UvData.XmlData{1}.TimeUnit; |
---|
| 3425 | end |
---|
| 3426 | end |
---|
| 3427 | end |
---|
[615] | 3428 | |
---|
[747] | 3429 | % time in the input file, not defined in a xml file or movie |
---|
[615] | 3430 | if isempty(abstime) |
---|
[784] | 3431 | if strcmp(TimeName,'civdata')||strcmp(TimeName,'civx')||strcmp(TimeName,'timestamp') |
---|
[675] | 3432 | abstime=Field{1}.Time; |
---|
[747] | 3433 | elseif ~isempty(regexp(TimeName,'^att:', 'once')) |
---|
| 3434 | abstime=Field{1}.(TimeName(5:end));%the time is an attribute selected by get_file |
---|
| 3435 | if isfield(Field{1},[TimeName(5:end) 'Unit']) |
---|
| 3436 | TimeUnit=Field{1}.([TimeName(5:end) 'Unit']); |
---|
| 3437 | else |
---|
| 3438 | TimeUnit=''; |
---|
| 3439 | end |
---|
| 3440 | elseif ~isempty(regexp(TimeName,'^var:')) |
---|
| 3441 | abstime=Field{1}.(TimeName(5:end));%the time is a variale selected by get_file |
---|
| 3442 | % TODO: look for time unit attribute |
---|
[693] | 3443 | elseif ~isempty(regexp(TimeName,'^dim:')) |
---|
| 3444 | abstime=str2num(get(handles.i1,'String')); |
---|
[747] | 3445 | TimeUnit='index'; |
---|
[615] | 3446 | end |
---|
[648] | 3447 | if isfield(Field{1},'Dt') |
---|
| 3448 | dt=Field{1}.Dt;%dt read from the netcdf input file |
---|
| 3449 | elseif numel(Field)==2 && isfield(Field{2},'Dt')%dt obtained from the second field if not defined in the first |
---|
| 3450 | dt=Field{2}.Dt;%dt read from the netcdf input file |
---|
[615] | 3451 | end |
---|
[667] | 3452 | end |
---|
[654] | 3453 | set(handles.TimeValue,'String',num2str(abstime)) |
---|
[674] | 3454 | |
---|
| 3455 | %% display time value of the second current file if relevant |
---|
[648] | 3456 | abstime_1=[]; |
---|
[674] | 3457 | if ~isempty(FileName_1) |
---|
| 3458 | TimeName_1=get(handles.TimeName_1,'String');% indicate whether time is from xml or video |
---|
| 3459 | % time from xml file or video movie as a second file series |
---|
| 3460 | if strcmp(TimeName_1,'xml')||strcmp(TimeName_1,'video') |
---|
| 3461 | if numel(UvData.XmlData)==2 |
---|
| 3462 | if isempty(i2_1) |
---|
| 3463 | i2_1=num_i1; |
---|
| 3464 | end |
---|
| 3465 | if isempty(j1_1) |
---|
| 3466 | j1_1=1; |
---|
| 3467 | end |
---|
| 3468 | if isempty(j2_1) |
---|
| 3469 | j2_1=j1_1; |
---|
| 3470 | end |
---|
| 3471 | siz=size(UvData.XmlData{2}.Time); |
---|
| 3472 | if ~isempty(i1_1) && siz(1)>=max(i1_1+1,i2_1+1) && siz(2)>=max(j1_1+1,j2_1+1) |
---|
| 3473 | abstime_1=(UvData.XmlData{2}.Time(i1_1+1,j1_1+1)+UvData.XmlData{2}.Time(i2_1+1,j2_1+1))/2;%overset the time read from files |
---|
| 3474 | Field{2}.Dt=(UvData.XmlData{2}.Time(i2_1+1,j2_1+1)-UvData.XmlData{2}.Time(i1_1+1,j1_1+1)); |
---|
| 3475 | end |
---|
| 3476 | end |
---|
| 3477 | end |
---|
| 3478 | |
---|
| 3479 | % get time in the input file of the second series, not defined in a xml file or movie |
---|
[675] | 3480 | if isempty(abstime_1) && numel(Field)==2 |
---|
| 3481 | if strcmp(TimeName_1,'civdata')||strcmp(TimeName_1,'civx') |
---|
| 3482 | abstime_1=Field{2}.Time; |
---|
| 3483 | elseif ~isempty(regexp(TimeName_1,'^att:')) ||~isempty(regexp(TimeName_1,'^dim:'))||~isempty(regexp(TimeName_1,'^var:')) |
---|
[648] | 3484 | abstime_1=Field{2}.(TimeName_1(5:end));%the time is an attribute or variale selected by get_file |
---|
[675] | 3485 | end |
---|
[674] | 3486 | end |
---|
| 3487 | set(handles.TimeValue_1,'String',num2str(abstime_1,5)) |
---|
[648] | 3488 | end |
---|
[674] | 3489 | |
---|
[415] | 3490 | if isempty(dt)||isequal(dt,0) |
---|
| 3491 | set(handles.Dt_txt,'String','') |
---|
| 3492 | else |
---|
| 3493 | if isempty(TimeUnit) |
---|
| 3494 | set(handles.Dt_txt,'String',['Dt=' num2str(1000*dt,3) ' 10^(-3)'] ) |
---|
| 3495 | else |
---|
| 3496 | set(handles.Dt_txt,'String',['Dt=' num2str(1000*dt,3) ' m' TimeUnit] ) |
---|
| 3497 | end |
---|
| 3498 | end |
---|
| 3499 | |
---|
[674] | 3500 | %% Time title with unit |
---|
| 3501 | if isempty(abstime)&&isempty(abstime_1) |
---|
| 3502 | Time_title=''; |
---|
| 3503 | else |
---|
| 3504 | Time_title='Time'; |
---|
| 3505 | if ~isempty(TimeUnit) |
---|
| 3506 | Time_title=['Time (' TimeUnit ')']; |
---|
| 3507 | end |
---|
| 3508 | end |
---|
| 3509 | set(handles.Time_title,'String',Time_title) |
---|
| 3510 | |
---|
[526] | 3511 | %% store the current open names, fieldname and vel types in uvmat interface |
---|
[450] | 3512 | UvData.FileName_1=FileName_1; |
---|
[512] | 3513 | UvData.ParamOut_1=ParamOut_1; |
---|
| 3514 | if numel(Field)==2 |
---|
[713] | 3515 | UvData.Field_1=Field{2}; %store the second field for possible use at next RUN |
---|
[512] | 3516 | end |
---|
[387] | 3517 | |
---|
| 3518 | %% apply coordinate transform or other user fct |
---|
[591] | 3519 | transform=get(handles.TransformPath,'UserData'); |
---|
[515] | 3520 | if isempty(transform) |
---|
| 3521 | UvData.Field=Field{1}; |
---|
| 3522 | else |
---|
[507] | 3523 | XmlData=[];%default |
---|
| 3524 | XmlData_1=[];%default |
---|
| 3525 | if isfield(UvData,'XmlData')%use geometry calib recorded from the ImaDoc xml file as first priority |
---|
| 3526 | XmlData=UvData.XmlData{1}; |
---|
| 3527 | if numel(UvData.XmlData)==2 |
---|
| 3528 | XmlData_1=UvData.XmlData{2}; |
---|
| 3529 | end |
---|
[387] | 3530 | end |
---|
[512] | 3531 | switch nargin(transform) |
---|
| 3532 | case 4 |
---|
| 3533 | if length(Field)==2 |
---|
| 3534 | UvData.Field=transform(Field{1},XmlData,Field{2},XmlData_1); |
---|
| 3535 | else |
---|
| 3536 | UvData.Field=transform(Field{1},XmlData); |
---|
| 3537 | end |
---|
| 3538 | case 3 |
---|
| 3539 | if length(Field)==2 |
---|
| 3540 | UvData.Field=transform(Field{1},XmlData,Field{2}); |
---|
| 3541 | else |
---|
| 3542 | UvData.Field=transform(Field{1},XmlData); |
---|
| 3543 | end |
---|
| 3544 | case 2 |
---|
| 3545 | UvData.Field=transform(Field{1},XmlData); |
---|
| 3546 | case 1 |
---|
| 3547 | UvData.Field=transform(Field{1}); |
---|
[387] | 3548 | end |
---|
[507] | 3549 | end |
---|
[508] | 3550 | |
---|
[515] | 3551 | %% calculate tps coefficients if needed |
---|
[581] | 3552 | UvData.Field=tps_coeff_field(UvData.Field,check_proj_tps); |
---|
[387] | 3553 | |
---|
[667] | 3554 | %% get bounds and dimensions of the input field |
---|
| 3555 | UvData.Field=find_field_bounds(UvData.Field); |
---|
| 3556 | |
---|
[387] | 3557 | testnewseries=UvData.NewSeries; |
---|
| 3558 | UvData.NewSeries=0;% put to 0 the test for a new field series (set by RootPath_callback) |
---|
| 3559 | |
---|
| 3560 | %% reset the min and max of scalar if only the mask is displayed(TODO: check the need) |
---|
[405] | 3561 | % if isfield(UvData,'Mask')&& ~isfield(UvData,'A') |
---|
| 3562 | % set(handles.num_MinA,'String','0') |
---|
| 3563 | % set(handles.num_MaxA,'String','255') |
---|
| 3564 | % end |
---|
[387] | 3565 | |
---|
[434] | 3566 | %% usual 1D (x,y) plots |
---|
[654] | 3567 | if UvData.Field.NbDim<=1 |
---|
[434] | 3568 | set(handles.Objects,'Visible','off') |
---|
[789] | 3569 | [PlotType,PlotParamOut,haxes]=plot_field(UvData.Field,handles.PlotAxes,read_GUI(handles.uvmat)); |
---|
| 3570 | UvData.PlotAxes=UvData.Field; %store data for further plot modifications |
---|
[598] | 3571 | errormsg=fill_GUI(PlotParamOut,handles.uvmat); |
---|
| 3572 | for list={'Scalar','Vectors'} |
---|
| 3573 | if ~isfield(PlotParamOut,list{1}) |
---|
| 3574 | set(handles.(list{1}),'Visible','off') |
---|
| 3575 | end |
---|
| 3576 | end |
---|
[747] | 3577 | set(handles.uvmat,'UserData',UvData) |
---|
[526] | 3578 | %% 2D or 3D fieldname are generally projected |
---|
[387] | 3579 | else |
---|
[434] | 3580 | set(handles.Objects,'Visible','on') |
---|
| 3581 | |
---|
| 3582 | %% Plot the projections on the selected projection objects |
---|
[747] | 3583 | %if no projection object exists, create a default one |
---|
| 3584 | if isempty(UvData.ProjObject{1}) |
---|
[508] | 3585 | set(handles.ListObject,'Value',1) |
---|
| 3586 | set(handles.ListObject,'String',{'plane'}) |
---|
[622] | 3587 | UvData.ProjObject{1}.Type='plane';%main plotting plane |
---|
| 3588 | UvData.ProjObject{1}.ProjMode='projection';%main plotting plane |
---|
| 3589 | UvData.ProjObject{1}.DisplayHandle.uvmat=[]; %plane not visible in uvmat |
---|
| 3590 | UvData.ProjObject{1}.DisplayHandle.view_field=[]; %plane not visible in uvmat |
---|
[434] | 3591 | set(handles.ListObject_1,'Value',1) |
---|
[508] | 3592 | set(handles.ListObject_1,'String',{'plane'}) |
---|
[747] | 3593 | if UvData.Field.NbDim==3 %3D case |
---|
| 3594 | % ZBounds(1)=UvData.Field.ZMin; %minimum for the Z slider |
---|
| 3595 | % ZBounds(2)=UvData.Field.ZMax;%maximum for the Z slider |
---|
| 3596 | UvData.ProjObject{1}.NbDim=3;%test for 3D objects |
---|
| 3597 | UvData.ProjObject{1}.RangeZ=UvData.Field.CoordMesh;%main plotting plane |
---|
| 3598 | UvData.ProjObject{1}.Coord(1,3)=(UvData.Field.ZMin+UvData.Field.ZMax)/2;%section at a middle plane chosen |
---|
| 3599 | UvData.ProjObject{1}.Angle=[0 0 0]; |
---|
| 3600 | elseif isfield(UvData,'Z') |
---|
| 3601 | %multilevel case (single menuplane in a 3D space) |
---|
| 3602 | if isfield(UvData,'CoordType')&& isequal(UvData.CoordType,'phys') && isfield(UvData,'XmlData') |
---|
| 3603 | XmlData=UvData.XmlData{1}; |
---|
| 3604 | if isfield(XmlData,'PlanePos') |
---|
| 3605 | UvData.ProjObject{1}.Coord=XmlData.PlanePos(UvData.ZIndex,:); |
---|
| 3606 | end |
---|
| 3607 | if isfield(XmlData,'PlaneAngle') |
---|
| 3608 | siz=size(XmlData.PlaneAngle); |
---|
| 3609 | indangle=min(siz(1),UvData.ZIndex);%take first angle if a single angle is defined (translating scanning) |
---|
| 3610 | UvData.ProjObject{1}.PlaneAngle=XmlData.PlaneAngle(indangle,:); |
---|
| 3611 | end |
---|
| 3612 | elseif isfield(UvData,'ZIndex') |
---|
| 3613 | UvData.ProjObject{1}.ZObject=UvData.ZIndex; |
---|
| 3614 | end |
---|
| 3615 | end |
---|
[387] | 3616 | end |
---|
[674] | 3617 | IndexObj=get(handles.ListObject_1,'Value');%selected projection object for main view |
---|
| 3618 | if IndexObj> numel(UvData.ProjObject) |
---|
| 3619 | IndexObj=1;%select the first object if the selected one does not exist |
---|
[434] | 3620 | set(handles.ListObject_1,'Value',1) |
---|
[387] | 3621 | end |
---|
[674] | 3622 | if get(handles.CheckViewField,'Value') |
---|
| 3623 | IndexObj_2=get(handles.ListObject,'Value');%selected projection object for view_field |
---|
| 3624 | if ~isequal(IndexObj_2,IndexObj(1)) |
---|
| 3625 | IndexObj(2)=IndexObj_2; |
---|
| 3626 | end |
---|
[434] | 3627 | end |
---|
| 3628 | plot_handles{1}=handles; |
---|
| 3629 | if isfield(UvData,'plotaxes')%case of movies |
---|
| 3630 | haxes(1)=UvData.plotaxes; |
---|
| 3631 | else |
---|
[511] | 3632 | haxes(1)=handles.PlotAxes; |
---|
[434] | 3633 | end |
---|
| 3634 | PlotParam{1}=read_GUI(handles.uvmat); |
---|
| 3635 | %default settings if vectors not visible |
---|
| 3636 | if ~isfield(PlotParam{1},'Vectors') |
---|
| 3637 | PlotParam{1}.Vectors.MaxVec=1; |
---|
| 3638 | PlotParam{1}.Vectors.MinVec=0; |
---|
| 3639 | PlotParam{1}.Vectors.CheckFixVecColor=1; |
---|
| 3640 | PlotParam{1}.Vectors.ColCode1=0.33; |
---|
| 3641 | PlotParam{1}.Vectors.ColCode2=0.66; |
---|
[517] | 3642 | PlotParam{1}.Vectors.ColorScalar={''}; |
---|
[434] | 3643 | PlotParam{1}.Vectors.ColorCode= {'rgb'}; |
---|
| 3644 | end |
---|
[781] | 3645 | %PosColorbar{1}=UvData.OpenParam.PosColorbar;%prescribe the colorbar position on the uvmat interface |
---|
[434] | 3646 | |
---|
| 3647 | %% second projection object (view_field display) |
---|
[747] | 3648 | if length( IndexObj)==2 |
---|
[434] | 3649 | view_field_handle=findobj(allchild(0),'tag','view_field');%handles of the view_field GUI |
---|
| 3650 | if ~isempty(view_field_handle) |
---|
| 3651 | plot_handles{2}=guidata(view_field_handle); |
---|
[511] | 3652 | haxes(2)=plot_handles{2}.PlotAxes; |
---|
[599] | 3653 | PlotParam{2}=read_GUI(view_field_handle); |
---|
[781] | 3654 | %PosColorbar{2}='*'; %TODO: deal with colorbar position on view_field |
---|
[421] | 3655 | end |
---|
[387] | 3656 | end |
---|
[434] | 3657 | |
---|
| 3658 | %% loop on the projection objects: one or two |
---|
| 3659 | |
---|
| 3660 | for imap=1:numel(IndexObj) |
---|
| 3661 | iobj=IndexObj(imap); |
---|
[622] | 3662 | if numel(UvData.ProjObject)<iobj |
---|
[606] | 3663 | break |
---|
| 3664 | end |
---|
[748] | 3665 | if UvData.Field.NbDim==3 |
---|
[747] | 3666 | UvData.ProjObject{iobj}.NbDim=3;%test for 3D objects |
---|
[748] | 3667 | if ~isfield(UvData.ProjObject{iobj},'RangeZ') |
---|
[747] | 3668 | UvData.ProjObject{iobj}.RangeZ=UvData.Field.CoordMesh;%main plotting plane |
---|
[748] | 3669 | end |
---|
| 3670 | if ~(isfield(UvData.ProjObject{iobj},'Coord') && UvData.ProjObject{iobj}.Coord(1,3)<UvData.Field.ZMax && UvData.ProjObject{iobj}.Coord(1,3)>UvData.Field.ZMin) |
---|
| 3671 | UvData.ProjObject{iobj}.Coord(1,3)=(UvData.Field.ZMin+UvData.Field.ZMax)/2;%section at a middle plane chosen |
---|
| 3672 | end |
---|
[747] | 3673 | end |
---|
[622] | 3674 | [ObjectData,errormsg]=proj_field(UvData.Field,UvData.ProjObject{iobj});% project field on the object |
---|
[434] | 3675 | if ~isempty(errormsg) |
---|
| 3676 | return |
---|
[387] | 3677 | end |
---|
[434] | 3678 | if testnewseries |
---|
| 3679 | PlotParam{imap}.Scalar.CheckBW=[]; %B/W option depends on the input field (image or scalar) |
---|
| 3680 | if isfield(ObjectData,'CoordUnit') |
---|
[748] | 3681 | PlotParam{imap}.Axes.CheckFixAspectRatio=1;% set x and y scaling equal if CoordUnit is defined (common unit for x and y) |
---|
| 3682 | PlotParam{imap}.Axes.AspectRatio=1; %set aspect ratio to 1 |
---|
[387] | 3683 | end |
---|
[434] | 3684 | end |
---|
| 3685 | %use of mask (TODO: check) |
---|
| 3686 | if isfield(ObjectData,'NbDim') && isequal(ObjectData.NbDim,2) && isfield(ObjectData,'Mask') && isfield(ObjectData,'A') |
---|
| 3687 | flag_mask=double(ObjectData.Mask>200);%=0 for masked regions |
---|
[782] | 3688 | Coord_x=ObjectData.Coord_x;%x coordiantes for the scalar field |
---|
| 3689 | Coord_y=ObjectData.Coord_y;%y coordinates for the scalar field |
---|
[434] | 3690 | MaskX=ObjectData.MaskX;%x coordiantes for the mask |
---|
| 3691 | MaskY=ObjectData.MaskY;%y coordiantes for the mask |
---|
[782] | 3692 | if ~isequal(MaskX,Coord_x)||~isequal(MaskY,Coord_y) |
---|
[434] | 3693 | nxy=size(flag_mask); |
---|
| 3694 | sizpx=(ObjectData.MaskX(end)-ObjectData.MaskX(1))/(nxy(2)-1);%size of a mask pixel |
---|
| 3695 | sizpy=(ObjectData.MaskY(1)-ObjectData.MaskY(end))/(nxy(1)-1); |
---|
| 3696 | x_mask=ObjectData.MaskX(1):sizpx:ObjectData.MaskX(end); % pixel x coordinates for image display |
---|
| 3697 | y_mask=ObjectData.MaskY(1):-sizpy:ObjectData.MaskY(end);% pixel x coordinates for image display |
---|
| 3698 | %project on the positions of the scalar |
---|
| 3699 | npxy=size(ObjectData.A); |
---|
[782] | 3700 | dxy(1)=(ObjectData.Coord_y(end)-ObjectData.Coord_y(1))/(npxy(1)-1);%grid mesh in y |
---|
| 3701 | dxy(2)=(ObjectData.Coord_x(end)-ObjectData.Coord_x(1))/(npxy(2)-1);%grid mesh in x |
---|
| 3702 | xi=ObjectData.Coord_x(1):dxy(2):ObjectData.Coord_x(end); |
---|
| 3703 | yi=ObjectData.Coord_y(1):dxy(1):ObjectData.Coord_y(end); |
---|
[434] | 3704 | [XI,YI]=meshgrid(xi,yi);% creates the matrix of regular coordinates |
---|
| 3705 | flag_mask = interp2(x_mask,y_mask,flag_mask,XI,YI); |
---|
| 3706 | end |
---|
| 3707 | AClass=class(ObjectData.A); |
---|
| 3708 | ObjectData.A=flag_mask.*double(ObjectData.A); |
---|
| 3709 | ObjectData.A=feval(AClass,ObjectData.A); |
---|
[750] | 3710 | end |
---|
| 3711 | set(handles.uvmat,'UserData',UvData) |
---|
[434] | 3712 | if ~isempty(ObjectData) |
---|
[569] | 3713 | %PlotType='none'; %default |
---|
[434] | 3714 | if imap==2 && isempty(view_field_handle) |
---|
| 3715 | view_field(ObjectData) |
---|
| 3716 | else |
---|
[781] | 3717 | [PlotType,PlotParamOut]=plot_field(ObjectData,haxes(imap),PlotParam{imap}); |
---|
[595] | 3718 | if imap==1 |
---|
[598] | 3719 | errormsg=fill_GUI(PlotParamOut,handles.uvmat); |
---|
[595] | 3720 | else |
---|
[596] | 3721 | errormsg=fill_GUI(PlotParamOut,view_field_handle); |
---|
[595] | 3722 | end |
---|
[598] | 3723 | for list={'Scalar','Vectors'} |
---|
| 3724 | if ~isfield(PlotParamOut,list{1}) |
