[60] | 1 |
|
---|
| 2 | %'view_field': function associated with the GUI 'view_field.fig' for images and data field visualization
|
---|
| 3 | %------------------------------------------------------------------------
|
---|
| 4 | % function huvmat=view_field(input)
|
---|
| 5 | %
|
---|
| 6 | %OUTPUT
|
---|
| 7 | % huvmat=current handles of the GUI view_field.fig
|
---|
| 8 | %%
|
---|
| 9 | %
|
---|
| 10 | %INPUT:
|
---|
| 11 | % input: input file name (if character chain), or input image matrix to
|
---|
| 12 | % visualize, or Matlab structure representing netcdf fields (with fields
|
---|
| 13 | % ListVarName....)
|
---|
| 14 | %
|
---|
| 15 | %AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA
|
---|
| 16 | % Copyright Joel Sommeria, 2008, LEGI / CNRS-UJF-INPG, joel.sommeria@legi.grenoble-inp.fr.
|
---|
| 17 | %AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA
|
---|
| 18 | % This open is part of the toolbox VIEW_FIELD.
|
---|
| 19 | %
|
---|
| 20 | % VIEW_FIELD is free software; you can redistribute it and/or modify
|
---|
| 21 | % it under the terms of the GNU General Public License as published by
|
---|
| 22 | % the Free Software Foundation; either version 2 of the License, or
|
---|
| 23 | % (at your option) any later version.
|
---|
| 24 | %
|
---|
| 25 | % VIEW_FIELD is distributed in the hope that it will be useful,
|
---|
| 26 | % but WITHOUT ANY WARRANTY; without even the implied warranty of
|
---|
| 27 | % MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
---|
| 28 | % GNU General Public License (open VIEW_FIELD/COPYING.txt) for more details.
|
---|
| 29 | %AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA
|
---|
| 30 |
|
---|
| 31 | %-------------------------------------------------------------------
|
---|
| 32 | % I - MAIN FUNCTION VIEW_FIELD (DO NOT MODIFY)
|
---|
| 33 | %-------------------------------------------------------------------
|
---|
| 34 | %-------------------------------------------------------------------
|
---|
| 35 | function varargout = view_field(varargin)
|
---|
| 36 |
|
---|
| 37 | % Begin initialization code - DO NOT EDIT
|
---|
| 38 | gui_Singleton = 1;
|
---|
| 39 | gui_State = struct('gui_Name', mfilename, ...
|
---|
| 40 | 'gui_Singleton', gui_Singleton, ...
|
---|
| 41 | 'gui_OpeningFcn', @view_field_OpeningFcn, ...
|
---|
| 42 | 'gui_OutputFcn', @view_field_OutputFcn, ...
|
---|
| 43 | 'gui_LayoutFcn', [], ...
|
---|
| 44 | 'gui_Callback', []);
|
---|
| 45 | if nargin && ischar(varargin{1})
|
---|
| 46 | gui_State.gui_Callback = str2func(varargin{1});
|
---|
| 47 | end
|
---|
| 48 |
|
---|
| 49 | if nargout
|
---|
| 50 | varargout{1:nargout} = gui_mainfcn(gui_State, varargin{:});
|
---|
| 51 | else
|
---|
| 52 | gui_mainfcn(gui_State, varargin{:});
|
---|
| 53 | end
|
---|
| 54 | % End initialization code - DO NOT EDIT
|
---|
| 55 |
|
---|
| 56 | %-------------------------------------------------------------------
|
---|
| 57 | % --- Executes just before view_field is made visible.
|
---|
| 58 | function view_field_OpeningFcn(hObject, eventdata, handles, Field )
|
---|
| 59 | %-------------------------------------------------------------------
|
---|
| 60 |
|
---|
| 61 | % Choose default command menuline output for view_field
|
---|
| 62 | handles.output = handles.axes3;
|
---|
| 63 |
|
---|
| 64 | % Update handles structure
|
---|
| 65 | guidata(hObject, handles);
|
---|
| 66 |
|
---|
| 67 | dircur=pwd; %current working directory
|
---|
| 68 | dir_opening=dircur;
|
---|
| 69 |
|
---|
| 70 | % set the position of colorbar and ancillary GUIs:
|
---|
| 71 | set(hObject,'Units','Normalized')
|
---|
| 72 | movegui(hObject,'center')
|
---|
| 73 | UvData.PosColorbar=[0.805 0.022 0.019 0.445];
|
---|
| 74 | UvData.SetObjectOrigin=[-0.05 -0.03]; %position for set_object
|
---|
| 75 | UvData.SetObjectSize=[0.3 0.7];
|
---|
| 76 | UvData.CalOrigin=[0.95 -0.03];%position for geometry_calib (TO IMPROVE)
|
---|
| 77 | UvData.CalSize=[0.28 1];
|
---|
| 78 | handles_mouse=handles;
|
---|
| 79 | huvmat=findobj(allchild(0),'Name','uvmat');
|
---|
| 80 | hhuvmat=guidata(huvmat);
|
---|
| 81 | handles_mouse.create=hhuvmat.create;
|
---|
| 82 | handles_mouse.edit=hhuvmat.edit;
|
---|
| 83 |
|
---|
| 84 | %functions for the mouse and keyboard
|
---|
| 85 | set(hObject,'KeyPressFcn',{'keyboard_callback',handles_mouse})%set keyboard action function
|
---|
| 86 | set(hObject,'WindowButtonMotionFcn',{'mouse_motion',handles_mouse})%set mouse action functio
|
---|
| 87 | set(hObject,'WindowButtonDownFcn',{'mouse_down'})%set mouse click action function
|
---|
| 88 | set(hObject,'WindowButtonUpFcn',{'mouse_up',handles_mouse})
|
---|
| 89 |
|
---|
| 90 |
|
---|
| 91 | [PlotType,PlotParamOut,haxes]= plot_field(Field,handles.axes3)%,PlotParam,KeepLim,PosColorbar)
|
---|
| 92 | %-------------------------------------------------------------------
|
---|
| 93 | % --- Outputs from this function are returned to the command menuline.
|
---|
| 94 | function varargout = view_field_OutputFcn(hObject, eventdata, handles)
|
---|
| 95 | varargout{1} = handles.output;% the only output argument is the handle to the GUI figure
|
---|
| 96 |
|
---|
| 97 | %-------------------------------------------------------------------
|
---|
| 98 | %-------------------------------------------------------------------
|
---|
| 99 | % II - FUNCTIONS FOR INTRODUCING THE INPUT FILES
|
---|
| 100 | % automatically sets the global properties when the rootfile name is introduced
|
---|
| 101 | % then activate the view-field action if selected
|
---|
| 102 | % it is activated either by clicking on the RootPath window or by the
|
---|
| 103 | % browser
|
---|
| 104 | %------------------------------------------------------------------
|
---|
| 105 | %------------------------------------------------------------------
|
---|
| 106 |
|
---|
| 107 | %-------------------------------------------------------------------
|
---|
| 108 | function update_mask(handles,num_i1,num_j1)
|
---|
| 109 | %-------------------------------------------------------------------
|
---|
| 110 |
|
---|
| 111 | MaskData=get(handles.mask_test,'UserData');
|
---|
| 112 | if isfield(MaskData,'maskhandle')&& ishandle(MaskData.maskhandle)
|
---|
| 113 | uistack(MaskData.maskhandle,'top');
|
---|
| 114 | end
|
---|
| 115 | num_i1_mask=mod(num_i1-1,MaskData.NbSlice)+1;
|
---|
| 116 | [MaskName,mdetect]=name_generator(MaskData.Base,num_i1_mask,num_j1,'.png',MaskData.NomType);
|
---|
| 117 | huvmat=get(handles.mask_test,'parent');
|
---|
| 118 | UvData=get(huvmat,'UserData');
|
---|
| 119 |
|
---|
| 120 | %update mask image if the mask is new
|
---|
| 121 | if ~ (isfield(UvData,'MaskName') && isequal(UvData.MaskName,MaskName))
|
---|
| 122 | UvData.MaskName=MaskName; %update the recorded name on UvData
|
---|
| 123 | set(huvmat,'UserData',UvData);
|
---|
| 124 | if mdetect==0
|
---|
| 125 | if isfield(MaskData,'maskhandle')&& ishandle(MaskData.maskhandle)
|
---|
| 126 | delete(MaskData.maskhandle)
|
---|
| 127 | end
|
---|
| 128 | else
|
---|
| 129 | %read mask image
|
---|
| 130 | Mask.AName='image';
|
---|
| 131 | Mask.A=imread(MaskName);
|
---|
| 132 | npxy=size(Mask.A);
|
---|
| 133 | Mask.AX=[0.5 npxy(2)-0.5];
|
---|
| 134 | Mask.AY=[npxy(1)-0.5 0.5 ];
|
---|
| 135 | Mask.CoordType='px';
|
---|
| 136 | if isequal(get(handles.slices,'Value'),1)
|
---|
| 137 | NbSlice=str2num(get(handles.nb_slice,'String'));
|
---|
| 138 | num_i1=str2num(get(handles.i1,'String'));
|
---|
| 139 | Mask.ZIndex=mod(num_i1-1,NbSlice)+1;
|
---|
| 140 | end
|
---|
| 141 | %px to phys or other transform on field
|
---|
| 142 | menu_transform=get(handles.transform_fct,'String');
|
---|
| 143 | choice_value=get(handles.transform_fct,'Value');
|
---|
| 144 | transform_name=menu_transform{choice_value};%name of the transform fct given by the menu 'transform_fct'
|
---|
| 145 | transform_list=get(handles.transform_fct,'UserData');
|
---|
| 146 | transform=transform_list{choice_value};
|
---|
| 147 | if ~isequal(transform_name,'') && ~isequal(transform_name,'px')
|
---|
| 148 | if isfield(UvData,'XmlData') && isfield(UvData.XmlData,'GeometryCalib')%use geometry calib recorded from the ImaDoc xml file as first priority
|
---|
| 149 | Calib=UvData.XmlData.GeometryCalib;
|
---|
| 150 | Mask=transform(Mask,UvData.XmlData);
|
---|
| 151 | end
|
---|
| 152 | end
|
---|
| 153 | flagmask=Mask.A < 200;
|
---|
| 154 |
|
---|
| 155 | %make brown color image
|
---|
| 156 | imflag(:,:,1)=0.9*flagmask;
|
---|
| 157 | imflag(:,:,2)=0.7*flagmask;
|
---|
| 158 | imflag(:,:,3)=zeros(size(flagmask));
|
---|
| 159 |
|
---|
| 160 | %update mask image
|
---|
| 161 | hmask=[]; %default
|
---|
| 162 | if isfield(MaskData,'maskhandle')&& ishandle(MaskData.maskhandle)
|
---|
| 163 | hmask=MaskData.maskhandle;
|
---|
| 164 | end
|
---|
| 165 | if ~isempty(hmask)
|
---|
| 166 | set(hmask,'CData',imflag)
|
---|
| 167 | set(hmask,'AlphaData',flagmask*0.6)
|
---|
| 168 | set(hmask,'XData',Mask.AX);
|
---|
| 169 | set(hmask,'YData',Mask.AY);
|
---|
| 170 | % uistack(hmask,'top')
|
---|
| 171 | else
|
---|
| 172 | axes(handles.axes3)
|
---|
| 173 | hold on
|
---|
| 174 | MaskData.maskhandle=image(Mask.AX,Mask.AY,imflag,'Tag','mask','HitTest','off','AlphaData',0.6*flagmask);
|
---|
| 175 | % set(MaskData.maskhandle,'AlphaData',0.6*flagmask)
|
---|
| 176 | set(handles.mask_test,'UserData',MaskData)
|
---|
| 177 | end
|
---|
| 178 | end
|
---|
| 179 | end
|
---|
| 180 |
|
---|
| 181 |
|
---|
| 182 | %-------------------------------------------------------------------
|
---|
| 183 | function MenuExportFigure_Callback(hObject, eventdata, handles)
|
---|
| 184 | %-------------------------------------------------------------------
|
---|
| 185 | huvmat=get(handles.MenuExport,'parent');
|
---|
| 186 | UvData=get(huvmat,'UserData');
|
---|
| 187 | hfig=figure;
|
---|
| 188 | newaxes=copyobj(handles.axes3,hfig);
|
---|
| 189 | map=colormap(handles.axes3);
|
---|
| 190 | colormap(map);%transmit the current colormap to the zoom fig
|
---|
| 191 | colorbar
|
---|
| 192 |
|
---|
| 193 | %-------------------------------------------------------------------
|
---|
| 194 | %-------------------------------------------------------------------
|
---|
| 195 | % III - MAIN REFRESH FUNCTIONS : 'FRAME PLOT'
|
---|
| 196 | %-------------------------------------------------------------------
|
---|
| 197 | %-------------------------------------------------------------------
|
---|
| 198 |
|
---|
| 199 | %Executes on button press in runplus: make one step forward and call
|
---|
| 200 | %run0. The step forward is along the fields series 1 or 2 depending on
|
---|
| 201 | %the scan_i and scan_j check box (exclusive each other)
|
---|
| 202 | %-------------------------------------------------------------------
|
---|
| 203 | function runplus_Callback(hObject, eventdata, handles)
|
---|
| 204 | increment=str2num(get(handles.increment_scan,'String')); %get the field increment d
|
---|
| 205 | runpm(hObject,eventdata,handles,increment)
|
---|
| 206 |
|
---|
| 207 | %-------------------------------------------------------------------
|
---|
| 208 | %Executes on button press in runmin: make one step backward and call
|
---|
| 209 | %run0. The step backward is along the fields series 1 or 2 depending on
|
---|
| 210 | %the scan_i and scan_j check box (exclusive each other)
|
---|
| 211 | %-------------------------------------------------------------------
|
---|
| 212 | function runmin_Callback(hObject, eventdata, handles)
|
---|
| 213 | increment=-str2num(get(handles.increment_scan,'String')); %get the field increment d
|
---|
| 214 | runpm(hObject,eventdata,handles,increment)
|
---|
| 215 |
|
---|
| 216 | %-------------------------------------------------------------------
|
---|
| 217 | %Executes on button press in runmin: make one step backward and call
|
---|
| 218 | %run0. The step backward is along the fields series 1 or 2 depending on
|
---|
| 219 | %the scan_i and scan_j check box (exclusive each other)
|
---|
| 220 | %-------------------------------------------------------------------
|
---|
| 221 | function RunMovie_Callback(hObject, eventdata, handles)
|
---|
| 222 | %------------------------------------------------------------------
|
---|
| 223 | set(handles.RunMovie,'BackgroundColor',[1 1 0])%paint the command button in yellow
|
---|
| 224 | drawnow
|
---|
| 225 | increment=str2num(get(handles.increment_scan,'String')); %get the field increment d
|
---|
| 226 | set(handles.STOP,'Visible','on')
|
---|
| 227 | set(handles.speed,'Visible','on')
|
---|
| 228 | set(handles.speed_txt,'Visible','on')
|
---|
| 229 | set(handles.RunMovie,'BusyAction','queue')
|
---|
| 230 | testavi=0;
|
---|
| 231 | UvData=get(handles.view_field,'UserData');
|
---|
| 232 |
|
---|
| 233 | while get(handles.speed,'Value')~=0 & isequal(get(handles.RunMovie,'BusyAction'),'queue') % enable STOP command
|
---|
| 234 | runpm(hObject,eventdata,handles,increment)
|
---|
| 235 | pause(1.02-get(handles.speed,'Value'))% wait for next image
|
---|
| 236 | end
|
---|
| 237 | if isfield(UvData,'aviobj') && ~isempty( UvData.aviobj),
|
---|
| 238 | UvData.aviobj=close(UvData.aviobj);
|
---|
| 239 | set(handles.view_field,'UserData',UvData);
|
---|
| 240 | end
|
---|
| 241 | set(handles.RunMovie,'BackgroundColor',[1 0 0])%paint the command buttonback to red
|
---|
| 242 |
|
---|
| 243 | %-------------------------------------------------------------------
|
---|
| 244 | function STOP_Callback(hObject, eventdata, handles)
|
---|
| 245 | %-------------------------------------------------------------------
|
---|
| 246 | set(handles.movie_pair,'BusyAction','Cancel')
|
---|
| 247 | set(handles.movie_pair,'value',0)
|
---|
| 248 | set(handles.RunMovie,'BusyAction','Cancel')
|
---|
| 249 | set(handles.MenuExportMovie,'BusyAction','Cancel')
|
---|
| 250 |
|
---|
| 251 |
|
---|
| 252 | %------------------------------------------------------------------
|
---|
| 253 | function runpm(hObject,eventdata,handles,increment)
|
---|
| 254 | %------------------------------------------------------------------
|
---|
| 255 | %check for mùovie pair status
|
---|
| 256 | movie_status=get(handles.movie_pair,'Value');
|
---|
| 257 | if isequal(movie_status,1)
|
---|
| 258 | STOP_Callback(hObject, eventdata, handles)
|
---|
| 259 | end
|
---|
| 260 | %read the data on the current input rootfile(s)
|
---|
| 261 |
|
---|
| 262 | [FileName,RootPath,filebase,FileIndices,FileExt,subdir]=read_file_boxes(handles);
|
---|
| 263 | NomType=get(handles.FileIndex,'UserData');
|
---|
| 264 |
|
---|
| 265 | num1=stra2num(get(handles.i1,'String'));
|
---|
| 266 | num2=stra2num(get(handles.i2,'String'));
|
---|
| 267 | num_a=stra2num(get(handles.j1,'String'));
|
---|
| 268 | num_b=stra2num(get(handles.j2,'String'));
|
---|
| 269 |
|
---|
| 270 | sub_value= get(handles.SubField,'Value');
|
---|
| 271 | if sub_value ==1
|
---|
| 272 | [FileName_1,RootPath_1,filebase_1,FileIndices_1,FileExt_1,SubDir_1]=read_file_boxes_1(handles);
|
---|
| 273 | end
|
---|
| 274 |
|
---|
| 275 | comp_input=get(handles.fix_pair,'Value');
|
---|
| 276 | if isequal(NomType,'_i1-i2')|isequal(NomType,'_i1-i2_j')
|
---|
| 277 | comp_input=1; %impose a fixed pair interval
|
---|
| 278 | set(handles.fix_pair,'Value',1)
|
---|
| 279 | end
|
---|
| 280 |
|
---|
| 281 | %case of scanning along the first direction (rootfile numbers)
|
---|
| 282 | if get(handles.scan_i,'Value')==1% case of scanning along field numbers
|
---|
| 283 | num1=num1+increment;
|
---|
| 284 | num2=num2+increment;
|
---|
| 285 | if comp_input==0% find a free pair
|
---|
| 286 | [filename,num_i1_out,num_j1_out,num_i2_out,num_j2_out]=...
|
---|
| 287 | name_generator(filebase,num1,num_a,FileExt,NomType,0,num2,num_b,subdir);
|
---|
| 288 | if exist(filename,'file')
|
---|
| 289 | num_a=num_j1_out;
|
---|
| 290 | num_b=num_j2_out;
|
---|
| 291 | end
|
---|
| 292 | end
|
---|
| 293 | if sub_value>=2
|
---|
| 294 | num_i1=num_i1+increment;
|
---|
| 295 | num_i2=num_i2+increment;
|
---|
| 296 | end
|
---|
| 297 | else % case of scanning along the second direction (burst numbers)
|
---|
| 298 | lastfield_cell=get(handles.last_j,'String'); % get the last field number
|
---|
| 299 | lastfield=str2num(lastfield_cell{1});
|
---|
| 300 | num_a=num_a+increment;
|
---|
| 301 | num_b=num_b+increment;
|
---|
| 302 | if sub_value >=2
|
---|
| 303 | num_j1=num_j1+increment;
|
---|
| 304 | num_j2=num_j2+increment;
|
---|
| 305 | elseif ~isempty(lastfield) && num_a>lastfield
|
---|
| 306 | num_a=1;
|
---|
| 307 | num1=num1+1;
|
---|
| 308 | num2=num2+1;
|
---|
| 309 | end
|
---|
| 310 | end
|
---|
| 311 |
|
---|
| 312 | % display the new open numbers
|
---|
| 313 | set(handles.i1,'String',num2stra(num1,NomType,1));
|
---|
| 314 | set(handles.i2,'String',num2stra(num2,NomType,1));
|
---|
| 315 | set(handles.j1,'String',num2stra(num_a,NomType,2));
|
---|
| 316 | set(handles.j2,'String',num2stra(num_b,NomType,2));
|
---|
| 317 | [indices]=name_generator('',num1,num_a,'',NomType,1,num2,num_b,'');
|
---|
| 318 | set(handles.FileIndex,'String',indices);
|
---|
| 319 | if sub_value ==1
|
---|
| 320 | NomType_1=get(handles.FileIndex_1,'UserData');
|
---|
| 321 | [indices]=...