---|
| 3725 | set(plot_handles{imap}.(list{1}),'Visible','off') |
---|
| 3726 | end |
---|
| 3727 | end |
---|
[575] | 3728 | if isfield(Field,'CoordMesh')&&~isempty(Field.CoordMesh) |
---|
| 3729 | ObjectData.CoordMesh=Field.CoordMesh; % gives an estimated mesh size (useful for mouse action on the plot) |
---|
[434] | 3730 | end |
---|
[387] | 3731 | end |
---|
| 3732 | end |
---|
| 3733 | end |
---|
[434] | 3734 | |
---|
| 3735 | %% update the mask |
---|
| 3736 | if isequal(get(handles.CheckMask,'Value'),1)%if the mask option is on |
---|
[641] | 3737 | update_mask(handles); |
---|
[434] | 3738 | end |
---|
| 3739 | |
---|
| 3740 | %% prepare the menus of histograms and plot them (histogram of the whole volume in 3D case) |
---|
| 3741 | menu_histo=(UvData.Field.ListVarName)';%list of field variables to be displayed for the menu of histogram display |
---|
| 3742 | ind_skip=[]; |
---|
| 3743 | % nb_histo=1; |
---|
| 3744 | Ustring=''; |
---|
| 3745 | Vstring=''; |
---|
[748] | 3746 | % suppress axes from the histogram menu |
---|
[434] | 3747 | for ivar=1:numel(menu_histo)%l loop on field variables: |
---|
| 3748 | if isfield(UvData.Field,'VarAttribute') && numel(UvData.Field.VarAttribute)>=ivar && isfield(UvData.Field.VarAttribute{ivar},'Role') |
---|
| 3749 | Role=UvData.Field.VarAttribute{ivar}.Role; |
---|
| 3750 | switch Role |
---|
| 3751 | case {'coord_x','coord_y','coord_z','dimvar'} |
---|
| 3752 | ind_skip=[ind_skip ivar]; |
---|
| 3753 | case {'vector_x'} |
---|
| 3754 | Ustring=UvData.Field.ListVarName{ivar}; |
---|
| 3755 | ind_skip=[ind_skip ivar]; |
---|
| 3756 | case {'vector_y'} |
---|
| 3757 | Vstring=UvData.Field.ListVarName{ivar}; |
---|
| 3758 | ind_skip=[ind_skip ivar]; |
---|
| 3759 | end |
---|
[387] | 3760 | end |
---|
[434] | 3761 | DimCell=UvData.Field.VarDimName{ivar}; |
---|
| 3762 | DimName=''; |
---|
| 3763 | if ischar(DimCell) |
---|
| 3764 | DimName=DimCell; |
---|
| 3765 | elseif iscell(DimCell)&& numel(DimCell)==1 |
---|
| 3766 | DimName=DimCell{1}; |
---|
| 3767 | end |
---|
| 3768 | if strcmp(DimName,menu_histo{ivar}) |
---|
| 3769 | ind_skip=[ind_skip ivar]; |
---|
| 3770 | end |
---|
[387] | 3771 | end |
---|
[434] | 3772 | menu_histo(ind_skip)=[];% remove skipped items |
---|
| 3773 | if ~isempty(Ustring) |
---|
| 3774 | menu_histo=[{[Ustring ',' Vstring]};menu_histo];% add U, V at the beginning if they exist |
---|
[387] | 3775 | end |
---|
[434] | 3776 | |
---|
| 3777 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 3778 | % display menus and plot histograms |
---|
| 3779 | test_v=0; |
---|
| 3780 | if ~isempty(menu_histo) |
---|
| 3781 | set(handles.histo1_menu,'Value',1) |
---|
| 3782 | set(handles.histo1_menu,'String',menu_histo) |
---|
| 3783 | histo1_menu_Callback(handles.histo1_menu, [], handles)% plot first histogram |
---|
[387] | 3784 | end |
---|
| 3785 | end |
---|
[747] | 3786 | |
---|
| 3787 | if UvData.Field.NbDim==3 |
---|
[748] | 3788 | set(handles.CheckEditObject,'Value',1) |
---|
[747] | 3789 | CheckEditObject_Callback(handles.uvmat, [], handles) |
---|
| 3790 | end |
---|
[781] | 3791 | %ResizeFcn(handles.uvmat,[],handles) |
---|
[714] | 3792 | set(handles.uvmat,'Pointer',pointer) |
---|
[387] | 3793 | |
---|
[424] | 3794 | %------------------------------------------------------------------------ |
---|
| 3795 | function histo1_menu_Callback(hObject, eventdata, handles) |
---|
| 3796 | %-------------------------------------------- |
---|
[747] | 3797 | %% get the current field stored in uvmat user data |
---|
| 3798 | UvData=get(handles.uvmat,'UserData'); |
---|
| 3799 | Field=UvData.Field; |
---|
| 3800 | |
---|
| 3801 | %% get from the menu 'histo1_menu' the name(s) of the fields to use |
---|
[424] | 3802 | histo_menu=get(handles.histo1_menu,'String'); |
---|
| 3803 | histo_value=get(handles.histo1_menu,'Value'); |
---|
| 3804 | FieldName=histo_menu{histo_value}; |
---|
| 3805 | r=regexp(FieldName,'(?<var1>.*)(?<sep>,)(?<var2>.*)','names'); |
---|
| 3806 | FieldName_2=''; |
---|
| 3807 | if ~isempty(r) |
---|
[747] | 3808 | FieldName=r.var1;% name of first variable |
---|
| 3809 | FieldName_2=r.var2;% name of second variable |
---|
[424] | 3810 | end |
---|
| 3811 | if ~isfield(UvData.Field,FieldName) |
---|
| 3812 | msgbox_uvmat('ERROR',['no field ' FieldName ' for histogram']) |
---|
| 3813 | return |
---|
| 3814 | end |
---|
[747] | 3815 | |
---|
| 3816 | %% extract the fields to use |
---|
| 3817 | % eliminate false data if relevant (false flag FF exists) |
---|
| 3818 | check_false=0; |
---|
| 3819 | if isfield(Field,'FF') && ~isempty(Field.FF) && isequal(size(Field.FF),size(Field.(FieldName))) |
---|
[424] | 3820 | indsel=find(Field.FF==0);%find values marked as false |
---|
| 3821 | if ~isempty(indsel) |
---|
[747] | 3822 | FieldHisto=Field.(FieldName)(indsel);%field of the first variable (U) |
---|
[424] | 3823 | if ~isempty(FieldName_2) |
---|
[747] | 3824 | if isfield(Field,'NbDim') && Field.NbDim==3 |
---|
| 3825 | FieldHisto(:,:,:,2)=Field.(FieldName_2)(indsel);%field of the second variable (U) |
---|
| 3826 | else |
---|
| 3827 | FieldHisto(:,:,2)=Field.(FieldName_2)(indsel);%field of the second variable (U) |
---|
| 3828 | end |
---|
[424] | 3829 | end |
---|
[747] | 3830 | check_false=1; |
---|
[387] | 3831 | end |
---|
| 3832 | end |
---|
[747] | 3833 | % no false data |
---|
| 3834 | if ~check_false |
---|
| 3835 | FieldHisto=Field.(FieldName);%field of the first variable (U) |
---|
| 3836 | if ~isempty(FieldName_2) |
---|
| 3837 | if isfield(Field,'NbDim') && Field.NbDim==3 |
---|
| 3838 | FieldHisto(:,:,:,2)=Field.(FieldName_2);%field of the second variable (V) |
---|
| 3839 | else |
---|
| 3840 | FieldHisto(:,:,2)=Field.(FieldName_2);%field of the second variable (V) |
---|
| 3841 | end |
---|
| 3842 | end |
---|
| 3843 | end |
---|
| 3844 | |
---|
| 3845 | %% calculate and plot histogram |
---|
[424] | 3846 | if isempty(Field) |
---|
| 3847 | msgbox_uvmat('ERROR',['empty field ' FieldName]) |
---|
| 3848 | else |
---|
| 3849 | nxy=size(FieldHisto); |
---|
[748] | 3850 | Amin=double(min(min(min(min(FieldHisto)))));%min of field value |
---|
| 3851 | Amax=double(max(max(max(max(FieldHisto)))));%max of field value |
---|
[424] | 3852 | if isequal(Amin,Amax) |
---|
[511] | 3853 | cla(handles.HistoAxes) |
---|
[424] | 3854 | else |
---|
| 3855 | Histo.ListVarName={FieldName,'histo'}; |
---|
| 3856 | if isfield(Field,'NbDim') && isequal(Field.NbDim,3) |
---|
| 3857 | Histo.VarDimName={FieldName,FieldName}; %dimensions for the histogram |
---|
| 3858 | else |
---|
| 3859 | if numel(nxy)==2 |
---|
| 3860 | Histo.VarDimName={FieldName,FieldName}; %dimensions for the histogram |
---|
| 3861 | else |
---|
| 3862 | Histo.VarDimName={FieldName,{FieldName,'component'}}; %dimensions for the histogram |
---|
| 3863 | end |
---|
| 3864 | end |
---|
| 3865 | %unit |
---|
| 3866 | units=[]; %default |
---|
| 3867 | for ivar=1:numel(Field.ListVarName) |
---|
| 3868 | if strcmp(Field.ListVarName{ivar},FieldName) |
---|
| 3869 | if isfield(Field,'VarAttribute') && numel(Field.VarAttribute)>=ivar && isfield(Field.VarAttribute{ivar},'units') |
---|
| 3870 | units=Field.VarAttribute{ivar}.units; |
---|
| 3871 | break |
---|
| 3872 | end |
---|
| 3873 | end |
---|
| 3874 | end |
---|
| 3875 | if ~isempty(units) |
---|
| 3876 | Histo.VarAttribute{1}.units=units; |
---|
| 3877 | end |
---|
[747] | 3878 | Histo.(FieldName)=linspace(Amin,Amax,50); %absissa values for histo |
---|
[424] | 3879 | if isfield(Field,'NbDim') && isequal(Field.NbDim,3) |
---|
| 3880 | C=reshape(double(FieldHisto),1,[]);% reshape in a vector |
---|
| 3881 | Histo.histo(:,1)=hist(C, Histo.(FieldName)); %calculate histogram |
---|
| 3882 | else |
---|
| 3883 | for col=1:size(FieldHisto,3) |
---|
| 3884 | B=FieldHisto(:,:,col); |
---|
| 3885 | C=reshape(double(B),1,nxy(1)*nxy(2));% reshape in a vector |
---|
| 3886 | Histo.histo(:,col)=hist(C, Histo.(FieldName)); %calculate histogram |
---|
| 3887 | end |
---|
| 3888 | end |
---|
[511] | 3889 | plot_field(Histo,handles.HistoAxes); |
---|
[426] | 3890 | hlegend=legend; |
---|
| 3891 | if isempty(FieldName_2) |
---|
| 3892 | set(hlegend,'String',FieldName) |
---|
| 3893 | else |
---|
| 3894 | set(hlegend,'String',{FieldName;FieldName_2}) |
---|
| 3895 | end |
---|
[424] | 3896 | end |
---|
[387] | 3897 | end |
---|
| 3898 | |
---|
[622] | 3899 | %------------------------------------------------------------------------ |
---|
[387] | 3900 | % --- translate coordinate to matrix index |
---|
[622] | 3901 | %------------------------------------------------------------------------ |
---|
[387] | 3902 | function [indx,indy]=pos2ind(x0,rangx0,nxy) |
---|
| 3903 | indx=1+round((nxy(2)-1)*(x0-rangx0(1))/(rangx0(2)-rangx0(1)));% index x of pixel |
---|
| 3904 | indy=1+round((nxy(1)-1)*(y12-rangy0(1))/(rangy0(2)-rangy0(1)));% index y of pixel |
---|
| 3905 | |
---|
[622] | 3906 | %------------------------------------------------------------------------ |
---|
[428] | 3907 | % --- Executes on button press in 'CheckZoom'. |
---|
[622] | 3908 | %------------------------------------------------------------------------ |
---|
[428] | 3909 | function CheckZoom_Callback(hObject, eventdata, handles) |
---|
| 3910 | |
---|
[699] | 3911 | if get(handles.CheckZoom,'Value') |
---|
| 3912 | set(handles.CheckFixLimits,'Value',1)% propose by default fixed limits for the plotting axes |
---|
| 3913 | set(handles.CheckZoomFig,'Value',0)%desactivate zoom fig |
---|
| 3914 | end |
---|
[428] | 3915 | |
---|
[699] | 3916 | |
---|
[622] | 3917 | %------------------------------------------------------------------------ |
---|
| 3918 | % --- Executes on button press in CheckZoomFig. |
---|
| 3919 | %------------------------------------------------------------------------ |
---|
| 3920 | function CheckZoomFig_Callback(hObject, eventdata, handles) |
---|
| 3921 | |
---|
| 3922 | if get(handles.CheckZoomFig,'Value') |
---|
| 3923 | set(handles.CheckZoom,'value',0) |
---|
| 3924 | end |
---|
| 3925 | |
---|
| 3926 | %------------------------------------------------------------------------ |
---|
[387] | 3927 | % --- Executes on button press in 'CheckFixLimits'. |
---|
[622] | 3928 | %------------------------------------------------------------------------ |
---|
[387] | 3929 | function CheckFixLimits_Callback(hObject, eventdata, handles) |
---|
[622] | 3930 | |
---|
| 3931 | if ~get(handles.CheckFixLimits,'Value') |
---|
[675] | 3932 | update_plot(handles) |
---|
| 3933 | set(handles.CheckZoom,'Value',0) |
---|
[387] | 3934 | end |
---|
| 3935 | |
---|
[622] | 3936 | %------------------------------------------------------------------------ |
---|
[428] | 3937 | % --- Executes on button press in CheckFixAspectRatio. |
---|
| 3938 | function CheckFixAspectRatio_Callback(hObject, eventdata, handles) |
---|
[622] | 3939 | %------------------------------------------------------------------------ |
---|
[750] | 3940 | update_plot(handles); |
---|
[622] | 3941 | |
---|
| 3942 | %------------------------------------------------------------------------ |
---|
[428] | 3943 | function num_AspectRatio_Callback(hObject, eventdata, handles) |
---|
[622] | 3944 | %------------------------------------------------------------------------ |
---|
[428] | 3945 | set(handles.CheckFixAspectRatio,'Value',1)% select the fixed aspect ratio button |
---|
| 3946 | update_plot(handles); |
---|
[387] | 3947 | |
---|
[622] | 3948 | %------------------------------------------------------------------------ |
---|
[387] | 3949 | %----Executes on button press in 'record': records the current flags of manual correction. |
---|
[622] | 3950 | %------------------------------------------------------------------------ |
---|
[387] | 3951 | function record_Callback(hObject, eventdata, handles) |
---|
[622] | 3952 | |
---|
[387] | 3953 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes(handles); |
---|
[450] | 3954 | FileName=[fullfile(RootPath,SubDir,RootFile) FileIndices FileExt]; |
---|
| 3955 | [erread,message]=fileattrib(FileName); |
---|
[387] | 3956 | if ~isempty(message) && ~isequal(message.UserWrite,1) |
---|
[450] | 3957 | msgbox_uvmat('ERROR',['no writting access to ' FileName]) |
---|
[387] | 3958 | return |
---|
| 3959 | end |
---|
[627] | 3960 | MenuVelType=get(handles.VelType,'String'); |
---|
| 3961 | test_civ2=strcmp(MenuVelType{get(handles.VelType,'Value')},'civ2'); |
---|
| 3962 | test_civ1=strcmp(MenuVelType{get(handles.VelType,'Value')},'civ1'); |
---|
[387] | 3963 | if ~test_civ2 && ~test_civ1 |
---|
| 3964 | msgbox_uvmat('ERROR','manual correction only possible for CIV1 or CIV2 velocity fields') |
---|
| 3965 | end |
---|
| 3966 | if test_civ2 |
---|
[627] | 3967 | nbname='nb_vec_2'; |
---|
| 3968 | flagname='Civ2_FF'; |
---|
| 3969 | CivStage=5; |
---|
[387] | 3970 | end |
---|
| 3971 | if test_civ1 |
---|
[627] | 3972 | nbname='nb_vec_1'; |
---|
| 3973 | flagname='Civ1_FF'; |
---|
| 3974 | CivStage=2; |
---|
[387] | 3975 | end |
---|
| 3976 | %write fix flags in the netcdf file |
---|
| 3977 | UvData=get(handles.uvmat,'UserData'); |
---|
| 3978 | hhh=which('netcdf.open');% look for built-in matlab netcdf library |
---|
[627] | 3979 | if ~isequal(hhh,'')% case of builtin Matlab netcdf library |
---|
[450] | 3980 | nc=netcdf.open(FileName,'NC_WRITE'); |
---|
[387] | 3981 | netcdf.reDef(nc); |
---|
[627] | 3982 | netcdf.putAtt(nc,netcdf.getConstant('NC_GLOBAL'),'CivStage',CivStage); |
---|
[387] | 3983 | dimid = netcdf.inqDimID(nc,nbname); |
---|
| 3984 | try |
---|
| 3985 | varid = netcdf.inqVarID(nc,flagname);% look for already existing fixflag variable |
---|
| 3986 | catch |
---|
| 3987 | varid=netcdf.defVar(nc,flagname,'double',dimid);%create fixflag variable if it does not exist |
---|
| 3988 | end |
---|
| 3989 | netcdf.endDef(nc); |
---|
[511] | 3990 | netcdf.putVar(nc,varid,UvData.PlotAxes.FF); |
---|
[387] | 3991 | netcdf.close(nc); |
---|
| 3992 | else %old netcdf library |
---|
[450] | 3993 | netcdf_toolbox(FileName,AxeData,attrname,nbname,flagname) |
---|
[387] | 3994 | end |
---|
| 3995 | |
---|
| 3996 | %------------------------------------------------------------------- |
---|
| 3997 | %----Correct the netcdf file, using toolbox (old versions of Matlab). |
---|
| 3998 | %------------------------------------------------------------------- |
---|
[450] | 3999 | function netcdf_toolbox(FileName,AxeData,attrname,nbname,flagname) |
---|
| 4000 | nc=netcdf(FileName,'write'); %open netcdf file |
---|
[387] | 4001 | result=redef(nc); |
---|
| 4002 | eval(['nc.' attrname '=1;']); |
---|
| 4003 | theDim=nc(nbname) ;% get the number of velocity vectors |
---|
| 4004 | nb_vectors=size(theDim); |
---|
| 4005 | var_FixFlag=ncvar(flagname,nc);% var_FixFlag will be written as the netcdf variable vec_FixFlag |
---|
| 4006 | var_FixFlag(1:nb_vectors)=AxeData.FF;% |
---|
| 4007 | fin=close(nc); |
---|
| 4008 | |
---|
[674] | 4009 | %----------------------------------------------------------------------- |
---|
[387] | 4010 | % --- Executes on button press in SubField |
---|
[674] | 4011 | %----------------------------------------------------------------------- |
---|
[387] | 4012 | function SubField_Callback(hObject, eventdata, handles) |
---|
[674] | 4013 | |
---|
| 4014 | if get(handles.SubField,'Value')==0% if the subfield button is desactivated |
---|
| 4015 | desable_subfield(handles) |
---|
[591] | 4016 | transform_fct_list=get(handles.TransformName,'String'); |
---|
| 4017 | transform_fct=transform_fct_list(get(handles.TransformName,'Value')); |
---|
[515] | 4018 | if strcmp(transform_fct,'sub_field') |
---|
[591] | 4019 | set(handles.TransformName,'Value',1)%suppress the sub_field transform |
---|
[651] | 4020 | TransformName_Callback(hObject, eventdata, handles); |
---|
[515] | 4021 | else |
---|
[713] | 4022 | REFRESH_Callback(hObject, eventdata, handles) |
---|
[515] | 4023 | end |
---|
[387] | 4024 | else |
---|
[651] | 4025 | fileinput_1=uigetfile_uvmat('select a second input file:',get(handles.RootPath,'String')); |
---|
| 4026 | if isempty(fileinput_1) |
---|
| 4027 | set(handles.SubField,'Value',0) |
---|
[674] | 4028 | else |
---|
[651] | 4029 | % refresh the current displayed field |
---|
| 4030 | display_file_name(handles,fileinput_1,2) |
---|
| 4031 | |
---|
| 4032 | %update list of recent files in the menubar |
---|
| 4033 | MenuFile_1=fileinput_1; |
---|
| 4034 | MenuFile_2=get(handles.MenuFile_1,'Label'); |
---|
| 4035 | MenuFile_3=get(handles.MenuFile_2,'Label'); |
---|
| 4036 | MenuFile_4=get(handles.MenuFile_3,'Label'); |
---|
| 4037 | MenuFile_5=get(handles.MenuFile_4,'Label'); |
---|
| 4038 | set(handles.MenuFile_1,'Label',MenuFile_1) |
---|
| 4039 | set(handles.MenuFile_2,'Label',MenuFile_2) |
---|
| 4040 | set(handles.MenuFile_3,'Label',MenuFile_3) |
---|
| 4041 | set(handles.MenuFile_4,'Label',MenuFile_4) |
---|
| 4042 | set(handles.MenuFile_5,'Label',MenuFile_5) |
---|
| 4043 | end |
---|
[387] | 4044 | end |
---|
| 4045 | |
---|
[674] | 4046 | %----------------------------------------------------------------------- |
---|
| 4047 | % --- desactivate display used for a second file series |
---|
| 4048 | %----------------------------------------------------------------------- |
---|
| 4049 | function desable_subfield(handles) |
---|
| 4050 | |
---|
| 4051 | set(handles.RootPath_1,'String','') |
---|
| 4052 | set(handles.RootFile_1,'String','') |
---|
| 4053 | set(handles.SubDir_1,'String',''); |
---|
| 4054 | set(handles.FileIndex_1,'String',''); |
---|
| 4055 | set(handles.FileExt_1,'String',''); |
---|
| 4056 | set(handles.RootPath_1,'Visible','off') |
---|
| 4057 | set(handles.RootFile_1,'Visible','off') |
---|
| 4058 | set(handles.SubDir_1,'Visible','off'); |
---|
| 4059 | set(handles.NomType_1,'Visible','off'); |
---|
| 4060 | set(handles.FileIndex_1,'Visible','off'); |
---|
| 4061 | set(handles.FileExt_1,'Visible','off'); |
---|
| 4062 | set(handles.TimeName_1,'String',''); |
---|
| 4063 | set(handles.TimeName_1,'Visible','off'); |
---|
| 4064 | set(handles.TimeValue_1,'String',''); |
---|
| 4065 | set(handles.TimeValue_1,'Visible','off'); |
---|
| 4066 | set(handles.FieldName_1,'Value',1);%set to blank state |
---|
| 4067 | set(handles.VelType_1,'Value',1);%set to blank state |
---|
| 4068 | set(handles.num_Opacity,'String','')% desactivate opacity setting |
---|
| 4069 | FieldList=get(handles.FieldName,'String'); |
---|
| 4070 | if numel(FieldList)>1 % if a choice of fields exists |
---|
| 4071 | set(handles.FieldName_1,'Value',1)% set second field choice to blank |
---|
| 4072 | set(handles.FieldName_1,'String',[{''};FieldList])% reproduce the menu FieldName plus a blank option |
---|
| 4073 | else |
---|
| 4074 | set(handles.FieldName_1,'String',{''})% set second field choice to blank |
---|
| 4075 | end |
---|
| 4076 | if ~strcmp(get(handles.VelType,'Visible'),'on') |
---|
| 4077 | set(handles.VelType_1,'Visible','off') |
---|
| 4078 | end |
---|
| 4079 | UvData=get(handles.uvmat,'UserData'); |
---|
| 4080 | if isfield(UvData,'XmlData_1') |
---|
| 4081 | UvData=rmfield(UvData,'XmlData_1'); |
---|
| 4082 | end |
---|
| 4083 | set(handles.uvmat,'UserData',UvData); |
---|
| 4084 | |
---|
[387] | 4085 | %------------------------------------------------------------------------ |
---|
| 4086 | % --- read the data displayed for the input rootfile windows (new): TODO use read_GUI |
---|
[674] | 4087 | %------------------------------------------------------------------------ |
---|
| 4088 | function [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes(handles) |
---|
[387] | 4089 | |
---|
| 4090 | InputFile=read_GUI(handles.InputFile); |
---|
| 4091 | RootPath=InputFile.RootPath; |
---|
| 4092 | SubDir=regexprep(InputFile.SubDir,'/|\',''); |
---|
| 4093 | RootFile=regexprep(InputFile.RootFile,'/|\',''); |
---|
| 4094 | FileIndices=InputFile.FileIndex; |
---|
| 4095 | FileExt=InputFile.FileExt; |
---|
| 4096 | |
---|
| 4097 | |
---|
| 4098 | %------------------------------------------------------------------------ |
---|
| 4099 | % ---- read the data displayed for the second input rootfile windows |
---|
[674] | 4100 | %------------------------------------------------------------------------ |
---|
[387] | 4101 | function [RootPath_1,SubDir_1,RootFile_1,FileIndex_1,FileExt_1,NomType_1]=read_file_boxes_1(handles) |
---|
[674] | 4102 | |
---|
[387] | 4103 | RootPath_1=get(handles.RootPath_1,'String'); % read the data from the file1_input window |
---|
| 4104 | if isequal(get(handles.RootPath_1,'Visible'),'off') || isequal(RootPath_1,'"') |
---|
| 4105 | RootPath_1=get(handles.RootPath,'String'); |
---|
| 4106 | end; |
---|
| 4107 | SubDir_1=get(handles.SubDir_1,'String'); |
---|
| 4108 | if isequal(get(handles.SubDir_1,'Visible'),'off')|| isequal(SubDir_1,'"') |
---|
| 4109 | SubDir_1=get(handles.SubDir,'String'); |
---|
| 4110 | end |
---|
| 4111 | SubDir_1=regexprep(SubDir_1,'\<[\\/]|[\\/]\>','');%suppress possible / or \ separator at the beginning or the end of the string |
---|
| 4112 | RootFile_1=get(handles.RootFile_1,'String'); |
---|
| 4113 | if isequal(get(handles.RootFile_1,'Visible'),'off') || isequal(RootFile_1,'"') |
---|
| 4114 | RootFile_1=get(handles.RootFile,'String'); |
---|
| 4115 | end |
---|
| 4116 | RootFile_1=regexprep(RootFile_1,'\<[\\/]|[\\/]\>','');%suppress possible / or \ separator at the beginning or the end of the string |
---|
| 4117 | FileIndex_1=get(handles.FileIndex_1,'String'); |
---|
| 4118 | if isequal(get(handles.FileIndex_1,'Visible'),'off')|| isequal(FileIndex_1,'"') |
---|
| 4119 | FileIndex_1=get(handles.FileIndex,'String'); |
---|
| 4120 | end |
---|
| 4121 | FileExt_1=get(handles.FileExt_1,'String'); |
---|
| 4122 | if isequal(get(handles.FileExt_1,'Visible'),'off') || isequal(FileExt_1,'"') |
---|
| 4123 | FileExt_1=get(handles.FileExt,'String');%read FileExt by default |
---|
| 4124 | end |
---|
| 4125 | NomType_1=get(handles.NomType_1,'String'); |
---|
| 4126 | if isequal(get(handles.NomType_1,'Visible'),'off') || isequal(NomType_1,'"') |
---|
| 4127 | NomType_1=get(handles.NomType,'String');%read FileExt by default |
---|
| 4128 | end |
---|
| 4129 | %------------------------------------------------------------------------ |
---|
[526] | 4130 | % --- Executes on menu selection FieldName |
---|
[747] | 4131 | |
---|
| 4132 | function FieldName_Callback(hObject, eventdata, handles) |
---|
[387] | 4133 | %------------------------------------------------------------------------ |
---|
[648] | 4134 | |
---|
| 4135 | %% read data from uvmat |
---|
[581] | 4136 | UvData=get(handles.uvmat,'UserData'); |
---|
[526] | 4137 | list_fields=get(handles.FieldName,'String');% list menu fields |
---|
| 4138 | index_fields=get(handles.FieldName,'Value');% selected string index |
---|
[387] | 4139 | field= list_fields{index_fields(1)}; % selected string |
---|
| 4140 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes(handles); |
---|
| 4141 | FileName=[fullfile(RootPath,SubDir,RootFile) FileIndices FileExt]; |
---|
| 4142 | [tild,tild,tild,i1,i2,j1,j2,tild,NomType]=fileparts_uvmat(['xxx' get(handles.FileIndex,'String') FileExt]); |
---|
[648] | 4143 | |
---|
[747] | 4144 | switch field |
---|
[648] | 4145 | case 'get_field...' |
---|
[748] | 4146 | %% fill the axes and variables from selections in get_field |
---|
[771] | 4147 | ParamIn.Title='get_field: choose input field for display in uvmat' ; |
---|
[648] | 4148 | % in case of civ data, we use the civ choice as default input for the GUI get_field |
---|
| 4149 | if strcmp(get(handles.VelType,'Visible'),'on') |
---|
| 4150 | ParamIn.SwitchVarIndexTime='attribute'; |
---|
| 4151 | ListVelType=get(handles.VelType,'String'); |
---|
| 4152 | VelType=ListVelType{get(handles.VelType,'Value')}; |
---|
| 4153 | switch VelType |
---|
| 4154 | case 'civ1' |
---|
[674] | 4155 | ParamIn.TimeAttrName='Civ1_Time'; |
---|
[648] | 4156 | ParamIn.vector_x='Civ1_U'; |
---|
| 4157 | ParamIn.vector_y='Civ1_V'; |
---|
| 4158 | ParamIn.vec_color='Civ1_C'; |
---|
| 4159 | case 'filter1' |
---|
[674] | 4160 | ParamIn.TimeAttrName='Civ1_Time'; |
---|
[648] | 4161 | ParamIn.vector_x='Civ1_U_smooth'; |
---|
| 4162 | ParamIn.vector_y='Civ1_V_smooth'; |
---|
| 4163 | case 'civ2' |
---|
[674] | 4164 | ParamIn.TimeAttrName='Civ2_Time'; |
---|
[648] | 4165 | ParamIn.vector_x='Civ2_U'; |
---|
| 4166 | ParamIn.vector_y='Civ2_V'; |
---|
| 4167 | case 'filter2' |
---|
[674] | 4168 | ParamIn.TimeAttrName='Civ2_Time'; |
---|
[648] | 4169 | ParamIn.vector_x='Civ2_U_smooth'; |
---|
| 4170 | ParamIn.vector_y='Civ2_V_smooth'; |
---|
| 4171 | ParamIn.vec_color='Civ2_C'; |
---|
| 4172 | end |
---|
| 4173 | end |
---|
| 4174 | |
---|
| 4175 | % VelType menu desactivated |
---|
| 4176 | set(handles.FixVelType,'visible','off') |
---|
| 4177 | set(handles.VelType,'Visible','off') |
---|
| 4178 | |
---|
| 4179 | %read selection from get_field |
---|
| 4180 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes(handles); |
---|
| 4181 | FileName=[fullfile(RootPath,SubDir,RootFile) FileIndices FileExt]; |
---|
| 4182 | GetFieldData=get_field(FileName,ParamIn);% inport field names from the GUI get_field |
---|
| 4183 | FieldList={}; |
---|
[726] | 4184 | VecColorList={''}; |
---|
[747] | 4185 | ZName=''; |
---|
[648] | 4186 | switch GetFieldData.FieldOption |
---|
| 4187 | case 'vectors' |
---|
| 4188 | UName=GetFieldData.PanelVectors.vector_x; |
---|
| 4189 | VName=GetFieldData.PanelVectors.vector_y; |
---|
[747] | 4190 | YName=GetFieldData.Coordinates.Coord_y; |
---|
| 4191 | if isfield(GetFieldData.Coordinates,'Coord_z') |
---|
| 4192 | ZName=GetFieldData.Coordinates.Coord_z; |
---|
| 4193 | end |
---|
[648] | 4194 | CName=GetFieldData.PanelVectors.vec_color; |
---|
[675] | 4195 | FieldList={['vec(' UName ',' VName ')'];... |
---|
| 4196 | ['norm(' UName ',' VName ')'];... |
---|
| 4197 | UName;VName}; |
---|
| 4198 | VecColorList={['norm(' UName ',' VName ')'];... |
---|
| 4199 | UName;VName}; |
---|
| 4200 | if ~isempty(CName) |
---|
| 4201 | VecColorList=[{CName};VecColorList]; |
---|
| 4202 | end |
---|
[648] | 4203 | case 'scalar' |
---|
| 4204 | AName=GetFieldData.PanelScalar.scalar; |
---|
[747] | 4205 | YName=GetFieldData.Coordinates.Coord_y; |
---|
| 4206 | if isfield(GetFieldData.Coordinates,'Coord_z') |
---|
| 4207 | ZName=GetFieldData.Coordinates.Coord_z; |
---|
| 4208 | end |
---|
[648] | 4209 | FieldList={AName}; |
---|
| 4210 | case '1D plot' |
---|
| 4211 | YName=GetFieldData.PanelOrdinate.ordinate; |
---|
[674] | 4212 | case 'civdata...'%reinitiate input, return to automatic civ data reading |
---|
| 4213 | display_file_name(handles,FileName,1) |
---|
[648] | 4214 | end |
---|
[747] | 4215 | % get time as file index, attribute, variable or matrix index |
---|
[654] | 4216 | if ~strcmp(GetFieldData.FieldOption,'civdata...') |
---|
| 4217 | XName=GetFieldData.Coordinates.Coord_x; |
---|
[674] | 4218 | TimeNameStr=GetFieldData.Time.SwitchVarIndexTime; |
---|
[693] | 4219 | switch TimeNameStr |
---|
| 4220 | case 'file index' |
---|
| 4221 | set(handles.TimeName,'String',''); |
---|
| 4222 | case 'attribute' |
---|
| 4223 | set(handles.TimeName,'String',['att:' GetFieldData.Time.TimeName]); |
---|
| 4224 | case 'variable' |
---|
| 4225 | set(handles.TimeName,'String',['var:' GetFieldData.Time.TimeName]) |
---|
| 4226 | set(handles.NomType,'String','*') |
---|
| 4227 | set(handles.RootFile,'String',[get(handles.RootFile,'String') get(handles.FileIndex,'String')]) |
---|
[747] | 4228 | set(handles.i1,'String','1')% set counter to 1 (now the time index in the input matrix) |
---|
[752] | 4229 | MaxIndex_i=get(handles.MaxIndex_i,'String'); |
---|
| 4230 | MaxIndex_i{1}=num2str(GetFieldData.Time.TimeDimension); |
---|
| 4231 | set(handles.MaxIndex_i,'String',MaxIndex_i)%TODO: record time unit |
---|
| 4232 | UvData=get(handles.uvmat,'UserData'); |
---|
| 4233 | UvData.TimeUnit=GetFieldData.Time.TimeUnit; |
---|
| 4234 | set(handles.uvmat,'UserData',UvData); |
---|
[693] | 4235 | set(handles.FileIndex,'String','') |
---|
| 4236 | ParamIn.TimeVarName=GetFieldData.Time.TimeName; |
---|
[747] | 4237 | case 'matrix index' |
---|
[693] | 4238 | set(handles.TimeName,'String',['dim:' GetFieldData.Time.TimeName]); |
---|
| 4239 | set(handles.NomType,'String','*') |
---|
[752] | 4240 | set(handles.RootFile,'String',[get(handles.RootFile,'String') get(handles.FileIndex,'String')]) |
---|
[747] | 4241 | set(handles.i1,'String','1')% set counter to 1 (now the time index in the input matrix) |
---|
[752] | 4242 | MaxIndex_i=get(handles.MaxIndex_i,'String'); |
---|
| 4243 | MaxIndex_i{1}=num2str(GetFieldData.Time.TimeDimension); |
---|
| 4244 | set(handles.MaxIndex_i,'String',MaxIndex_i)%TODO: record time unit |
---|
| 4245 | UvData=get(handles.uvmat,'UserData'); |
---|
| 4246 | UvData.TimeUnit=GetFieldData.Time.TimeUnit; |
---|
| 4247 | set(handles.uvmat,'UserData',UvData); |
---|
[693] | 4248 | set(handles.FileIndex,'String','') |
---|
| 4249 | ParamIn.TimeDimName=GetFieldData.Time.TimeName; |
---|
[674] | 4250 | end |
---|
| 4251 | set(handles.Coord_x,'String',XName) |
---|
[747] | 4252 | % if ischar(YName) |
---|
| 4253 | % YName={YName}; |
---|
| 4254 | % end |
---|
| 4255 | set(handles.Coord_y,'String',YName) |
---|
| 4256 | set(handles.Coord_z,'String',ZName) |
---|
[674] | 4257 | set(handles.FieldName,'Value',1) |
---|
| 4258 | set(handles.FieldName,'String',[FieldList; {'get_field...'}]); |
---|
| 4259 | set(handles.ColorScalar,'Value',1) |
---|
| 4260 | set(handles.ColorScalar,'String',VecColorList); |
---|
| 4261 | UvData.FileType{1}='netcdf'; |
---|
| 4262 | set(handles.uvmat,'UserData',UvData) |
---|
[713] | 4263 | REFRESH_Callback(hObject, eventdata, handles) |
---|
[648] | 4264 | end |
---|
[674] | 4265 | |
---|
[648] | 4266 | case 'image' |
---|
[674] | 4267 | %% look for image corresponding to civ data |
---|
[648] | 4268 | if isfield(UvData.Field,'Civ2_ImageA')%get the corresponding input image in the netcdf file |
---|
| 4269 | imagename=UvData.Field.Civ2_ImageA; |
---|
| 4270 | elseif isfield(UvData.Field,'Civ1_ImageA')% |
---|
| 4271 | imagename=UvData.Field.Civ1_ImageA; |
---|
| 4272 | else |
---|
| 4273 | SubDirBase=regexprep(SubDir,'\..*','');%take the root part of SubDir, before the first dot '.' |
---|
| 4274 | imagename=fullfile_uvmat(RootPath,SubDirBase,RootFile,'.png',NomType,i1,[],j1,[]); |
---|
| 4275 | end |
---|
| 4276 | if ~exist(imagename,'file') |
---|
| 4277 | imagename=uigetfile_uvmat('Pick an image file',imagename,'image'); |
---|
| 4278 | if isempty(imagename) |
---|
| 4279 | return |
---|
| 4280 | end |
---|
| 4281 | end |
---|
[387] | 4282 | % display the selected field and related information |
---|
[648] | 4283 | display_file_name(handles,imagename)%display the image |
---|
[674] | 4284 | otherwise |
---|
[713] | 4285 | REFRESH_Callback(hObject, eventdata, handles) |
---|
[387] | 4286 | end |
---|
| 4287 | |
---|
[622] | 4288 | %---------------------------------------------------------------- |
---|
[526] | 4289 | % --- Executes on menu selection FieldName |
---|
| 4290 | function FieldName_1_Callback(hObject, eventdata, handles) |
---|
[387] | 4291 | %------------------------------------------------- |
---|
[648] | 4292 | |
---|
| 4293 | %%%%%% TODO: modify like FieldName_Callback |
---|
[387] | 4294 | %% read input data |
---|
| 4295 | check_new=~get(handles.SubField,'Value'); %check_new=1 if a second field was not previously entered |
---|
| 4296 | UvData=get(handles.uvmat,'UserData'); |
---|
| 4297 | if check_new && isfield(UvData,'XmlData') |
---|
| 4298 | UvData.XmlData{2}=UvData.XmlData{1}; |
---|
| 4299 | end |
---|
[389] | 4300 | if isfield(UvData,'Field_1') |
---|
| 4301 | UvData=rmfield(UvData,'Field_1');% remove the stored second field (a new one needs to be read) |
---|
| 4302 | end |
---|
[450] | 4303 | UvData.FileName_1='';% desactivate the use of a constant second file |
---|
[526] | 4304 | list_fields=get(handles.FieldName,'String');% list menu fields |
---|
| 4305 | field= list_fields{get(handles.FieldName,'Value')}; % selected string |
---|
| 4306 | list_fields=get(handles.FieldName_1,'String');% list menu fields |
---|
| 4307 | field_1= list_fields{get(handles.FieldName_1,'Value')}; % selected string for the second field |
---|
[405] | 4308 | if isempty(field_1)%||(numel(UvData.FileType)>=2 && strcmp(UvData.FileType{2},'image')) |
---|
[387] | 4309 | set(handles.SubField,'Value',0) |
---|
| 4310 | SubField_Callback(hObject, eventdata, handles) |
---|