|
---|
| 322 | name_generator('',num1,num_a,'',NomType_1,1,num2,num_b,'');
|
---|
| 323 | set(handles.FileIndex_1,'String',indices);
|
---|
| 324 | end
|
---|
| 325 |
|
---|
| 326 | if isequal(movie_status,1)
|
---|
| 327 | set(handles.movie_pair,'Value',1)
|
---|
| 328 | movie_pair_Callback(hObject, eventdata, handles); %run
|
---|
| 329 | else
|
---|
| 330 | % refresh plots
|
---|
| 331 | run0_Callback(hObject, eventdata, handles); %run
|
---|
| 332 | end
|
---|
| 333 |
|
---|
| 334 |
|
---|
| 335 | %-------------------------------------------------------
|
---|
| 336 | % --- Executes on button press in movie_pair: create an alternating movie with two view
|
---|
| 337 | %-------------------------------------------------------
|
---|
| 338 | function movie_pair_Callback(hObject, eventdata, handles)
|
---|
| 339 | status=get(handles.movie_pair,'value');
|
---|
| 340 | if isequal(status,0)
|
---|
| 341 | set(handles.movie_pair,'BusyAction','Cancel')
|
---|
| 342 | return
|
---|
| 343 | else
|
---|
| 344 | set(handles.movie_pair,'BusyAction','queue')
|
---|
| 345 | end
|
---|
| 346 | %initialisation
|
---|
| 347 | set(handles.movie_pair,'BackgroundColor',[1 1 0])%paint the command button in yellow
|
---|
| 348 | drawnow
|
---|
| 349 | list_fields=get(handles.Fields,'String');% list menu fields
|
---|
| 350 | index_fields=get(handles.Fields,'Value');% selected string index
|
---|
| 351 | FieldName=list_fields{index_fields}; % selected field
|
---|
| 352 | if isequal(FieldName,'image')
|
---|
| 353 | run0_Callback(hObject, eventdata, handles)%display the first image
|
---|
| 354 | UvData=get(handles.view_field,'UserData');
|
---|
| 355 | else
|
---|
| 356 | msgbox_view_field('ERROR','an image or movie must be first introduced as input')
|
---|
| 357 | return
|
---|
| 358 | end
|
---|
| 359 | [ff,rr,filebase,xx,Ext,SubDir]=read_file_boxes(handles);
|
---|
| 360 | NomType=get(handles.FileIndex,'UserData');
|
---|
| 361 | num_i1=stra2num(get(handles.i1,'String'));
|
---|
| 362 | num_j1=stra2num(get(handles.j1,'String'));
|
---|
| 363 | num_i2=stra2num(get(handles.i2,'String'));
|
---|
| 364 | num_j2=stra2num(get(handles.j2,'String'));
|
---|
| 365 | if isempty(num_j2)
|
---|
| 366 | if isempty(num_i2)
|
---|
| 367 | msgbox_view_field('ERROR', 'a second image index i2 or j2 is needed to show the pair as a movie')
|
---|
| 368 | return
|
---|
| 369 | else
|
---|
| 370 | num_j2=num_j1;%repeat the index i1 by default
|
---|
| 371 | end
|
---|
| 372 | end
|
---|
| 373 | if isempty(num_i2)
|
---|
| 374 | num_i2=num_i1;%repeat the index i1 by default
|
---|
| 375 | end
|
---|
| 376 | imaname_1=name_generator(filebase,num_i2,num_j2,Ext,NomType);
|
---|
| 377 | if ~exist(imaname_1,'file')
|
---|
| 378 | msgbox_view_field('ERROR',['second input open (-) ' imaname_1 ' not found']);
|
---|
| 379 | return
|
---|
| 380 | end
|
---|
| 381 | % set(handles.i2,'String',''); % indicates that the second index i2 is not used
|
---|
| 382 | % set(handles.j2,'String',''); % indicates that the second index i2 is not used
|
---|
| 383 |
|
---|
| 384 | %read the second image
|
---|
| 385 | Field.AName='image';
|
---|
| 386 | Field.AX=UvData.Field.AX;
|
---|
| 387 | Field.AY=UvData.Field.AY;
|
---|
| 388 | % z index
|
---|
| 389 | nbslice=str2double(get(handles.nb_slice,'String'));
|
---|
| 390 | if ~isempty(nbslice)
|
---|
| 391 | Field.ZIndex=mod(num_i2-1,nbslice)+1;
|
---|
| 392 | end
|
---|
| 393 | Field.CoordType='px';
|
---|
| 394 | %determine the input file type
|
---|
| 395 | if isfield(UvData,'MovieObject')
|
---|
| 396 | FileType='movie';
|
---|
| 397 | elseif isequal(lower(Ext),'.avi')
|
---|
| 398 | FileType='avi';
|
---|
| 399 | elseif isequal(lower(Ext),'.vol')
|
---|
| 400 | FileType='vol';
|
---|
| 401 | else
|
---|
| 402 | form=imformats(Ext([2:end]));
|
---|
| 403 | if ~isempty(form)% if the extension corresponds to an image format recognized by Matlab
|
---|
| 404 | if isequal(NomType,'*');
|
---|
| 405 | FileType='multimage';
|
---|
| 406 | else
|
---|
| 407 | FileType='image';
|
---|
| 408 | end
|
---|
| 409 | end
|
---|
| 410 | end
|
---|
| 411 | switch FileType
|
---|
| 412 | case 'movie'
|
---|
| 413 | Field.A=read(UvData.MovieObject,num_i2);
|
---|
| 414 | case 'avi'
|
---|
| 415 | mov=aviread(imaname_1,num_i2);
|
---|
| 416 | Field.A=frame2im(mov(1));
|
---|
| 417 | case 'vol'
|
---|
| 418 | Field.A=imread(imaname_1);
|
---|
| 419 | case 'multimage'
|
---|
| 420 | Field.A=imread(imaname_1,num_i2);
|
---|
| 421 | case 'image'
|
---|
| 422 | Field.A=imread(imaname_1);
|
---|
| 423 | end
|
---|
| 424 |
|
---|
| 425 | %px to phys or other transform on field
|
---|
| 426 | menu_transform=get(handles.transform_fct,'String');
|
---|
| 427 | choice_value=get(handles.transform_fct,'Value');
|
---|
| 428 | transform_name=menu_transform{choice_value};%name of the transform fct given by the menu 'transform_fct'
|
---|
| 429 | transform_list=get(handles.transform_fct,'UserData');
|
---|
| 430 | transform=transform_list{choice_value};
|
---|
| 431 | if ~isequal(transform_name,'') && ~isequal(transform_name,'px')
|
---|
| 432 | if isfield(UvData,'XmlData') && isfield(UvData.XmlData,'GeometryCalib')%use geometry calib recorded from the ImaDoc xml file as first priority
|
---|
| 433 | Field=transform(Field,UvData.XmlData);
|
---|
| 434 | end
|
---|
| 435 | end
|
---|
| 436 |
|
---|
| 437 | % make movie until movie speed is set to 0 or STOP is activated
|
---|
| 438 | hima=findobj(handles.axes3,'Tag','ima');% %handles.axes3 =main plotting window (A GENERALISER)
|
---|
| 439 | set(handles.STOP,'Visible','on')
|
---|
| 440 | set(handles.speed,'Visible','on')
|
---|
| 441 | set(handles.speed_txt,'Visible','on')
|
---|
| 442 | while get(handles.speed,'Value')~=0 && isequal(get(handles.movie_pair,'BusyAction'),'queue')%isequal(get(handles.run0,'BusyAction'),'queue'); % enable STOP command
|
---|
| 443 | % read and plot the series of images in non erase mode
|
---|
| 444 | set(hima,'CData',Field.A);
|
---|
| 445 | pause(1.02-get(handles.speed,'Value'));% wait for next image
|
---|
| 446 | set(hima,'CData',UvData.Field.A);
|
---|
| 447 | pause(1.02-get(handles.speed,'Value'));% wait for next image
|
---|
| 448 | end
|
---|
| 449 | set(handles.movie_pair,'BackgroundColor',[1 0 0])%paint the command button in red
|
---|
| 450 |
|
---|
| 451 | %-------------------------------------------------------
|
---|
| 452 | % --- Executes on button press in run0.
|
---|
| 453 | %-------------------------------------------------
|
---|
| 454 | function run0_Callback(hObject, eventdata, handles)
|
---|
| 455 |
|
---|
| 456 | %initialisation
|
---|
| 457 | set(handles.run0,'BackgroundColor',[1 1 0])%paint the command button in yellow
|
---|
| 458 | drawnow
|
---|
| 459 | abstime=[];
|
---|
| 460 | abstime_1=[];
|
---|
| 461 | dt=[];
|
---|
| 462 | Field={};
|
---|
| 463 | UvData=get(handles.view_field,'UserData');
|
---|
| 464 | if isfield(UvData,'Txt')
|
---|
| 465 | UvData=rmfield(UvData,'Txt');%erase previous error message
|
---|
| 466 | end
|
---|
| 467 | %set(handles.run0,'BusyAction','queue');
|
---|
| 468 | if ishandle(handles.VIEW_FIELD_title) %remove title panel on view_field
|
---|
| 469 | delete(handles.VIEW_FIELD_title)
|
---|
| 470 | end
|
---|
| 471 |
|
---|
| 472 | % determine the main input file information for action
|
---|
| 473 | TestInputFile=1;%default
|
---|
| 474 | if isfield(UvData,'TestInputFile')&& isequal(UvData.TestInputFile,0),
|
---|
| 475 | TestInputFile=0;
|
---|
| 476 | end
|
---|
| 477 | num_i1=[];%default
|
---|
| 478 | FileType=[];%default
|
---|
| 479 | if TestInputFile
|
---|
| 480 | [filename,RootPath,filebase,xx,Ext]=read_file_boxes(handles);
|
---|
| 481 | if ~exist(filename,'file')
|
---|
| 482 | msgbox_view_field('ERROR',['input file ' filename ' does not exist'])
|
---|
| 483 | return
|
---|
| 484 | end
|
---|
| 485 | num_i1=stra2num(get(handles.i1,'String'));
|
---|
| 486 | num_i2=stra2num(get(handles.i2,'String'));
|
---|
| 487 | num_j1=stra2num(get(handles.j1,'String'));
|
---|
| 488 | num_j2=stra2num(get(handles.j2,'String'));
|
---|
| 489 | NomType=get(handles.FileIndex,'UserData');
|
---|
| 490 | %update the z position index
|
---|
| 491 | nbslice=str2double(get(handles.nb_slice,'String'));
|
---|
| 492 | if ~isnan(nbslice)
|
---|
| 493 | z_index=mod(num_i1-1,nbslice)+1;
|
---|
| 494 | set(handles.z_index,'String',num2str(z_index))
|
---|
| 495 | % refresh menu for save_mask if relevant
|
---|
| 496 | masknumber=get(handles.masklevel,'String');
|
---|
| 497 | if length(masknumber)>=z_index
|
---|
| 498 | set(handles.masklevel,'Value',z_index)
|
---|
| 499 | end
|
---|
| 500 | end
|
---|
| 501 | % determine the input file type
|
---|
| 502 | if isequal(Ext,'.nc')||isequal(Ext,'.cdf')
|
---|
| 503 | FileType='netcdf';
|
---|
| 504 | elseif isfield(UvData,'MovieObject')
|
---|
| 505 | FileType='movie';
|
---|
| 506 | FieldName='image';
|
---|
| 507 | elseif isequal(lower(Ext),'.avi')
|
---|
| 508 | FileType='avi';
|
---|
| 509 | FieldName='image';
|
---|
| 510 | elseif isequal(lower(Ext),'.vol')
|
---|
| 511 | FileType='vol';
|
---|
| 512 | FieldName='image';
|
---|
| 513 | else
|
---|
| 514 | form=imformats(Ext([2:end]));
|
---|
| 515 | if ~isempty(form)% if the extension corresponds to an image format recognized by Matlab
|
---|
| 516 | if isequal(NomType,'*');
|
---|
| 517 | FileType='multimage';
|
---|
| 518 | else
|
---|
| 519 | FileType='image';
|
---|
| 520 | end
|
---|
| 521 | FieldName='image';
|
---|
| 522 | end
|
---|
| 523 | end
|
---|
| 524 | else
|
---|
| 525 | filename=[];
|
---|
| 526 | FileType='netcdf';
|
---|
| 527 | FieldName='get_field...';
|
---|
| 528 | end
|
---|
| 529 | VelType=[];%default
|
---|
| 530 | if isequal(FileType,'netcdf')
|
---|
| 531 | list_fields=get(handles.Fields,'String');% list menu fields
|
---|
| 532 | index_fields=get(handles.Fields,'Value');% selected string index
|
---|
| 533 | FieldName= list_fields{index_fields}; % selected field
|
---|
| 534 | if isequal(FieldName,'get_field...')% read the field names on the interface get_field...
|
---|
| 535 | VelType=get(handles.Fields,'UserData');
|
---|
| 536 | Field{1}=get(handles.Fields,'UserData');
|
---|
| 537 | else
|
---|
| 538 | VelType=setfield(handles);
|
---|
| 539 | end
|
---|
| 540 | end
|
---|
| 541 |
|
---|
| 542 | % choose a second field if Subfield option is 'on'
|
---|
| 543 | filename_1=[];
|
---|
| 544 | FieldName_1=[];
|
---|
| 545 | scal_color=[];
|
---|
| 546 | VelType_1=setfield_1(handles);
|
---|
| 547 | sub_value=get(handles.SubField,'Value');
|
---|
| 548 | FileType_1='none';%default
|
---|
| 549 | if sub_value==1
|
---|
| 550 | filename_1=read_file_boxes_1(handles);
|
---|
| 551 | if ~exist(filename_1,'file')
|
---|
| 552 | msgbox_view_field('ERROR',['second file ' filename_1 ' does not exist'])
|
---|
| 553 | return
|
---|
| 554 | end
|
---|
| 555 | NomType_1=get(handles.FileIndex_1,'UserData');
|
---|
| 556 | Ext_1=get(handles.FileExt_1,'String');
|
---|
| 557 | % determine the input file type
|
---|
| 558 | if isequal(Ext_1,'.nc')||isequal(Ext_1,'.cdf')
|
---|
| 559 | FileType_1='netcdf';
|
---|
| 560 | elseif isfield(UvData,'MovieObject_1')
|
---|
| 561 | FileType_1='movie';
|
---|
| 562 | FieldName_1='image';
|
---|
| 563 | elseif isequal(lower(Ext_1),'.avi')
|
---|
| 564 | FileType='avi';
|
---|
| 565 | FieldName_1='image';
|
---|
| 566 | elseif isequal(lower(Ext_1),'.vol')
|
---|
| 567 | FileType_1='vol';
|
---|
| 568 | FieldName_1='image';
|
---|
| 569 | else
|
---|
| 570 | form=imformats(Ext([2:end]));
|
---|
| 571 | if ~isempty(form)% if the extension corresponds to an image format recognized by Matlab
|
---|
| 572 | if isequal(NomType_1,'*');
|
---|
| 573 | FileType_1='multimage';
|
---|
| 574 | else
|
---|
| 575 | FileType_1='image';
|
---|
| 576 | end
|
---|
| 577 | FieldName_1='image';
|
---|
| 578 | end
|
---|
| 579 | end
|
---|
| 580 | if ~isequal(FieldName_1,'image')
|
---|
| 581 | list_fields=get(handles.Fields_1,'String');% list menu fields
|
---|
| 582 | index_fields=get(handles.Fields_1,'Value');% selected string index
|
---|
| 583 | FieldName_1= list_fields{index_fields}; % selected field
|
---|
| 584 | if isequal(VelType_1,'*')% free veltype choice
|
---|
| 585 | VelType_1=[];
|
---|
| 586 | elseif isequal(VelType_1,'"')% veltype the same as for the first field
|
---|
| 587 | if isempty(VelType)
|
---|
| 588 | VelType_1=[];
|
---|
| 589 | else
|
---|
| 590 | VelType_1=VelType;
|
---|
| 591 | end
|
---|
| 592 | end
|
---|
| 593 | end
|
---|
| 594 | end
|
---|
| 595 |
|
---|
| 596 | % test for keeping the previous stored data if the input files are unchanged
|
---|
| 597 | test_keepdata_1=0;%defautl
|
---|
| 598 | test_keepdata=0;
|
---|
| 599 | if sub_value>=2
|
---|
| 600 | if ~isequal(NomType_1,'*')%in cas of a series of files (not avi movie)
|
---|
| 601 | if isfield(UvData,'filename_1')&& isfield(UvData,'VelType_1') && isfield(UvData,'FieldName_1')
|
---|
| 602 | test_keepdata_1= isequal(filename_1,UvData.filename_1)&&...
|
---|
| 603 | isequal(VelType_1,UvData.filename_1) && isequal(FieldName_1,UvData.FieldName_1);
|
---|
| 604 |
|
---|
| 605 | end
|
---|
| 606 | end
|
---|
| 607 | end
|
---|
| 608 |
|
---|
| 609 | %read the input field(s)
|
---|
| 610 |
|
---|
| 611 | %read images
|
---|
| 612 | if ~isempty(filename) && isequal(FieldName,'image')
|
---|
| 613 | switch FileType
|
---|
| 614 | case 'movie'
|
---|
| 615 | A=read(UvData.MovieObject,num_i1);
|
---|
| 616 | case 'avi'
|
---|
| 617 | mov=aviread(filename,num_i1);
|
---|
| 618 | A=frame2im(mov(1));
|
---|
| 619 | case 'vol'
|
---|
| 620 | A=imread(filename);
|
---|
| 621 | case 'multimage'
|
---|
| 622 | A=imread(filename,num_i1);
|
---|
| 623 | case 'image'
|
---|
| 624 | A=imread(filename);
|
---|
| 625 | end
|
---|
| 626 | npxy=size(A);
|
---|
| 627 | set(handles.npx,'String',num2str(npxy(2)));% display image size on the interface
|
---|
| 628 | set(handles.npy,'String',num2str(npxy(1)));
|
---|
| 629 | Rangx=[0.5 npxy(2)-0.5]; % coordinates of the first and last pixel centers
|
---|
| 630 | Rangy=[npxy(1)-0.5 0.5]; %
|
---|
| 631 | Field{1}.AName='image';
|
---|
| 632 | Field{1}.ListVarName={'AY','AX','A'}; %
|
---|
| 633 | if size(A,3)==3;%color
|
---|
| 634 | Field{1}.VarDimName={'AY','AX',{'AY','AX','rgb'}}; %
|
---|
| 635 | else
|
---|
| 636 | Field{1}.VarDimName={'AY','AX',{'AY','AX'}}; %
|
---|
| 637 | end
|
---|
| 638 | Field{1}.AY=Rangy;
|
---|
| 639 | Field{1}.AX=Rangx;
|
---|
| 640 | Field{1}.A=A;
|
---|
| 641 | Field{1}.CoordType='px'; %used for mouse_motion
|
---|
| 642 | Field{1}.CoordUnit='pixel'; %used for mouse_motion
|
---|
| 643 | end
|
---|
| 644 |
|
---|
| 645 | %read a second image
|
---|
| 646 | if ~isfield(UvData,'Txt')&& ~isempty(filename_1) && isequal(FieldName_1,'image')
|
---|
| 647 | switch FileType_1
|
---|
| 648 | case 'movie'
|
---|
| 649 | A=read(UvData.MovieObject_1,num_i1);
|
---|
| 650 | case 'avi'
|
---|
| 651 | mov=aviread(filename,num_i1);
|
---|
| 652 | A=frame2im(mov(1));
|
---|
| 653 | case 'vol'
|
---|
| 654 | A=imread(filename);
|
---|
| 655 | case 'multimage'
|
---|
| 656 | A=imread(filename,num_i1);
|
---|
| 657 | case 'image'
|
---|
| 658 | A=imread(filename);
|
---|
| 659 | end
|
---|
| 660 | npxy=size(A);
|
---|
| 661 | set(handles.npx,'String',num2str(npxy(2)));% display image size on the interface
|
---|
| 662 | set(handles.npy,'String',num2str(npxy(1)));
|
---|
| 663 | Rangx=[0.5 npxy(2)-0.5]; % coordinates of the first and last pixel centers
|
---|
| 664 | Rangy=[npxy(1)-0.5 0.5]; %
|
---|
| 665 | Field{2}.AName='image';
|
---|
| 666 | Field{2}.ListVarName={'AY','AX','A'}; %
|
---|
| 667 | if size(A,3)==3;%color
|
---|
| 668 | Field{2}.VarDimName={'AY','AX',{'AY','AX','rgb'}}; %
|
---|
| 669 | else
|
---|
| 670 | Field{2}.VarDimName={'AY','AX',{'AY','AX'}}; %
|
---|
| 671 | end
|
---|
| 672 | Field{2}.AY=Rangy;
|
---|
| 673 | Field{2}.AX=Rangx;
|
---|
| 674 | Field{2}.A=A;
|
---|
| 675 | Field{2}.CoordType='px'; %used for mouse_motion
|
---|
| 676 | Field{2}.CoordUnit='px'; %used for move_mou
|
---|
| 677 | end
|
---|
| 678 |
|
---|
| 679 | %read ncfile(s)
|
---|
| 680 | CivStage_1=0;%default
|
---|
| 681 | VelType_out_1=[];
|
---|
| 682 | InputField={FieldName};
|
---|
| 683 | InputField_1={FieldName_1};
|
---|
| 684 | if ~isfield(UvData,'Txt') && ((~isempty(filename)&& isequal(FileType,'netcdf')) || (~isempty(filename_1)&& isequal(FileType,'netcdf'))) ;
|
---|
| 685 | %read the velocity field(s) from netcdf rootfile(s)
|
---|
| 686 | list_code=get(handles.col_vec,'String');% list menu fields
|
---|
| 687 | index_code=get(handles.col_vec,'Value');% selected string index
|
---|
| 688 | scal_color= list_code{index_code(1)}; % selected field
|
---|
| 689 | if isequal(FieldName,'velocity')&& ~isequal(scal_color,'black') && ~isequal(scal_color,'white')
|
---|
| 690 | InputField=[InputField scal_color];
|
---|
| 691 | end
|
---|
| 692 | if isequal(FieldName_1,'velocity') && ~isequal(scal_color,'black') && ~isequal(scal_color,'white')
|
---|
| 693 | InputField_1=[InputField_1 scal_color];
|
---|
| 694 | end
|
---|
| 695 | if isequal(FileType,'netcdf') %read the first nc field
|
---|
| 696 | if isequal(FieldName,'get_field...')% read the field names on the interface get_field.
|
---|
| 697 | VelType=get(handles.Fields,'UserData');
|
---|
| 698 | hget_field=findobj(allchild(0),'Name','get_field');%find the get_field... GUI
|
---|
| 699 | if isempty(hget_field)
|
---|
| 700 | hget_field= get_field(filename);%open the get_field GUI
|
---|
| 701 | end
|
---|
| 702 | hhget_field=guidata(hget_field);
|
---|
| 703 | set(hhget_field.inputfile,'String',filename)% update the list of input fields in get_field
|
---|
| 704 | set(hhget_field.ACTION,'Value',1)% PLOT option selected
|
---|
| 705 | set(hhget_field.list_fig,'Value',2)% plotting axes =view_field selected
|
---|
| 706 | [Field{1},errormsg]=read_get_field(hget_field); %read the names of the variables to plot in the get_field GUI
|
---|
| 707 | if ~isempty(errormsg)
|
---|
| 708 | msgbox_view_field('ERROR',['error in view_field/run0_Callback/read_get_field: ' errormsg])
|
---|
| 709 | return
|
---|
| 710 | end
|
---|
| 711 | CivStage=0;
|
---|
| 712 | VelType_out=[];
|
---|
| 713 | else
|
---|
| 714 | [Field{1},VelType_out]=read_civxdata(filename,InputField,VelType);
|
---|
| 715 | if isfield(Field{1},'Txt')
|
---|
| 716 | msgbox_view_field('ERROR',Field{1}.Txt)
|
---|
| 717 | return
|
---|
| 718 | end
|
---|
| 719 | CivStage=Field{1}.CivStage;
|
---|
| 720 | UvData.NbDim=Field{1}.nb_dim;
|
---|
| 721 | end
|
---|
| 722 | end
|
---|
| 723 | if ~isempty(filename_1) && isequal(FileType_1,'netcdf') %read the second file
|
---|
| 724 | if isequal(FieldName_1,'get_field...')% read the field names on the interface get_field.