[428] | 4311 | return |
---|
[405] | 4312 | else |
---|
| 4313 | set(handles.SubField,'Value',1)%state that a second field is now entered |
---|
[387] | 4314 | end |
---|
| 4315 | |
---|
| 4316 | %% read the rootfile input display |
---|
[405] | 4317 | [RootPath_1,SubDir_1,RootFile_1,FileIndex_1,FileExt_1]=read_file_boxes_1(handles); |
---|
[450] | 4318 | FileName_1=[fullfile(RootPath_1,SubDir_1,RootFile_1) FileIndex_1 FileExt_1]; |
---|
[387] | 4319 | [tild,tild,tild,i1,i2,j1,j2]=fileparts_uvmat(get(handles.FileIndex,'String')); |
---|
| 4320 | switch field_1 |
---|
| 4321 | case 'get_field...' |
---|
[748] | 4322 | %% fill the axes and variables from selections in get_field |
---|
[713] | 4323 | ParamIn=[]; |
---|
| 4324 | % in case of civ data, we use the civ choice as default input for the GUI get_field |
---|
| 4325 | if strcmp(get(handles.VelType_1,'Visible'),'on') |
---|
| 4326 | ParamIn.SwitchVarIndexTime='attribute'; |
---|
| 4327 | ListVelType=get(handles.VelType_1,'String'); |
---|
| 4328 | VelType=ListVelType{get(handles.VelType_1,'Value')}; |
---|
| 4329 | switch VelType |
---|
| 4330 | case 'civ1' |
---|
| 4331 | ParamIn.TimeAttrName='Civ1_Time'; |
---|
| 4332 | ParamIn.vector_x='Civ1_U'; |
---|
| 4333 | ParamIn.vector_y='Civ1_V'; |
---|
| 4334 | ParamIn.vec_color='Civ1_C'; |
---|
| 4335 | case 'filter1' |
---|
| 4336 | ParamIn.TimeAttrName='Civ1_Time'; |
---|
| 4337 | ParamIn.vector_x='Civ1_U_smooth'; |
---|
| 4338 | ParamIn.vector_y='Civ1_V_smooth'; |
---|
| 4339 | case 'civ2' |
---|
| 4340 | ParamIn.TimeAttrName='Civ2_Time'; |
---|
| 4341 | ParamIn.vector_x='Civ2_U'; |
---|
| 4342 | ParamIn.vector_y='Civ2_V'; |
---|
| 4343 | case 'filter2' |
---|
| 4344 | ParamIn.TimeAttrName='Civ2_Time'; |
---|
| 4345 | ParamIn.vector_x='Civ2_U_smooth'; |
---|
| 4346 | ParamIn.vector_y='Civ2_V_smooth'; |
---|
| 4347 | ParamIn.vec_color='Civ2_C'; |
---|
| 4348 | end |
---|
[387] | 4349 | end |
---|
[713] | 4350 | |
---|
| 4351 | % VelType menu desactivated |
---|
| 4352 | set(handles.FixVelType,'visible','off') |
---|
| 4353 | set(handles.VelType,'Visible','off') |
---|
| 4354 | |
---|
| 4355 | %read selection from get_field |
---|
| 4356 | [RootPath,SubDir,RootFile,FileIndices,FileExt]=read_file_boxes_1(handles); |
---|
| 4357 | FileName=[fullfile(RootPath,SubDir,RootFile) FileIndices FileExt]; |
---|
| 4358 | GetFieldData=get_field(FileName,ParamIn);% inport field names from the GUI get_field |
---|
| 4359 | FieldList={}; |
---|
| 4360 | VecColorList={}; |
---|
| 4361 | switch GetFieldData.FieldOption |
---|
| 4362 | case 'vectors' |
---|
| 4363 | UName=GetFieldData.PanelVectors.vector_x; |
---|
| 4364 | VName=GetFieldData.PanelVectors.vector_y; |
---|
[747] | 4365 | YName=GetFieldData.Coordinates.Coord_y; |
---|
[713] | 4366 | CName=GetFieldData.PanelVectors.vec_color; |
---|
| 4367 | FieldList={['vec(' UName ',' VName ')'];... |
---|
| 4368 | ['norm(' UName ',' VName ')'];... |
---|
| 4369 | UName;VName}; |
---|
| 4370 | VecColorList={['norm(' UName ',' VName ')'];... |
---|
| 4371 | UName;VName}; |
---|
| 4372 | if ~isempty(CName) |
---|
| 4373 | VecColorList=[{CName};VecColorList]; |
---|
| 4374 | end |
---|
| 4375 | case 'scalar' |
---|
| 4376 | AName=GetFieldData.PanelScalar.scalar; |
---|
[747] | 4377 | YName=GetFieldData.Coordinates.Coord_y; |
---|
[713] | 4378 | FieldList={AName}; |
---|
| 4379 | case '1D plot' |
---|
| 4380 | YName=GetFieldData.PanelOrdinate.ordinate; |
---|
| 4381 | case 'civdata...'%reinitiate input, return to automatic civ data reading |
---|
| 4382 | display_file_name(handles,FileName,1) |
---|
[428] | 4383 | end |
---|
[713] | 4384 | if ~strcmp(GetFieldData.FieldOption,'civdata...') |
---|
| 4385 | XName=GetFieldData.Coordinates.Coord_x; |
---|
| 4386 | TimeNameStr=GetFieldData.Time.SwitchVarIndexTime; |
---|
| 4387 | switch TimeNameStr |
---|
| 4388 | case 'file index' |
---|
| 4389 | set(handles.TimeName_1,'String',''); |
---|
| 4390 | case 'attribute' |
---|
| 4391 | set(handles.TimeName_1,'String',['att:' GetFieldData.Time.TimeName]); |
---|
| 4392 | case 'variable' |
---|
| 4393 | set(handles.TimeName_1,'String',['var:' GetFieldData.Time.TimeName]) |
---|
| 4394 | set(handles.NomType_1,'String','*') |
---|
| 4395 | set(handles.RootFile_1,'String',[get(handles.RootFile,'String') get(handles.FileIndex,'String')]) |
---|
| 4396 | set(handles.FileIndex_1,'String','') |
---|
| 4397 | ParamIn.TimeVarName=GetFieldData.Time.TimeName; |
---|
| 4398 | case 'matrix_index' |
---|
| 4399 | set(handles.TimeName_1,'String',['dim:' GetFieldData.Time.TimeName]); |
---|
| 4400 | set(handles.NomType_1,'String','*') |
---|
| 4401 | set(handles.RootFile_1,'String',[get(handles.RootFile,'String') get(handles.FileIndex,'String')]) |
---|
| 4402 | set(handles.FileIndex_1,'String','') |
---|
| 4403 | ParamIn.TimeDimName_1=GetFieldData.Time.TimeName; |
---|
| 4404 | end |
---|
| 4405 | set(handles.Coord_x,'String',XName) |
---|
[747] | 4406 | % if ischar(YName) |
---|
| 4407 | % YName={YName}; |
---|
| 4408 | % end |
---|
| 4409 | set(handles.Coord_y,'String',YName) |
---|
[713] | 4410 | set(handles.FieldName_1,'Value',1) |
---|
| 4411 | set(handles.FieldName_1,'String',[FieldList; {'get_field...'}]); |
---|
| 4412 | set(handles.ColorScalar,'Value',1) |
---|
| 4413 | set(handles.ColorScalar,'String',VecColorList); |
---|
| 4414 | UvData.FileType{2}='netcdf'; |
---|
| 4415 | set(handles.uvmat,'UserData',UvData) |
---|
| 4416 | REFRESH_Callback(hObject, eventdata, handles) |
---|
| 4417 | end |
---|
| 4418 | |
---|
| 4419 | % set_veltype_display(0) % no veltype display |
---|
| 4420 | % hget_field=findobj(allchild(0),'name','get_field_1'); |
---|
| 4421 | % if ~isempty(hget_field) |
---|
| 4422 | % delete(hget_field) |
---|
| 4423 | % end |
---|
| 4424 | % hget_field=get_field(FileName_1); |
---|
| 4425 | % set(hget_field,'name','get_field_1') |
---|
| 4426 | % hhget_field=guidata(hget_field); |
---|
| 4427 | % set(hhget_field.list_fig,'Value',1) |
---|
| 4428 | % set(hhget_field.list_fig,'String',{'uvmat'}) |
---|
| 4429 | % if check_new |
---|
| 4430 | % UvData.FileType{2}=UvData.FileType{1}; |
---|
| 4431 | % set(handles.FileIndex_1,'String',get(handles.FileIndex,'String')) |
---|
| 4432 | % set(handles.uvmat,'UserData',UvData) |
---|
| 4433 | % end |
---|
[387] | 4434 | case 'image' |
---|
[674] | 4435 | %% look for image corresponding to civ data |
---|
| 4436 | imagename=''; |
---|
[494] | 4437 | if isfield(UvData.Field,'Civ2_ImageA')%get the corresponding input image in the netcdf file |
---|
| 4438 | imagename=UvData.Field.Civ2_ImageA; |
---|
| 4439 | elseif isfield(UvData.Field,'Civ1_ImageA')% |
---|
| 4440 | imagename=UvData.Field.Civ1_ImageA; |
---|
| 4441 | else |
---|
[674] | 4442 | SubDirBase=regexprep(SubDir,'\..*','');%take the root part of SubDir, before the first dot '.' |
---|
| 4443 | imagename=fullfile_uvmat(RootPath,SubDirBase,RootFile,'.png',NomType,i1,[],j1,[]); |
---|
[494] | 4444 | end |
---|
[674] | 4445 | if ~exist(imagename,'file') |
---|
| 4446 | imagename=uigetfile_uvmat('Pick an image file',imagename,'image'); |
---|
| 4447 | |
---|
[387] | 4448 | end |
---|
[674] | 4449 | if isempty(imagename) |
---|
[405] | 4450 | set(handles.SubField,'Value',0) |
---|
[674] | 4451 | return |
---|
| 4452 | else |
---|
| 4453 | display_file_name(handles,imagename,2)%display the image as second field |
---|
[405] | 4454 | end |
---|
[387] | 4455 | otherwise |
---|
[580] | 4456 | check_refresh=1; |
---|
| 4457 | if check_new% if a second field was not previously entered, we just read another field in the first input file |
---|
[387] | 4458 | set(handles.FileIndex_1,'String',get(handles.FileIndex,'String')) |
---|
| 4459 | set(handles.FileExt_1,'String',get(handles.FileExt,'String')) |
---|
[580] | 4460 | |
---|
| 4461 | UvData.FileType{2}=UvData.FileType{1}; |
---|
| 4462 | UvData.XmlData{2}= UvData.XmlData{1}; |
---|
[591] | 4463 | transform=get(handles.TransformPath,'UserData'); |
---|
[580] | 4464 | if (~isa(transform,'function_handle')||nargin(transform)<3) |
---|
| 4465 | set(handles.uvmat,'UserData',UvData) |
---|
[591] | 4466 | set(handles.TransformName,'value',2); % set transform fct to 'sub_field' if the current fct does not accept two input fields |
---|
[674] | 4467 | TransformName_Callback(hObject, eventdata, handles)% activate transform_fct_Callback and refresh current plot |
---|
[580] | 4468 | check_refresh=0; |
---|
| 4469 | end |
---|
[387] | 4470 | end |
---|
| 4471 | if ~isequal(field,'image') |
---|
[546] | 4472 | set(handles.TitleNpxy,'Visible','off')% visible npx,pxcm... buttons |
---|
[387] | 4473 | set(handles.num_Npx,'Visible','off') |
---|
| 4474 | set(handles.num_Npy,'Visible','off') |
---|
| 4475 | end |
---|
| 4476 | set(handles.uvmat,'UserData',UvData) |
---|
[580] | 4477 | |
---|
| 4478 | if check_refresh && ~(isfield(UvData,'NewSeries')&&isequal(UvData.NewSeries,1)) |
---|
[713] | 4479 | REFRESH_Callback(hObject, eventdata, handles) |
---|
[387] | 4480 | end |
---|
| 4481 | end |
---|
| 4482 | |
---|
| 4483 | %------------------------------------------------------------------------ |
---|
| 4484 | % --- set the visibility of relevant velocity type menus: |
---|
| 4485 | function menu=set_veltype_display(Civ,FileType) |
---|
| 4486 | %------------------------------------------------------------------------ |
---|
| 4487 | if ~exist('FileType','var') |
---|
| 4488 | FileType='civx'; |
---|
| 4489 | end |
---|
| 4490 | switch FileType |
---|
| 4491 | case 'civx' |
---|
[389] | 4492 | menu={'civ1';'interp1';'filter1';'civ2';'interp2';'filter2'}; |
---|
| 4493 | if isequal(Civ,0) |
---|
| 4494 | imax=0; |
---|
| 4495 | elseif isequal(Civ,1) || isequal(Civ,2) |
---|
| 4496 | imax=1; |
---|
| 4497 | elseif isequal(Civ,3) |
---|
| 4498 | imax=3; |
---|
| 4499 | elseif isequal(Civ,4) || isequal(Civ,5) |
---|
| 4500 | imax=4; |
---|
| 4501 | elseif isequal(Civ,6) %patch2 |
---|
| 4502 | imax=6; |
---|
| 4503 | end |
---|
[387] | 4504 | case 'civdata' |
---|
[389] | 4505 | menu={'civ1';'filter1';'civ2';'filter2'}; |
---|
| 4506 | if isequal(Civ,0) |
---|
| 4507 | imax=0; |
---|
| 4508 | elseif isequal(Civ,1) || isequal(Civ,2) |
---|
| 4509 | imax=1; |
---|
| 4510 | elseif isequal(Civ,3) |
---|
| 4511 | imax=2; |
---|
| 4512 | elseif isequal(Civ,4) || isequal(Civ,5) |
---|
| 4513 | imax=3; |
---|
| 4514 | elseif isequal(Civ,6) %patch2 |
---|
| 4515 | imax=4; |
---|
| 4516 | end |
---|
[387] | 4517 | end |
---|
| 4518 | menu=menu(1:imax); |
---|
| 4519 | |
---|
| 4520 | %------------------------------------------------------------------------ |
---|
[402] | 4521 | % --- Executes on button press in FixVelType. |
---|
| 4522 | function FixVelType_Callback(hObject, eventdata, handles) |
---|
| 4523 | %------------------------------------------------------------------------ |
---|
[713] | 4524 | % inputfilerefresh the current plot if the fixed veltype is unselected |
---|
[405] | 4525 | if ~get(handles.FixVelType,'Value') |
---|
[713] | 4526 | REFRESH_Callback(hObject, eventdata, handles) |
---|
[402] | 4527 | end |
---|
| 4528 | |
---|
| 4529 | %------------------------------------------------------------------------ |
---|
[387] | 4530 | % --- Executes on button press in VelType. |
---|
| 4531 | function VelType_Callback(hObject, eventdata, handles) |
---|
| 4532 | %------------------------------------------------------------------------ |
---|
| 4533 | set(handles.FixVelType,'Value',1) |
---|
[713] | 4534 | REFRESH_Callback(hObject, eventdata, handles) |
---|
[387] | 4535 | |
---|
| 4536 | %------------------------------------------------------------------------ |
---|
[515] | 4537 | % --- Executes on choice selection in VelType_1. |
---|
[387] | 4538 | function VelType_1_Callback(hObject, eventdata, handles) |
---|
| 4539 | %------------------------------------------------------------------------ |
---|
| 4540 | set(handles.FixVelType,'Value',1)% the velocity type is now imposed by the GUI (not automatic) |
---|
[389] | 4541 | UvData=get(handles.uvmat,'UserData'); |
---|
[713] | 4542 | set(handles.InputFileREFRESH,'BackgroundColor',[1 1 0])%paint REFRESH button in yellow to indicate its activation |
---|
[387] | 4543 | drawnow |
---|
[515] | 4544 | InputFile=read_GUI(handles.InputFile);% read the input file parameters |
---|
| 4545 | [RootPath,SubDir,RootFile,FileIndex,FileExt]=read_file_boxes(handles); |
---|
| 4546 | [RootPath_1,SubDir_1,RootFile_1,FileIndex_1,FileExt_1]=read_file_boxes_1(handles); |
---|
| 4547 | FileName=[fullfile(RootPath,SubDir,RootFile) FileIndex FileExt];% name of the first input file |
---|
[405] | 4548 | |
---|
[515] | 4549 | check_refresh=0; |
---|
[389] | 4550 | if isempty(InputFile.VelType_1) |
---|
[515] | 4551 | FileName_1='';% we plot the first input field without the second field |
---|
[387] | 4552 | set(handles.SubField,'Value',0) |
---|
[580] | 4553 | SubField_Callback(hObject, eventdata, handles)% activate SubField_Callback and refresh current plot, removing the second field |
---|
[387] | 4554 | elseif get(handles.SubField,'Value')% if subfield is already 'on' |
---|
[515] | 4555 | FileName_1=[fullfile(RootPath_1,SubDir_1,RootFile_1) FileIndex_1 FileExt_1];% name of the second input file |
---|
[580] | 4556 | check_refresh=1;%will refresh the current plot |
---|
[515] | 4557 | else% we introduce the same file (with a different field) for the second series |
---|
| 4558 | FileName_1=FileName;% we compare two fields in the same file |
---|
[389] | 4559 | UvData.FileType{2}=UvData.FileType{1}; |
---|
[515] | 4560 | UvData.XmlData{2}= UvData.XmlData{1}; |
---|
[387] | 4561 | set(handles.SubField,'Value',1) |
---|
[591] | 4562 | transform=get(handles.TransformPath,'UserData'); |
---|
[515] | 4563 | if (~isa(transform,'function_handle')||nargin(transform)<3) |
---|
[580] | 4564 | set(handles.uvmat,'UserData',UvData) |
---|
[591] | 4565 | set(handles.TransformName,'value',2); % set transform fct to 'sub_field' if the current fct does not accept two input fields |
---|
[669] | 4566 | TransformName_Callback(hObject, eventdata, handles)% activate transform_fct_Callback and refresh current plot |
---|
[515] | 4567 | else |
---|
| 4568 | check_refresh=1; |
---|
| 4569 | end |
---|
[387] | 4570 | end |
---|
| 4571 | |
---|
[713] | 4572 | % inputfilerefresh the current plot if it has not been done previously |
---|
[515] | 4573 | if check_refresh |
---|
| 4574 | UvData.FileName_1='';% desactivate the use of a constant second file |
---|
| 4575 | set(handles.uvmat,'UserData',UvData) |
---|
| 4576 | num_i1=stra2num(get(handles.i1,'String')); |
---|
| 4577 | num_i2=stra2num(get(handles.i2,'String')); |
---|
| 4578 | num_j1=stra2num(get(handles.j1,'String')); |
---|
| 4579 | num_j2=stra2num(get(handles.j2,'String')); |
---|
| 4580 | [tild,tild,tild,i1_1,i2_1,j1_1,j2_1]=fileparts_uvmat(['xx' FileIndex_1]); |
---|
| 4581 | errormsg=refresh_field(handles,FileName,FileName_1,num_i1,num_i2,num_j1,num_j2,i1_1,i2_1,j1_1,j2_1); |
---|
| 4582 | if ~isempty(errormsg) |
---|
| 4583 | msgbox_uvmat('ERROR',errormsg); |
---|
| 4584 | else |
---|
[764] | 4585 | % set(handles.i1,'BackgroundColor',[1 1 1]) |
---|
| 4586 | % set(handles.i2,'BackgroundColor',[1 1 1]) |
---|
| 4587 | % set(handles.j1,'BackgroundColor',[1 1 1]) |
---|
| 4588 | % set(handles.j2,'BackgroundColor',[1 1 1]) |
---|
| 4589 | % set(handles.FileIndex,'BackgroundColor',[1 1 1]) |
---|
| 4590 | % set(handles.FileIndex_1,'BackgroundColor',[1 1 1]) |
---|
[515] | 4591 | end |
---|
[713] | 4592 | set(handles.InputFileREFRESH,'BackgroundColor',[1 0 0]) |
---|
[387] | 4593 | end |
---|
| 4594 | |
---|
[580] | 4595 | |
---|
[622] | 4596 | %------------------------------------------------------------------------ |
---|
[387] | 4597 | % --- reset civ buttons |
---|
| 4598 | function reset_vel_type(handles_civ0,handle1) |
---|
[622] | 4599 | %------------------------------------------------------------------------ |
---|
[387] | 4600 | for ibutton=1:length(handles_civ0) |
---|
| 4601 | set(handles_civ0(ibutton),'BackgroundColor',[0.831 0.816 0.784]) |
---|
| 4602 | set(handles_civ0(ibutton),'Value',0) |
---|
| 4603 | end |
---|
| 4604 | if exist('handle1','var')%handles of selected button |
---|
| 4605 | set(handle1,'BackgroundColor',[1 1 0]) |
---|