|
---|
| 725 | hget_field=findobj(allchild(0),'Name','get_field_1');%find the get_field... GUI
|
---|
| 726 | if isempty(hget_field)
|
---|
| 727 | hget_field= get_field(filename_1);%open the get_field GUI
|
---|
| 728 | set(hget_field,'name','get_field_1')
|
---|
| 729 | % enable_transform(handles,'off')% no field transform (possible transform in the GUI get_field)
|
---|
| 730 | end
|
---|
| 731 | hhget_field=guidata(hget_field);%handles of GUI elements in get_field
|
---|
| 732 | SubField=get_field('read_var_names',hObject,eventdata,hhget_field); %read the names of the variables to plot in the get_field GUI
|
---|
| 733 | [Field{2},var_detect]=nc2struct(filename_1,SubField.ListVarName); %read the corresponding input data
|
---|
| 734 | Field{2}.VarAttribute=SubField.VarAttribute;
|
---|
| 735 | %update the display on get_field
|
---|
| 736 | set(hhget_field.inputfile,'String',filename_1)
|
---|
| 737 | set(hhget_field.variables,'Value',1)
|
---|
| 738 | Tabchar={''};%default
|
---|
| 739 | Tabcell=[];
|
---|
| 740 | if isfield(Field{2},'ListGlobalAttribute')& ~isempty(Field{2}.ListGlobalAttribute)
|
---|
| 741 | for iline=1:length(Field{2}.ListGlobalAttribute)
|
---|
| 742 | Tabcell{iline,1}=Field{2}.ListGlobalAttribute{iline};
|
---|
| 743 | if isfield(Field{2}, Field{2}.ListGlobalAttribute{iline})
|
---|
| 744 | eval(['val=Field{2}.' Field{2}.ListGlobalAttribute{iline} ';'])
|
---|
| 745 | if ischar(val);
|
---|
| 746 | Tabcell{iline,2}=val;
|
---|
| 747 | else
|
---|
| 748 | Tabcell{iline,2}=num2str(val);
|
---|
| 749 | end
|
---|
| 750 | end
|
---|
| 751 | end
|
---|
| 752 | if ~isempty(Tabcell)
|
---|
| 753 | Tabchar=cell2tab(Tabcell,'=');
|
---|
| 754 | Tabchar=[{''};Tabchar];
|
---|
| 755 | end
|
---|
| 756 | end
|
---|
| 757 | set(hhget_field.attributes,'String',Tabchar);%update list of global attributes in get_field
|
---|
| 758 | else
|
---|
| 759 | [Field{2},VelType_out_1]=read_civxdata(filename_1,[],VelType_1);
|
---|
| 760 | CivStage_1=Field{2}.CivStage;
|
---|
| 761 | end
|
---|
| 762 | if ~isequal(FileType,'netcdf')
|
---|
| 763 | VelType_out=VelType_out_1;
|
---|
| 764 | end
|
---|
| 765 | end
|
---|
| 766 | end
|
---|
| 767 |
|
---|
| 768 | %update the display buttons for the first velocity type (first menuline)
|
---|
| 769 | veltype_handles=[handles.civ1 handles.interp1 handles.filter1 handles.civ2 handles.interp2 handles.filter2];
|
---|
| 770 | if ~isequal(FileType,'netcdf')
|
---|
| 771 | reset_vel_type(veltype_handles)
|
---|
| 772 | elseif isempty(VelType)
|
---|
| 773 | set_veltype_display(veltype_handles,CivStage)%update the display of available velocity types for the first field
|
---|
| 774 | if isempty(VelType_out)
|
---|
| 775 | reset_vel_type(veltype_handles)
|
---|
| 776 | else
|
---|
| 777 | handle1=eval(['handles.' VelType_out]);
|
---|
| 778 | reset_vel_type(veltype_handles,handle1)
|
---|
| 779 | end
|
---|
| 780 | end
|
---|
| 781 |
|
---|
| 782 | %update the display buttons for the second velocity type (second menuline)
|
---|
| 783 | veltype_handles_1=[handles.civ1_1 handles.interp1_1 handles.filter1_1 handles.civ2_1 handles.interp2_1 handles.filter2_1];
|
---|
| 784 | if ~isequal(FileType_1,'netcdf')
|
---|
| 785 | reset_vel_type(veltype_handles_1)
|
---|
| 786 | elseif isempty(VelType_1)
|
---|
| 787 | set_veltype_display(veltype_handles_1,CivStage_1)%update the display of available velocity types for the first field
|
---|
| 788 | if isempty(VelType_out_1)
|
---|
| 789 | reset_vel_type(veltype_handles_1)
|
---|
| 790 | else
|
---|
| 791 | handle1=eval(['handles.' VelType_out_1 '_1']);
|
---|
| 792 | reset_vel_type(veltype_handles_1,handle1)
|
---|
| 793 | end
|
---|
| 794 | end
|
---|
| 795 |
|
---|
| 796 | %introduce w as background image by default for a new series (only for nbdim=2)
|
---|
| 797 | if ~isfield(UvData,'NewSeries')
|
---|
| 798 | UvData.NewSeries=1;
|
---|
| 799 | end
|
---|
| 800 | %put W as background image by default if NbDim=2:
|
---|
| 801 | if ~isfield(UvData,'NbDim')||isempty(UvData.NbDim)||~isequal(UvData.NbDim,3)
|
---|
| 802 | if UvData.NewSeries && isequal(get(handles.SubField,'Value'),0) && isfield(Field{1},'W') && ~isempty(Field{1}.W);
|
---|
| 803 | set(handles.SubField,'Value',1);
|
---|
| 804 | %menu=update_menu(handles.Fields_1,'w');%update the menu for the background scalar nd set the choice to 'w'
|
---|
| 805 | set(handles.RootPath_1,'String','"')
|
---|
| 806 | set(handles.RootFile_1,'String','"')
|
---|
| 807 | set(handles.SubDir_1,'String','"');
|
---|
| 808 | [indices]=name_generator('',num_i1,num_j1,'',NomType,1,num_i2,num_j2,'');
|
---|
| 809 | set(handles.FileIndex_1,'String',indices)
|
---|
| 810 | set(handles.FileExt_1,'String','"');
|
---|
| 811 | set(handles.Fields_1,'Visible','on');
|
---|
| 812 | set(handles.Fields_1,'Visible','on');
|
---|
| 813 | set(handles.RootPath_1,'Visible','on')
|
---|
| 814 | set(handles.RootFile_1,'Visible','on')
|
---|
| 815 | set(handles.SubDir_1,'Visible','on');
|
---|
| 816 | set(handles.FileIndex_1,'Visible','on');
|
---|
| 817 | set(handles.FileExt_1,'Visible','on');
|
---|
| 818 | set(handles.Fields_1,'Visible','on');
|
---|
| 819 | Field{1}.AName='w';
|
---|
| 820 | testscal=1;
|
---|
| 821 | end
|
---|
| 822 | end
|
---|
| 823 |
|
---|
| 824 | %multislice case
|
---|
| 825 | if TestInputFile &&(~isfield(UvData,'NbDim') || isequal(UvData.NbDim,2))&&...%2D case
|
---|
| 826 | isfield(UvData,'XmlData') && isfield(UvData.XmlData,'GeometryCalib')&& isfield(UvData.XmlData.GeometryCalib,'SliceCoord')
|
---|
| 827 | % nbfield2=str2num(get(handles.last_j,'String'));
|
---|
| 828 | siz=size(UvData.XmlData.GeometryCalib.SliceCoord);
|
---|
| 829 | if siz(1)>1
|
---|
| 830 | NbSlice=siz(1);
|
---|
| 831 | set(handles.slices,'Visible','on')
|
---|
| 832 | set(handles.slices,'Value',1)
|
---|
| 833 | else
|
---|
| 834 | NbSlice=1;
|
---|
| 835 | end
|
---|
| 836 | set(handles.nb_slice,'String',num2str(NbSlice))
|
---|
| 837 | slices_Callback(hObject, eventdata, handles)
|
---|
| 838 | % Coord=UvData.XmlData.GeometryCalib.SliceCoord;
|
---|
| 839 | % ZIndex=num_i1-NbSlice*(floor((num_i1-1)/NbSlice));
|
---|
| 840 | % Field{1}.Z=ZIndex;
|
---|
| 841 | end
|
---|
| 842 |
|
---|
| 843 | %store the current open names, fields and vel types in view_field interface
|
---|
| 844 | UvData.filename=filename;
|
---|
| 845 | UvData.filename_1=filename_1;
|
---|
| 846 | UvData.VelType=VelType;
|
---|
| 847 | UvData.VelType_1=VelType_1;
|
---|
| 848 | UvData.FieldName=FieldName;
|
---|
| 849 | UvData.FieldName_1=FieldName_1;
|
---|
| 850 | if ~isempty(scal_color)
|
---|
| 851 | UvData.CName=scal_color;
|
---|
| 852 | end
|
---|
| 853 |
|
---|
| 854 | %coordinate transform or user fct
|
---|
| 855 | XmlData=[];%default
|
---|
| 856 | if isfield(UvData,'XmlData')%use geometry calib recorded from the ImaDoc xml file as first priority
|
---|
| 857 | XmlData=UvData.XmlData;
|
---|
| 858 | end
|
---|
| 859 | XmlData_1=[];%default
|
---|
| 860 | if isfield(UvData,'XmlData_1')
|
---|
| 861 | XmlData_1=UvData.XmlData_1;
|
---|
| 862 | end
|
---|
| 863 | menu_transform=get(handles.transform_fct,'String');
|
---|
| 864 | choice_value=get(handles.transform_fct,'Value');
|
---|
| 865 | %transform=menu_transform{choice_value};%name of the transform fct given by the menu 'transform_fct'
|
---|
| 866 | transform_list=get(handles.transform_fct,'UserData');
|
---|
| 867 | transform=transform_list{choice_value};%selected function handles
|
---|
| 868 |
|
---|
| 869 | % z index
|
---|
| 870 | if TestInputFile
|
---|
| 871 | Field{1}.ZIndex=mod(num_i1-1,nbslice)+1;
|
---|
| 872 | end
|
---|
| 873 | %px to phys or other transform on field
|
---|
| 874 | if ~isempty(transform)
|
---|
| 875 | if length(Field)>=2
|
---|
| 876 | Field{2}.ZIndex=mod(num_i1-1,nbslice)+1;
|
---|
| 877 | [Field{1},Field{2}]=transform(Field{1},XmlData,Field{2},XmlData_1);
|
---|
| 878 | if isempty(Field{2})
|
---|
| 879 | Field(2)=[];
|
---|
| 880 | end
|
---|
| 881 | else
|
---|
| 882 | Field{1}=transform(Field{1},XmlData);
|
---|
| 883 | end
|
---|
| 884 | end
|
---|
| 885 |
|
---|
| 886 | %calculate scalar
|
---|
| 887 | if isequal(FileType,'netcdf') && ~isequal(FieldName,'get_field...')%
|
---|
| 888 | Field{1}=calc_field(InputField,Field{1});
|
---|
| 889 | end
|
---|
| 890 | if length(Field)==2 && isequal(FileType_1,'netcdf') && ~isequal(FieldName_1,'get_field...')
|
---|
| 891 | Field{2}=calc_field(InputField_1,Field{2});
|
---|
| 892 | end
|
---|
| 893 |
|
---|
| 894 | % combine the two input fields (e.g. substract velocity fields)
|
---|
| 895 | if numel(Field)==2
|
---|
| 896 | if ~(isequal(get(handles.movie_pair,'Value'),1) && isequal(FieldName,'image') && isequal(FieldName_1,'image')) %combine fields if not viewing image pairs
|
---|
| 897 | UvData.Field=sub_field(Field{1},Field{2}); %TO UPDATE FOR MORE GENERAL INPUT
|
---|
| 898 | end
|
---|
| 899 | else
|
---|
| 900 | UvData.Field=Field{1};
|
---|
| 901 | end
|
---|
| 902 | UvData.NewSeries=0;% put to 0 the test for a new field series (set by RootPath_callback)
|
---|
| 903 | % test 3D , default projection menuplane and typical mesh (needed to menuopen set_object)
|
---|
| 904 | test_x=0;
|
---|
| 905 | test_z=0;% test for unstructured z coordinate
|
---|
| 906 | UvData.ZMax=0;
|
---|
| 907 | UvData.ZMin=0;%default
|
---|
| 908 | UvData.Mesh=1; %default
|
---|
| 909 | [UvData.Field,errormsg]=check_field_structure(UvData.Field);
|
---|
| 910 | if ~isempty(errormsg)
|
---|
| 911 | msgbox_view_field('ERROR',['error in view_field/run0_Callback/check_field_structure: ' errormsg])
|
---|
| 912 | return
|
---|
| 913 | end
|
---|
| 914 | [CellVarIndex,NbDim,VarType]=find_field_indices(UvData.Field);
|
---|
| 915 | [NbDim,imax]=max(NbDim);
|
---|
| 916 | if isempty(imax)
|
---|
| 917 | % DimVarIndex=0;
|
---|
| 918 | coord_x=[];
|
---|
| 919 | else
|
---|
| 920 | % VarIndex=CellVarIndex{imax};
|
---|
| 921 | coord_x=VarType{imax}.coord_x;
|
---|
| 922 | end
|
---|
| 923 | if isfield(UvData,'NbDim') && ~isempty(UvData.NbDim)
|
---|
| 924 | NbDim=UvData.NbDim;
|
---|
| 925 | else
|
---|
| 926 | UvData.NbDim=NbDim;
|
---|
| 927 | end
|
---|
| 928 | if ~isempty(CellVarIndex) && ~isempty(VarType{imax}.coord_x) && ~isempty(VarType{imax}.coord_y) %unstructured coordinate z
|
---|
| 929 | XName=UvData.Field.ListVarName{VarType{imax}.coord_x};
|
---|
| 930 | YName=UvData.Field.ListVarName{VarType{imax}.coord_y};
|
---|
| 931 | test_x=1;
|
---|
| 932 | elseif isfield(UvData.Field,'X') && isfield(UvData.Field,'Y')
|
---|
| 933 | XName='X';
|
---|
| 934 | YName='Y';
|
---|
| 935 | test_x=1;
|
---|
| 936 | end
|
---|
| 937 | if test_x
|
---|
| 938 | eval(['UvData.XMax=max(UvData.Field.' XName ');'])
|
---|
| 939 | eval(['UvData.XMin=min(UvData.Field.' XName ');'])
|
---|
| 940 | eval(['UvData.YMax=max(UvData.Field.' YName ');'])
|
---|
| 941 | eval(['UvData.YMin=min(UvData.Field.' YName ');'])
|
---|
| 942 | eval(['nbvec=length(UvData.Field.' XName ');'])
|
---|
| 943 | if NbDim==3%
|
---|
| 944 | if ~isempty(CellVarIndex) && ~isempty(VarType{imax}.coord_z)%unstructured coordinate z
|
---|
| 945 | ZName=UvData.Field.ListVarName{VarType{imax}.coord_z};
|
---|
| 946 | eval(['UvData.ZMax=max(UvData.Field.' ZName ');'])
|
---|
| 947 | eval(['UvData.ZMin=min(UvData.Field.' ZName ');'])
|
---|
| 948 | test_z=1;
|
---|
| 949 | elseif isfield(UvData,'Z')% usual civ data
|
---|
| 950 | UvData.ZMax=max(UvData.Z);
|
---|
| 951 | UvData.ZMin=min(UvData.Z);
|
---|
| 952 | test_z=1;
|
---|
| 953 | end
|
---|
| 954 | end
|
---|
| 955 | if isequal(UvData.ZMin,UvData.ZMax)%no z dependency
|
---|
| 956 | NbDim=2;
|
---|
| 957 | test_z=0;
|
---|
| 958 | end
|
---|
| 959 | if test_z
|
---|
| 960 | UvData.Mesh=((UvData.XMax-UvData.XMin)*(UvData.YMax-UvData.YMin)*(UvData.ZMax-UvData.ZMin))/nbvec;% volume per vector
|
---|
| 961 | UvData.Mesh=(UvData.Mesh)^(1/3);
|
---|
| 962 | else
|
---|
| 963 | UvData.Mesh=sqrt((UvData.XMax-UvData.XMin)*(UvData.YMax-UvData.YMin)/nbvec);%2D
|
---|
| 964 | end
|
---|
| 965 | end
|
---|
| 966 | %case of structured coordinates
|
---|
| 967 | if isfield(UvData.Field,'AX') & isfield(UvData.Field,'AY')& isfield(UvData.Field,'A')
|
---|
| 968 | UvData.XMax=max(UvData.Field.AX);
|
---|
| 969 | UvData.XMin=min(UvData.Field.AX);
|
---|
| 970 | UvData.YMax=max(UvData.Field.AY);
|
---|
| 971 | UvData.YMin=min(UvData.Field.AY);
|
---|
| 972 | np_A=size(UvData.Field.A);
|
---|
| 973 | UvData.Mesh=sqrt((UvData.XMax-UvData.XMin)*(UvData.YMax-UvData.YMin)/((np_A(1)-1) * (np_A(2)-1))) ;
|
---|
| 974 | end
|
---|
| 975 | if isempty(coord_x)&~isempty(CellVarIndex)
|
---|
| 976 | VarIndex=CellVarIndex{imax}; % list of variable indices
|
---|
| 977 | DimIndex=UvData.Field.VarDimIndex{VarIndex(1)}; %list of dim indices for the variable
|
---|
| 978 | if NbDim==3
|
---|
| 979 | nbpoints=UvData.Field.DimValue(DimIndex(1));
|
---|
| 980 | %Zvar=DimVarIndex(DimIndex(1));
|
---|
| 981 | %Zvar=DimVarIndex(1);
|
---|
| 982 | Zvar=VarType{imax}.coord_3;
|
---|
| 983 | if Zvar~=0 % z is a dimension variable
|
---|
| 984 | ZName=UvData.Field.ListVarName{Zvar};
|
---|
| 985 | eval(['UvData.ZMax=max(UvData.Field.' ZName ');'])
|
---|
| 986 | eval(['UvData.ZMin=min(UvData.Field.' ZName ');'])
|
---|
| 987 | else
|
---|
| 988 | testcoord_z=0;
|
---|
| 989 | if length(UvData.Field.VarAttribute)>=VarIndex(1)
|
---|
| 990 | if isfield(UvData.Field.VarAttribute{VarIndex(1)},'Coord_1')%regular grid
|
---|
| 991 | Coord_z=UvData.Field.VarAttribute{VarIndex(1)}.Coord_1;
|
---|
| 992 | UvData.ZMax=max(Coord_z);
|
---|
| 993 | UvData.ZMin=min(Coord_z);
|
---|
| 994 | testcoord_z=1;
|
---|
| 995 | end
|
---|
| 996 | end
|
---|
| 997 | if ~testcoord_z
|
---|
| 998 | UvData.ZMin=1;
|
---|
| 999 | UvData.ZMax=UvData.Field.DimValue(DimIndex(1));
|
---|
| 1000 | end
|
---|
| 1001 | end
|
---|
| 1002 | UvData.Mesh=(UvData.ZMax-UvData.ZMin)/(nbpoints-1);
|
---|
| 1003 | elseif NbDim==2
|
---|
| 1004 | nbpoints_y=UvData.Field.DimValue(DimIndex(1));
|
---|
| 1005 | Yvar=VarType{imax}.coord_y;
|
---|
| 1006 | if Yvar~=0 % x is a dimension variable
|
---|
| 1007 | YName=UvData.Field.ListVarName{Yvar};
|
---|
| 1008 | eval(['UvData.YMax=max(UvData.Field.' YName ');'])
|
---|
| 1009 | eval(['UvData.YMin=min(UvData.Field.' YName ');'])
|
---|
| 1010 | else
|
---|
| 1011 | testcoord_y=0;
|
---|
| 1012 | if ~testcoord_y
|
---|
| 1013 | UvData.YMin=1;
|
---|
| 1014 | UvData.YMax=UvData.Field.DimValue(DimIndex(1));
|
---|
| 1015 | end
|
---|
| 1016 | end
|
---|
| 1017 | DY=(UvData.YMax-UvData.YMin)/(nbpoints_y-1);
|
---|
| 1018 | nbpoints_x=UvData.Field.DimValue(DimIndex(2));
|
---|
| 1019 | Xvar=VarType{imax}.coord_x;
|
---|
| 1020 | if Xvar~=0 % x is a dimension variable
|
---|
| 1021 | XName=UvData.Field.ListVarName{Xvar};
|
---|
| 1022 | eval(['UvData.XMax=max(UvData.Field.' XName ');'])
|
---|
| 1023 | eval(['UvData.XMin=min(UvData.Field.' XName ');'])
|
---|
| 1024 | else
|
---|
| 1025 | testcoord_x=0;
|
---|
| 1026 | if ~testcoord_x
|
---|
| 1027 | UvData.XMin=1;
|
---|
| 1028 | UvData.XMax=UvData.Field.DimValue(DimIndex(2));
|
---|
| 1029 | end
|
---|
| 1030 | end
|
---|
| 1031 | DX=(UvData.XMax-UvData.XMin)/(nbpoints_x-1);
|
---|
| 1032 | UvData.Mesh= sqrt(DX*DY);
|
---|
| 1033 | end
|
---|
| 1034 | end
|
---|
| 1035 |
|
---|
| 1036 | %create a default projection menuplane
|
---|
| 1037 | UvData.Object{1}.Style='plane';%main plotting plane
|
---|
| 1038 | UvData.Object{1}.ProjMode='projection';%main plotting plane
|
---|
| 1039 | if ~isfield(UvData.Object{1},'plotaxes')
|
---|
| 1040 | UvData.Object{1}.plotaxes=handles.axes3;%default plotting axis
|
---|
| 1041 | set(handles.list_object,'String',{'1-PLANE';'...'});
|
---|
| 1042 | set(handles.list_object,'Value',1);
|
---|
| 1043 | end
|
---|
| 1044 |
|
---|
| 1045 | %3D case (menuvolume)
|
---|
| 1046 | if NbDim==3
|
---|
| 1047 | UvData.Object{1}.NbDim=UvData.NbDim;%test for 3D objects
|
---|
| 1048 | UvData.Object{1}.RangeZ=UvData.Mesh;%main plotting plane
|
---|
| 1049 | UvData.Object{1}.Coord(1,3)=(UvData.ZMin+UvData.ZMax)/2;%section at a middle plane chosen
|
---|
| 1050 | UvData.Object{1}.Phi=0;
|
---|
| 1051 | UvData.Object{1}.Theta=0;
|
---|
| 1052 | UvData.Object{1}.Psi=0;
|
---|
| 1053 | UvData.Object{1}.HandlesDisplay=plot(0,0,'Tag','proj_object');% A REVOIR
|
---|
| 1054 | PlotHandles=get_plot_handles(handles);
|
---|
| 1055 | ZBounds(1)=UvData.ZMin; %minimum for the Z slider
|
---|
| 1056 | ZBounds(2)=UvData.ZMax;%maximum for the Z slider
|
---|
| 1057 | set_object(UvData.Object{1},PlotHandles,ZBounds);
|
---|
| 1058 | set(handles.list_object,'Value',1);
|
---|
| 1059 | %multilevel case (single menuplane in a 3D space)
|
---|
| 1060 | elseif isfield(UvData,'Z')
|
---|
| 1061 | if isfield(UvData,'CoordType')& isequal(UvData.CoordType,'phys') & isfield(UvData,'XmlData')
|
---|
| 1062 | XmlData=UvData.XmlData;
|
---|
| 1063 | if isfield(XmlData,'PlanePos')
|
---|
| 1064 | UvData.Object{1}.Coord=XmlData.PlanePos(UvData.ZIndex,:);
|
---|
| 1065 | end
|
---|
| 1066 | if isfield(XmlData,'PlaneAngle')
|
---|
| 1067 | siz=size(XmlData.PlaneAngle);
|
---|
| 1068 | indangle=min(siz(1),UvData.ZIndex);%take first angle if a single angle is defined (translating scanning)
|
---|
| 1069 | UvData.Object{1}.Phi=XmlData.PlaneAngle(indangle,1);
|
---|
| 1070 | UvData.Object{1}.Theta=XmlData.PlaneAngle(indangle,2);
|
---|
| 1071 | UvData.Object{1}.Psi=XmlData.PlaneAngle(indangle,3);
|
---|
| 1072 | end
|
---|
| 1073 | elseif isfield(UvData,'ZIndex')
|
---|
| 1074 | UvData.Object{1}.ZObject=UvData.ZIndex;
|
---|
| 1075 | end
|
---|
| 1076 | end
|
---|
| 1077 |
|
---|
| 1078 | %Plot the projections on all existing projection objects
|
---|
| 1079 | keeplim=get(handles.FixedLimits,'Value');
|
---|
| 1080 | %reset the min and max of scalar if only the mask is displayed
|
---|
| 1081 | if isfield(UvData,'Mask')&~isfield(UvData,'A')
|
---|
| 1082 | set(handles.MinA,'String','0')
|
---|
| 1083 | set(handles.MaxA,'String','255')
|
---|
| 1084 | end
|
---|
| 1085 |
|
---|
| 1086 | Object=UvData.Object;
|
---|
| 1087 | for iobj=1:length(Object)
|
---|
| 1088 | if ~isempty(Object{iobj})%& isfield(Object{iobj},'plotaxes')& ishandle(Object{iobj}.plotaxes)
|
---|
| 1089 | %Projeter les champs sur l'objet:*
|
---|
| 1090 | ObjectData=proj_field(UvData.Field,Object{iobj},iobj);
|
---|
| 1091 |
|
---|
| 1092 | %use of mask
|
---|
| 1093 | if isfield(ObjectData,'NbDim')&isequal(ObjectData.NbDim,2)
|
---|