| 4606 | end |
---|
| 4607 | |
---|
[580] | 4608 | %----------------------------------------------------------------------- |
---|
[387] | 4609 | % --- Executes on button press in MENUVOLUME. |
---|
| 4610 | function VOLUME_Callback(hObject, eventdata, handles) |
---|
[580] | 4611 | %----------------------------------------------------------------------- |
---|
[387] | 4612 | %errordlg('command VOL not implemented yet') |
---|
| 4613 | if ishandle(handles.UVMAT_title) |
---|
| 4614 | delete(handles.UVMAT_title) |
---|
| 4615 | end |
---|
| 4616 | UvData=get(handles.uvmat,'UserData');%read UvData properties stored on the uvmat interface |
---|
| 4617 | if isequal(get(handles.VOLUME,'Value'),1) |
---|
| 4618 | set(handles.CheckZoom,'Value',0) |
---|
[623] | 4619 | % set(handles.CheckZoom,'BackgroundColor',[0.7 0.7 0.7]) |
---|
[387] | 4620 | set(handles.edit_vect,'Value',0) |
---|
| 4621 | edit_vect_Callback(hObject, eventdata, handles) |
---|
[650] | 4622 | set(handles.CheckEditObject,'Value',0) |
---|
| 4623 | % set(handles.CheckEditObject,'BackgroundColor',[0.7 0.7 0.7]) |
---|
[387] | 4624 | % set(handles.cal,'Value',0) |
---|
| 4625 | % set(handles.cal,'BackgroundColor',[0 1 0]) |
---|
| 4626 | set(handles.edit_vect,'Value',0) |
---|
| 4627 | edit_vect_Callback(hObject, eventdata, handles) |
---|
| 4628 | %initiate set_object GUI |
---|
| 4629 | data.Name='VOLUME'; |
---|
| 4630 | if isfield(UvData,'CoordType') |
---|
| 4631 | data.CoordType=UvData.CoordType; |
---|
| 4632 | end |
---|
[575] | 4633 | if isfield(UvData.Field,'CoordMesh')&~isempty(UvData.Field.CoordMesh) |
---|
[404] | 4634 | data.RangeX=[UvData.Field.XMin UvData.Field.XMax]; |
---|
| 4635 | data.RangeY=[UvData.Field.YMin UvData.Field.YMax]; |
---|
[575] | 4636 | data.DX=UvData.Field.CoordMesh; |
---|
| 4637 | data.DY=UvData.Field.CoordMesh; |
---|
[782] | 4638 | elseif isfield(UvData.Field,'Coord_x')&isfield(UvData.Field,'Coord_y')& isfield(UvData.Field,'A')%only image |
---|
[387] | 4639 | np=size(UvData.Field.A); |
---|
[782] | 4640 | meshx=(UvData.Field.Coord_x(end)-UvData.Field.Coord_x(1))/np(2); |
---|
| 4641 | meshy=abs(UvData.Field.Coord_y(end)-UvData.Field.Coord_y(1))/np(1); |
---|
[387] | 4642 | data.RangeY=max(meshx,meshy); |
---|
| 4643 | data.RangeX=max(meshx,meshy); |
---|
| 4644 | data.DX=max(meshx,meshy); |
---|
| 4645 | end |
---|
| 4646 | data.ParentButton=handles.VOLUME; |
---|
| 4647 | PlotHandles=get_plot_handles(handles);%get the handles of the interface elements setting the plotting parameters |
---|
| 4648 | [hset_object,UvData.sethandles]=set_object(data,PlotHandles);% call the set_object interface with action on haxes, |
---|
| 4649 | % associate the set_object interface handle to the plotting axes |
---|
[735] | 4650 | set(hset_object,'name','set_object') |
---|
[387] | 4651 | UvData.MouseAction='create_object'; |
---|
| 4652 | else |
---|
| 4653 | set(handles.VOLUME,'BackgroundColor',[0 1 0]) |
---|
| 4654 | end |
---|
| 4655 | set(handles.uvmat,'UserData',UvData) |
---|
| 4656 | |
---|
| 4657 | %------------------------------------------------------- |
---|
| 4658 | function edit_vect_Callback(hObject, eventdata, handles) |
---|
| 4659 | %------------------------------------------------------- |
---|
| 4660 | % |
---|
| 4661 | if isequal(get(handles.edit_vect,'Value'),1) |
---|
[581] | 4662 | VelTypeMenu=get(handles.VelType,'String'); |
---|
| 4663 | VelType=VelTypeMenu{get(handles.VelType,'Value')}; |
---|
| 4664 | if ~strcmp(VelType,'civ2') && ~strcmp(VelType,'civ1') |
---|
[387] | 4665 | msgbox_uvmat('ERROR','manual correction only possible for CIV1 or CIV2 velocity fields') |
---|
| 4666 | end |
---|
| 4667 | set(handles.record,'Visible','on') |
---|
| 4668 | set(handles.edit_vect,'BackgroundColor',[1 1 0]) |
---|
[650] | 4669 | set(handles.CheckEditObject,'Value',0) |
---|
[387] | 4670 | set(handles.CheckZoom,'Value',0) |
---|
| 4671 | set(gcf,'Pointer','arrow') |
---|
| 4672 | else |
---|
| 4673 | set(handles.record,'Visible','off') |
---|
| 4674 | set(handles.edit_vect,'BackgroundColor',[0.7 0.7 0.7]) |
---|
| 4675 | end |
---|
| 4676 | |
---|
| 4677 | %---------------------------------------------- |
---|
| 4678 | function save_mask_Callback(hObject, eventdata, handles) |
---|
| 4679 | %----------------------------------------------------------------------- |
---|
| 4680 | UvData=get(handles.uvmat,'UserData'); |
---|
| 4681 | |
---|
| 4682 | flag=1; |
---|
| 4683 | npx=size(UvData.Field.A,2); |
---|
| 4684 | npy=size(UvData.Field.A,1); |
---|
| 4685 | xi=0.5:npx-0.5; |
---|
| 4686 | yi=0.5:npy-0.5; |
---|
| 4687 | [Xi,Yi]=meshgrid(xi,yi); |
---|
[622] | 4688 | if isfield(UvData,'ProjObject') |
---|
| 4689 | for iobj=1:length(UvData.ProjObject) |
---|
| 4690 | ObjectData=UvData.ProjObject{iobj}; |
---|
[387] | 4691 | if isfield(ObjectData,'ProjMode') &&(isequal(ObjectData.ProjMode,'mask_inside')||isequal(ObjectData.ProjMode,'mask_outside')); |
---|
| 4692 | flagobj=1; |
---|
| 4693 | testphys=0; %coordinates in pixels by default |
---|
| 4694 | if isfield(ObjectData,'CoordType') && isequal(ObjectData.CoordType,'phys') |
---|
| 4695 | if isfield(UvData,'XmlData')&& isfield(UvData.XmlData{1},'GeometryCalib') |
---|
| 4696 | Calib=UvData.XmlData{1}.GeometryCalib; |
---|
| 4697 | testphys=1; |
---|
| 4698 | end |
---|
| 4699 | end |
---|
| 4700 | if isfield(ObjectData,'Coord')& isfield(ObjectData,'Style') |
---|
| 4701 | if isequal(ObjectData.Type,'polygon') |
---|
| 4702 | X=ObjectData.Coord(:,1); |
---|
| 4703 | Y=ObjectData.Coord(:,2); |
---|
| 4704 | if testphys |
---|
| 4705 | [X,Y]=px_XYZ(Calib,X,Y,0);% to generalise with 3D cases |
---|
| 4706 | end |
---|
| 4707 | flagobj=~inpolygon(Xi,Yi,X',Y');%=0 inside the polygon, 1 outside |
---|
| 4708 | elseif isequal(ObjectData.Type,'ellipse') |
---|
| 4709 | if testphys |
---|
| 4710 | %[X,Y]=px_XYZ(Calib,X,Y,0);% TODO:create a polygon boundary and transform to phys |
---|
| 4711 | end |
---|
| 4712 | RangeX=max(ObjectData.RangeX); |
---|
| 4713 | RangeY=max(ObjectData.RangeY); |
---|
| 4714 | X2Max=RangeX*RangeX; |
---|
| 4715 | Y2Max=RangeY*RangeY; |
---|
| 4716 | distX=(Xi-ObjectData.Coord(1,1)); |
---|
| 4717 | distY=(Yi-ObjectData.Coord(1,2)); |
---|
| 4718 | flagobj=(distX.*distX/X2Max+distY.*distY/Y2Max)>1; |
---|
| 4719 | elseif isequal(ObjectData.Type,'rectangle') |
---|
| 4720 | if testphys |
---|
| 4721 | %[X,Y]=px_XYZ(Calib,X,Y,0);% TODO:create a polygon boundary and transform to phys |
---|
| 4722 | end |
---|
| 4723 | distX=abs(Xi-ObjectData.Coord(1,1)); |
---|
| 4724 | distY=abs(Yi-ObjectData.Coord(1,2)); |
---|
| 4725 | flagobj=distX>max(ObjectData.RangeX) | distY>max(ObjectData.RangeY); |
---|
| 4726 | end |
---|
| 4727 | if isequal(ObjectData.ProjMode,'mask_outside') |
---|
| 4728 | flagobj=~flagobj; |
---|
| 4729 | end |
---|
| 4730 | flag=flag & flagobj; |
---|
| 4731 | end |
---|
| 4732 | end |
---|
| 4733 | end |
---|
| 4734 | end |
---|
| 4735 | % flag=~flag; |
---|
| 4736 | %mask name |
---|
| 4737 | RootPath=get(handles.RootPath,'String'); |
---|
| 4738 | RootFile=get(handles.RootFile,'String'); |
---|
| 4739 | RootFile=regexprep(RootFile,'\<[\\/]|[\\/]\>','');%suppress possible / or \ separator at the beginning or the end of the string |
---|
| 4740 | filebase=fullfile(RootPath,RootFile); |
---|
| 4741 | list=get(handles.masklevel,'String'); |
---|
| 4742 | masknumber=num2str(length(list)); |
---|
| 4743 | maskindex=get(handles.masklevel,'Value'); |
---|
| 4744 | mask_name=fullfile_uvmat(RootPath,SubDir,[RootFile '_' masknumber 'mask'],'.png','_1',maskindex); |
---|
| 4745 | %mask_name=name_generator([filebase '_' masknumber 'mask'],maskindex,1,'.png','_i'); |
---|
| 4746 | imflag=uint8(255*(0.392+0.608*flag));% =100 for flag=0 (vectors not computed when 20<imflag<200) |
---|
| 4747 | imflag=flipdim(imflag,1); |
---|
| 4748 | % imflag=uint8(255*flag);% =0 for flag=0 (vectors=0 when 20<imflag<200) |
---|
| 4749 | msgbox_uvmat('CONFIRMATION',[mask_name ' saved']) |
---|
| 4750 | imwrite(imflag,mask_name,'BitDepth',8); |
---|
| 4751 | |
---|
| 4752 | %display the mask |
---|
| 4753 | figure; |
---|
| 4754 | vec=linspace(0,1,256);%define a linear greyscale colormap |
---|
| 4755 | map=[vec' vec' vec']; |
---|
| 4756 | colormap(map) |
---|
| 4757 | |
---|
| 4758 | image(imflag); |
---|
| 4759 | |
---|
[622] | 4760 | %------------------------------------------------------------------------ |
---|
| 4761 | %------------------------------------------------------------------------ |
---|
[387] | 4762 | % - FUNCTIONS FOR SETTING PLOTTING PARAMETERS |
---|
| 4763 | |
---|
[622] | 4764 | %------------------------------------------------------------------------ |
---|
| 4765 | %------------------------------------------------------------------------ |
---|
[591] | 4766 | % --- Executes on selection change in TransformName. |
---|
[508] | 4767 | |
---|
[591] | 4768 | function TransformName_Callback(hObject, eventdata, handles) |
---|
[622] | 4769 | %------------------------------------------------------------------------ |
---|
[714] | 4770 | set(handles.TransformName,'backgroundColor',[1 1 0])% indicate activation of the menu |
---|
| 4771 | drawnow |
---|
[387] | 4772 | UvData=get(handles.uvmat,'UserData'); |
---|
[671] | 4773 | menu=get(handles.TransformName,'String');%refresh |
---|
[591] | 4774 | ichoice=get(handles.TransformName,'Value');%item number in the menu |
---|
[507] | 4775 | transform_name=menu{ichoice};% choice of the transform fct |
---|
[591] | 4776 | list_path=get(handles.TransformName,'UserData'); |
---|
[507] | 4777 | |
---|
[729] | 4778 | %% handles visibility of the path to the transform function |
---|
[689] | 4779 | if isempty(transform_name) |
---|
| 4780 | set(handles.TransformPath,'Visible','off') |
---|
| 4781 | else |
---|
| 4782 | set(handles.TransformPath,'Visible','on') |
---|
| 4783 | end |
---|
| 4784 | |
---|
[507] | 4785 | %% add a new item to the menu if the option 'more...' has been selected |
---|
[591] | 4786 | prev_path=fullfile(get(handles.TransformPath,'String')); |
---|
[508] | 4787 | if ~exist(prev_path,'dir') |
---|
| 4788 | prev_path=fullfile(fileparts(which('uvmat')),'transform_field'); |
---|
| 4789 | end |
---|
[507] | 4790 | if strcmp(transform_name,'more...'); |
---|
[671] | 4791 | transform_fct_chosen=uigetfile_uvmat('Pick the transform function',prev_path,'.m'); |
---|
| 4792 | if ~isempty(transform_fct_chosen) |
---|
| 4793 | [PathName,transform_name]=fileparts(transform_fct_chosen); |
---|
[648] | 4794 | ichoice=find(strcmp(transform_name,menu),1);%look for the selected fct in the existing menu |
---|
| 4795 | if isempty(ichoice)% if the item is not found, add it to the menu (before 'more...' and select it) |
---|
| 4796 | menu=[menu(1:end-1);{transform_name};{'more...'}]; |
---|
| 4797 | ichoice=numel(menu)-1; |
---|
[507] | 4798 | end |
---|
[648] | 4799 | list_path{ichoice}=PathName;%update the list fo fct paths |
---|
| 4800 | set(handles.TransformName,'String',menu) |
---|
| 4801 | set(handles.TransformName,'Value',ichoice) |
---|
| 4802 | |
---|
| 4803 | % save the new menu in the personal file 'uvmat_perso.mat' |
---|
| 4804 | dir_perso=prefdir;%personal Matalb directory |
---|
| 4805 | profil_perso=fullfile(dir_perso,'uvmat_perso.mat'); |
---|
| 4806 | if exist(profil_perso,'file') |
---|
| 4807 | nb_builtin=UvData.OpenParam.NbBuiltin;% number of 'builtin' (basic) transform fcts in uvmat |
---|
| 4808 | if nb_builtin<numel(list_path) |
---|
| 4809 | for ilist=nb_builtin+1:numel(list_path) |
---|
| 4810 | transform_fct{ilist-nb_builtin}=[fullfile(list_path{ilist},menu{ilist}) '.m']; |
---|
| 4811 | end |
---|
| 4812 | save (profil_perso,'transform_fct','-append'); %store the root name for future opening of uvmat |
---|
| 4813 | end |
---|
[523] | 4814 | end |
---|
[507] | 4815 | end |
---|
[387] | 4816 | end |
---|
| 4817 | |
---|
[507] | 4818 | %% create the function handle of the selected fct |
---|
| 4819 | if isempty(list_path{ichoice})% case of no selected fct |
---|
| 4820 | transform_handle=[]; |
---|
[387] | 4821 | else |
---|
[507] | 4822 | if ~exist(list_path{ichoice},'dir') |
---|
| 4823 | msgbox_uvmat('ERROR','invalid fct path: select the transform fct again with the option more...') |
---|
| 4824 | return |
---|
| 4825 | end |
---|
| 4826 | current_dir=pwd;%current working dir |
---|
| 4827 | cd(list_path{ichoice}) |
---|
| 4828 | transform_handle=str2func(transform_name); |
---|
| 4829 | cd(current_dir) |
---|
[387] | 4830 | end |
---|
[591] | 4831 | set(handles.TransformPath,'String',list_path{ichoice}) |
---|
| 4832 | set(handles.TransformPath,'UserData',transform_handle) |
---|
| 4833 | set(handles.TransformName,'UserData',list_path) |
---|
[387] | 4834 | |
---|
[591] | 4835 | %% update the ToolTip string of the menu TransformName with the first line of the selected fct file |
---|
[507] | 4836 | if isempty(list_path{ichoice})% case of no selected fct |
---|
[591] | 4837 | set(handles.TransformName,'ToolTipString','transform_fct:choose a transform function') |
---|
[507] | 4838 | else |
---|
| 4839 | try |
---|
| 4840 | [fid,errormsg] =fopen([fullfile(list_path{ichoice},transform_name) '.m']); |
---|
| 4841 | InputText=textscan(fid,'%s',1,'delimiter','\n'); |
---|
[714] | 4842 | fclose(fid); |
---|
[591] | 4843 | set(handles.TransformName,'ToolTipString',['transform_fct: ' InputText{1}{1}])% put the first line of the selected function as tooltip help |
---|
[507] | 4844 | end |
---|
| 4845 | end |
---|
| 4846 | |
---|
| 4847 | %% adapt the GUI to the input/output conditions of the selected transform fct |
---|
[508] | 4848 | CoordUnit=''; |
---|
| 4849 | CoordUnitPrev=''; |
---|
| 4850 | if isfield(UvData,'Field')&&isfield(UvData.Field,'CoordUnit') |
---|
| 4851 | CoordUnitPrev=UvData.Field.CoordUnit; |
---|
| 4852 | end |
---|
[752] | 4853 | if ~isempty(list_path{ichoice}) |
---|
| 4854 | if nargin(transform_handle)>1 %&& isfield(UvData,'XmlData')&&~isempty(UvData.XmlData) |
---|
| 4855 | XmlData=[]; |
---|
| 4856 | if isfield(UvData,'XmlData')&&~isempty(UvData.XmlData) |
---|
| 4857 | XmlData=UvData.XmlData{1}; |
---|
| 4858 | end |
---|
| 4859 | UvData.Field.Action.RUN=0;% indicate that the transform fct is called only to get input param |
---|
| 4860 | DataOut=feval(transform_handle,UvData.Field,XmlData);% execute the transform fct to get the required conditions |
---|
[641] | 4861 | if isfield(DataOut,'CoordUnit')% set the requested coord unit (info used to possibly delete the current projection objects) |
---|
[508] | 4862 | CoordUnit=DataOut.CoordUnit; |
---|
[507] | 4863 | end |
---|
[641] | 4864 | if isfield(DataOut,'InputFieldType')% to be used to impose a type of input file (eg. for image transform) |
---|
[508] | 4865 | UvData.InputFieldType=DataOut.InputFieldType; |
---|
| 4866 | end |
---|
[729] | 4867 | if isfield(DataOut,'TransformInput')% used to add transform parameters at selection of the transform fct |
---|
| 4868 | UvData.XmlData{1}.TransformInput=DataOut.TransformInput; |
---|
[641] | 4869 | end |
---|
[507] | 4870 | end |
---|
| 4871 | end |
---|
| 4872 | |
---|
[508] | 4873 | %% delete drawn objects if the output CooordUnit is different from the previous one |
---|
[783] | 4874 | if ~isempty(CoordUnit) && ~isempty(CoordUnitPrev) && ~strcmp(CoordUnit,CoordUnitPrev) |
---|
[541] | 4875 | set(handles.CheckFixLimits,'Value',0) |
---|
[508] | 4876 | hother=findobj('Tag','proj_object');%find all the proj objects |
---|
| 4877 | for iobj=1:length(hother) |
---|
| 4878 | delete_object(hother(iobj)) |
---|
| 4879 | end |
---|
| 4880 | hother=findobj('Tag','DeformPoint');%find all the proj objects |
---|
| 4881 | for iobj=1:length(hother) |
---|
| 4882 | delete_object(hother(iobj)) |
---|
| 4883 | end |
---|
| 4884 | hh=findobj('Tag','calib_points'); |
---|
| 4885 | if ~isempty(hh) |
---|
| 4886 | delete(hh) |
---|
| 4887 | end |
---|
| 4888 | hhh=findobj('Tag','calib_marker'); |
---|
| 4889 | if ~isempty(hhh) |
---|
| 4890 | delete(hhh) |
---|
| 4891 | end |
---|
| 4892 | set(handles.ListObject,'Value',1) |
---|
| 4893 | set(handles.ListObject,'String',{''}) |
---|
| 4894 | set(handles.ListObject_1,'Value',1) |
---|
| 4895 | set(handles.ListObject_1,'String',{''}) |
---|