| 1094 | if isfield(ObjectData,'Mask') & isfield(ObjectData,'A')
|
---|
| 1095 | flag_mask=double(ObjectData.Mask>200);%=0 for masked regions
|
---|
| 1096 | AX=ObjectData.AX;
|
---|
| 1097 | AY=ObjectData.AY;
|
---|
| 1098 | MaskX=ObjectData.MaskX;
|
---|
| 1099 | MaskY=ObjectData.MaskY;
|
---|
| 1100 | if ~isequal(MaskX,AX)|~isequal(MaskY,AY)
|
---|
| 1101 | nxy=size(flag_mask);
|
---|
| 1102 | sizpx=(ObjectData.MaskX(end)-ObjectData.MaskX(1))/(nxy(2)-1);%size of a mask pixel
|
---|
| 1103 | sizpy=(ObjectData.MaskY(1)-ObjectData.MaskY(end))/(nxy(1)-1);
|
---|
| 1104 | x_mask=[ObjectData.MaskX(1):sizpx:ObjectData.MaskX(end)]; % pixel x coordinates for image display
|
---|
| 1105 | y_mask=[ObjectData.MaskY(1):-sizpy:ObjectData.MaskY(end)];% pixel x coordinates for image display
|
---|
| 1106 | %project on the positions of the scalar
|
---|
| 1107 | npxy=size(ObjectData.A);
|
---|
| 1108 | dxy(1)=(ObjectData.AY(end)-ObjectData.AY(1))/(npxy(1)-1);%grid mesh in y
|
---|
| 1109 | dxy(2)=(ObjectData.AX(end)-ObjectData.AX(1))/(npxy(2)-1);%grid mesh in x
|
---|
| 1110 | xi=[ObjectData.AX(1):dxy(2):ObjectData.AX(end)];
|
---|
| 1111 | yi=[ObjectData.AY(1):dxy(1):ObjectData.AY(end)];
|
---|
| 1112 | [XI,YI]=meshgrid(xi,yi);% creates the matrix of regular coordinates
|
---|
| 1113 | flag_mask = interp2(x_mask,y_mask,flag_mask,XI,YI);
|
---|
| 1114 | end
|
---|
| 1115 | AClass=class(ObjectData.A);
|
---|
| 1116 | ObjectData.A=flag_mask.*double(ObjectData.A);
|
---|
| 1117 | ObjectData.A=feval(AClass,ObjectData.A);
|
---|
| 1118 | ind_off=[];
|
---|
| 1119 | if isfield(ObjectData,'ListVarName')
|
---|
| 1120 | for ilist=1:length(ObjectData.ListVarName)
|
---|
| 1121 | if isequal(ObjectData.ListVarName{ilist},'Mask')|isequal(ObjectData.ListVarName{ilist},'MaskX')|isequal(ObjectData.ListVarName{ilist},'MaskY')
|
---|
| 1122 | ind_off=[ind_off ilist];
|
---|
| 1123 | end
|
---|
| 1124 | end
|
---|
| 1125 | ObjectData.ListVarName(ind_off)=[];
|
---|
| 1126 | ObjectData.VarDimIndex(ind_off)=[];
|
---|
| 1127 | ind_off=[];
|
---|
| 1128 | for ilist=1:length(ObjectData.ListDimName)
|
---|
| 1129 | if isequal(ObjectData.ListDimName{ilist},'MaskX')|isequal(ObjectData.ListDimName{ilist},'MaskY')
|
---|
| 1130 | ind_off=[ind_off ilist];
|
---|
| 1131 | end
|
---|
| 1132 | end
|
---|
| 1133 | ObjectData.ListDimName(ind_off)=[];
|
---|
| 1134 | ObjectData.DimValue(ind_off)=[];
|
---|
| 1135 | end
|
---|
| 1136 | end
|
---|
| 1137 | end
|
---|
| 1138 | if ~isempty(ObjectData)
|
---|
| 1139 | haxes=[];%default
|
---|
| 1140 | if isfield(Object{iobj},'plotaxes')
|
---|
| 1141 | haxes=Object{iobj}.plotaxes;%axes used for representing the projection on the object
|
---|
| 1142 | end
|
---|
| 1143 | PosColorbar=[];%default: no colorbar
|
---|
| 1144 | if ishandle(haxes) & isequal(get(haxes,'Tag'),'axes3')& isfield(UvData,'PosColorbar')
|
---|
| 1145 | PosColorbar=UvData.PosColorbar;%prescribe the colorbar position on the view_field interface
|
---|
| 1146 | else
|
---|
| 1147 | PosColorbar='*';%default position
|
---|
| 1148 | end
|
---|
| 1149 | PlotParam=read_plot_param(handles);%read plotting parameters on the view_field interface
|
---|
| 1150 | [PlotType,ScalOut,UvData.Object{iobj}.plotaxes]=plot_field(ObjectData,haxes,PlotParam,keeplim,PosColorbar);
|
---|
| 1151 | if isequal(PlotType,'none')
|
---|
| 1152 | hget_field=findobj(allchild(0),'name','get_field');
|
---|
| 1153 | if isempty(hget_field)
|
---|
| 1154 | get_field([],ObjectData)% the projected field cannot be automatically plotted: use get_field to specify the variablesdelete(hget_field)
|
---|
| 1155 | else
|
---|
| 1156 | msgbox_view_field('ERROR','The field defined by get_field cannot be plotted')
|
---|
| 1157 | end
|
---|
| 1158 | end
|
---|
| 1159 | UvData.Object{iobj}.PlotParam=ScalOut; %record the plotting parameters
|
---|
| 1160 | end
|
---|
| 1161 |
|
---|
| 1162 | end
|
---|
| 1163 | end
|
---|
| 1164 |
|
---|
| 1165 | %display the updated plotting parameters for the base menuplane
|
---|
| 1166 | write_plot_param(handles,UvData.Object{1}.PlotParam);% update the display of the plotting parameters
|
---|
| 1167 | set(handles.view_field,'UserData',UvData)
|
---|
| 1168 |
|
---|
| 1169 | %update the mask
|
---|
| 1170 | if isequal(get(handles.mask_test,'Value'),1)%if the mask option is on
|
---|
| 1171 | update_mask(handles,num_i1,num_i2);
|
---|
| 1172 | end
|
---|
| 1173 |
|
---|
| 1174 | %prepare the menus of histograms (for the whole menuvolume in 3D case)
|
---|
| 1175 | menu_histo=(UvData.Field.ListVarName)';
|
---|
| 1176 | ind_bad=[];
|
---|
| 1177 | nb_histo=1;
|
---|
| 1178 | for ivar=1:numel(menu_histo)
|
---|
| 1179 | if isfield(UvData.Field,'VarAttribute') && numel(UvData.Field.VarAttribute)>=ivar && isfield(UvData.Field.VarAttribute{ivar},'Role')
|
---|
| 1180 | Role=UvData.Field.VarAttribute{ivar}.Role;
|
---|
| 1181 | switch Role
|
---|
| 1182 | case {'coord_x','coord_y','coord_z','dimvar'}
|
---|
| 1183 | ind_bad=[ind_bad ivar];
|
---|
| 1184 | case {'vector_y'}
|
---|
| 1185 | nb_histo=nb_histo+1;
|
---|
| 1186 | end
|
---|
| 1187 | end
|
---|
| 1188 | DimCell=UvData.Field.VarDimName{ivar};
|
---|
| 1189 | DimName='';
|
---|
| 1190 | if ischar(DimCell)
|
---|
| 1191 | DimName=DimCell;
|
---|
| 1192 | elseif iscell(DimCell)&& numel(DimCell)==1
|
---|
| 1193 | DimName=DimCell{1};
|
---|
| 1194 | end
|
---|
| 1195 | if strcmp(DimName,menu_histo{ivar})
|
---|
| 1196 | ind_bad=[ind_bad ivar];
|
---|
| 1197 | end
|
---|
| 1198 | end
|
---|
| 1199 | menu_histo(ind_bad)=[];
|
---|
| 1200 | test_v=0;
|
---|
| 1201 | if ~isempty(menu_histo)
|
---|
| 1202 | set(handles.histo1_menu,'Value',1)
|
---|
| 1203 | set(handles.histo1_menu,'String',menu_histo)
|
---|
| 1204 | histo1_menu_Callback(hObject, eventdata, handles)
|
---|
| 1205 | if nb_histo > 1
|
---|
| 1206 | test_v=1;
|
---|
| 1207 | set(handles.histo2_menu,'Visible','on')
|
---|
| 1208 | set(handles.histo_v,'Visible','on')
|
---|
| 1209 | set(handles.histo2_menu,'String',menu_histo)
|
---|
| 1210 | set(handles.histo2_menu,'Value',2)
|
---|
| 1211 | histo2_menu_Callback(hObject, eventdata, handles)
|
---|
| 1212 | end
|
---|
| 1213 | end
|
---|
| 1214 | if ~test_v
|
---|
| 1215 | set(handles.histo2_menu,'Visible','off')
|
---|
| 1216 | set(handles.histo_v,'Visible','off')
|
---|
| 1217 | cla(handles.histo_v)
|
---|
| 1218 | set(handles.histo2_menu,'Value',1)
|
---|
| 1219 | end
|
---|
| 1220 |
|
---|
| 1221 | %display time
|
---|
| 1222 | testimedoc=0;
|
---|
| 1223 | if isfield(UvData,'XmlData') && isfield(UvData.XmlData,'Time')
|
---|
| 1224 | if isempty(num_i2)
|
---|
| 1225 | num_i2=num_i1;
|
---|
| 1226 | end
|
---|
| 1227 | if isempty(num_j1)
|
---|
| 1228 | num_j1=1;
|
---|
| 1229 | end
|
---|
| 1230 | if isempty(num_j2)
|
---|
| 1231 | num_j2=num_j1;
|
---|
| 1232 | end
|
---|
| 1233 | siz=size(UvData.XmlData.Time);
|
---|
| 1234 | if siz(1)>=max(num_i1,num_i2) & siz(2)>=max(num_j1,num_j2)
|
---|
| 1235 | abstime=(UvData.XmlData.Time(num_i1,num_j1)+UvData.XmlData.Time(num_i2,num_j2))/2;%overset the time read from files
|
---|
| 1236 | dt=(UvData.XmlData.Time(num_i2,num_j2)-UvData.XmlData.Time(num_i1,num_j1));
|
---|
| 1237 | testimedoc=1;
|
---|
| 1238 | end
|
---|
| 1239 | end
|
---|
| 1240 | if isfield(UvData,'XmlData_1') && isfield(UvData.XmlData_1,'Time')
|
---|
| 1241 | [P,F,str1,str2,str_a,str_b,E,NomType]=name2display(['xx' get(handles.FileIndex_1,'String') get(handles.FileExt_1,'String')]);
|
---|
| 1242 | num_i2=str2num(str2);
|
---|
| 1243 | if isempty(num_i2)
|
---|
| 1244 | num_i2=num_i1;
|
---|
| 1245 | end
|
---|
| 1246 | num_j1=str2num(str_a);
|
---|
| 1247 | if isempty(num_j1)
|
---|
| 1248 | num_j1=1;
|
---|
| 1249 | end
|
---|
| 1250 | num_j2=str2num(str_b);
|
---|
| 1251 | if isempty(num_j2)
|
---|
| 1252 | num_j2=num_j1;
|
---|
| 1253 | end
|
---|
| 1254 | num_i1=str2num(str1);
|
---|
| 1255 | siz=size(UvData.XmlData_1.Time);
|
---|
| 1256 | if siz(1)>=max(num_i1,num_i2) & siz(2)>=max(num_j1,num_j2)
|
---|
| 1257 | abstime_1=(UvData.XmlData_1.Time(num_i1,num_j1)+UvData.XmlData_1.Time(num_i2,num_j2))/2;%overset the time read from files
|
---|
| 1258 | end
|
---|
| 1259 | end
|
---|
| 1260 | set(handles.abs_time,'String',num2str(abstime,4))
|
---|
| 1261 | set(handles.abs_time_1,'String',num2str(abstime_1,4))
|
---|
| 1262 | if testimedoc && isfield(UvData,'dt')
|
---|
| 1263 | dt=UvData.dt;
|
---|
| 1264 | end
|
---|
| 1265 | if isequal(dt,0)
|
---|
| 1266 | set(handles.Dt_txt,'String','')
|
---|
| 1267 | else
|
---|
| 1268 | if ~(isfield(UvData,'TimeUnit') && ~isempty(UvData.TimeUnit))
|
---|
| 1269 | set(handles.Dt_txt,'String',['Dt=' num2str(1000*dt,3) ' 10^(-3)'] )
|
---|
| 1270 | else
|
---|
| 1271 | set(handles.Dt_txt,'String',['Dt=' num2str(1000*dt,3) ' m' UvData.TimeUnit] )
|
---|
| 1272 | end
|
---|
| 1273 | end
|
---|
| 1274 | set(handles.run0,'BackgroundColor',[1 0 0])
|
---|
| 1275 |
|
---|
| 1276 |
|
---|
| 1277 |
|
---|
| 1278 | %-------------------------------------------------------------------
|
---|
| 1279 | % --- translate coordinate to matrix index
|
---|
| 1280 | %-------------------------------------------------------------------
|
---|
| 1281 | function [indx,indy]=pos2ind(x0,rangx0,nxy)
|
---|
| 1282 | indx=1+round((nxy(2)-1)*(x0-rangx0(1))/(rangx0(2)-rangx0(1)));% index x of pixel
|
---|
| 1283 | indy=1+round((nxy(1)-1)*(y12-rangy0(1))/(rangy0(2)-rangy0(1)));% index y of pixel
|
---|
| 1284 |
|
---|
| 1285 | %-------------------------------------------------------------------
|
---|
| 1286 | % --- Executes on button press in 'FixedLimits'.
|
---|
| 1287 | %-------------------------------------------------------------------
|
---|
| 1288 | function FixedLimits_Callback(hObject, eventdata, handles)
|
---|
| 1289 | test=get(handles.FixedLimits,'Value');
|
---|
| 1290 | if test
|
---|
| 1291 | set(handles.FixedLimits,'BackgroundColor',[1 1 0])
|
---|
| 1292 | else
|
---|
| 1293 | set(handles.FixedLimits,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 1294 | end
|
---|
| 1295 |
|
---|
| 1296 | %-------------------------------------------------------------------
|
---|
| 1297 | % --- Executes on button press in auto_xy.
|
---|
| 1298 | function auto_xy_Callback(hObject, eventdata, handles)
|
---|
| 1299 | test=get(handles.auto_xy,'Value');
|
---|
| 1300 | if test
|
---|
| 1301 | set(handles.auto_xy,'BackgroundColor',[1 1 0])
|
---|
| 1302 | cla(handles.axes3)
|
---|
| 1303 | update_plot(handles)
|
---|
| 1304 | else
|
---|
| 1305 | set(handles.auto_xy,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 1306 | update_plot(handles)
|
---|
| 1307 | % axis(handles.axes3,'image')
|
---|
| 1308 | end
|
---|
| 1309 |
|
---|
| 1310 |
|
---|
| 1311 | %-------------------------------------------------------------------
|
---|
| 1312 |
|
---|
| 1313 | %-------------------------------------------------------------------
|
---|
| 1314 | % --- Executes on button press in 'zoom'.
|
---|
| 1315 | %-------------------------------------------------------------------
|
---|
| 1316 | function zoom_Callback(hObject, eventdata, handles)
|
---|
| 1317 | if (get(handles.zoom,'Value') == 1);
|
---|
| 1318 | set(handles.zoom,'BackgroundColor',[1 1 0])
|
---|
| 1319 | set(handles.FixedLimits,'Value',1)% propose by default fixed limits for the plotting axes
|
---|
| 1320 | set(handles.FixedLimits,'BackgroundColor',[1 1 0])
|
---|
| 1321 | else
|
---|
| 1322 | set(handles.zoom,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 1323 | end
|
---|
| 1324 |
|
---|
| 1325 | %-------------------------------------------------------------------
|
---|
| 1326 | %----Executes on button press in 'record': records the current flags of manual correction.
|
---|
| 1327 | %-------------------------------------------------------------------
|
---|
| 1328 | function record_Callback(hObject, eventdata, handles)
|
---|
| 1329 | % [filebase,num_i1,num_j1,num_i2,num_j2,Ext,NomType,SubDir]=read_input_file(handles);
|
---|
| 1330 | filename=read_file_boxes(handles);
|
---|
| 1331 | AxeData=get(gca,'UserData');
|
---|
| 1332 | [erread,message]=fileattrib(filename);
|
---|
| 1333 | if ~isempty(message) && ~isequal(message.UserWrite,1)
|
---|
| 1334 | msgbox_view_field('ERROR',['no writting access to ' filename])
|
---|
| 1335 | return
|
---|
| 1336 | end
|
---|
| 1337 | test_civ2=isequal(get(handles.civ2,'BackgroundColor'),[1 1 0]);
|
---|
| 1338 | test_civ1=isequal(get(handles.civ1,'BackgroundColor'),[1 1 0]);
|
---|
| 1339 | if ~test_civ2 && ~test_civ1
|
---|
| 1340 | msgbox_view_field('ERROR','manual correction only possible for CIV1 or CIV2 velocity fields')
|
---|
| 1341 | end
|
---|
| 1342 | if test_civ2
|
---|
| 1343 | nbname='nb_vectors2';
|
---|
| 1344 | flagname='vec2_FixFlag';
|
---|
| 1345 | attrname='fix2';
|
---|
| 1346 | end
|
---|
| 1347 | if test_civ1
|
---|
| 1348 | nbname='nb_vectors';
|
---|
| 1349 | flagname='vec_FixFlag';
|
---|
| 1350 | attrname='fix';
|
---|
| 1351 | end
|
---|
| 1352 | %write fix flags in the netcdf file
|
---|
| 1353 | hhh=which('netcdf.open');% look for built-in matlab netcdf library
|
---|
| 1354 | if ~isequal(hhh,'')% case of new builtin Matlab netcdf library
|
---|
| 1355 | nc=netcdf.open(filename,'NC_WRITE');
|
---|
| 1356 | netcdf.reDef(nc)
|
---|
| 1357 | netcdf.putAtt(nc,netcdf.getConstant('NC_GLOBAL'),attrname,1)
|
---|
| 1358 | dimid = netcdf.inqDimID(nc,nbname);
|
---|
| 1359 | try
|
---|
| 1360 | varid = netcdf.inqVarID(nc,flagname);% look for already existing fixflag variable
|
---|
| 1361 | catch
|
---|
| 1362 | varid=netcdf.defVar(nc,flagname,'double',dimid);%create fixflag variable if it does not exist
|
---|
| 1363 | end
|
---|
| 1364 | netcdf.endDef(nc)
|
---|
| 1365 | netcdf.putVar(nc,varid,AxeData.FF);
|
---|
| 1366 | netcdf.close(nc)
|
---|
| 1367 | else %old netcdf library
|
---|
| 1368 | netcdf_toolbox(filename,AxeData,attrname,nbname,flagname)
|
---|
| 1369 | end
|
---|
| 1370 |
|
---|
| 1371 | function netcdf_toolbox(filename,AxeData,attrname,nbname,flagname)
|
---|
| 1372 | nc=netcdf(filename,'write'); %open netcdf file
|
---|
| 1373 | result=redef(nc);
|
---|
| 1374 | eval(['nc.' attrname '=1;']);
|
---|
| 1375 | theDim=nc(nbname) ;% get the number of velocity vectors
|
---|
| 1376 | nb_vectors=size(theDim);
|
---|
| 1377 | var_FixFlag=ncvar(flagname,nc);% var_FixFlag will be written as the netcdf variable vec_FixFlag
|
---|
| 1378 | var_FixFlag(1:nb_vectors)=AxeData.FF;%
|
---|
| 1379 | fin=close(nc);
|
---|
| 1380 |
|
---|
| 1381 |
|
---|
| 1382 | %-------------------------------------------------------------------
|
---|
| 1383 | %determines the fields to read from the interface
|
---|
| 1384 | %------------------------------------------------------------------
|
---|
| 1385 | function [VelType,civ]=setfield(handles)
|
---|
| 1386 |
|
---|
| 1387 | VelType=[]; %default
|
---|
| 1388 | if (get(handles.civ1,'Value') == 1);
|
---|
| 1389 | VelType='civ1';
|
---|
| 1390 | % interp1
|
---|
| 1391 | elseif (get(handles.interp1,'Value') == 1);
|
---|
| 1392 | VelType='interp1';
|
---|
| 1393 | % filter1
|
---|
| 1394 | elseif (get(handles.filter1,'Value') == 1);
|
---|
| 1395 | VelType='filter1';
|
---|
| 1396 | % CIV2
|
---|
| 1397 | elseif (get(handles.civ2,'Value') == 1);
|
---|
| 1398 | VelType='civ2';
|
---|
| 1399 | % interp2
|
---|
| 1400 | elseif (get(handles.interp2,'Value') == 1);
|
---|
| 1401 | VelType='interp2';
|
---|
| 1402 | % filter2
|
---|
| 1403 | elseif (get(handles.filter2,'Value') == 1);
|
---|
| 1404 | VelType='filter2';
|
---|
| 1405 | end
|
---|
| 1406 |
|
---|
| 1407 | if isequal(get(handles.filter2,'Visible'),'on');
|
---|
| 1408 | civ=6;
|
---|
| 1409 | % interp1
|
---|
| 1410 | elseif isequal(get(handles.interp2,'Visible'),'on');
|
---|
| 1411 | civ=5;
|
---|
| 1412 | % filter1
|
---|
| 1413 | elseif isequal(get(handles.civ2,'Visible'),'on');
|
---|
| 1414 | civ=4;
|
---|
| 1415 | % CIV2
|
---|
| 1416 | elseif isequal(get(handles.filter1,'Visible'),'on');
|
---|
| 1417 | civ=3;
|
---|
| 1418 | % interp2
|
---|
| 1419 | elseif isequal(get(handles.interp1,'Visible'),'on');
|
---|
| 1420 | civ=2;
|
---|
| 1421 | % filter2
|
---|
| 1422 | elseif isequal(get(handles.civ1,'Visible'),'on');
|
---|
| 1423 | civ=1;
|
---|
| 1424 | else
|
---|
| 1425 | civ=0;
|
---|
| 1426 | end
|
---|
| 1427 |
|
---|
| 1428 | %-------------------------------------------------------------------
|
---|
| 1429 | %determines the veltype of the second field to read from the iinterface
|
---|
| 1430 | %------------------------------------------------------------------
|
---|
| 1431 | function VelType=setfield_1(handles)
|
---|
| 1432 |
|
---|
| 1433 | VelType=[]; %default
|
---|
| 1434 | if (get(handles.civ1_1,'Value') == 1);
|
---|
| 1435 | VelType='civ1';
|
---|
| 1436 | % interp1
|
---|
| 1437 | elseif (get(handles.interp1_1,'Value') == 1);
|
---|
| 1438 | VelType='interp1';
|
---|
| 1439 | % filter1
|
---|
| 1440 | elseif (get(handles.filter1_1,'Value') == 1);
|
---|
| 1441 | VelType='filter1';
|
---|
| 1442 | % CIV2
|
---|
| 1443 | elseif (get(handles.civ2_1,'Value') == 1);
|
---|
| 1444 | VelType='civ2';
|
---|
| 1445 | % interp2
|
---|
| 1446 | elseif (get(handles.interp2_1,'Value') == 1);
|
---|
| 1447 | VelType='interp2';
|
---|
| 1448 | % filter2
|
---|
| 1449 | elseif (get(handles.filter2_1,'Value') == 1);
|
---|
| 1450 | VelType='filter2';
|
---|
| 1451 | end
|
---|
| 1452 |
|
---|
| 1453 |
|
---|
| 1454 | %---------------------------------------------------
|
---|
| 1455 | % --- Executes on button press in SubField
|
---|
| 1456 | function SubField_Callback(hObject, eventdata, handles)
|
---|
| 1457 | huvmat=get(handles.run0,'parent');
|
---|
| 1458 | UvData=get(huvmat,'UserData');
|
---|
| 1459 | if get(handles.SubField,'Value')==0% if the subfield button is desactivated
|
---|
| 1460 | set(handles.RootPath_1,'String','')
|
---|
| 1461 | set(handles.RootFile_1,'String','')
|
---|
| 1462 | set(handles.SubDir_1,'String','');
|
---|
| 1463 | set(handles.FileIndex_1,'String','');
|
---|
| 1464 | set(handles.FileExt_1,'String','');
|
---|
| 1465 | set(handles.RootPath_1,'Visible','off')
|
---|
| 1466 | set(handles.RootFile_1,'Visible','off')
|
---|
| 1467 | set(handles.SubDir_1,'Visible','off');
|
---|
| 1468 | set(handles.FileIndex_1,'Visible','off');
|
---|
| 1469 | set(handles.FileExt_1,'Visible','off');
|
---|
| 1470 | set(handles.Fields_1,'Value',1);%set to blank state
|
---|
| 1471 | set_veltype_display([handles.civ1_1 handles.interp1_1 handles.filter1_1 ...
|
---|
| 1472 | handles.civ2_1 handles.interp2_1 handles.filter2_1],0)
|
---|
| 1473 | if isfield(UvData,'XmlData_1')
|
---|
| 1474 | UvData=rmfield(UvData,'XmlData_1');
|
---|
| 1475 | end
|
---|
| 1476 | set(huvmat,'UserData',UvData);
|
---|
| 1477 | run0_Callback(hObject, eventdata, handles); %run
|
---|
| 1478 | else
|
---|
| 1479 | MenuBrowse_1_Callback(hObject, eventdata, handles)
|
---|
| 1480 | end
|
---|
| 1481 |
|
---|
| 1482 | % %----------------------------------------------
|
---|
| 1483 | % %read the data displayed for the input rootfile windows (new)
|
---|
| 1484 | % %-------------------------------------------------
|
---|
| 1485 | function [FileName,RootPath,FileBase,FileIndices,FileExt,SubDir]=read_file_boxes(handles)
|
---|
| 1486 | RootPath=get(handles.RootPath,'String');
|
---|
| 1487 | FileName=RootPath; %default
|
---|
| 1488 | SubDir=get(handles.SubDir,'String');
|
---|
| 1489 | if ~isempty(SubDir) && ~isequal(SubDir,'')
|
---|
| 1490 | if (isequal(SubDir(1),'/')|| isequal(SubDir(1),'\'))
|
---|
| 1491 | SubDir(1)=[]; %suppress possible / or \ separator
|
---|
| 1492 | end
|
---|
| 1493 | FileName=fullfile(RootPath,SubDir);
|
---|
| 1494 | end
|
---|
| 1495 | RootFile=get(handles.RootFile,'String');
|
---|
| 1496 | if ~isempty(RootFile) && ~isequal(RootFile,'')
|
---|
| 1497 | if (isequal(RootFile(1),'/')|| isequal(RootFile(1),'\'))
|
---|
| 1498 | RootFile(1)=[]; %suppress possible / or \ separator
|
---|
| 1499 | end
|
---|
| 1500 | FileName=fullfile(FileName,RootFile);
|
---|
| 1501 | end
|
---|
| 1502 | FileBase=fullfile(RootPath,RootFile);
|
---|
| 1503 | FileIndices=get(handles.FileIndex,'String');
|
---|
| 1504 | FileExt=get(handles.FileExt,'String');
|
---|
| 1505 | FileName=[FileName FileIndices FileExt];
|
---|
| 1506 |
|
---|
| 1507 | %----------------------------------------------
|
---|
| 1508 | %read the data displayed for the second input rootfile windows
|
---|
| 1509 | %-------------------------------------------------
|
---|
| 1510 | function [FileName_1,RootPath_1,FileBase_1,FileIndices_1,FileExt_1,SubDir_1]=read_file_boxes_1(handles)
|
---|
| 1511 | RootPath_1=get(handles.RootPath_1,'String'); % read the data from the file1_input window
|
---|
| 1512 | if isequal(RootPath_1,'"'),RootPath_1=get(handles.RootPath,'String'); end;
|
---|
| 1513 | FileName_1=RootPath_1; %default
|
---|
| 1514 | SubDir_1=get(handles.SubDir_1,'String');
|
---|
| 1515 | if isequal(SubDir_1,'"')
|
---|
| 1516 | SubDir_1=get(handles.SubDir,'String');
|
---|
| 1517 | end
|
---|
| 1518 | if ~isempty(SubDir_1) && ~isequal(SubDir_1,'')
|
---|
| 1519 | if (isequal(SubDir_1(1),'/')|| isequal(SubDir_1(1),'\'))
|
---|
| 1520 | SubDir_1(1)=[]; %suppress possible / or \ separator
|
---|
| 1521 | end
|
---|
| 1522 | FileName_1=fullfile(RootPath_1,SubDir_1);
|
---|
| 1523 | end
|
---|
| 1524 | RootFile_1=get(handles.RootFile_1,'String');
|
---|
| 1525 | if isequal(RootFile_1,'"'),RootFile_1=get(handles.RootFile,'String'); end;
|
---|
| 1526 | if ~isempty(RootFile_1) && ~isequal(RootFile_1,'')
|
---|
| 1527 | if ~(isequal(RootFile_1(1),'/')|isequal(RootFile_1(1),'\'))
|
---|
| 1528 | RootFile_1(1)=[];%suppress possible / or \ separator
|
---|
| 1529 | end
|
---|
| 1530 | FileName_1=fullfile(FileName_1,RootFile_1);
|
---|
| 1531 | end
|
---|
| 1532 | FileBase_1=fullfile(RootPath_1,RootFile_1);
|
---|
| 1533 | FileIndices_1=get(handles.FileIndex_1,'String');
|
---|
| 1534 | FileExt_1=get(handles.FileExt_1,'String');
|
---|
| 1535 | if isequal(FileExt_1,'"'),FileExt_1=get(handles.FileExt,'String'); end;
|
---|
| 1536 | FileName_1=[FileName_1 FileIndices_1 FileExt_1];
|
---|
| 1537 |
|
---|
| 1538 | %---------------------------------------------------
|
---|
| 1539 | % --- Executes on menu selection Fields
|
---|
| 1540 | function Fields_Callback(hObject, eventdata, handles)
|
---|
| 1541 | %-------------------------------------------------
|
---|
| 1542 | huvmat=get(handles.Fields,'parent');
|
---|
| 1543 | list_fields=get(handles.Fields,'String');% list menu fields
|
---|
| 1544 | index_fields=get(handles.Fields,'Value');% selected string index
|
---|
| 1545 | field= list_fields{index_fields(1)}; % selected string
|
---|
| 1546 | if isequal(field,'get_field...')
|
---|
| 1547 | veltype_handles=[handles.civ1 handles.interp1 handles.filter1 handles.civ2 handles.interp2 handles.filter2];
|
---|
| 1548 | set_veltype_display(veltype_handles,0) % unvisible civ buttons
|
---|
| 1549 | filename=read_file_boxes(handles);
|
---|
| 1550 | hget_field=findobj(allchild(0),'name','get_field');
|
---|
| 1551 | if ~isempty(hget_field)
|
---|
| 1552 | delete(hget_field)
|
---|
| 1553 | end
|
---|
| 1554 | get_field(filename)
|
---|
| 1555 | return %no action
|
---|
| 1556 | end
|
---|
| 1557 | list_fields=get(handles.Fields_1,'String');% list menu fields
|
---|
| 1558 | index_fields=get(handles.Fields_1,'Value');% selected string index
|
---|
| 1559 | field_1= list_fields{index_fields(1)}; % selected string
|
---|
| 1560 | UvData=get(huvmat,'UserData');
|
---|
| 1561 |
|
---|
| 1562 | %read the rootfile input display
|
---|
| 1563 | FileExt=get(handles.FileExt,'String');
|
---|
| 1564 | [P,F,str1,str2,str_a,str_b,E,NomType]=name2display(['xxx' get(handles.FileIndex,'String') FileExt]);
|
---|
| 1565 | NomTypeNew=NomType;%default
|
---|
| 1566 | if isequal(field,'image')
|
---|
| 1567 | % transform netc type to the corresponding image type
|
---|
| 1568 | if isequal(NomType,'_i1-i2_j')||isequal(NomType,'_i_j1-j2')|| isequal(NomType,'#_ab')|| isequal(NomType,'_i1-i2')
|
---|
| 1569 | UvData.SubDir=get(handles.SubDir,'String'); %preserve the subdir in memory
|
---|
| 1570 | if ~isempty(UvData.SubDir) && (isequal(UvData.SubDir(1),'/')||isequal(UvData.SubDir(1),'/'))
|
---|
| 1571 | UvData.SubDir(1)=[];
|
---|
| 1572 | end
|
---|
| 1573 | set(handles.SubDir,'String','')
|
---|
| 1574 | set(handles.FileExt,'String','.png');
|
---|
| 1575 | if isequal(NomType,'_i1-i2_j')||isequal(NomType,'_i_j1-j2')
|
---|
| 1576 | NomTypeNew='_i_j';
|
---|
| 1577 | elseif isequal(NomType,'#_ab')
|
---|
| 1578 | NomTypeNew='#a';
|
---|
| 1579 | elseif isequal(NomType,'_i1-i2')
|
---|
| 1580 | NomTypeNew='_i';
|
---|
| 1581 | end
|
---|
| 1582 | end
|
---|
| 1583 | veltype_handles=[handles.civ1 handles.interp1 handles.filter1 handles.civ2 handles.interp2 handles.filter2];
|
---|
| 1584 | set_veltype_display(veltype_handles,0) % unvisible civ buttons
|
---|
| 1585 | else
|
---|
| 1586 | ext=get(handles.FileExt,'String');
|
---|
| 1587 | if ~isequal(ext,'.nc') %find the new NomType if the previous display was not already a netcdf file
|
---|
| 1588 | MenuBrowse_Callback(hObject, eventdata, handles)
|
---|
| 1589 | end
|
---|
| 1590 | if isequal(field,'vort') || isequal(field,'div') || isequal(field,'strain')
|
---|
| 1591 | set(handles.civ1,'BackgroundColor',[0.702 0.702 0.702]) % put their color to grey
|
---|
| 1592 | set(handles.civ2,'BackgroundColor',[0.702 0.702 0.702])
|
---|
| 1593 | set(handles.interp1,'BackgroundColor',[0.702 0.702 0.702])
|
---|
| 1594 | set(handles.interp2,'BackgroundColor',[0.702 0.702 0.702])
|
---|
| 1595 | elseif isequal(field,'more...');
|
---|
| 1596 | set(handles.civ1,'BackgroundColor',[0.702 0.702 0.702]) % put their color to grey
|
---|
| 1597 | set(handles.civ2,'BackgroundColor',[0.702 0.702 0.702])
|
---|
| 1598 | str=calc_field;%get the list of available scalars by the function calc_scal
|
---|
| 1599 | [ind_answer] = listdlg('PromptString','Select a file:',...
|
---|
| 1600 | 'SelectionMode','single',...
|
---|
| 1601 | 'ListString',str);
|
---|
| 1602 | % edit the choice in the field and action menu
|
---|
| 1603 | scalar=cell2mat(str(ind_answer));
|
---|
| 1604 | menu=update_menu(handles.Fields,scalar);
|
---|
| 1605 | menu=[{''};menu];
|
---|
| 1606 | set(handles.Fields_1,'String',menu);% store the selected scalar type
|
---|
| 1607 | end
|
---|
| 1608 | end
|
---|
| 1609 | indices=name_generator('',str2double(str1),str2double(str_a),'',NomTypeNew,1,str2double(str2),str2double(str_b),'');
|
---|
| 1610 | set(handles.FileIndex,'String',indices)
|
---|
| 1611 | set(handles.FileIndex,'UserData',NomTypeNew)
|
---|
| 1612 | %common to Fields_1_Callback
|
---|
| 1613 | if isequal(field,'image')||isequal(field_1,'image')
|
---|
| 1614 | set(handles.npx_title,'Visible','on')% visible npx,pxcm... buttons
|
---|
| 1615 | set(handles.npy_title,'Visible','on')
|
---|
| 1616 | set(handles.npx,'Visible','on')
|
---|
| 1617 | set(handles.npy,'Visible','on')
|
---|
| 1618 | set(handles.fix_pair,'Value',0)
|
---|
| 1619 | else
|
---|
| 1620 | set(handles.npx_title,'Visible','off')% visible npx,pxcm... buttons
|
---|
| 1621 | set(handles.npy_title,'Visible','off')
|
---|
| 1622 | set(handles.npx,'Visible','off')
|
---|
| 1623 | set(handles.npy,'Visible','off')
|
---|
| 1624 | set(handles.fix_pair,'Value',1)
|
---|
| 1625 | end
|
---|
| 1626 | % if isequal(field,'velocity')|isequal(field_1,'velocity');
|
---|
| 1627 | % state_vect='on';
|
---|
| 1628 | % else
|
---|
| 1629 | % state_vect='off';
|
---|
| 1630 | % end
|
---|
| 1631 | % if ~isequal(field,'velocity')|(~isequal(field_1,'velocity'));
|
---|
| 1632 | % state_scal='on';
|
---|
| 1633 | % else
|
---|
| 1634 | % state_scal='off';
|
---|
| 1635 | % end
|
---|
| 1636 | setfield(handles);% update the field structure ('civ1'....)
|
---|
| 1637 |
|
---|
| 1638 | if ~isfield(UvData,'NewSeries')||isequal(UvData.NewSeries,0)
|
---|
| 1639 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1640 | end
|
---|
| 1641 |
|
---|
| 1642 | %---------------------------------------------------
|
---|
| 1643 | % --- Executes on menu selection Fields
|
---|
| 1644 | function Fields_1_Callback(hObject, eventdata, handles)
|
---|
| 1645 | %-------------------------------------------------
|
---|
| 1646 | huvmat=get(handles.Fields_1,'parent');
|
---|
| 1647 | list_fields=get(handles.Fields,'String');% list menu fields
|
---|
| 1648 | index_fields=get(handles.Fields,'Value');% selected string index
|
---|
| 1649 | field= list_fields{index_fields(1)}; % selected string
|
---|
| 1650 | list_fields=get(handles.Fields_1,'String');% list menu fields
|
---|
| 1651 | index_fields=get(handles.Fields_1,'Value');% selected string index
|
---|
| 1652 | field_1= list_fields{index_fields(1)}; % selected string for the second field
|
---|
| 1653 | if isequal(field_1,'') %remove second field if 'blank' field is selected
|
---|
| 1654 | set(handles.SubField,'Value',0)
|
---|
| 1655 | SubField_Callback(hObject, eventdata, handles)
|
---|
| 1656 | return
|
---|
| 1657 | end
|
---|
| 1658 | UvData=get(huvmat,'UserData');
|
---|
| 1659 |
|
---|
| 1660 | %read the rootfile input display
|
---|
| 1661 | FileExt_prev=get(handles.FileExt_1,'String');
|
---|
| 1662 | if isempty(FileExt_prev)|isequal(FileExt_prev,'')
|
---|
| 1663 | FileExt_1=get(handles.FileExt,'String');
|
---|
| 1664 | else
|
---|
| 1665 | FileExt_1=FileExt_prev;
|
---|
| 1666 | end
|
---|
| 1667 | NomType_1=get(handles.FileIndex_1,'UserData');
|
---|
| 1668 | if isempty(NomType_1)|isequal(NomType_1,'')
|
---|
| 1669 | NomType_1=get(handles.FileIndex,'UserData');
|
---|
| 1670 | end
|
---|
| 1671 | NomTypeNew=NomType_1;%default
|
---|
| 1672 |
|
---|
| 1673 | set(handles.SubField,'Value',1)%introduce second field
|
---|
| 1674 | if isfield(UvData,'XmlData')
|
---|
| 1675 | UvData.XmlData_1=UvData.XmlData;
|
---|
| 1676 | end
|
---|
| 1677 | set(handles.FileIndex_1,'Visible','on')
|
---|
| 1678 | set(handles.FileExt_1,'Visible','on')
|
---|
| 1679 | RootPath_1=get(handles.RootPath_1,'String');
|
---|
| 1680 | RootFile_1=get(handles.RootFile_1,'String');
|
---|
| 1681 | if isempty(RootPath_1)|isequal(RootPath_1,'')
|
---|
| 1682 | set(handles.RootPath_1,'String','"')
|
---|
| 1683 | end
|
---|
| 1684 | if isempty(RootFile_1) | isequal(RootFile_1,'')
|
---|
| 1685 | set(handles.RootFile_1,'String','"')
|
---|
| 1686 | end
|
---|
| 1687 | if ~isempty(RootFile_1)&(isequal(RootFile_1(1),'/')|isequal(RootFile_1(1),'\'))
|
---|
| 1688 | RootFile_1(1)=[];
|
---|
| 1689 | end
|
---|
| 1690 |
|
---|
| 1691 | if isequal(field_1,'get_field...')
|
---|
| 1692 | veltype_handles=[handles.civ1 handles.interp1 handles.filter1 handles.civ2 handles.interp2 handles.filter2];
|
---|
| 1693 | set_veltype_display(veltype_handles,0) % unvisible civ buttons
|
---|
| 1694 | filename=read_file_boxes_1(handles);
|
---|
| 1695 | hget_field=findobj(allchild(0),'name','get_field_1');
|
---|
| 1696 | if ~isempty(hget_field)
|
---|
| 1697 | delete(hget_field)
|
---|
| 1698 | end
|
---|
| 1699 | hget_field=get_field(filename);
|
---|
| 1700 | set(hget_field,'name','get_field_1')
|
---|
| 1701 | return %no action
|
---|
| 1702 | end
|
---|
| 1703 | if isequal(field_1,'image')
|
---|
| 1704 | % transform netc type to the corresponding image type
|
---|
| 1705 | set(handles.FileExt_1,'String','.png');
|
---|
| 1706 | if isequal(NomType_1,'_i1-i2_j')|isequal(NomType_1,'_i_j1-j2')| isequal(NomType_1,'#_ab')| isequal(NomType_1,'_i1-i2')
|
---|
| 1707 | UvData.SubDir_1=get(handles.SubDir_1,'String'); %preserve the subdir in memory
|
---|
| 1708 | set(handles.SubDir_1,'String','')
|
---|
| 1709 | % set(handles.FileExt_1,'String','.png');
|
---|
| 1710 | if isequal(NomType_1,'_i1-i2_j')|isequal(NomType_1,'_i_j1-j2')
|
---|
| 1711 | NomTypeNew='_i_j';
|
---|
| 1712 | elseif isequal(NomType_1,'#_ab')
|
---|
| 1713 | NomTypeNew='#a';
|
---|
| 1714 | elseif isequal(NomType_1,'_i1-i2')
|
---|
| 1715 | NomTypeNew='_i';
|
---|
| 1716 | end
|
---|
| 1717 | end
|
---|
| 1718 | veltype_handles=[handles.civ1_1 handles.interp1_1 handles.filter1_1 handles.civ2_1 handles.interp2_1 handles.filter2_1];
|
---|
| 1719 | set_veltype_display(veltype_handles,0) % unvisible civ buttons
|
---|
| 1720 | else
|
---|
| 1721 | set(handles.SubDir_1,'Visible','on')
|
---|
| 1722 | if ~isequal(FileExt_prev,'.nc') %find the new NomType if the previous display was not already a netcdf file
|
---|
| 1723 | veltype_handles=[handles.civ1_1 handles.interp1_1 handles.filter1_1 handles.civ2_1 handles.interp2_1 handles.filter2_1];
|
---|
| 1724 | set_veltype_display(veltype_handles,6); % make all civ buttons visible
|
---|
| 1725 | RootPath_1=get(handles.RootPath_1,'String');
|
---|
| 1726 | RootFile_1=get(handles.RootFile_1,'String');
|
---|
| 1727 | if isempty(RootPath_1)|isequal(RootPath_1,'')
|
---|
| 1728 | set(handles.RootPath_1,'String','"')
|
---|
| 1729 | end
|
---|
| 1730 | if isempty(RootFile_1) | isequal(RootFile_1,'')
|
---|
| 1731 | set(handles.RootFile_1,'String','"')
|
---|
| 1732 | end
|
---|
| 1733 | if ~isempty(RootFile_1)&(isequal(RootFile_1(1),'/')|isequal(RootFile_1(1),'\'))
|
---|
| 1734 | RootFile_1(1)=[];
|
---|
| 1735 | end
|
---|
| 1736 | filebase_1=fullfile(RootPath_1,RootFile_1);
|
---|
| 1737 | SubDir_1=get(handles.SubDir,'String');
|
---|
| 1738 | if isempty(SubDir_1)|isequal(SubDir_1,'')
|
---|
| 1739 | if isfield(UvData,'SubDir_1')
|
---|
| 1740 | SubDir_1=UvData.SubDir_1;%retrieve previous subdir
|
---|
| 1741 | else
|
---|
| 1742 | SubDir_1='?';
|
---|
| 1743 | end
|
---|
| 1744 | end
|
---|
| 1745 | if isequal(NomType_1,'#_ab')|isequal(NomType_1,'_i1-i2_j')|isequal(NomType_1,'_i_j1-j2')|isequal(NomType_1,'_i1-i2')
|
---|
| 1746 | NomTypeNew=NomType_1;
|
---|
| 1747 | elseif isequal(NomType_1,'#a')
|
---|
| 1748 | [filename,idetect,n1,na,n2,nb,SubDir_1]=name_generator(filebase_1, str2num(str1),str2num(str_a),'.nc','#_ab',0,[],[],SubDir_1);
|
---|
| 1749 | NomTypeNew='#_ab';
|
---|
| 1750 | elseif isequal(NomType_1,'_i_j')
|
---|
| 1751 | [filename,idetect,n1,na,n2,nb,SubDir_1]=name_generator(filebase_1,str2num(str1),str2num(str_a),'.nc','_i1-i2_j',0,str2num(str1),[],SubDir_1);
|
---|
| 1752 | if idetect==1
|
---|
| 1753 | NomTypeNew='_i1-i2_j';
|
---|
| 1754 | else
|
---|
| 1755 | NomTypeNew='_i_j1-j2';
|
---|
| 1756 | end
|
---|
| 1757 | else %for instance avi files or any ima_num series
|
---|
| 1758 | [filename,idetect,n1,na,n2,nb,SubDir_1]=name_generator(filebase_1,str2num(str1),str2num(str_a),'.nc','_i1-i2',0,str2num(str1),[],SubDir_1);
|
---|
| 1759 | NomTypeNew='_i1-i2';
|
---|
| 1760 | end
|
---|
| 1761 | [Path,Name]=fileparts(filebase_1);
|
---|
| 1762 | set(handles.FileExt_1,'String','.nc');
|
---|
| 1763 | if ~isempty(SubDir_1) & ~isequal(SubDir_1,'''')& ~isequal(SubDir_1,'"')
|
---|
| 1764 | SubDir_1=['/' SubDir_1];
|
---|
| 1765 | end
|
---|
| 1766 | set(handles.SubDir_1,'String',SubDir_1);
|
---|
| 1767 | end
|
---|
| 1768 | if isequal(field,'vort') | isequal(field,'div') | isequal(field,'strain')
|
---|
| 1769 | set(handles.civ1_1,'BackgroundColor',[0.702 0.702 0.702]) % put their color to grey
|
---|
| 1770 | set(handles.civ2_1,'BackgroundColor',[0.702 0.702 0.702])
|
---|
| 1771 | set(handles.interp1_1,'BackgroundColor',[0.702 0.702 0.702])
|
---|
| 1772 | set(handles.interp2_1,'BackgroundColor',[0.702 0.702 0.702])
|
---|
| 1773 | elseif isequal(field_1,'more...'); %add new item to the menu
|
---|
| 1774 | set(handles.civ1_1,'BackgroundColor',[0.702 0.702 0.702]) % put their color to grey
|
---|
| 1775 | set(handles.civ2_1,'BackgroundColor',[0.702 0.702 0.702])
|
---|
| 1776 | str=calc_field;%get the list of available scalars by the function calc_scal
|
---|
| 1777 | [ind_answer,v] = listdlg('PromptString','Select a file:',...
|
---|
| 1778 | 'SelectionMode','single',...
|
---|
| 1779 | 'ListString',str);
|
---|
| 1780 | % edit the choice in the field and action menu
|
---|
| 1781 | scalar=cell2mat(str(ind_answer));
|
---|
| 1782 | menu=update_menu(handles.Fields_1,scalar);
|
---|
| 1783 | set(handles.Fields_1,'String',menu);% store the selected scalar type
|
---|
| 1784 | end
|
---|
| 1785 | end
|
---|
| 1786 | str1=get(handles.i1,'String');
|
---|
| 1787 | str2=get(handles.i2,'String');
|
---|
| 1788 | str_a=get(handles.j1,'String');
|
---|
| 1789 | str_b=get(handles.j2,'String');
|
---|
| 1790 | indices=name_generator('',str2num(str1),stra2num(str_a),'',NomTypeNew,1,str2num(str2),stra2num(str_b),'');
|
---|
| 1791 | set(handles.FileIndex_1,'String',indices)
|
---|
| 1792 | set(handles.FileIndex_1,'UserData',NomTypeNew)
|
---|
| 1793 |
|
---|
| 1794 | %common to Fields_Callback
|
---|
| 1795 | if isequal(field,'image')|isequal(field_1,'image')
|
---|
| 1796 | set(handles.npx_title,'Visible','on')% visible npx,pxcm... buttons
|
---|
| 1797 | set(handles.npy_title,'Visible','on')
|
---|
| 1798 | set(handles.npx,'Visible','on')
|
---|
| 1799 | set(handles.npy,'Visible','on')
|
---|
| 1800 | set(handles.fix_pair,'Value',0)
|
---|
| 1801 | else
|
---|
| 1802 | set(handles.npx_title,'Visible','off')% visible npx,pxcm... buttons
|
---|
| 1803 | set(handles.npy_title,'Visible','off')
|
---|
| 1804 | set(handles.npx,'Visible','off')
|
---|
| 1805 | set(handles.npy,'Visible','off')
|
---|
| 1806 | set(handles.fix_pair,'Value',1)
|
---|
| 1807 | end
|
---|
| 1808 | if isequal(field,'velocity')|isequal(field_1,'velocity');
|
---|
| 1809 | state_vect='on';
|
---|
| 1810 | else
|
---|
| 1811 | state_vect='off';
|
---|
| 1812 | end
|
---|
| 1813 | if ~isequal(field,'velocity')|(~isequal(field_1,'velocity')&~isequal(field_1,''));
|
---|
| 1814 | state_scal='on';
|
---|
| 1815 | else
|
---|
| 1816 | state_scal='off';
|
---|
| 1817 | end
|
---|
| 1818 | set(huvmat,'UserData',UvData)
|
---|
| 1819 | setfield(handles);% update the field structure ('civ1'....)