[650] | 4896 | set(handles.CheckViewObject,'value',0) |
---|
| 4897 | CheckViewObject_Callback(hObject, eventdata, handles) |
---|
| 4898 | set(handles.CheckViewField,'value',0) |
---|
| 4899 | CheckViewField_Callback(hObject, eventdata, handles) |
---|
| 4900 | set(handles.CheckEditObject,'Value',0) |
---|
| 4901 | CheckEditObject_Callback(hObject, eventdata, handles) |
---|
[622] | 4902 | UvData.ProjObject={[]}; |
---|
[387] | 4903 | end |
---|
[508] | 4904 | set(handles.uvmat,'UserData',UvData) |
---|
[714] | 4905 | set(handles.TransformName,'backgroundColor',[1 1 1])% indicate desactivation of the menu |
---|
| 4906 | drawnow |
---|
[387] | 4907 | |
---|
[713] | 4908 | %% inputfilerefresh the current plot |
---|
[515] | 4909 | if isempty(list_path{ichoice}) || nargin(transform_handle)<3 |
---|
| 4910 | set(handles.SubField,'Value',0) |
---|
| 4911 | SubField_Callback(hObject, eventdata, handles) |
---|
| 4912 | else |
---|
[713] | 4913 | REFRESH_Callback(hObject, eventdata, handles) |
---|
[515] | 4914 | end |
---|
[387] | 4915 | |
---|
| 4916 | %------------------------------------------------ |
---|
| 4917 | %CALLBACKS FOR PLOTTING PARAMETERS |
---|
| 4918 | %------------------------------------------------- |
---|
[405] | 4919 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
[748] | 4920 | % Plot axes |
---|
[405] | 4921 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
[387] | 4922 | %------------------------------------------------------------------------ |
---|
| 4923 | function num_MinX_Callback(hObject, eventdata, handles) |
---|
| 4924 | %------------------------------------------------------------------------ |
---|
| 4925 | set(handles.CheckFixLimits,'Value',1) %suppress auto mode |
---|
[627] | 4926 | % set(handles.CheckFixLimits,'BackgroundColor',[1 1 0]) |
---|
[387] | 4927 | update_plot(handles); |
---|
| 4928 | |
---|
| 4929 | %------------------------------------------------------------------------ |
---|
| 4930 | function num_MaxX_Callback(hObject, eventdata, handles) |
---|
| 4931 | %------------------------------------------------------------------------ |
---|
| 4932 | set(handles.CheckFixLimits,'Value',1) %suppress auto mode |
---|
[627] | 4933 | % set(handles.CheckFixLimits,'BackgroundColor',[1 1 0]) |
---|
[387] | 4934 | update_plot(handles); |
---|
| 4935 | |
---|
| 4936 | %------------------------------------------------------------------------ |
---|
| 4937 | function num_MinY_Callback(hObject, eventdata, handles) |
---|
| 4938 | %------------------------------------------ |
---|
| 4939 | set(handles.CheckFixLimits,'Value',1) %suppress auto mode |
---|
[627] | 4940 | % set(handles.CheckFixLimits,'BackgroundColor',[1 1 0]) |
---|
[387] | 4941 | update_plot(handles); |
---|
| 4942 | |
---|
| 4943 | %------------------------------------------------------------------------ |
---|
| 4944 | function num_MaxY_Callback(hObject, eventdata, handles) |
---|
| 4945 | %------------------------------------------------------------------------ |
---|
| 4946 | set(handles.CheckFixLimits,'Value',1) %suppress auto mode |
---|
[627] | 4947 | % set(handles.CheckFixLimits,'BackgroundColor',[1 1 0]) |
---|
[387] | 4948 | update_plot(handles); |
---|
| 4949 | |
---|
[405] | 4950 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 4951 | % Scalar or image representation |
---|
| 4952 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
[387] | 4953 | %------------------------------------------------------------------------ |
---|
| 4954 | function num_MinA_Callback(hObject, eventdata, handles) |
---|
| 4955 | %------------------------------------------ |
---|
| 4956 | set(handles.CheckFixScalar,'Value',1) %suppress auto mode |
---|
[627] | 4957 | % set(handles.CheckFixScalar,'BackgroundColor',[1 1 0]) |
---|
[387] | 4958 | MinA=str2double(get(handles.num_MinA,'String')); |
---|
| 4959 | MaxA=str2double(get(handles.num_MaxA,'String')); |
---|
| 4960 | if MinA>MaxA% switch minA and maxA in case of error |
---|
| 4961 | MinA_old=MinA; |
---|
| 4962 | MinA=MaxA; |
---|
| 4963 | MaxA=MinA_old; |
---|
| 4964 | set(handles.num_MinA,'String',num2str(MinA,5)); |
---|
| 4965 | set(handles.num_MaxA,'String',num2str(MaxA,5)); |
---|
| 4966 | end |
---|
| 4967 | update_plot(handles); |
---|
| 4968 | |
---|
| 4969 | %------------------------------------------------------------------------ |
---|
| 4970 | function num_MaxA_Callback(hObject, eventdata, handles) |
---|
| 4971 | %------------------------------------------------------------------------ |
---|
| 4972 | set(handles.CheckFixScalar,'Value',1) %suppress auto mode |
---|
[627] | 4973 | % set(handles.CheckFixScalar,'BackgroundColor',[1 1 0]) |
---|
[387] | 4974 | MinA=str2double(get(handles.num_MinA,'String')); |
---|
| 4975 | MaxA=str2double(get(handles.num_MaxA,'String')); |
---|
| 4976 | if MinA>MaxA% switch minA and maxA in case of error |
---|
| 4977 | MinA_old=MinA; |
---|
| 4978 | MinA=MaxA; |
---|
| 4979 | MaxA=MinA_old; |
---|
| 4980 | set(handles.num_MinA,'String',num2str(MinA,5)); |
---|
| 4981 | set(handles.num_MaxA,'String',num2str(MaxA,5)); |
---|
| 4982 | end |
---|
| 4983 | update_plot(handles); |
---|
| 4984 | |
---|
| 4985 | %------------------------------------------------------------------------ |
---|
| 4986 | function CheckFixScalar_Callback(hObject, eventdata, handles) |
---|
| 4987 | %------------------------------------------------------------------------ |
---|
| 4988 | test=get(handles.CheckFixScalar,'Value'); |
---|
| 4989 | if test |
---|
[627] | 4990 | % set(handles.CheckFixScalar,'BackgroundColor',[1 1 0]) |
---|
[387] | 4991 | else |
---|
[627] | 4992 | % set(handles.CheckFixScalar,'BackgroundColor',[0.7 0.7 0.7]) |
---|
[387] | 4993 | update_plot(handles); |
---|
| 4994 | end |
---|
| 4995 | |
---|
| 4996 | %------------------------------------------------------------------- |
---|
| 4997 | function CheckBW_Callback(hObject, eventdata, handles) |
---|
| 4998 | %------------------------------------------------------------------- |
---|
| 4999 | update_plot(handles); |
---|
| 5000 | |
---|
| 5001 | %------------------------------------------------------------------- |
---|
[428] | 5002 | function num_Opacity_Callback(hObject, eventdata, handles) |
---|
| 5003 | update_plot(handles); |
---|
| 5004 | %------------------------------------------------------------------- |
---|
| 5005 | |
---|
| 5006 | %------------------------------------------------------------------- |
---|
[387] | 5007 | function ListContour_Callback(hObject, eventdata, handles) |
---|
| 5008 | %------------------------------------------------------------------- |
---|
| 5009 | val=get(handles.ListContour,'Value'); |
---|
[688] | 5010 | if val==2% option 'contours' |
---|
[387] | 5011 | set(handles.interval_txt,'Visible','on') |
---|
| 5012 | set(handles.num_IncrA,'Visible','on') |
---|
[688] | 5013 | set(handles.num_IncrA,'String','')% refresh contour interval |
---|
| 5014 | % set(handles.opacity_txt,'Visible','off') |
---|
| 5015 | % set(handles.num_Opacity,'Visible','off') |
---|
| 5016 | else % option 'image' |
---|
[387] | 5017 | set(handles.interval_txt,'Visible','off') |
---|
| 5018 | set(handles.num_IncrA,'Visible','off') |
---|
[688] | 5019 | % set(handles.opacity_txt,'Visible','on') |
---|
| 5020 | % set(handles.num_Opacity,'Visible','on') |
---|
[387] | 5021 | end |
---|
| 5022 | update_plot(handles); |
---|
| 5023 | |
---|
| 5024 | %------------------------------------------------------------------- |
---|
| 5025 | function num_IncrA_Callback(hObject, eventdata, handles) |
---|
| 5026 | %------------------------------------------------------------------- |
---|
| 5027 | update_plot(handles); |
---|
| 5028 | |
---|
[405] | 5029 | |
---|
| 5030 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
| 5031 | % Vector representation |
---|
| 5032 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
---|
[387] | 5033 | %------------------------------------------------------------------- |
---|
| 5034 | function CheckHideWarning_Callback(hObject, eventdata, handles) |
---|
| 5035 | %------------------------------------------------------------------- |
---|
| 5036 | update_plot(handles); |
---|
| 5037 | |
---|
| 5038 | %------------------------------------------------------------------- |
---|
| 5039 | function CheckHideFalse_Callback(hObject, eventdata, handles) |
---|
| 5040 | %------------------------------------------------------------------- |
---|
| 5041 | update_plot(handles); |
---|
| 5042 | |
---|
| 5043 | %------------------------------------------------------------------- |
---|
| 5044 | function num_VecScale_Callback(hObject, eventdata, handles) |
---|
| 5045 | %------------------------------------------------------------------- |
---|
| 5046 | set(handles.CheckFixVectors,'Value',1); |
---|
[760] | 5047 | %set(handles.CheckFixVectors,'BackgroundColor',[1 1 0]) |
---|
[387] | 5048 | update_plot(handles); |
---|
| 5049 | |
---|
| 5050 | %------------------------------------------------------------------- |
---|
| 5051 | function CheckFixVectors_Callback(hObject, eventdata, handles) |
---|
| 5052 | %------------------------------------------------------------------- |
---|
[688] | 5053 | if ~get(handles.CheckFixVectors,'Value') |
---|
[387] | 5054 | update_plot(handles); |
---|
| 5055 | end |
---|
| 5056 | |
---|
| 5057 | %------------------------------------------------------------------------ |
---|
| 5058 | % --- Executes on selection change in CheckDecimate4 (nb_vec/4). |
---|
[622] | 5059 | %------------------------------------------------------------------------ |
---|
[387] | 5060 | function CheckDecimate4_Callback(hObject, eventdata, handles) |
---|
[622] | 5061 | |
---|
[581] | 5062 | if isequal(get(handles.CheckDecimate4,'Value'),1) |
---|
| 5063 | set(handles.CheckDecimate16,'Value',0) |
---|
| 5064 | end |
---|
[387] | 5065 | update_plot(handles); |
---|
| 5066 | |
---|
| 5067 | %------------------------------------------------------------------------ |
---|
[581] | 5068 | % --- Executes on selection change in CheckDecimate16 (nb_vec/16). |
---|
[622] | 5069 | %------------------------------------------------------------------------ |
---|
[581] | 5070 | function CheckDecimate16_Callback(hObject, eventdata, handles) |
---|
[622] | 5071 | |
---|
[581] | 5072 | if isequal(get(handles.CheckDecimate16,'Value'),1) |
---|
| 5073 | set(handles.CheckDecimate4,'Value',0) |
---|
| 5074 | end |
---|
| 5075 | update_plot(handles); |
---|
| 5076 | |
---|
| 5077 | %------------------------------------------------------------------------ |
---|
[405] | 5078 | % --- Executes on selection change in ColorCode menu |
---|
| 5079 | function ColorCode_Callback(hObject, eventdata, handles) |
---|
[387] | 5080 | %------------------------------------------------------------------------ |
---|
[405] | 5081 | % edit the choice for color code |
---|
| 5082 | update_color_code_boxes(handles); |
---|
| 5083 | update_plot(handles); |
---|
| 5084 | |
---|
| 5085 | %------------------------------------------------------------------------ |
---|
| 5086 | function update_color_code_boxes(handles) |
---|
| 5087 | %------------------------------------------------------------------------ |
---|
| 5088 | list_code=get(handles.ColorCode,'String');% list menu fields |
---|
| 5089 | colcode= list_code{get(handles.ColorCode,'Value')}; % selected field |
---|
| 5090 | enable_slider='off';%default |
---|
| 5091 | enable_bounds='off';%default |
---|
| 5092 | enable_scalar='off';%default |
---|
| 5093 | switch colcode |
---|
| 5094 | case {'rgb','bgr'} |
---|
| 5095 | enable_slider='on'; |
---|
| 5096 | enable_bounds='on'; |
---|
| 5097 | enable_scalar='on'; |
---|
| 5098 | case '64 colors' |
---|
| 5099 | enable_bounds='on'; |
---|
| 5100 | enable_scalar='on'; |
---|
| 5101 | end |
---|
| 5102 | set(handles.Slider1,'Visible',enable_slider) |
---|
| 5103 | set(handles.Slider2,'Visible', enable_slider) |
---|
| 5104 | set(handles.num_ColCode1,'Visible',enable_slider) |
---|
| 5105 | set(handles.num_ColCode2,'Visible',enable_slider) |
---|
| 5106 | set(handles.TitleColCode1,'Visible',enable_slider) |
---|
| 5107 | set(handles.TitleColCode2,'Visible',enable_slider) |
---|
| 5108 | set(handles.CheckFixVecColor,'Visible',enable_bounds) |
---|
| 5109 | set(handles.num_MinVec,'Visible',enable_bounds) |
---|
| 5110 | set(handles.num_MaxVec,'Visible',enable_bounds) |
---|
| 5111 | set(handles.ColorScalar,'Visible',enable_scalar) |
---|
[387] | 5112 | set_vec_col_bar(handles) |
---|
[405] | 5113 | |
---|
| 5114 | %------------------------------------------------------------------ |
---|
| 5115 | % --- Executes on selection change in ColorScalar: choice of the color code. |
---|
| 5116 | function ColorScalar_Callback(hObject, eventdata, handles) |
---|
| 5117 | %------------------------------------------------------------------ |
---|
| 5118 | % edit the choice for color code |
---|
| 5119 | list_scalar=get(handles.ColorScalar,'String');% list menu fields |
---|
| 5120 | col_scalar= list_scalar{get(handles.ColorScalar,'Value')}; % selected field |
---|
| 5121 | if isequal(col_scalar,'ima_cor') |
---|
| 5122 | set(handles.CheckFixVecColor,'Value',1)%fixed scale by default |
---|
| 5123 | ColorCode='rgb'; |
---|
| 5124 | set(handles.num_MinVec,'String','0') |
---|
| 5125 | set(handles.num_MaxVec,'String','1') |
---|
| 5126 | set(handles.num_ColCode1,'String','0.333') |
---|
| 5127 | set(handles.num_ColCode2,'String','0.666') |
---|
| 5128 | else |
---|
| 5129 | set(handles.CheckFixVecColor,'Value',0)%auto scale between min,max by default |
---|
| 5130 | ColorCode='64 colors'; |
---|
| 5131 | end |
---|
| 5132 | ColorCodeList=get(handles.ColorCode,'String'); |
---|
| 5133 | ichoice=find(strcmp(ColorCode,ColorCodeList),1); |
---|
| 5134 | set(handles.ColorCode,'Value',ichoice)% set color code in the menu |
---|
| 5135 | |
---|
| 5136 | update_color_code_boxes(handles); |
---|
| 5137 | %replot the current graph |
---|
[713] | 5138 | REFRESH_Callback(hObject, eventdata, handles) |
---|
[405] | 5139 | |
---|
| 5140 | %---------------------------------------------------------------- |
---|
| 5141 | % -- Executes on slider movement to set the color code |
---|
| 5142 | % |
---|
| 5143 | function Slider1_Callback(hObject, eventdata, handles) |
---|
| 5144 | %------------------------------------------------------------------ |
---|
| 5145 | slider1=get(handles.Slider1,'Value'); |
---|
| 5146 | min_val=str2num(get(handles.num_MinVec,'String')); |
---|
| 5147 | max_val=str2num(get(handles.num_MaxVec,'String')); |
---|
| 5148 | col=min_val+(max_val-min_val)*slider1; |
---|
| 5149 | set(handles.num_ColCode1,'String',num2str(col)) |
---|
| 5150 | if(get(handles.Slider2,'Value') < col)%move also the second slider at the same value if needed |
---|
| 5151 | set(handles.Slider2,'Value',col) |
---|
| 5152 | set(handles.num_ColCode2,'String',num2str(col)) |
---|
| 5153 | end |
---|
| 5154 | set_vec_col_bar(handles) |
---|
[387] | 5155 | update_plot(handles); |
---|
| 5156 | |
---|
[405] | 5157 | %---------------------------------------------------------------- |
---|
| 5158 | % Executes on slider movement to set the color code |
---|
| 5159 | %---------------------------------------------------------------- |
---|
| 5160 | function Slider2_Callback(hObject, eventdata, handles) |
---|
| 5161 | slider2=get(handles.Slider2,'Value'); |
---|
| 5162 | min_val=str2num(get(handles.num_MinVec,'String')); |
---|
| 5163 | max_val=str2num(get(handles.num_MaxVec,'String')); |
---|
| 5164 | col=min_val+(max_val-min_val)*slider2; |
---|
| 5165 | set(handles.num_ColCode2,'String',num2str(col)) |
---|
| 5166 | if(get(handles.Slider1,'Value') > col)%move also the first slider at the same value if needed |
---|
| 5167 | set(handles.Slider1,'Value',col) |
---|
| 5168 | set(handles.num_ColCode1,'String',num2str(col)) |
---|
| 5169 | end |
---|
| 5170 | set_vec_col_bar(handles) |
---|
| 5171 | update_plot(handles); |
---|
| 5172 | |
---|
| 5173 | %---------------------------------------------------------------- |
---|
| 5174 | % --- Execute on return carriage on the edit box corresponding to slider 1 |
---|
| 5175 | %---------------------------------------------------------------- |
---|