|
---|
| 1820 | if ~isfield(UvData,'NewSeries')|isequal(UvData.NewSeries,0)
|
---|
| 1821 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1822 | end
|
---|
| 1823 |
|
---|
| 1824 | %------------------------------------------------------------------------
|
---|
| 1825 | % --- set the visibility of relevant velocity type menus:
|
---|
| 1826 | function set_veltype_display(handles,Civ)
|
---|
| 1827 | %------------------------------------------------------------------------
|
---|
| 1828 | %Civ=0; all states 'off'
|
---|
| 1829 | %Civ=6; all states 'on'
|
---|
| 1830 | if isequal(Civ,0)
|
---|
| 1831 | imax=0;
|
---|
| 1832 | % set(handles(1),'Visible','on') % unvisible civ buttons
|
---|
| 1833 | % else
|
---|
| 1834 | % set(handles(1),'String','civ1')
|
---|
| 1835 | % end
|
---|
| 1836 | elseif isequal(Civ,1) || isequal(Civ,2)
|
---|
| 1837 | imax=1;
|
---|
| 1838 | elseif isequal(Civ,3)
|
---|
| 1839 | imax=3;
|
---|
| 1840 | elseif isequal(Civ,4) || isequal(Civ,5)
|
---|
| 1841 | imax=4;
|
---|
| 1842 | elseif isequal(Civ,6) %patch2
|
---|
| 1843 | imax=6;
|
---|
| 1844 | end
|
---|
| 1845 | for ibutton=1:imax;
|
---|
| 1846 | set(handles(ibutton),'Visible','on') % unvisible civ buttons
|
---|
| 1847 | end
|
---|
| 1848 | % for ibutton=max(imax+1,2):6;
|
---|
| 1849 | for ibutton=imax+1:6;
|
---|
| 1850 | set(handles(ibutton),'Visible','off') % unvisible civ buttons
|
---|
| 1851 | set(handles(ibutton),'Value',0)%unactivate unvisible buttons
|
---|
| 1852 | end
|
---|
| 1853 |
|
---|
| 1854 | %-------------------------------------------------------------------
|
---|
| 1855 | % --- Executes on button press in civ1.
|
---|
| 1856 | function civ1_Callback(hObject, eventdata, handles)
|
---|
| 1857 | %-------------------------------------------------------------------
|
---|
| 1858 | if get(handles.civ1,'Value')==1
|
---|
| 1859 | reset_vel_type([handles.interp1 handles.civ2 handles.filter1 handles.interp1 handles.interp2 handles.filter2],handles.civ1)
|
---|
| 1860 | else
|
---|
| 1861 | reset_vel_type([handles.civ1 handles.filter1 handles.interp1 handles.civ2 handles.interp2 handles.filter2])
|
---|
| 1862 | end
|
---|
| 1863 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1864 |
|
---|
| 1865 | %-------------------------------------------------------------------
|
---|
| 1866 | % --- Executes on button press in interp1.
|
---|
| 1867 | function interp1_Callback(hObject, eventdata, handles)
|
---|
| 1868 | %-------------------------------------------------------------------
|
---|
| 1869 | if get(handles.interp1,'Value')==1
|
---|
| 1870 | reset_vel_type([handles.civ1 handles.civ2 handles.filter1 handles.interp2 handles.filter2],handles.interp1)
|
---|
| 1871 | else
|
---|
| 1872 | reset_vel_type([handles.civ1 handles.filter1 handles.interp1 handles.civ2 handles.interp2 handles.filter2])
|
---|
| 1873 | end
|
---|
| 1874 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1875 |
|
---|
| 1876 | %-------------------------------------------------------------------
|
---|
| 1877 | % --- Executes on button press in filter1.
|
---|
| 1878 | function filter1_Callback(hObject, eventdata, handles)
|
---|
| 1879 | %-------------------------------------------------------------------
|
---|
| 1880 | if get(handles.filter1,'Value')==1
|
---|
| 1881 | reset_vel_type([handles.civ1 handles.civ2 handles.interp1 handles.interp2 handles.filter2],handles.filter1)
|
---|
| 1882 | else
|
---|
| 1883 | reset_vel_type([handles.civ1 handles.filter1 handles.interp1 handles.civ2 handles.interp2 handles.filter2])
|
---|
| 1884 | end
|
---|
| 1885 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1886 |
|
---|
| 1887 | %-------------------------------------------------------------------
|
---|
| 1888 | % --- Executes on button press in civ2.
|
---|
| 1889 | function civ2_Callback(hObject, eventdata, handles)
|
---|
| 1890 | %-------------------------------------------------------------------
|
---|
| 1891 | if get(handles.civ2,'Value')==1
|
---|
| 1892 | reset_vel_type([handles.civ1 handles.filter1 handles.interp1 handles.interp2 handles.filter2],handles.civ2)
|
---|
| 1893 | else
|
---|
| 1894 | reset_vel_type([handles.civ1 handles.filter1 handles.interp1 handles.civ2 handles.interp2 handles.filter2])
|
---|
| 1895 | end
|
---|
| 1896 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1897 |
|
---|
| 1898 | %-----------------------------------------
|
---|
| 1899 | % --- Executes on button press in interp2.
|
---|
| 1900 | %-------------------------------------------
|
---|
| 1901 | function interp2_Callback(hObject, eventdata, handles)
|
---|
| 1902 | if get(handles.interp2,'Value')==1
|
---|
| 1903 | reset_vel_type([handles.civ1 handles.filter1 handles.interp1 handles.civ2 handles.filter2],handles.interp2)
|
---|
| 1904 | else
|
---|
| 1905 | reset_vel_type([handles.civ1 handles.filter1 handles.interp1 handles.civ2 handles.interp2 handles.filter2])
|
---|
| 1906 | end
|
---|
| 1907 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1908 | %---------------------------------------------
|
---|
| 1909 | % --- Executes on button press in filter2.
|
---|
| 1910 | %-------------------------------------------
|
---|
| 1911 | function filter2_Callback(hObject, eventdata, handles)
|
---|
| 1912 | if get(handles.filter2,'Value')==1
|
---|
| 1913 | reset_vel_type([handles.civ1 handles.filter1 handles.interp1 handles.civ2 handles.interp2],handles.filter2)
|
---|
| 1914 | else
|
---|
| 1915 | reset_vel_type([handles.civ1 handles.filter1 handles.interp1 handles.civ2 handles.interp2 handles.filter2])
|
---|
| 1916 | end
|
---|
| 1917 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1918 |
|
---|
| 1919 | %---------------------------------------------
|
---|
| 1920 | function civ1_1_Callback(hObject, eventdata, handles)
|
---|
| 1921 | %---------------------------------------------
|
---|
| 1922 | if get(handles.civ1_1,'Value')==1
|
---|
| 1923 | reset_vel_type([handles.interp1_1 handles.civ2_1 handles.filter1_1 handles.interp1_1 handles.interp2_1 handles.filter2_1],handles.civ1_1)
|
---|
| 1924 | else
|
---|
| 1925 | reset_vel_type([handles.civ1_1 handles.filter1_1 handles.interp1_1 handles.civ2_1 handles.interp2_1 handles.filter2_1])
|
---|
| 1926 | end
|
---|
| 1927 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1928 |
|
---|
| 1929 | %--------------------------------------------
|
---|
| 1930 | function interp1_1_Callback(hObject, eventdata, handles)
|
---|
| 1931 | %--------------------------------------------
|
---|
| 1932 | if get(handles.interp1_1,'Value')==1
|
---|
| 1933 | reset_vel_type([handles.civ1_1 handles.civ2_1 handles.filter1_1 handles.interp2_1 handles.filter2_1],handles.interp1_1)
|
---|
| 1934 | else
|
---|
| 1935 | reset_vel_type([handles.civ1_1 handles.filter1_1 handles.interp1_1 handles.civ2_1 handles.interp2_1 handles.filter2_1])
|
---|
| 1936 | end
|
---|
| 1937 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1938 |
|
---|
| 1939 | %--------------------------------------------
|
---|
| 1940 | function filter1_1_Callback(hObject, eventdata, handles)
|
---|
| 1941 | %--------------------------------------------
|
---|
| 1942 | if get(handles.filter1_1,'Value')==1
|
---|
| 1943 | reset_vel_type([handles.interp1_1 handles.civ2_1 handles.interp1_1 handles.interp2_1 handles.filter2_1],handles.filter1_1)
|
---|
| 1944 | else
|
---|
| 1945 | reset_vel_type([handles.civ1_1 handles.filter1_1 handles.interp1_1 handles.civ2_1 handles.interp2_1 handles.filter2_1])
|
---|
| 1946 | end
|
---|
| 1947 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1948 |
|
---|
| 1949 | %--------------------------------------------
|
---|
| 1950 | function civ2_1_Callback(hObject, eventdata, handles)
|
---|
| 1951 | %--------------------------------------------
|
---|
| 1952 | if get(handles.civ2_1,'Value')==1
|
---|
| 1953 | reset_vel_type([handles.civ1_1 handles.interp1_1 handles.filter1_1 handles.interp2_1 handles.filter2_1],handles.civ2_1)
|
---|
| 1954 | else
|
---|
| 1955 | reset_vel_type([handles.civ1_1 handles.filter1_1 handles.interp1_1 handles.civ2_1 handles.interp2_1 handles.filter2_1])
|
---|
| 1956 | end
|
---|
| 1957 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1958 |
|
---|
| 1959 | %--------------------------------------------
|
---|
| 1960 | function interp2_1_Callback(hObject, eventdata, handles)
|
---|
| 1961 | %--------------------------------------------
|
---|
| 1962 | if get(handles.interp2_1,'Value')==1
|
---|
| 1963 | reset_vel_type([handles.civ1_1 handles.civ2_1 handles.filter1_1 handles.interp1_1 handles.filter2_1],handles.interp2_1)
|
---|
| 1964 | else
|
---|
| 1965 | reset_vel_type([handles.civ1_1 handles.filter1_1 handles.interp1_1 handles.civ2_1 handles.interp2_1 handles.filter2_1])
|
---|
| 1966 | end
|
---|
| 1967 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1968 |
|
---|
| 1969 | %--------------------------------------------
|
---|
| 1970 | function filter2_1_Callback(hObject, eventdata, handles)
|
---|
| 1971 | %--------------------------------------------
|
---|
| 1972 | if get(handles.filter2_1,'Value')==1
|
---|
| 1973 | reset_vel_type([handles.civ1_1 handles.interp1_1 handles.civ2_1 handles.filter1_1 handles.interp1_1 handles.interp2_1],handles.filter2_1)
|
---|
| 1974 | else
|
---|
| 1975 | reset_vel_type([handles.civ1_1 handles.filter1_1 handles.interp1_1 handles.civ2_1 handles.interp2_1 handles.filter2_1])
|
---|
| 1976 | end
|
---|
| 1977 | run0_Callback(hObject, eventdata, handles)
|
---|
| 1978 |
|
---|
| 1979 | %-----------------------------------------------
|
---|
| 1980 | % --- reset civ buttons
|
---|
| 1981 | function reset_vel_type(handles_civ0,handle1)
|
---|
| 1982 | for ibutton=1:length(handles_civ0)
|
---|
| 1983 | set(handles_civ0(ibutton),'BackgroundColor',[0.831 0.816 0.784])
|
---|
| 1984 | set(handles_civ0(ibutton),'Value',0)
|
---|
| 1985 | end
|
---|
| 1986 | if exist('handle1','var')%handles of selected button
|
---|
| 1987 | set(handle1,'BackgroundColor',[1 1 0])
|
---|
| 1988 | end
|
---|
| 1989 |
|
---|
| 1990 | %------------------------------------------------
|
---|
| 1991 | function create_Callback(hObject,eventdata,handles)
|
---|
| 1992 | %------------------------------------------------
|
---|
| 1993 | if ishandle(handles.VIEW_FIELD_title)
|
---|
| 1994 | delete(handles.VIEW_FIELD_title)
|
---|
| 1995 | end
|
---|
| 1996 | huvmat=get(handles.create,'parent');
|
---|
| 1997 | UvData=get(huvmat,'UserData');%read UvData properties stored on the view_field interface (handles huvmat)
|
---|
| 1998 | if isequal(get(handles.create,'Value'),1)
|
---|
| 1999 | set(handles.zoom,'Value',0)
|
---|
| 2000 | zoom_Callback(hObject, eventdata, handles)
|
---|
| 2001 | set(handles.create,'BackgroundColor',[1 1 0]) %visualise in yellow
|
---|
| 2002 | set(handles.edit_vect,'Value',0)
|
---|
| 2003 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2004 | set(handles.edit,'Value',0)
|
---|
| 2005 | set(handles.edit,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2006 | list_object=get(handles.list_object,'String');
|
---|
| 2007 | if ~isempty(list_object)
|
---|
| 2008 | set(handles.list_object,'Value',length(list_object))
|
---|
| 2009 | end
|
---|
| 2010 | MouseAction='create_object';
|
---|
| 2011 | hset_object=findobj(allchild(0),'Name','set_object');
|
---|
| 2012 | uistack(hset_object,'top')
|
---|
| 2013 | else
|
---|
| 2014 | set(handles.create,'BackgroundColor',[0 1 0])
|
---|
| 2015 | set(handles.edit,'Value',1)
|
---|
| 2016 | set(handles.edit,'BackgroundColor',[1 1 0])
|
---|
| 2017 | MouseAction='none';
|
---|
| 2018 | end
|
---|
| 2019 |
|
---|
| 2020 | UvData.MouseAction=MouseAction;
|
---|
| 2021 | set(huvmat,'UserData',UvData);
|
---|
| 2022 |
|
---|
| 2023 | %------------------------------------------------
|
---|
| 2024 | function POINTS_Callback(hObject,eventdata,handles)
|
---|
| 2025 | %------------------------------------------------
|
---|
| 2026 | if ishandle(handles.VIEW_FIELD_title)
|
---|
| 2027 | delete(handles.VIEW_FIELD_title)
|
---|
| 2028 | end
|
---|
| 2029 | huvmat=get(handles.create,'parent');
|
---|
| 2030 | UvData=get(huvmat,'UserData');%read UvData properties stored on the view_field interface (handles huvmat)
|
---|
| 2031 | if isequal(get(handles.create,'Value'),1)
|
---|
| 2032 | set(handles.zoom,'Value',0)
|
---|
| 2033 | zoom_Callback(hObject, eventdata, handles)
|
---|
| 2034 | set(handles.edit_vect,'Value',0)
|
---|
| 2035 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2036 | set(handles.edit,'Value',0)
|
---|
| 2037 | set(handles.edit,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2038 | %set(handles.grid,'Value',0)
|
---|
| 2039 | %set(handles.grid,'BackgroundColor',[0 1 0])
|
---|
| 2040 | % initiate set_object GUI
|
---|
| 2041 | data.TITLE='POINTS';
|
---|
| 2042 | if isfield(UvData,'CoordType')
|
---|
| 2043 | data.CoordType=UvData.CoordType;
|
---|
| 2044 | end
|
---|
| 2045 | if isfield(UvData,'Mesh')&~isempty(UvData.Mesh)
|
---|
| 2046 | data.RangeY=UvData.Mesh;
|
---|
| 2047 | elseif isfield(UvData,'AX')&isfield(UvData,'AY')& isfield(UvData,'A')%only image
|
---|
| 2048 | np=size(UvData.Field.A);
|
---|
| 2049 | meshx=(UvData.Field.AX(end)-UvData.Field.AX(1))/np(2);
|
---|
| 2050 | meshy=abs(UvData.Field.AY(end)-UvData.Field.AY(1))/np(1);
|
---|
| 2051 | data.RangeY=max(meshx,meshy);
|
---|
| 2052 | data.DX=max(meshx,meshy);
|
---|
| 2053 | end
|
---|
| 2054 | data.Coord=[0 0 0]; %default
|
---|
| 2055 | data.ParentButton=handles.create;
|
---|
| 2056 | PlotHandles=get_plot_handles(handles);%get the handles of the graphic objects setting the plotting parameters
|
---|
| 2057 | [hset_object,UvData.sethandles]=set_object(data,PlotHandles);% call the set_object interface
|
---|
| 2058 | if isfield(UvData,'SetObjectOrigin')
|
---|
| 2059 | pos_view_field=get(huvmat,'Position');
|
---|
| 2060 | pos_set_object(1:2)=UvData.SetObjectOrigin + pos_view_field(1:2);
|
---|
| 2061 | pos_set_object(3:4)=UvData.SetObjectSize .* pos_view_field(3:4);
|
---|
| 2062 | set(hset_object,'Position',pos_set_object)
|
---|
| 2063 | end
|
---|
| 2064 | %set(hset_object,'Position',[pos_view_field(1) pos_view_field(2)-0.05*pos_view_field(4) 0.2*pos_view_field(3) 0.5*pos_view_field(4)]);
|
---|
| 2065 | list_object=get(handles.list_object,'String');
|
---|
| 2066 | if ~isempty(list_object)
|
---|
| 2067 | set(handles.list_object,'Value',length(list_object))
|
---|
| 2068 | end
|
---|
| 2069 | MouseAction='create_object';
|
---|
| 2070 | %UvData.ZoomOn=0;
|
---|
| 2071 | else
|
---|
| 2072 | set(handles.create,'BackgroundColor',[0 1 0])
|
---|
| 2073 | set(handles.edit,'Value',1)
|
---|
| 2074 | set(handles.edit,'BackgroundColor',[1 1 0])
|
---|
| 2075 | MouseAction='none';
|
---|
| 2076 | end
|
---|
| 2077 |
|
---|
| 2078 | UvData.MouseAction=MouseAction;
|
---|
| 2079 | set(huvmat,'UserData',UvData);
|
---|
| 2080 |
|
---|
| 2081 | %-----------------------------------------------------------
|
---|
| 2082 | function LINE_Callback(hObject, eventdata, handles)
|
---|
| 2083 | %-------------------------------------------------
|
---|
| 2084 | if ishandle(handles.VIEW_FIELD_title)
|
---|
| 2085 | delete(handles.VIEW_FIELD_title)
|
---|
| 2086 | end
|
---|
| 2087 | % handles.view_field
|
---|
| 2088 | huvmat=get(handles.create,'parent');
|
---|
| 2089 | UvData=get(huvmat,'UserData');%read UvData properties stored on the view_field interface
|
---|
| 2090 | set(handles.zoom,'Value',0)
|
---|
| 2091 | zoom_Callback(hObject, eventdata, handles)
|
---|
| 2092 | set(handles.edit_vect,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2093 | set(handles.edit_vect,'Value',0)
|
---|
| 2094 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2095 | set(handles.edit,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2096 | set(handles.edit,'Value',0)
|
---|
| 2097 | set(handles.list_object,'Value',1);
|
---|
| 2098 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2099 | set(handles.edit,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2100 | set(handles.cal,'Value',0)
|
---|
| 2101 | set(handles.cal,'BackgroundColor',[0 1 0])
|
---|
| 2102 | % initiate the set_object GUI
|
---|
| 2103 | data.TITLE='LINE';
|
---|
| 2104 | if isfield(UvData,'CoordType')
|
---|
| 2105 | data.CoordType=UvData.CoordType;
|
---|
| 2106 | end
|
---|
| 2107 | if isfield(UvData,'Mesh')&~isempty(UvData.Mesh)
|
---|
| 2108 | data.RangeX=UvData.Mesh;
|
---|
| 2109 | data.RangeY=UvData.Mesh;
|
---|
| 2110 | data.DX=UvData.Mesh;
|
---|
| 2111 | data.DY=UvData.Mesh;
|
---|
| 2112 | elseif isfield(UvData.Field,'AX')&isfield(UvData.Field,'AY')& isfield(UvData.Field,'A')%only image
|
---|
| 2113 | np=size(UvData.Field.A);
|
---|
| 2114 | meshx=(UvData.Field.AX(end)-UvData.Field.AX(1))/np(2);
|
---|
| 2115 | meshy=abs(UvData.Field.AY(end)-UvData.Field.AY(1))/np(1);
|
---|
| 2116 | data.RangeY=max(meshx,meshy);
|
---|
| 2117 | data.RangeX=max(meshx,meshy);
|
---|
| 2118 | data.DX=max(meshx,meshy);
|
---|
| 2119 | end
|
---|
| 2120 | if isfield(data,'DX')
|
---|
| 2121 | data.Coord=[[0 0 0];[data.DX 0 0]]; %default
|
---|
| 2122 | else
|
---|
| 2123 | data.Coord=[[0 0 0];[1 0 0]]; %default
|
---|
| 2124 | end
|
---|
| 2125 | data.ParentButton=handles.create;
|
---|
| 2126 | PlotHandles=get_plot_handles(handles);%get the handles of the interface elements setting the plotting parameters
|
---|
| 2127 | [hset_object,UvData.sethandles]=set_object(data,PlotHandles);% call the set_object interface with action on haxes,
|
---|
| 2128 | % associate the set_edit interface handle to the plotting axes
|
---|
| 2129 | pos_view_field=get(huvmat,'Position');
|
---|
| 2130 | if isfield(UvData,'SetObjectOrigin')
|
---|
| 2131 | pos_set_object(1:2)=UvData.SetObjectOrigin + pos_view_field(1:2);
|
---|
| 2132 | pos_set_object(3:4)=UvData.SetObjectSize .* pos_view_field(3:4);
|
---|
| 2133 | set(hset_object,'Position',pos_set_object)
|
---|
| 2134 | end
|
---|
| 2135 | list_object=get(handles.list_object,'String');
|
---|
| 2136 | if ~isempty(list_object)
|
---|
| 2137 | set(handles.list_object,'Value',length(list_object))
|
---|
| 2138 | end
|
---|
| 2139 | MouseAction='create_object';
|
---|
| 2140 | UvData.MouseAction=MouseAction;
|
---|
| 2141 | set(huvmat,'UserData',UvData)
|
---|
| 2142 |
|
---|
| 2143 | %-----------------------------------------------------------
|
---|
| 2144 | function PATCH_Callback(hObject, eventdata, handles)
|
---|
| 2145 | %-----------------------------------------------------------
|
---|
| 2146 | if ishandle(handles.VIEW_FIELD_title)
|
---|
| 2147 | delete(handles.VIEW_FIELD_title)
|
---|
| 2148 | end
|
---|
| 2149 | huvmat=get(handles.create,'parent');
|
---|
| 2150 | UvData=get(huvmat,'UserData');%read UvData properties stored on the view_field interface
|
---|
| 2151 | % if isequal(get(handles.PATCH,'Value'),1)
|
---|
| 2152 | set(handles.zoom,'Value',0)
|
---|
| 2153 | set(handles.zoom,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2154 | % set(handles.create,'Value',0)%suppress the other options if LINE is chosen
|
---|
| 2155 | % set(handles.create,'BackgroundColor',[0 1 0])
|
---|
| 2156 | % set(handles.LINE,'Value',0)
|
---|
| 2157 | % set(handles.LINE,'BackgroundColor',[0 1 0])
|
---|
| 2158 | % set(handles.PATCH,'Value',1)
|
---|
| 2159 | % set(handles.PATCH,'BackgroundColor',[1 1 0])
|
---|
| 2160 | % set(handles.PLANE,'Value',0)
|
---|
| 2161 | % set(handles.PLANE,'BackgroundColor',[0 1 0])%put activated buttons to yellow
|
---|
| 2162 | % set(handles.VOLUME,'Value',0)
|
---|
| 2163 | % set(handles.VOLUME,'BackgroundColor',[0 1 0])
|
---|
| 2164 | %set(handles.makemask,'Value',0)
|
---|
| 2165 | %makemask_Callback(hObject, eventdata, handles)
|
---|
| 2166 | set(handles.edit_vect,'Value',0)
|
---|
| 2167 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2168 | set(handles.edit,'Value',0)
|
---|
| 2169 | set(handles.edit,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2170 | set(handles.edit_vect,'Value',0)
|
---|
| 2171 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2172 | set(handles.cal,'Value',0)
|
---|
| 2173 | set(handles.cal,'BackgroundColor',[0 1 0])
|
---|
| 2174 | %set(handles.grid,'Value',0)
|
---|
| 2175 | %set(handles.grid,'BackgroundColor',[0 1 0])
|
---|
| 2176 | %initiate set_object GUI
|
---|
| 2177 | data.TITLE='PATCH';
|
---|
| 2178 | if isfield(UvData,'CoordType')
|
---|
| 2179 | data.CoordType=UvData.CoordType;
|
---|
| 2180 | end
|
---|
| 2181 | if isfield(UvData,'Mesh')&~isempty(UvData.Mesh)
|
---|
| 2182 | data.YMax=UvData.Mesh;
|
---|
| 2183 | elseif isfield(UvData.Field,'AX')&isfield(UvData.Field,'AY')& isfield(UvData.Field,'A')%only image
|
---|
| 2184 | np=size(UvData.Field.A);
|
---|
| 2185 | meshx=(UvData.Field.AX(end)-UvData.Field.AX(1))/(np(2)-1);
|
---|
| 2186 | meshy=abs(UvData.Field.AY(end)-UvData.Field.AY(1))/(np(1)-1);
|
---|
| 2187 | data.YMax=max(meshx,meshy);
|
---|
| 2188 | data.DX=max(meshx,meshy);
|
---|
| 2189 | end
|
---|
| 2190 | data.Coord=[0 0 0]; %default
|
---|
| 2191 | data.ParentButton=handles.create;
|
---|
| 2192 | PlotHandles=get_plot_handles(handles);%get the handles of the graphic objects setting the plotting parameters
|
---|
| 2193 | [hset_object,UvData.sethandles]=set_object(data,PlotHandles);% call the set_object interface
|
---|
| 2194 | pos_view_field=get(huvmat,'Position');
|
---|
| 2195 | if isfield(UvData,'SetObjectOrigin')
|
---|
| 2196 | pos_set_object(1:2)=UvData.SetObjectOrigin + pos_view_field(1:2);
|
---|
| 2197 | pos_set_object(3:4)=UvData.SetObjectSize .* pos_view_field(3:4);
|
---|
| 2198 | set(hset_object,'Position',pos_set_object)
|
---|
| 2199 | end
|
---|
| 2200 | list_object=get(handles.list_object,'String');
|
---|
| 2201 | if ~isempty(list_object)
|
---|
| 2202 | set(handles.list_object,'Value',length(list_object))
|
---|
| 2203 | end
|
---|
| 2204 | UvData.MouseAction='create_object';
|
---|
| 2205 | set(huvmat,'UserData',UvData);
|
---|
| 2206 | %-------------------------------------------------------
|
---|
| 2207 | function PLANE_Callback(hObject, eventdata, handles)
|
---|
| 2208 | %-------------------------------------------------------
|
---|
| 2209 | if ishandle(handles.VIEW_FIELD_title)
|
---|
| 2210 | delete(handles.VIEW_FIELD_title)
|
---|
| 2211 | end
|
---|
| 2212 | huvmat=get(handles.create,'parent');
|
---|
| 2213 | UvData=get(huvmat,'UserData');%read UvData properties stored on the view_field interface
|
---|
| 2214 | set(handles.zoom,'Value',0)
|
---|
| 2215 | set(handles.zoom,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2216 | set(handles.edit_vect,'Value',0)
|
---|
| 2217 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2218 | set(handles.edit,'Value',0)
|
---|
| 2219 | set(handles.edit,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2220 | set(handles.cal,'Value',0)
|
---|
| 2221 | set(handles.cal,'BackgroundColor',[0 1 0])
|
---|
| 2222 | %set(handles.grid,'Value',0)
|
---|
| 2223 | %set(handles.grid,'BackgroundColor',[0 1 0])
|
---|
| 2224 | %initiate set_object GUI
|
---|
| 2225 | data.TITLE='PLANE';
|
---|
| 2226 | if isfield(UvData,'CoordType')
|
---|
| 2227 | data.CoordType=UvData.CoordType;
|
---|
| 2228 | end
|
---|
| 2229 | %Si 3D data.nbdim=3;
|
---|
| 2230 | %Si 2D
|
---|
| 2231 | if isfield(UvData,'Mesh')&~isempty(UvData.Mesh)
|
---|
| 2232 | data.ZMax=UvData.Mesh;
|
---|
| 2233 | data.DX=UvData.Mesh;
|
---|
| 2234 | data.DY=UvData.Mesh;
|
---|
| 2235 | elseif isfield(UvData.Field,'AX')&isfield(UvData.Field,'AY')& isfield(UvData.Field,'A')%only image
|
---|
| 2236 | np=size(UvData.Field.A);
|
---|
| 2237 | meshx=(UvData.Field.AX(end)-UvData.Field.AX(1))/(np(2)-1);
|
---|
| 2238 | meshy=abs(UvData.Field.AY(end)-UvData.Field.AY(1))/(np(1)-1);
|
---|
| 2239 | data.DX=max(meshx,meshy);
|
---|
| 2240 | end
|
---|
| 2241 | if isfield(UvData,'DX')
|
---|
| 2242 | data.DX=UvData.DX;
|
---|
| 2243 | end
|
---|
| 2244 | if isfield(UvData,'DY')
|
---|
| 2245 | data.DY=UvData.DY;
|
---|
| 2246 | elseif isfield(UvData,'Mesh')
|
---|
| 2247 | data.DY=UvData.Mesh;
|
---|
| 2248 | end
|
---|
| 2249 | if isfield(UvData.Field,'X')& isfield(UvData.Field,'Y')
|
---|
| 2250 | data.Coord=[0 0 0];
|
---|
| 2251 | data.Style='plane';
|
---|
| 2252 | data.Phi=0;
|
---|
| 2253 | data.IndexObj=1; %act on the first reference plane by default
|
---|
| 2254 | haxes= handles.axes3;%GENERALISER
|
---|
| 2255 | plot_object(data,[],haxes,'m'); %plot the axes of the default plane
|
---|
| 2256 | end
|
---|
| 2257 | data.ParentButton=handles.create;
|
---|
| 2258 | PlotHandles=get_plot_handles(handles);%get the handles of the graphic objects setting the plotting parameters
|
---|
| 2259 | ZBounds=0; % default
|
---|
| 2260 | if isfield(UvData,'ZMin') && isfield(UvData,'ZMax')
|
---|
| 2261 | ZBounds(1)=UvData.ZMin; %minimum for the Z slider
|
---|
| 2262 | ZBounds(2)=UvData.ZMax;%maximum for the Z slider
|
---|
| 2263 | end
|
---|
| 2264 | [hset_object,UvData.sethandles]=set_object(data,PlotHandles,ZBounds);% call the set_object interface with action on haxes,
|
---|
| 2265 | if isfield(UvData,'SetObjectOrigin')
|
---|
| 2266 | pos_view_field=get(huvmat,'Position');
|
---|
| 2267 | pos_set_object(1:2)=UvData.SetObjectOrigin + pos_view_field(1:2);
|
---|
| 2268 | pos_set_object(3:4)=UvData.SetObjectSize .* pos_view_field(3:4);
|
---|
| 2269 | set(hset_object,'Position',pos_set_object)
|
---|
| 2270 | end
|
---|
| 2271 | list_object=get(handles.list_object,'String');
|
---|
| 2272 | nbobject=length(list_object);
|
---|
| 2273 | set(handles.list_object,'Value',nbobject)
|
---|
| 2274 | UvData.MouseAction='create_object';
|
---|
| 2275 | set(huvmat,'UserData',UvData)
|
---|
| 2276 |
|
---|
| 2277 | %-------------------------------------------------------
|
---|
| 2278 | % --- Executes on button press in MENUVOLUME.
|
---|
| 2279 | %-------------------------------------------------------
|
---|
| 2280 | function VOLUME_Callback(hObject, eventdata, handles)
|
---|
| 2281 | %errordlg('command VOL not implemented yet')
|
---|
| 2282 | if ishandle(handles.VIEW_FIELD_title)
|
---|
| 2283 | delete(handles.VIEW_FIELD_title)
|
---|
| 2284 | end
|
---|
| 2285 | huvmat=get(handles.create,'parent');
|
---|
| 2286 | UvData=get(huvmat,'UserData');%read UvData properties stored on the view_field interface
|
---|
| 2287 | if isequal(get(handles.VOLUME,'Value'),1)
|
---|
| 2288 | set(handles.zoom,'Value',0)
|
---|
| 2289 | set(handles.zoom,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2290 | set(handles.edit_vect,'Value',0)
|
---|
| 2291 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2292 | set(handles.edit,'Value',0)
|
---|
| 2293 | set(handles.edit,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2294 | set(handles.cal,'Value',0)
|
---|
| 2295 | set(handles.cal,'BackgroundColor',[0 1 0])
|
---|
| 2296 | set(handles.edit_vect,'Value',0)
|
---|
| 2297 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2298 | %initiate set_object GUI
|
---|
| 2299 | data.TITLE='VOLUME';
|
---|
| 2300 | if isfield(UvData,'CoordType')
|
---|
| 2301 | data.CoordType=UvData.CoordType;
|
---|
| 2302 | end
|
---|
| 2303 | if isfield(UvData,'Mesh')&~isempty(UvData.Mesh)
|
---|
| 2304 | data.RangeY=UvData.Mesh;
|
---|
| 2305 | data.RangeX=UvData.Mesh;
|
---|
| 2306 | data.DX=UvData.Mesh;
|
---|
| 2307 | data.DY=UvData.Mesh;
|
---|
| 2308 | elseif isfield(UvData.Field,'AX')&isfield(UvData.Field,'AY')& isfield(UvData.Field,'A')%only image
|
---|
| 2309 | np=size(UvData.Field.A);
|
---|
| 2310 | meshx=(UvData.Field.AX(end)-UvData.Field.AX(1))/np(2);
|
---|
| 2311 | meshy=abs(UvData.Field.AY(end)-UvData.Field.AY(1))/np(1);
|
---|
| 2312 | data.RangeY=max(meshx,meshy);
|
---|
| 2313 | data.RangeX=max(meshx,meshy);
|
---|
| 2314 | data.DX=max(meshx,meshy);
|
---|
| 2315 | end
|
---|
| 2316 | data.ParentButton=handles.VOLUME;
|
---|
| 2317 | PlotHandles=get_plot_handles(handles);%get the handles of the interface elements setting the plotting parameters
|
---|
| 2318 | [hset_object,UvData.sethandles]=set_object(data,PlotHandles);% call the set_object interface with action on haxes,
|
---|
| 2319 | % associate the set_edit interface handle to the plotting axes
|
---|
| 2320 | if isfield(UvData,'SetObjectOrigin')
|
---|
| 2321 | pos_view_field=get(huvmat,'Position');
|
---|
| 2322 | pos_set_object(1:2)=UvData.SetObjectOrigin + pos_view_field(1:2);
|
---|
| 2323 | pos_set_object(3:4)=UvData.SetObjectSize .* pos_view_field(3:4);
|
---|
| 2324 | set(hset_object,'Position',pos_set_object)
|
---|
| 2325 | end
|
---|
| 2326 | UvData.MouseAction='create_object';
|
---|
| 2327 | else
|
---|
| 2328 | set(handles.VOLUME,'BackgroundColor',[0 1 0])
|
---|
| 2329 | UvData.MouseAction='none';
|
---|
| 2330 | end
|
---|
| 2331 | set(huvmat,'UserData',UvData)
|
---|
| 2332 |
|
---|
| 2333 | %-------------------------------------------------------
|
---|
| 2334 | function edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2335 | %-------------------------------------------------------
|
---|
| 2336 |
|
---|
| 2337 | UvData=get(handles.view_field,'UserData');%read UvData properties stored on the view_field interface
|
---|
| 2338 | if isequal(get(handles.edit_vect,'Value'),1)
|
---|
| 2339 | test_civ2=isequal(get(handles.civ2,'BackgroundColor'),[1 1 0]);
|
---|
| 2340 | test_civ1=isequal(get(handles.civ1,'BackgroundColor'),[1 1 0]);
|
---|
| 2341 | if ~test_civ2 && ~test_civ1
|
---|
| 2342 | msgbox_view_field('ERROR','manual correction only possible for CIV1 or CIV2 velocity fields')
|
---|
| 2343 | end
|
---|
| 2344 | set(handles.record,'Visible','on')
|
---|
| 2345 | set(handles.edit_vect,'BackgroundColor',[1 1 0])
|
---|
| 2346 | set(handles.edit,'Value',0)
|
---|
| 2347 | set(handles.create,'Value',0)
|
---|
| 2348 | set(handles.create,'BackgroundColor',[0 1 0])
|
---|
| 2349 | set(handles.edit,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2350 | set(gcf,'Pointer','arrow')
|
---|
| 2351 | UvData.MouseAction='edit_vect';
|
---|
| 2352 | else
|
---|
| 2353 | set(handles.record,'Visible','off')
|
---|
| 2354 | set(handles.edit_vect,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2355 | UvData.MouseAction='none';
|
---|
| 2356 | end
|
---|
| 2357 | set(handles.view_field,'UserData',UvData)
|
---|
| 2358 |
|
---|
| 2359 | %----------------------------------------------
|
---|
| 2360 | function save_mask_Callback(hObject, eventdata, handles)
|
---|
| 2361 | %-----------------------------------------------------------------------
|
---|
| 2362 | huvmat=get(handles.save_mask,'parent');
|
---|
| 2363 | UvData=get(huvmat,'UserData');
|
---|
| 2364 |
|
---|
| 2365 | hpatch=findobj(huvmat,'Type','patch');
|
---|
| 2366 | flag=1;
|
---|
| 2367 | npx=size(UvData.Field.A,2);
|
---|
| 2368 | npy=size(UvData.Field.A,1);
|
---|
| 2369 | xi=[0.5:npx-0.5];
|
---|
| 2370 | yi=[0.5:npy-0.5];
|
---|
| 2371 | [Xi,Yi]=meshgrid(xi,yi);
|
---|
| 2372 | if isfield(UvData,'Object')
|
---|
| 2373 | for iobj=1:length(UvData.Object)
|
---|
| 2374 | ObjectData=UvData.Object{iobj};
|
---|
| 2375 | if isfield(ObjectData,'ProjMode') &&(isequal(ObjectData.ProjMode,'mask_inside')||isequal(ObjectData.ProjMode,'mask_outside'));
|
---|
| 2376 | flagobj=1;
|
---|
| 2377 | testphys=0; %coordinates in pixels by default
|
---|
| 2378 | if isfield(ObjectData,'CoordType') && isequal(ObjectData.CoordType,'phys')
|
---|
| 2379 | if isfield(UvData,'XmlData')&& isfield(UvData.XmlData,'GeometryCalib')
|
---|
| 2380 | Calib=UvData.XmlData.GeometryCalib;
|
---|
| 2381 | testphys=1;
|
---|
| 2382 | end
|
---|
| 2383 | end
|
---|
| 2384 | if isfield(ObjectData,'Coord')& isfield(ObjectData,'Style')
|
---|
| 2385 | if isequal(ObjectData.Style,'polygon')
|
---|
| 2386 | X=ObjectData.Coord(:,1);
|
---|
| 2387 | Y=ObjectData.Coord(:,2);
|
---|
| 2388 | if testphys
|
---|
| 2389 | [X,Y]=px_XYZ(Calib,X,Y,0);% to generalise with 3D cases
|
---|
| 2390 | end
|
---|
| 2391 | flagobj=~inpolygon(Xi,Yi,X,Y);%=0 inside the polygon, 1 outside
|
---|
| 2392 | elseif isequal(ObjectData.Style,'ellipse')
|
---|
| 2393 | if testphys
|
---|
| 2394 | %[X,Y]=px_XYZ(Calib,X,Y,0);% TODO:create a polygon boundary and transform to phys
|
---|
| 2395 | end
|
---|
| 2396 | RangeX=max(ObjectData.RangeX);
|
---|
| 2397 | RangeY=max(ObjectData.RangeY);
|
---|
| 2398 | X2Max=RangeX*RangeX;
|
---|
| 2399 | Y2Max=RangeY*RangeY;
|
---|
| 2400 | distX=(Xi-ObjectData.Coord(1,1));
|
---|
| 2401 | distY=(Yi-ObjectData.Coord(1,2));
|
---|
| 2402 | flagobj=(distX.*distX/X2Max+distY.*distY/Y2Max)>1;
|
---|
| 2403 | elseif isequal(ObjectData.Style,'rectangle')
|
---|
| 2404 | if testphys
|
---|
| 2405 | %[X,Y]=px_XYZ(Calib,X,Y,0);% TODO:create a polygon boundary and transform to phys
|
---|
| 2406 | end
|
---|
| 2407 | distX=abs(Xi-ObjectData.Coord(1,1));
|
---|
| 2408 | distY=abs(Yi-ObjectData.Coord(1,2));
|
---|
| 2409 | flagobj=distX>max(ObjectData.RangeX) | distY>max(ObjectData.RangeY);
|
---|
| 2410 | end
|
---|
| 2411 | if isequal(ObjectData.ProjMode,'mask_outside')
|
---|
| 2412 | flagobj=~flagobj;
|
---|
| 2413 | end
|
---|
| 2414 | flag=flag & flagobj;
|
---|
| 2415 | end
|
---|
| 2416 | end
|
---|
| 2417 | end
|
---|
| 2418 | end
|
---|
| 2419 | % flag=~flag;
|
---|
| 2420 | %mask name
|
---|
| 2421 | RootPath=get(handles.RootPath,'String');
|
---|
| 2422 | RootFile=get(handles.RootFile,'String');
|
---|
| 2423 | if ~isempty(RootFile)&(isequal(RootFile(1),'/')| isequal(RootFile(1),'\'))
|
---|
| 2424 | RootFile(1)=[];
|
---|
| 2425 | end
|
---|
| 2426 | filebase=fullfile(RootPath,RootFile);
|
---|
| 2427 | list=get(handles.masklevel,'String');
|
---|
| 2428 | masknumber=num2str(length(list));
|
---|
| 2429 | maskindex=get(handles.masklevel,'Value');
|
---|
| 2430 | mask_name=name_generator([filebase '_' masknumber 'mask'],maskindex,1,'.png','_i');
|
---|
| 2431 | imflag=uint8(255*(0.392+0.608*flag));% =100 for flag=0 (vectors not computed when 20<imflag<200)
|
---|
| 2432 | imflag=flipdim(imflag,1);
|
---|
| 2433 | % imflag=uint8(255*flag);% =0 for flag=0 (vectors=0 when 20<imflag<200)
|
---|
| 2434 | msgbox_view_field('CONFIRMATION',[mask_name ' saved'])
|
---|
| 2435 | imwrite(imflag,mask_name,'BitDepth',8);
|
---|
| 2436 |
|
---|
| 2437 | %display the mask
|
---|
| 2438 | %update_mask(handles,num_i1,num_j1)
|
---|
| 2439 | figure;
|
---|
| 2440 | vec=linspace(0,1,256);%define a linear greyscale colormap
|
---|
| 2441 | map=[vec' vec' vec'];
|
---|
| 2442 | colormap(map)
|
---|
| 2443 |
|
---|
| 2444 | image(imflag);
|
---|
| 2445 |
|
---|
| 2446 | %-------------------------------------------------------------------
|
---|
| 2447 | %-------------------------------------------------------------------
|
---|
| 2448 | % - FUNCTIONS FOR SETTING PLOTTING PARAMETERS
|
---|
| 2449 |
|
---|
| 2450 | %------------------------------------------------------------------
|
---|
| 2451 |
|
---|
| 2452 |
|
---|
| 2453 |
|
---|
| 2454 | %------------------------------------------------------------------
|
---|
| 2455 | % --- Executes on selection change in col_vec: choice of the color code.
|
---|
| 2456 | %
|
---|
| 2457 | function col_vec_Callback(hObject, eventdata, handles)
|
---|
| 2458 | %------------------------------------------------------------------
|
---|
| 2459 | % edit the choice for color code
|
---|
| 2460 | list_code=get(handles.col_vec,'String');% list menu fields
|
---|
| 2461 | index_code=get(handles.col_vec,'Value');% selected string index
|
---|
| 2462 | col_code= list_code{index_code(1)}; % selected field
|
---|
| 2463 | if isequal(col_code,'black') | isequal(col_code,'white')
|
---|
| 2464 | set(handles.slider1,'Visible','off')
|
---|
| 2465 | set(handles.slider2,'Visible','off')
|
---|
| 2466 | set(handles.colcode1,'Visible','off')
|
---|
| 2467 | set(handles.colcode2,'Visible','off')
|
---|
| 2468 | set(handles.AutoVecColor,'Visible','off')
|
---|
| 2469 | set_vec_col_bar(handles)
|
---|
| 2470 | else
|
---|
| 2471 | set(handles.slider1,'Visible','on')
|
---|
| 2472 | set(handles.slider2,'Visible','on')
|
---|
| 2473 | set(handles.colcode1,'Visible','on')
|
---|
| 2474 | set(handles.colcode2,'Visible','on')
|
---|
| 2475 | set(handles.AutoVecColor,'Visible','on')
|
---|
| 2476 | if isequal(col_code,'ima_cor')
|
---|
| 2477 | set(handles.AutoVecColor,'Value',0)%fixed scale by default
|
---|
| 2478 | set(handles.vec_col_bar,'Value',0)% 3 colors r,g,b by default
|
---|
| 2479 | set(handles.slider1,'Min',0);
|
---|
| 2480 | set(handles.slider1,'Max',1);
|
---|
| 2481 | set(handles.slider2,'Min',0);
|
---|
| 2482 | set(handles.slider2,'Max',1);
|
---|
| 2483 | % set(handles.min_title_vec,'String','0')
|
---|
| 2484 | set(handles.max_vec,'String','1')
|
---|
| 2485 | set(handles.colcode1,'String','0.333')
|
---|
| 2486 | colcode1_Callback(hObject, eventdata, handles)
|
---|
| 2487 | set(handles.colcode2,'String','0.666')
|
---|
| 2488 | colcode2_Callback(hObject, eventdata, handles)
|
---|
| 2489 | else
|
---|
| 2490 | set(handles.AutoVecColor,'Value',1)%auto scale between min,max by default
|
---|
| 2491 | set(handles.vec_col_bar,'Value',1)% colormap 'jet' by default
|
---|
| 2492 | minval=get(handles.slider1,'Min');
|
---|
| 2493 | maxval=get(handles.slider1,'Max');
|
---|
| 2494 | set(handles.slider1,'Value',minval)
|
---|
| 2495 | set(handles.slider2,'Value',maxval)
|
---|
| 2496 | set_vec_col_bar(handles)
|
---|
| 2497 | end
|
---|
| 2498 | % slider_update(handles)
|
---|
| 2499 | end
|
---|
| 2500 | %replot the current graph
|
---|
| 2501 | run0_Callback(hObject, eventdata, handles)
|
---|
| 2502 |
|
---|
| 2503 |
|
---|
| 2504 | %----------------------------------------------------------------
|
---|
| 2505 | % -- Executes on slider movement to set the color code
|
---|
| 2506 | %
|
---|
| 2507 | function slider1_Callback(hObject, eventdata, handles)
|
---|
| 2508 | %------------------------------------------------------------------
|
---|
| 2509 | slider1=get(handles.slider1,'Value');
|
---|
| 2510 | min_val=str2num(get(handles.min_vec,'String'));
|
---|
| 2511 | max_val=str2num(get(handles.max_vec,'String'));
|
---|
| 2512 | col=min_val+(max_val-min_val)*slider1;
|
---|
| 2513 | set(handles.colcode1,'String',num2str(col))
|
---|
| 2514 | if(get(handles.slider2,'Value') < col)%move also the second slider at the same value if needed
|
---|
| 2515 | set(handles.slider2,'Value',col)
|
---|
| 2516 | set(handles.colcode2,'String',num2str(col))
|
---|
| 2517 | end
|
---|
| 2518 | colcode1_Callback(hObject, eventdata, handles)
|
---|
| 2519 |
|
---|
| 2520 | %----------------------------------------------------------------
|
---|
| 2521 | % Executes on slider movement to set the color code
|
---|
| 2522 | %----------------------------------------------------------------
|
---|
| 2523 | function slider2_Callback(hObject, eventdata, handles)
|
---|
| 2524 | slider2=get(handles.slider2,'Value');
|
---|
| 2525 | min_val=str2num(get(handles.min_vec,'String'));
|
---|
| 2526 | max_val=str2num(get(handles.max_vec,'String'));
|
---|
| 2527 | col=min_val+(max_val-min_val)*slider2;
|
---|
| 2528 | set(handles.colcode2,'String',num2str(col))
|
---|
| 2529 | if(get(handles.slider1,'Value') > col)%move also the first slider at the same value if needed
|
---|
| 2530 | set(handles.slider1,'Value',col)
|
---|
| 2531 | set(handles.colcode1,'String',num2str(col))
|
---|
| 2532 | end
|
---|
| 2533 | colcode2_Callback(hObject, eventdata, handles)
|
---|
| 2534 |
|
---|
| 2535 | %----------------------------------------------------------------
|
---|
| 2536 | %execute on return carriage on the edit box corresponding to slider 1
|
---|
| 2537 | %----------------------------------------------------------------
|
---|
| 2538 | function colcode1_Callback(hObject, eventdata, handles)
|
---|
| 2539 | % col=str2num(get(handles.colcode1,'String'));
|
---|
| 2540 | % set(handles.slider1,'Value',col)
|
---|
| 2541 | set_vec_col_bar(handles)
|
---|
| 2542 | update_plot(handles)
|
---|
| 2543 |
|
---|
| 2544 | %----------------------------------------------------------------
|
---|
| 2545 | %execute on return carriage on the edit box corresponding to slider 2
|
---|
| 2546 | %----------------------------------------------------------------
|
---|
| 2547 | function colcode2_Callback(hObject, eventdata, handles)
|
---|
| 2548 | % col=str2num(get(handles.colcode2,'String'));
|
---|
| 2549 | % set(handles.slider2,'Value',col)
|
---|
| 2550 | % slider2_Callback(hObject, eventdata, handles)
|
---|
| 2551 | set_vec_col_bar(handles)
|
---|
| 2552 | update_plot(handles)
|
---|
| 2553 | %------------------------------------------------------------
|
---|
| 2554 | %update the slider values after displaying vectors
|
---|
| 2555 | %--------------------------------------------------------
|
---|
| 2556 | % function slider_update(handles,auto,minC,colcode1,colcode2,maxC)
|
---|
| 2557 | % set(handles.slider1,'Min',minC)
|
---|
| 2558 | % set(handles.slider1,'Max',maxC)
|
---|
| 2559 | % set(handles.slider2,'Min',minC)
|
---|
| 2560 | % set(handles.slider2,'Max',maxC)
|
---|
| 2561 | % set(handles.min_title_vec,'String',num2str(minC))
|
---|
| 2562 | % set(handles.max_vec,'String',num2str(maxC))
|
---|
| 2563 | % if auto
|
---|
| 2564 | % set(handles.colcode1,'String',num2str(colcode1,3))%update display
|
---|
| 2565 | % set(handles.colcode2,'String',num2str(colcode2,3))
|
---|
| 2566 | % end
|
---|
| 2567 | % set(handles.slider1,'Value',colcode1)%update slider with constant display
|
---|
| 2568 | % set(handles.slider2,'Value',colcode2)
|
---|
| 2569 | % set_vec_col_bar(handles)
|
---|
| 2570 |
|
---|
| 2571 |
|
---|
| 2572 | %-------------------------------------------------------
|
---|
| 2573 | % --- Executes on button press in AutoVecColor.