| 5176 | function num_ColCode1_Callback(hObject, eventdata, handles) |
---|
| 5177 | set_vec_col_bar(handles) |
---|
| 5178 | update_plot(handles); |
---|
| 5179 | |
---|
| 5180 | %---------------------------------------------------------------- |
---|
| 5181 | % --- Execute on return carriage on the edit box corresponding to slider 2 |
---|
| 5182 | %---------------------------------------------------------------- |
---|
| 5183 | function num_ColCode2_Callback(hObject, eventdata, handles) |
---|
| 5184 | set_vec_col_bar(handles) |
---|
| 5185 | update_plot(handles); |
---|
[387] | 5186 | %------------------------------------------------------------------------ |
---|
[405] | 5187 | %------------------------------------------------------- |
---|
[387] | 5188 | % --- Executes on button press in CheckFixVecColor. |
---|
[405] | 5189 | %------------------------------------------------------- |
---|
| 5190 | function VecColBar_Callback(hObject, eventdata, handles) |
---|
| 5191 | set_vec_col_bar(handles) |
---|
| 5192 | |
---|
| 5193 | %------------------------------------------------------------------------ |
---|
| 5194 | % --- Executes on button press in CheckFixVecColor. |
---|
[387] | 5195 | function CheckFixVecColor_Callback(hObject, eventdata, handles) |
---|
| 5196 | %------------------------------------------------------------------------ |
---|
[405] | 5197 | if ~get(handles.CheckFixVecColor,'Value') |
---|
[387] | 5198 | update_plot(handles); |
---|
| 5199 | end |
---|
| 5200 | |
---|
| 5201 | %------------------------------------------------------------------------ |
---|
| 5202 | % --- Executes on selection change in num_MaxVec. |
---|
| 5203 | function num_MinVec_Callback(hObject, eventdata, handles) |
---|
| 5204 | %------------------------------------------------------------------------ |
---|
[654] | 5205 | num_MaxVec_Callback(hObject, eventdata, handles) |
---|
[387] | 5206 | |
---|
| 5207 | %------------------------------------------------------------------------ |
---|
| 5208 | % --- Executes on selection change in num_MaxVec. |
---|
| 5209 | function num_MaxVec_Callback(hObject, eventdata, handles) |
---|
| 5210 | %------------------------------------------------------------------------ |
---|
| 5211 | set(handles.CheckFixVecColor,'Value',1) |
---|
| 5212 | CheckFixVecColor_Callback(hObject, eventdata, handles) |
---|
| 5213 | min_val=str2num(get(handles.num_MinVec,'String')); |
---|
| 5214 | max_val=str2num(get(handles.num_MaxVec,'String')); |
---|
| 5215 | slider1=get(handles.Slider1,'Value'); |
---|
| 5216 | slider2=get(handles.Slider2,'Value'); |
---|
| 5217 | colcode1=min_val+(max_val-min_val)*slider1; |
---|
| 5218 | colcode2=min_val+(max_val-min_val)*slider2; |
---|
| 5219 | set(handles.num_ColCode1,'String',num2str(colcode1)) |
---|
| 5220 | set(handles.num_ColCode2,'String',num2str(colcode2)) |
---|
| 5221 | update_plot(handles); |
---|
| 5222 | |
---|
| 5223 | %------------------------------------------------------------------------ |
---|
[405] | 5224 | % --- update the display of color code for vectors (on vecColBar) |
---|
[387] | 5225 | function set_vec_col_bar(handles) |
---|
| 5226 | %------------------------------------------------------------------------ |
---|
| 5227 | %get the image of the color display button 'VecColBar' in pixels |
---|
[781] | 5228 | set(handles.VecColBar,'Units','pixel'); |
---|
[387] | 5229 | pos_vert=get(handles.VecColBar,'Position'); |
---|
[781] | 5230 | set(handles.VecColBar,'Units','Normalized'); |
---|
[387] | 5231 | width=ceil(pos_vert(3)); |
---|
| 5232 | height=ceil(pos_vert(4)); |
---|
| 5233 | |
---|
| 5234 | %get slider indications |
---|
[405] | 5235 | list=get(handles.ColorCode,'String'); |
---|
| 5236 | ichoice=get(handles.ColorCode,'Value'); |
---|
| 5237 | colcode.ColorCode=list{ichoice}; |
---|
[387] | 5238 | colcode.MinVec=str2num(get(handles.num_MinVec,'String')); |
---|
| 5239 | colcode.MaxVec=str2num(get(handles.num_MaxVec,'String')); |
---|
[405] | 5240 | test3color=strcmp(colcode.ColorCode,'rgb') || strcmp(colcode.ColorCode,'bgr'); |
---|
[387] | 5241 | if test3color |
---|
| 5242 | colcode.ColCode1=str2num(get(handles.num_ColCode1,'String')); |
---|
| 5243 | colcode.ColCode2=str2num(get(handles.num_ColCode2,'String')); |
---|
| 5244 | end |
---|
| 5245 | vec_C=colcode.MinVec+(colcode.MaxVec-colcode.MinVec)*(0.5:width-0.5)/width;%sample of vec_C values from min to max |
---|
| 5246 | [colorlist,col_vec]=set_col_vec(colcode,vec_C); |
---|
| 5247 | oneheight=ones(1,height); |
---|
| 5248 | A1=colorlist(col_vec,1)*oneheight; |
---|
| 5249 | A2=colorlist(col_vec,2)*oneheight; |
---|
| 5250 | A3=colorlist(col_vec,3)*oneheight; |
---|
| 5251 | A(:,:,1)=A1'; |
---|
| 5252 | A(:,:,2)=A2'; |
---|
| 5253 | A(:,:,3)=A3'; |
---|
| 5254 | set(handles.VecColBar,'Cdata',A) |
---|
| 5255 | |
---|
| 5256 | %------------------------------------------------------------------- |
---|
| 5257 | function update_plot(handles) |
---|
| 5258 | %------------------------------------------------------------------- |
---|
[713] | 5259 | set(handles.REFRESH,'BackgroundColor',[1 1 0]);% display plot activity by yellow color |
---|
[688] | 5260 | drawnow |
---|
[387] | 5261 | UvData=get(handles.uvmat,'UserData'); |
---|
[789] | 5262 | AxeData=[]; |
---|
| 5263 | if isfield(UvData,'PlotAxes') |
---|
[511] | 5264 | AxeData=UvData.PlotAxes;% retrieve the current plotted data |
---|
[789] | 5265 | end |
---|
[387] | 5266 | PlotParam=read_GUI(handles.uvmat); |
---|
[511] | 5267 | [tild,PlotParamOut]= plot_field(AxeData,handles.PlotAxes,PlotParam); |
---|
[595] | 5268 | errormsg=fill_GUI(PlotParamOut,handles.uvmat); |
---|
[764] | 5269 | if isempty(errormsg) |
---|
| 5270 | set(handles.REFRESH,'BackgroundColor',[1 0 0]);% operation finished, back to red color |
---|
| 5271 | else |
---|
[688] | 5272 | msgbox_uvmat('ERROR',errormsg) |
---|
[764] | 5273 | set(handles.REFRESH,'BackgroundColor',[1 0 1]);% magenta color: graph still needs to be updated |
---|
[681] | 5274 | end |
---|
[387] | 5275 | |
---|
[764] | 5276 | |
---|
[402] | 5277 | %------------------------------------------------------------------------ |
---|
| 5278 | %------------------------------------------------------------------------ |
---|
| 5279 | % SELECTION AND EDITION OF PROJECTION OBJECTS |
---|
| 5280 | %------------------------------------------------------------------------ |
---|
| 5281 | %------------------------------------------------------------------------ |
---|
[387] | 5282 | |
---|
[410] | 5283 | % --- Executes on selection change in ListObject_1. |
---|
| 5284 | function ListObject_1_Callback(hObject, eventdata, handles) |
---|
[432] | 5285 | list_str=get(handles.ListObject,'String'); |
---|
[410] | 5286 | UvData=get(handles.uvmat,'UserData'); |
---|
[622] | 5287 | ObjectData=UvData.ProjObject{get(handles.ListObject_1,'Value')}; |
---|
[410] | 5288 | |
---|
| 5289 | %% update the projection plot on uvmat |
---|
[432] | 5290 | ProjData= proj_field(UvData.Field,ObjectData);%project the current input field on object ObjectData |
---|
[511] | 5291 | plot_field(ProjData,handles.PlotAxes,read_GUI(handles.uvmat));% plot the projected field; |
---|
[432] | 5292 | %replot all the objects within the new projected field |
---|
| 5293 | for IndexObj=1:numel(list_str) |
---|
[622] | 5294 | hobject=UvData.ProjObject{IndexObj}.DisplayHandle.uvmat; |
---|
[432] | 5295 | if isempty(hobject) || ~ishandle(hobject) |
---|
[515] | 5296 | hobject=handles.PlotAxes; |
---|
[432] | 5297 | end |
---|
| 5298 | if isequal(IndexObj,get(handles.ListObject,'Value')) |
---|
| 5299 | objectcolor='m'; %paint in magenta the currently selected object in ListObject |
---|
| 5300 | else |
---|
| 5301 | objectcolor='b'; |
---|
| 5302 | end |
---|
[622] | 5303 | UvData.ProjObject{IndexObj}.DisplayHandle.uvmat=plot_object(UvData.ProjObject{IndexObj},ObjectData,hobject,objectcolor);%draw the object in uvmat |
---|
[432] | 5304 | end |
---|
| 5305 | set(handles.uvmat,'UserData',UvData) |
---|
[410] | 5306 | |
---|
| 5307 | %% display the object parameters if the GUI set_object is already opened |
---|
[650] | 5308 | if ~get(handles.CheckViewObject,'Value') |
---|
[410] | 5309 | ZBounds=0; % default |
---|
| 5310 | if isfield(UvData.Field,'ZMin') && isfield(UvData.Field,'ZMax') |
---|
| 5311 | ZBounds(1)=UvData.Field.ZMin; %minimum for the Z slider |
---|
| 5312 | ZBounds(2)=UvData.Field.ZMax;%maximum for the Z slider |
---|
| 5313 | end |
---|
[425] | 5314 | ObjectData.Name=list_str{get(handles.ListObject_1,'Value')}; |
---|
[735] | 5315 | hset_object=set_object(ObjectData,[],ZBounds); |
---|
| 5316 | set(hset_object,'name','set_object') |
---|
[650] | 5317 | set(handles.CheckViewObject,'Value',1)% show that the selected object in ListObject_1 is currently visualised |
---|
[410] | 5318 | end |
---|
[432] | 5319 | |
---|
[410] | 5320 | % desactivate the edit object mode |
---|
[650] | 5321 | set(handles.CheckEditObject,'Value',0) |
---|
| 5322 | % set(handles.CheckEditObject,'BackgroundColor',[0.7,0.7,0.7]) |
---|
[410] | 5323 | |
---|
[387] | 5324 | %------------------------------------------------------------------------ |
---|
| 5325 | % --- Executes on selection change in ListObject. |
---|
| 5326 | function ListObject_Callback(hObject, eventdata, handles) |
---|
| 5327 | %------------------------------------------------------------------------ |
---|
| 5328 | list_str=get(handles.ListObject,'String'); |
---|
| 5329 | IndexObj=get(handles.ListObject,'Value');%present object selection |
---|
[402] | 5330 | UvData=get(handles.uvmat,'UserData'); |
---|
[729] | 5331 | if numel(UvData.ProjObject)<IndexObj |
---|
| 5332 | return |
---|
| 5333 | end |
---|
[622] | 5334 | ObjectData=UvData.ProjObject{IndexObj}; |
---|
[402] | 5335 | ZBounds=0; % default |
---|
| 5336 | if isfield(UvData.Field,'ZMin') && isfield(UvData.Field,'ZMax') |
---|
| 5337 | ZBounds(1)=UvData.Field.ZMin; %minimum for the Z slider |
---|
| 5338 | ZBounds(2)=UvData.Field.ZMax;%maximum for the Z slider |
---|
| 5339 | end |
---|
[625] | 5340 | |
---|
| 5341 | %% show object features if view_object isselected |
---|
[650] | 5342 | if get(handles.CheckViewObject,'value') |
---|
[735] | 5343 | hset_object=set_object(ObjectData,[],ZBounds); |
---|
| 5344 | set(hset_object,'name','set_object') |
---|
[402] | 5345 | end |
---|
[429] | 5346 | |
---|
[625] | 5347 | %% desactivate the edit object mode for security |
---|
[650] | 5348 | set(handles.CheckEditObject,'Value',0) |
---|
[625] | 5349 | |
---|
[429] | 5350 | %% update the plot on view_field if view_field is already openened |
---|
| 5351 | hview_field=findobj(allchild(0),'tag','view_field'); |
---|
| 5352 | if isempty(hview_field) |
---|
[511] | 5353 | hhview_field.PlotAxes=[]; |
---|
[429] | 5354 | else |
---|
| 5355 | Data=get(hview_field,'UserData'); |
---|
| 5356 | hhview_field=guidata(hview_field); |
---|
| 5357 | ProjData= proj_field(UvData.Field,ObjectData);%project the current interface field on ObjectData |
---|
[595] | 5358 | [PlotType,PlotParam]=plot_field(ProjData,hhview_field.PlotAxes,read_GUI(hview_field));%read plotting parameters on the uvmat interface |
---|
[429] | 5359 | haxes=findobj(hview_field,'tag','axes3'); |
---|
| 5360 | pos=get(hview_field,'Position'); |
---|
[748] | 5361 | if strcmp(get(haxes,'Visible'),'off')%sempty(PlotParam.Axes)% case of no plot display (pure text table) |
---|
[429] | 5362 | h_TableDisplay=findobj(hview_field,'tag','TableDisplay'); |
---|
| 5363 | pos_table=get(h_TableDisplay,'Position'); |
---|
| 5364 | set(hview_field,'Position',[pos(1)+pos(3)-pos_table(3) pos(2)+pos(4)-pos_table(4) pos_table(3) pos_table(4)]) |
---|
| 5365 | drawnow% needed to change position before the next command |
---|
| 5366 | set(hview_field,'UserData',Data);% restore the previously stored GUI position after GUI resizing |
---|
| 5367 | else |
---|
[644] | 5368 | % set(hview_field,'Position',Data.GUISize)% return to the previously stored GUI position and size |
---|
[387] | 5369 | end |
---|
| 5370 | end |
---|
| 5371 | |
---|
[402] | 5372 | %% update the color of the graphic object representation: the selected object in magenta, others in blue |
---|
[622] | 5373 | update_object_color(handles.PlotAxes,hhview_field.PlotAxes,UvData.ProjObject{IndexObj}.DisplayHandle.uvmat) |
---|
[387] | 5374 | |
---|
| 5375 | %------------------------------------------------------------------------ |
---|
[402] | 5376 | %--- update the color representation of objects (indicating the selected ones) |
---|
| 5377 | function update_object_color(axes_uvmat,axes_view_field,DisplayHandle) |
---|
[387] | 5378 | %------------------------------------------------------------------------ |
---|
[402] | 5379 | if isempty(axes_view_field)% case with no view_field plot |
---|
| 5380 | hother=[findobj(axes_uvmat,'Tag','proj_object');findobj(axes_uvmat,'Tag','DeformPoint')];%find all the proj object and deform point representations |
---|
[387] | 5381 | else |
---|
[402] | 5382 | hother=[findobj(axes_uvmat,'Tag','proj_object') ;findobj(axes_view_field,'Tag','proj_object');... %find all the proj object representations |
---|
| 5383 | findobj(axes_uvmat,'Tag','DeformPoint'); findobj(axes_view_field,'Tag','DeformPoint')];%find all the deform point representations |
---|
[387] | 5384 | end |
---|
| 5385 | for iobj=1:length(hother) |
---|
| 5386 | if isequal(get(hother(iobj),'Type'),'rectangle')||isequal(get(hother(iobj),'Type'),'patch') |
---|
| 5387 | set(hother(iobj),'EdgeColor','b') |
---|
| 5388 | if isequal(get(hother(iobj),'FaceColor'),'m') |
---|
| 5389 | set(hother(iobj),'FaceColor','b') |
---|
| 5390 | end |
---|
| 5391 | elseif isequal(get(hother(iobj),'Type'),'image') |
---|
| 5392 | Acolor=get(hother(iobj),'CData'); |
---|
| 5393 | Acolor(:,:,1)=zeros(size(Acolor,1),size(Acolor,2)); |
---|
| 5394 | set(hother(iobj),'CData',Acolor); |
---|
| 5395 | else |
---|
| 5396 | set(hother(iobj),'Color','b') |
---|
| 5397 | end |
---|
| 5398 | set(hother(iobj),'Selected','off') |
---|
| 5399 | end |
---|
[432] | 5400 | if ishandle(DisplayHandle) |
---|
[402] | 5401 | linetype=get(DisplayHandle,'Type'); |
---|
| 5402 | if isequal(linetype,'line') |
---|
| 5403 | set(DisplayHandle,'Color','m'); %set the selected object to magenta color |
---|
| 5404 | elseif isequal(linetype,'rectangle') |
---|
| 5405 | set(DisplayHandle,'EdgeColor','m'); %set the selected object to magenta color |
---|
| 5406 | elseif isequal(linetype,'patch') |
---|
| 5407 | set(DisplayHandle,'FaceColor','m'); %set the selected object to magenta color |
---|
| 5408 | end |
---|
| 5409 | SubObjectData=get(DisplayHandle,'UserData'); |
---|
| 5410 | if isfield(SubObjectData,'SubObject') & ishandle(SubObjectData.SubObject) |
---|
| 5411 | for iobj=1:length(SubObjectData.SubObject) |
---|
| 5412 | hsub=SubObjectData.SubObject(iobj); |
---|
| 5413 | if isequal(get(hsub,'Type'),'rectangle') |
---|
| 5414 | set(hsub,'EdgeColor','m'); %set the selected object to magenta color |
---|
| 5415 | elseif isequal(get(hsub,'Type'),'image') |
---|
| 5416 | Acolor=get(hsub,'CData'); |
---|
| 5417 | Acolor(:,:,1)=Acolor(:,:,3); |
---|
| 5418 | set(hsub,'CData',Acolor); |
---|
| 5419 | else |
---|
| 5420 | set(hsub,'Color','m') |
---|
| 5421 | end |
---|
[387] | 5422 | end |
---|
| 5423 | end |
---|
[402] | 5424 | if isfield(SubObjectData,'DeformPoint') & ishandle(SubObjectData.DeformPoint) |
---|
| 5425 | set(SubObjectData.DeformPoint,'Color','m') |
---|
| 5426 | end |
---|
[387] | 5427 | end |
---|
[402] | 5428 | |
---|
[427] | 5429 | %------------------------------------------------------------------- |
---|
[650] | 5430 | % --- Executes on selection change in CheckEditObject. |
---|
| 5431 | function CheckEditObject_Callback(hObject, eventdata, handles) |
---|
[427] | 5432 | %------------------------------------------------------------------- |
---|
| 5433 | hset_object=findobj(allchild(0),'Tag','set_object'); |
---|
[650] | 5434 | if get(handles.CheckEditObject,'Value') |
---|
[427] | 5435 | %suppress the other options |
---|
[701] | 5436 | set(handles.MenuObject,'checked','off') |
---|
[427] | 5437 | set(handles.CheckZoom,'Value',0) |
---|
| 5438 | CheckZoom_Callback(hObject, eventdata, handles) |
---|
| 5439 | hgeometry_calib=findobj(allchild(0),'tag','geometry_calib'); |
---|
| 5440 | if ishandle(hgeometry_calib) |
---|
| 5441 | hhgeometry_calib=guidata(hgeometry_calib); |
---|
[660] | 5442 | set(hhgeometry_calib.CheckEnableMouse,'Value',0)% desactivate mouse action in geometry_calib |
---|
[682] | 5443 | set(hhgeometry_calib.CheckEnableMouse,'BackgroundColor',[0.7 0.7 0.7]) |
---|
[427] | 5444 | end |
---|
[650] | 5445 | set(handles.CheckViewObject,'value',1) |
---|
| 5446 | CheckViewObject_Callback(hObject, eventdata, handles) |
---|
[625] | 5447 | else % desactivate object edit mode |
---|
[427] | 5448 | if ~isempty(hset_object)% open the |
---|
[625] | 5449 | set(get(hset_object,'children'),'Enable','off') |
---|
| 5450 | hSAVE=findobj(hset_object,'Tag','SAVE'); |
---|
| 5451 | set(hSAVE,'Enable','on') |
---|
[427] | 5452 | end |
---|
| 5453 | end |
---|
| 5454 | |
---|
| 5455 | |
---|
[402] | 5456 | %------------------------------------------------------------------------ |
---|
[650] | 5457 | % --- Executes on button press in CheckViewObject. |
---|
| 5458 | function CheckViewObject_Callback(hObject, eventdata, handles) |
---|
[410] | 5459 | %------------------------------------------------------------------------ |
---|
[650] | 5460 | check_view=get(handles.CheckViewObject,'Value'); |
---|
[410] | 5461 | |
---|
| 5462 | if check_view %activate set_object |
---|
[424] | 5463 | IndexObj=get(handles.ListObject,'Value'); |
---|
| 5464 | list_object=get(handles.ListObject,'String'); |
---|
[410] | 5465 | UvData=get(handles.uvmat,'UserData');%read UvData properties stored on the uvmat interface |
---|
[622] | 5466 | UvData.ProjObject{IndexObj}.Name=list_object{IndexObj}; |
---|
| 5467 | if numel(UvData.ProjObject)<IndexObj;% error in UvData |
---|
[410] | 5468 | msgbox_uvmat('ERROR','invalid object list') |
---|
| 5469 | return |
---|
| 5470 | end |
---|
| 5471 | ZBounds=0; % default |
---|
| 5472 | if isfield(UvData.Field,'ZMin') && isfield(UvData.Field,'ZMax') |
---|
| 5473 | ZBounds(1)=UvData.Field.ZMin; %minimum for the Z slider |
---|
| 5474 | ZBounds(2)=UvData.Field.ZMax;%maximum for the Z slider |
---|
| 5475 | end |
---|
[622] | 5476 | data=UvData.ProjObject{IndexObj}; |
---|
[410] | 5477 | if ~isfield(data,'Type')% default plane |
---|
| 5478 | data.Type='plane'; |
---|
| 5479 | end |
---|
| 5480 | hset_object=set_object(data,[],ZBounds); |
---|
[735] | 5481 | set(hset_object,'name','set_object') |
---|
[410] | 5482 | hhset_object=guidata(hset_object); |
---|
[650] | 5483 | if get(handles.CheckEditObject,'Value')% edit mode |
---|
[625] | 5484 | set(get(hset_object,'children'),'Enable','on') |
---|
[410] | 5485 | else |
---|
[625] | 5486 | set(get(hset_object,'children'),'Enable','off')% deactivate the GUI except SAVE |
---|
[427] | 5487 | set(hhset_object.SAVE,'Enable','on') |
---|
[410] | 5488 | end |
---|
| 5489 | else |
---|
| 5490 | hset_object=findobj(allchild(0),'tag','set_object'); |
---|
| 5491 | if ~isempty(hset_object) |
---|
| 5492 | delete(hset_object)% delete existing version of set_object |
---|
| 5493 | end |
---|
| 5494 | end |
---|
| 5495 | |
---|
[424] | 5496 | |
---|
[410] | 5497 | %------------------------------------------------------------------------ |
---|
[650] | 5498 | % --- Executes on button press in CheckViewField. |
---|
| 5499 | function CheckViewField_Callback(hObject, eventdata, handles) |
---|
[402] | 5500 | %------------------------------------------------------------------------ |
---|
[650] | 5501 | check_view=get(handles.CheckViewField,'Value'); |
---|
[387] | 5502 | |
---|
[410] | 5503 | if check_view |
---|
| 5504 | IndexObj=get(handles.ListObject,'Value'); |
---|
| 5505 | UvData=get(handles.uvmat,'UserData');%read UvData properties stored on the uvmat interface |
---|
[622] | 5506 | if numel(UvData.ProjObject)<IndexObj(end);% error in UvData |
---|
[410] | 5507 | msgbox_uvmat('ERROR','invalid object list') |
---|
| 5508 | return |
---|
| 5509 | end |
---|
| 5510 | ZBounds=0; % default |
---|
| 5511 | if isfield(UvData.Field,'ZMin') && isfield(UvData.Field,'ZMax') |
---|
| 5512 | ZBounds(1)=UvData.Field.ZMin; %minimum for the Z slider |
---|
| 5513 | ZBounds(2)=UvData.Field.ZMax;%maximum for the Z slider |
---|
| 5514 | end |
---|
| 5515 | set(handles.ListObject,'Value',IndexObj);%restore ListObject selection after set_object deletion |
---|
[622] | 5516 | if ~isfield(UvData.ProjObject{IndexObj(1)},'Type')% default plane |
---|
| 5517 | UvData.ProjObject{IndexObj(1)}.Type='plane'; |
---|
[410] | 5518 | end |
---|
| 5519 | list_object=get(handles.ListObject,'String'); |
---|
[622] | 5520 | UvData.ProjObject{IndexObj(end)}.Name=list_object{IndexObj(end)}; |
---|
[410] | 5521 | |
---|
[429] | 5522 | %% show the projection of the selected object on view_field |
---|
[622] | 5523 | ProjData= proj_field(UvData.Field,UvData.ProjObject{IndexObj});%project the current field on ObjectData |
---|
[402] | 5524 | hview_field=findobj(allchild(0),'tag','view_field'); |
---|
| 5525 | if isempty(hview_field) |
---|
| 5526 | hview_field=view_field; |
---|
| 5527 | end |
---|
[429] | 5528 | hhview_field=guidata(hview_field); |
---|
[511] | 5529 | [PlotType,PlotParam]=plot_field(ProjData,hhview_field.PlotAxes,read_GUI(hview_field));%read plotting parameters on the GUI view_field); |
---|
[595] | 5530 | errormsg=fill_GUI(PlotParam,hview_field); |
---|
[609] | 5531 | for list={'Scalar','Vectors'} |
---|
| 5532 | if ~isfield(PlotParam,list{1}) |
---|
| 5533 | set(hhview_field.(list{1}),'Visible','off') |
---|
| 5534 | end |
---|
| 5535 | end |
---|
[429] | 5536 | haxes=findobj(hview_field,'tag','axes3'); |
---|
| 5537 | pos=get(hview_field,'Position'); |
---|
[748] | 5538 | if strcmp(get(haxes,'Visible'),'off')%sempty(PlotParam.Axes)% case of no plot display (pure text table) |
---|
[429] | 5539 | h_TableDisplay=findobj(hview_field,'tag','TableDisplay'); |
---|
| 5540 | pos_table=get(h_TableDisplay,'Position'); |
---|
| 5541 | set(hview_field,'Position',[pos(1)+pos(3)-pos_table(3) pos(2)+pos(4)-pos_table(4) pos_table(3) pos_table(4)]) |
---|
| 5542 | else |
---|
| 5543 | Data=get(hview_field,'UserData'); |
---|
| 5544 | end |
---|
[410] | 5545 | else |
---|
[424] | 5546 | hview_field=findobj(allchild(0),'tag','view_field'); |
---|
| 5547 | if ~isempty(hview_field) |
---|
| 5548 | delete(hview_field)% delete existing version of set_object |
---|
[410] | 5549 | end |
---|
[402] | 5550 | end |
---|
| 5551 | |
---|
[424] | 5552 | |
---|
[402] | 5553 | %------------------------------------------------------------------------ |
---|
[650] | 5554 | % --- Executes on button press in DeleteObject. |
---|
[622] | 5555 | %------------------------------------------------------------------------ |
---|
[650] | 5556 | function DeleteObject_Callback(hObject, eventdata, handles) |
---|
[622] | 5557 | |
---|
[499] | 5558 | IndexObj=get(handles.ListObject,'Value');%projection object selected for view_field |
---|
| 5559 | IndexObj_1=get(handles.ListObject_1,'Value');%projection object selected for uvmat plot |
---|
| 5560 | if IndexObj>1 && ~isequal(IndexObj,IndexObj_1) % do not delete the object used for the uvmat plot |
---|
[410] | 5561 | delete_object(IndexObj) |
---|
[402] | 5562 | end |
---|
| 5563 | |
---|
[650] | 5564 | %'DeleteObject': delete a projection object, defined by its index in the Uvmat list or by its graphic handle |
---|
[402] | 5565 | %------------------------------------------------------------------------ |
---|
[650] | 5566 | % function DeleteObject(hObject) |
---|
[622] | 5567 | % |
---|
| 5568 | % INPUT: |
---|
| 5569 | % hObject: object index (if integer) or handle of the graphic object. If |
---|
| 5570 | % hObject is a subobject, the parent object is detected and deleted. |
---|
| 5571 | |
---|
| 5572 | function delete_object(IndexObj) |
---|
| 5573 | |
---|
| 5574 | huvmat=findobj('tag','uvmat');%handles of the uvmat interface |
---|
| 5575 | UvData=get(huvmat,'UserData'); |
---|
| 5576 | hlist_object=findobj(huvmat,'Tag','ListObject');%handles of the object list in the uvmat interface |
---|
| 5577 | list_str=get(hlist_object,'String');%objet list |
---|
[648] | 5578 | if ~isempty(UvData) && isfield(UvData, 'ProjObject') && length(UvData.ProjObject)>=IndexObj |
---|
| 5579 | if isfield(UvData.ProjObject{IndexObj},'DisplayHandle') && isfield(UvData.ProjObject{IndexObj}.DisplayHandle,'uvmat') |
---|
[681] | 5580 | hdisplay=UvData.ProjObject{IndexObj}.DisplayHandle.uvmat;%handle of the object graphic representation in uvmat |
---|
[648] | 5581 | for iview=1:length(hdisplay) |
---|
| 5582 | if ishandle(hdisplay(iview)) && ~isequal(hdisplay(iview),0) |
---|
| 5583 | ObjectData=get(hdisplay(iview),'UserData'); |
---|
[701] | 5584 | if isfield(ObjectData,'SubObject') && ~isempty(ObjectData.SubObject) |
---|
| 5585 | delete(ObjectData.SubObject(ishandle(ObjectData.SubObject)));% delete the graphic 'sub-objects (e.g. projection bounds) |
---|
[648] | 5586 | end |
---|
[701] | 5587 | if isfield(ObjectData,'DeformPoint')&& ~isempty(ObjectData.DeformPoint) |
---|
| 5588 | delete(ObjectData.DeformPoint(ishandle(ObjectData.DeformPoint)));% delete the graphic deformation points |
---|
| 5589 | delete(hdisplay(iview))% delete the main graphic representation of the object |
---|
| 5590 | end |
---|
[648] | 5591 | end |
---|
| 5592 | ishandle(hdisplay(iview)) |
---|
| 5593 | end |
---|
| 5594 | for iobj=IndexObj+1:length(UvData.ProjObject) |
---|
| 5595 | hdisplay=UvData.ProjObject{iobj}.DisplayHandle.uvmat; |
---|
[622] | 5596 | for iview=1:length(hdisplay) |
---|
| 5597 | if ishandle(hdisplay(iview)) && ~isequal(hdisplay(iview),0) |
---|
[648] | 5598 | PlotData=get(hdisplay(iview),'UserData'); |
---|
| 5599 | PlotData.IndexObj=iobj-1; |
---|
| 5600 | set(hdisplay(iview),'UserData',PlotData); |
---|
[622] | 5601 | end |
---|
| 5602 | end |
---|
| 5603 | end |
---|
| 5604 | end |
---|
[648] | 5605 | UvData.ProjObject(IndexObj)=[]; |
---|
[729] | 5606 | end |
---|
[738] | 5607 | if numel(list_str)>=IndexObj |
---|
| 5608 | list_str(IndexObj)=[]; |
---|
| 5609 | end |
---|
[622] | 5610 | set(huvmat,'UserData',UvData); |
---|
| 5611 | set(hlist_object,'String',list_str) |
---|
| 5612 | set(hlist_object,'Value',length(list_str)) |
---|
| 5613 | hlist_object_1=findobj(huvmat,'Tag','ListObject_1');%handles of the first object list in the uvmat interface |
---|
| 5614 | old_index=get(hlist_object_1,'Value'); |
---|
| 5615 | set(hlist_object_1,'String',list_str) |
---|
| 5616 | if IndexObj<=old_index |
---|
| 5617 | set(hlist_object_1,'Value',old_index-1) |
---|
| 5618 | end |
---|
| 5619 | |
---|
[402] | 5620 | |
---|
[387] | 5621 | |
---|
| 5622 | |
---|
[598] | 5623 | %TODO: use to modify fill_GUI |
---|
| 5624 | %'write_plot_param': update the plotting parameters on the uvmat or view_field interface after a plotting operation |
---|
| 5625 | function write_plot_param(handles,PlotParam) |
---|
[748] | 5626 | %% axes |
---|
| 5627 | if isempty(PlotParam.Axes) |
---|
| 5628 | set(handles.Axes,'Visible','off') |
---|
[598] | 5629 | set(handles.PlotAxes,'Visible','off') |
---|
| 5630 | set(handles.text_display,'Visible','off') |
---|
| 5631 | set(handles.TableDisplay,'Visible','on') |
---|
| 5632 | else |
---|
[748] | 5633 | set(handles.Axes,'Visible','on') |
---|
[598] | 5634 | set(handles.PlotAxes,'Visible','on') |
---|
| 5635 | set(handles.text_display,'Visible','on') |
---|
| 5636 | if isfield(handles,'TableDisplay') |
---|
| 5637 | set(handles.TableDisplay,'Visible','off') |
---|
| 5638 | end |
---|
[748] | 5639 | Coordinates=PlotParam.Axes; |
---|
[598] | 5640 | if isfield(Coordinates,'CheckFixAspectRatio') |
---|
| 5641 | if Coordinates.CheckFixAspectRatio |
---|
| 5642 | set(handles.CheckFixAspectRatio,'Value',1) |
---|
| 5643 | else |
---|
| 5644 | set(handles.CheckFixAspectRatio,'Value',0) |
---|
| 5645 | |
---|
| 5646 | end |
---|
| 5647 | end |
---|
| 5648 | if isfield(Coordinates,'AspectRatio') |
---|
| 5649 | set(handles.num_AspectRatio,'String',num2str(Coordinates.AspectRatio)) |
---|
| 5650 | end |
---|
| 5651 | if isfield(Coordinates,'MinX') |
---|
| 5652 | set(handles.num_MinX,'String',num2str(Coordinates.MinX,4)); |
---|
| 5653 | set(handles.num_MaxX,'String',num2str(Coordinates.MaxX,4)); |
---|
| 5654 | set(handles.num_MinY,'String',num2str(Coordinates.MinY,4)); |
---|
| 5655 | set(handles.num_MaxY,'String',num2str(Coordinates.MaxY,4)); |
---|
| 5656 | else |
---|
| 5657 | set(handles.num_MinX,'String',''); |
---|
| 5658 | set(handles.num_MaxX,'String',''); |
---|
| 5659 | set(handles.num_MinY,'String',''); |
---|
| 5660 | set(handles.num_MaxY,'String',''); |
---|
| 5661 | end |
---|
| 5662 | end |
---|
| 5663 | |
---|
| 5664 | %% scalar or image parameters |
---|
| 5665 | if isfield(PlotParam,'Scalar') |
---|
| 5666 | set(handles.Scalar,'Visible','on') |
---|
| 5667 | if isfield(PlotParam.Scalar,'MaxA') |
---|
| 5668 | set(handles.num_MaxA,'String',num2str(PlotParam.Scalar.MaxA,3)); |
---|
| 5669 | end |
---|
| 5670 | if isfield(PlotParam.Scalar,'MinA') |
---|
| 5671 | set(handles.num_MinA,'String',num2str(PlotParam.Scalar.MinA,3)); |
---|
| 5672 | end |
---|
| 5673 | if isfield(PlotParam.Scalar,'IncrA') |
---|
| 5674 | set(handles.num_IncrA,'String',num2str(PlotParam.Scalar.IncrA,3)) |
---|
| 5675 | end |
---|
| 5676 | set(handles.CheckBW,'Value',PlotParam.Scalar.CheckBW) |
---|
| 5677 | if isfield(PlotParam.Scalar,'Opacity')&&isfield(handles,'num_Opacity') |
---|
| 5678 | set(handles.num_Opacity,'String',num2str(PlotParam.Scalar.Opacity)) |
---|
| 5679 | end |
---|
| 5680 | else |
---|
| 5681 | set(handles.Scalar,'Visible','off') |
---|
| 5682 | end |
---|
| 5683 | |
---|
| 5684 | %% parameter for vector field |
---|
| 5685 | if isfield(PlotParam,'Vectors') |
---|
| 5686 | set(handles.Vectors,'Visible','on') |
---|
| 5687 | if isfield(PlotParam.Vectors,'VecScale') |
---|
| 5688 | set(handles.num_VecScale,'String',num2str(PlotParam.Vectors.VecScale,3)) |
---|
| 5689 | end |
---|
| 5690 | if isfield(PlotParam.Vectors,'MinC')&& isfield(PlotParam.Vectors,'MaxC') |
---|
| 5691 | MinC=PlotParam.Vectors.MinC; |
---|
| 5692 | MaxC=PlotParam.Vectors.MaxC; |
---|
| 5693 | set(handles.num_MinVec,'String', num2str(MinC,3)); |
---|
| 5694 | set(handles.num_MaxVec,'String',num2str(MaxC,3)); |
---|
| 5695 | list=get(handles.ColorCode,'String'); |
---|
| 5696 | ichoice=get(handles.ColorCode,'Value'); |
---|
| 5697 | color_option=list{ichoice}; |
---|
| 5698 | test3color=strcmp(color_option,'rgb')||strcmp(color_option,'bgr'); |
---|
| 5699 | if test3color% need to update color thresholds |
---|
| 5700 | set(handles.num_ColCode1,'Visible','on') |
---|
| 5701 | set(handles.num_ColCode2,'Visible','on') |
---|
| 5702 | set(handles.Slider1,'Visible','on') |
---|
| 5703 | set(handles.Slider2,'Visible','on') |
---|
| 5704 | set(handles.num_ColCode1,'String',num2str(PlotParam.Vectors.ColCode1,3)) |
---|
| 5705 | set(handles.num_ColCode2,'String',num2str(PlotParam.Vectors.ColCode2,3)) |
---|
| 5706 | set(handles.Slider1,'Value',(PlotParam.Vectors.ColCode1-MinC)/(MaxC-MinC)) |
---|
| 5707 | set(handles.Slider2,'Value',(PlotParam.Vectors.ColCode2-MinC)/(MaxC-MinC)) |
---|
| 5708 | else |
---|
| 5709 | set(handles.num_ColCode1,'Visible','off') |
---|
| 5710 | set(handles.num_ColCode2,'Visible','off') |
---|
| 5711 | set(handles.Slider1,'Visible','off') |
---|
| 5712 | set(handles.Slider2,'Visible','off') |
---|
| 5713 | end |
---|
| 5714 | end |
---|
| 5715 | else |
---|
| 5716 | set(handles.Vectors,'Visible','off') |
---|
| 5717 | if isfield(handles,'edit_vect') |
---|
| 5718 | set(handles.edit_vect,'Visible','off') |
---|
| 5719 | set(handles.record,'Visible','off') |
---|
| 5720 | end |
---|
| 5721 | end |
---|
[690] | 5722 | |
---|
[738] | 5723 | % -------------------------------------------------------------------- |
---|
[690] | 5724 | % --- Executes on button press in CheckTable. |
---|
[738] | 5725 | % -------------------------------------------------------------------- |
---|
[690] | 5726 | function CheckTable_Callback(hObject, eventdata, handles) |
---|
| 5727 | if get(handles.CheckTable,'Value') |
---|
| 5728 | set(handles.TableDisplay,'Visible','on') |
---|
| 5729 | else |
---|
| 5730 | set(handles.TableDisplay,'Visible','off') |
---|
| 5731 | end |
---|