|
---|
| 2574 | %-------------------------------------------------------
|
---|
| 2575 | function vec_col_bar_Callback(hObject, eventdata, handles)
|
---|
| 2576 | set_vec_col_bar(handles)
|
---|
| 2577 |
|
---|
| 2578 | % %--------------------------------------------
|
---|
| 2579 | % %update the display of color code for vectors
|
---|
| 2580 | % %--------------------------------------------
|
---|
| 2581 | % function set_vec_col_bar(handles)
|
---|
| 2582 | % %get the image of the color display button 'vec_col_bar' in pixels
|
---|
| 2583 | % uni=get(handles.vec_col_bar,'Unit');
|
---|
| 2584 | % set(handles.vec_col_bar,'Unit','pixel')
|
---|
| 2585 | % pos_vert=get(handles.vec_col_bar,'Position');
|
---|
| 2586 | % set(handles.vec_col_bar,'Unit','Normalized')
|
---|
| 2587 | % width=ceil(pos_vert(3));
|
---|
| 2588 | % height=ceil(pos_vert(4));
|
---|
| 2589 | % %get slider indications
|
---|
| 2590 | % colcode.min=get(handles.slider1,'Min');
|
---|
| 2591 | % colcode.max=get(handles.slider1,'Max');
|
---|
| 2592 | % colcode.colcode1=get(handles.slider1,'Value');
|
---|
| 2593 | % colcode.colcode2=get(handles.slider2,'Value');
|
---|
| 2594 | % colcode.option=get(handles.vec_col_bar,'Value');
|
---|
| 2595 | % colcode.auto=1;
|
---|
| 2596 | % list_code=get(handles.col_vec,'String');% list menu fields
|
---|
| 2597 | % index_code=get(handles.col_vec,'Value');% selected string index
|
---|
| 2598 | % colcode.CName= list_code{index_code(1)}; % selected field used for vector color
|
---|
| 2599 | % vec_C=colcode.min+(colcode.max-colcode.min)*[0.5:width-0.5]/width;%sample of vec_C values from min to max
|
---|
| 2600 | % [colorlist,col_vec]=set_col_vec(colcode,vec_C);
|
---|
| 2601 | % oneheight=ones(1,height);
|
---|
| 2602 | % A1=colorlist(col_vec,1)*oneheight;
|
---|
| 2603 | % A2=colorlist(col_vec,2)*oneheight;
|
---|
| 2604 | % A3=colorlist(col_vec,3)*oneheight;
|
---|
| 2605 | % A(:,:,1)=A1';
|
---|
| 2606 | % A(:,:,2)=A2';
|
---|
| 2607 | % A(:,:,3)=A3';
|
---|
| 2608 | % set(handles.vec_col_bar,'Cdata',A)
|
---|
| 2609 |
|
---|
| 2610 | %--------------------------------------------------------
|
---|
| 2611 | % --- Executes on button press in cal.
|
---|
| 2612 | function cal_Callback(hObject, eventdata, handles)
|
---|
| 2613 |
|
---|
| 2614 | huvmat=get(handles.cal,'parent');%handles of the view_field interface
|
---|
| 2615 | UvData=get(huvmat,'UserData');%read UvData properties stored on the view_field interface
|
---|
| 2616 | %reinitialize the edit interface associated with view_field
|
---|
| 2617 | value=get(handles.cal,'Value');
|
---|
| 2618 | if value
|
---|
| 2619 | set(handles.cal,'BackgroundColor',[1 1 0])
|
---|
| 2620 | %suppress the other options if MENULINE is chosen
|
---|
| 2621 | set(handles.zoom,'Value',0)
|
---|
| 2622 | set(handles.zoom,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2623 | set(handles.create,'Value',0)
|
---|
| 2624 | set(handles.create,'BackgroundColor',[0 1 0])
|
---|
| 2625 | set(handles.create,'enable','off')
|
---|
| 2626 | set(handles.edit_vect,'Value',0)
|
---|
| 2627 | set(handles.edit_vect,'enable','off')
|
---|
| 2628 | edit_vect_Callback(hObject, eventdata, handles)
|
---|
| 2629 | set(handles.edit,'Value',0)
|
---|
| 2630 | set(handles.edit,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2631 | set(handles.edit,'enable','off')
|
---|
| 2632 | set(handles.list_object,'Value',1)
|
---|
| 2633 | % initiate display of GUI geometry_calib
|
---|
| 2634 | data=[]; %default
|
---|
| 2635 | if isfield(UvData,'CoordType')
|
---|
| 2636 | data.CoordType=UvData.CoordType;
|
---|
| 2637 | end
|
---|
| 2638 | %data.ParentButton=handles.cal; % transmit the handles of the calling button to the GUI geometry_calib
|
---|
| 2639 | pos=get(huvmat,'Position');
|
---|
| 2640 | pos(1)=pos(1)+pos(3)-0.311+0.04; %0.311= width of the geometry_calib interface (units relative to the srcreen)
|
---|
| 2641 | pos(2)=pos(2)-0.02;
|
---|
| 2642 | [FileName,RootPath,FileBase,FileIndices,FileExt,SubDir]=read_file_boxes(handles);
|
---|
| 2643 | % [filebase,num_i1,num_j1,num_i2,num_j2,Ext,NomType,SubDir]=read_input_file(handles);
|
---|
| 2644 | % [inputfile,idetect]=name_generator(filebase,num_i1,num_j1,Ext,NomType,1,num_i2,num_j2,SubDir);
|
---|
| 2645 | [UvData.hset_object,UvData.sethandles]=geometry_calib(handles,pos,FileName);% call the set_object interface
|
---|
| 2646 | pos_view_field=get(huvmat,'Position');
|
---|
| 2647 | %pos_cal(1:2)=UvData.CalOrigin + pos_view_field(1:2);
|
---|
| 2648 | if isfield(UvData,'CalOrigin')
|
---|
| 2649 | pos_cal(1)=pos_view_field(1)+UvData.CalOrigin(1)*pos_view_field(3);
|
---|
| 2650 | pos_cal(2)=pos_view_field(2)+UvData.CalOrigin(2)*pos_view_field(4);
|
---|
| 2651 | pos_cal(3:4)=UvData.CalSize .* pos_view_field(3:4);
|
---|
| 2652 | set(UvData.hset_object,'Position',pos_cal)
|
---|
| 2653 | end
|
---|
| 2654 | UvData.MouseAction='calib';
|
---|
| 2655 | else
|
---|
| 2656 | UvData.MouseAction='none';
|
---|
| 2657 | hgeometry_calib=findobj(allchild(0),'Name','geometry_calib');
|
---|
| 2658 | % if ~isempty(hgeometry_calib)
|
---|
| 2659 | % answer=questdlg('close the GUI geometry-calib?');
|
---|
| 2660 | % if isequal(answer,'Yes')
|
---|
| 2661 | % delete(hgeometry_calib)
|
---|
| 2662 | % set(handles.cal,'BackgroundColor',[0 1 0])
|
---|
| 2663 | % else
|
---|
| 2664 | % set(handles.cal,'Value',1)% keep the calibration function active
|
---|
| 2665 | % end
|
---|
| 2666 | % end
|
---|
| 2667 | set(handles.edit_vect,'enable','on')
|
---|
| 2668 | set(handles.edit,'enable','on')
|
---|
| 2669 | set(handles.create,'enable','on')
|
---|
| 2670 | % set(handles.LINE,'enable','on')
|
---|
| 2671 | % set(handles.PATCH,'enable','on')
|
---|
| 2672 | % set(handles.PLANE,'enable','on')
|
---|
| 2673 | % set(handles.VOLUME,'enable','on')
|
---|
| 2674 | %set(handles.makemask,'enable','on')
|
---|
| 2675 | hh=findobj(handles.axes3,'Tag','calib_points');
|
---|
| 2676 | if ~isempty(hh)
|
---|
| 2677 | delete(hh)
|
---|
| 2678 | end
|
---|
| 2679 | hhh=findobj(handles.axes3,'Tag','calib_marker');
|
---|
| 2680 | if ~isempty(hhh)
|
---|
| 2681 | delete(hhh)
|
---|
| 2682 | end
|
---|
| 2683 | end
|
---|
| 2684 | set(huvmat,'UserData',UvData);
|
---|
| 2685 |
|
---|
| 2686 | %-------------------------------------------------------------
|
---|
| 2687 | % --- Executes on selection change in transform_fct.
|
---|
| 2688 | function transform_fct_Callback(hObject, eventdata, handles)
|
---|
| 2689 | %-------------------------------------------------------------
|
---|
| 2690 | global nb_builtin
|
---|
| 2691 |
|
---|
| 2692 | huvmat=get(handles.transform_fct,'parent');
|
---|
| 2693 | menu=get(handles.transform_fct,'String');
|
---|
| 2694 | ind_coord=get(handles.transform_fct,'Value');
|
---|
| 2695 | coord_option=menu{ind_coord};
|
---|
| 2696 | list_transform=get(handles.transform_fct,'UserData');
|
---|
| 2697 | ff=functions(list_transform{end});
|
---|
| 2698 | if isequal(coord_option,'more...');
|
---|
| 2699 | coord_fct='';
|
---|
| 2700 |
|
---|
| 2701 | % if exist(profil_perso,'file')
|
---|
| 2702 | % h=load (profil_perso);
|
---|
| 2703 | % if isfield(h,'transform_fct')
|
---|
| 2704 | % transform_fct=h.transform_fct;
|
---|
| 2705 | % end
|
---|
| 2706 | % end
|
---|
| 2707 | prompt = {'Enter the name of the transform function'};
|
---|
| 2708 | dlg_title = 'user defined transform';
|
---|
| 2709 | num_lines= 1;
|
---|
| 2710 | [FileName, PathName, filterindex] = uigetfile( ...
|
---|
| 2711 | {'*.m', ' (*.m)';
|
---|
| 2712 | '*.m', '.m files '; ...
|
---|
| 2713 | '*.*', 'All Files (*.*)'}, ...
|
---|
| 2714 | 'Pick a file', ff.file);
|
---|
| 2715 | if isequal(PathName(end),'/')||isequal(PathName(end),'\')
|
---|
| 2716 | PathName(end)=[];
|
---|
| 2717 | end
|
---|
| 2718 | transform_selected =fullfile(PathName,FileName);
|
---|
| 2719 | if ~exist(transform_selected,'file')
|
---|
| 2720 | % msgbox_view_field('ERROR',['procesing fct ' transform_selected ' not found'])
|
---|
| 2721 | return
|
---|
| 2722 | end
|
---|
| 2723 | [ppp,transform,ext_fct]=fileparts(FileName);% removes extension .m
|
---|
| 2724 | if ~isequal(ext_fct,'.m')
|
---|
| 2725 | msgbox_view_field('ERROR','a Matlab function .m must be introduced');
|
---|
| 2726 | return
|
---|
| 2727 | end
|
---|
| 2728 | menu=update_menu(handles.transform_fct,transform);%add the selected fct to the menu
|
---|
| 2729 | ind_coord=get(handles.transform_fct,'Value');
|
---|
| 2730 | addpath(PathName)
|
---|
| 2731 | list_transform{ind_coord}=str2func(transform);% create the function handle corresponding to the newly seleced function
|
---|
| 2732 | set(handles.transform_fct,'UserData',list_transform)
|
---|
| 2733 | rmpath(PathName)
|
---|
| 2734 | % save the new menu in the personal file 'view_field_perso.mat'
|
---|
| 2735 | dir_perso=prefdir;%personal Matalb directory
|
---|
| 2736 | profil_perso=fullfile(dir_perso,'view_field_perso.mat');
|
---|
| 2737 | if exist(profil_perso,'file')
|
---|
| 2738 | for ilist=nb_builtin+1:numel(list_transform)
|
---|
| 2739 | ff=functions(list_transform{ilist});
|
---|
| 2740 | transform_fct{ilist-nb_builtin}=ff.file;
|
---|
| 2741 | end
|
---|
| 2742 | save (profil_perso,'transform_fct','-append'); %store the root name for future opening of view_field
|
---|
| 2743 | end
|
---|
| 2744 | end
|
---|
| 2745 |
|
---|
| 2746 | %check the current path to the selected function
|
---|
| 2747 | if isa(list_transform{ind_coord},'function_handle')
|
---|
| 2748 | func=functions(list_transform{ind_coord});
|
---|
| 2749 | set(handles.path_transform,'String',fileparts(func.file)); %show the path to the senlected function
|
---|
| 2750 | else
|
---|
| 2751 | set(handles.path_transform,'String','')
|
---|
| 2752 | end
|
---|
| 2753 | %CurrentPath=fileparts(which(coord_option));
|
---|
| 2754 | % if ~isequal(PathName,CurrentPath)
|
---|
| 2755 | % addpath(PathName)
|
---|
| 2756 | % errormsg=check_functions;
|
---|
| 2757 | % msgbox_view_field('WARNING',[['path ' PathName ' added to the current Matlab pathes'];errormsg])
|
---|
| 2758 | % end
|
---|
| 2759 | %set(handles.path_transform,'String',fullfile(PathName,' ')); %show the path to the senlected function
|
---|
| 2760 | set(handles.FixedLimits,'Value',0)
|
---|
| 2761 | set(handles.FixedLimits,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2762 |
|
---|
| 2763 | UvData=get(huvmat,'UserData');
|
---|
| 2764 |
|
---|
| 2765 | %delete drawn objects
|
---|
| 2766 | hother=findobj('Tag','proj_object');%find all the proj objects
|
---|
| 2767 | for iobj=1:length(hother)
|
---|
| 2768 | delete_object(hother(iobj))
|
---|
| 2769 | end
|
---|
| 2770 | hother=findobj('Tag','DeformPoint');%find all the proj objects
|
---|
| 2771 | for iobj=1:length(hother)
|
---|
| 2772 | delete_object(hother(iobj))
|
---|
| 2773 | end
|
---|
| 2774 | hh=findobj('Tag','calib_points');
|
---|
| 2775 | if ~isempty(hh)
|
---|
| 2776 | delete(hh)
|
---|
| 2777 | end
|
---|
| 2778 | hhh=findobj('Tag','calib_marker');
|
---|
| 2779 | if ~isempty(hhh)
|
---|
| 2780 | delete(hhh)
|
---|
| 2781 | end
|
---|
| 2782 | if isfield(UvData,'Object')
|
---|
| 2783 | nbobject=length(UvData.Object);
|
---|
| 2784 | UvData.Object([2:nbobject])=[];
|
---|
| 2785 | end
|
---|
| 2786 |
|
---|
| 2787 | %delete mask if it is displayed
|
---|
| 2788 | if isequal(get(handles.mask_test,'Value'),1)%if the mask option is on
|
---|
| 2789 | UvData=rmfield(UvData,'MaskName'); %will impose mask refresh
|
---|
| 2790 | end
|
---|
| 2791 | set(huvmat,'UserData',UvData)
|
---|
| 2792 | run0_Callback(hObject, eventdata, handles)
|
---|
| 2793 |
|
---|
| 2794 | %--------------------------------------------
|
---|
| 2795 | function histo1_menu_Callback(hObject, eventdata, handles)
|
---|
| 2796 | %--------------------------------------------
|
---|
| 2797 | %plot first histo
|
---|
| 2798 | huvmat=get(handles.histo1_menu,'parent');
|
---|
| 2799 | histo_menu=get(handles.histo1_menu,'String');
|
---|
| 2800 | histo_value=get(handles.histo1_menu,'Value');
|
---|
| 2801 | FieldName=histo_menu{histo_value};
|
---|
| 2802 | UvData=get(huvmat,'UserData');
|
---|
| 2803 | update_histo(handles.histo_u,huvmat,FieldName)
|
---|
| 2804 |
|
---|
| 2805 | %----------------------------------------------
|
---|
| 2806 | function histo2_menu_Callback(hObject, eventdata, handles)
|
---|
| 2807 | %----------------------------------------------
|
---|
| 2808 | %plot second histo
|
---|
| 2809 | huvmat=get(handles.histo2_menu,'parent');
|
---|
| 2810 | histo_menu=get(handles.histo2_menu,'String');
|
---|
| 2811 | histo_value=get(handles.histo2_menu,'Value');
|
---|
| 2812 | FieldName=histo_menu{histo_value};
|
---|
| 2813 | UvData=get(huvmat,'UserData');
|
---|
| 2814 | update_histo(handles.histo_v,huvmat,FieldName)
|
---|
| 2815 |
|
---|
| 2816 |
|
---|
| 2817 | %--------------------------------------------
|
---|
| 2818 | %read the field .Fieldname stored in UvData and plot its histogram
|
---|
| 2819 | function update_histo(haxes,huvmat,FieldName)
|
---|
| 2820 | UvData=get(huvmat,'UserData');
|
---|
| 2821 |
|
---|
| 2822 | if ~isfield(UvData.Field,FieldName)
|
---|
| 2823 | msgbox_view_field('ERROR',['no field ' FieldName ' for histogram'])
|
---|
| 2824 | return
|
---|
| 2825 | end
|
---|
| 2826 | Field=UvData.Field;
|
---|
| 2827 | FieldHisto=eval(['Field.' FieldName]);
|
---|
| 2828 | if isfield(Field,'FF') & ~isempty(Field.FF) & isequal(size(Field.FF),size(FieldHisto))
|
---|
| 2829 | indsel=find(Field.FF==0);%find values marked as false
|
---|
| 2830 | if ~isempty(indsel)
|
---|
| 2831 | FieldHisto=FieldHisto(indsel);
|
---|
| 2832 | end
|
---|
| 2833 | end
|
---|
| 2834 | if isempty(Field)
|
---|
| 2835 | msgbox_view_field('ERROR',['empty field ' FieldName])
|
---|
| 2836 | else
|
---|
| 2837 | nxy=size(FieldHisto);
|
---|
| 2838 | Amin=double(min(min(min(FieldHisto))));%min of image
|
---|
| 2839 | Amax=double(max(max(max(FieldHisto))));%max of image
|
---|
| 2840 | if isequal(Amin,Amax)
|
---|
| 2841 | Histo.Txt=['uniform field =' num2str(Amin)];
|
---|
| 2842 | else
|
---|
| 2843 | Histo.ListVarName={FieldName,'histo'};
|
---|
| 2844 | if numel(nxy)==2
|
---|
| 2845 | Histo.VarDimName={FieldName,FieldName}; %dimensions for the histogram
|
---|
| 2846 | else %color images
|
---|
| 2847 | Histo.VarDimName={FieldName,{FieldName,'rgb'}}; %dimensions for the histogram
|
---|
| 2848 | end
|
---|
| 2849 | %unit
|
---|
| 2850 | units=[]; %default
|
---|
| 2851 | for ivar=1:numel(Field.ListVarName)
|
---|
| 2852 | if strcmp(Field.ListVarName{ivar},FieldName)
|
---|
| 2853 | if isfield(Field,'VarAttribute') && numel(Field.VarAttribute)>=ivar && isfield(Field.VarAttribute{ivar},'units')
|
---|
| 2854 | units=Field.VarAttribute{ivar}.units;
|
---|
| 2855 | break
|
---|
| 2856 | end
|
---|
| 2857 | end
|
---|
| 2858 | end
|
---|
| 2859 | if ~isempty(units)
|
---|
| 2860 | Histo.VarAttribute{1}.units=units;
|
---|
| 2861 | end
|
---|
| 2862 | eval(['Histo.' FieldName '=linspace(Amin,Amax,50);'])%absissa values for histo
|
---|
| 2863 | for col=1:size(FieldHisto,3)
|
---|
| 2864 | B=FieldHisto(:,:,col);
|
---|
| 2865 | C=reshape(double(B),1,nxy(1)*nxy(2));% reshape in a vector
|
---|
| 2866 | eval(['Histo.histo(:,col)=hist(C, Histo.' FieldName ');']); %calculate histogram
|
---|
| 2867 | end
|
---|
| 2868 | set(haxes,'XLimMode','auto')%reset auto mode (after zoom effect)
|
---|
| 2869 | set(haxes,'YLimMode','auto')
|
---|
| 2870 | plot_field(Histo,haxes);
|
---|
| 2871 | end
|
---|
| 2872 | end
|
---|
| 2873 |
|
---|
| 2874 |
|
---|
| 2875 |
|
---|
| 2876 | %------------------------------------------------
|
---|
| 2877 | %CALLBACKS FOR PLOTTING PARAMETERS
|
---|
| 2878 | %-------------------------------------------------
|
---|
| 2879 |
|
---|
| 2880 | %-----------------------------------------------------------------
|
---|
| 2881 | function MinA_Callback(hObject, eventdata, handles)
|
---|
| 2882 | %------------------------------------------
|
---|
| 2883 | set(handles.AutoScal,'Value',1) %suppress auto mode
|
---|
| 2884 | set(handles.AutoScal,'BackgroundColor',[1 1 0])
|
---|
| 2885 | update_plot(handles)
|
---|
| 2886 |
|
---|
| 2887 | %-----------------------------------------------------------------
|
---|
| 2888 | function MaxA_Callback(hObject, eventdata, handles)
|
---|
| 2889 | %--------------------------------------------
|
---|
| 2890 | set(handles.AutoScal,'Value',1) %suppress auto mode
|
---|
| 2891 | set(handles.AutoScal,'BackgroundColor',[1 1 0])
|
---|
| 2892 | update_plot(handles)
|
---|
| 2893 |
|
---|
| 2894 | %-----------------------------------------------
|
---|
| 2895 | function AutoScal_Callback(hObject, eventdata, handles)
|
---|
| 2896 | %--------------------------------------------
|
---|
| 2897 | test=get(handles.AutoScal,'Value');
|
---|
| 2898 | if test
|
---|
| 2899 | set(handles.AutoScal,'BackgroundColor',[1 1 0])
|
---|
| 2900 | else
|
---|
| 2901 | set(handles.AutoScal,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2902 | update_plot(handles);
|
---|
| 2903 | % set(handles.MinA,'String',num2str(ScalOut.MinA,3))
|
---|
| 2904 | % set(handles.MaxA,'String',num2str(ScalOut.MaxA,3))
|
---|
| 2905 | end
|
---|
| 2906 |
|
---|
| 2907 | %-------------------------------------------------------------------
|
---|
| 2908 | function BW_Callback(hObject, eventdata, handles)
|
---|
| 2909 | %-------------------------------------------------------------------
|
---|
| 2910 | update_plot(handles)
|
---|
| 2911 |
|
---|
| 2912 | %-------------------------------------------------------------------
|
---|
| 2913 | function Contours_Callback(hObject, eventdata, handles)
|
---|
| 2914 | %-------------------------------------------------------------------
|
---|
| 2915 | val=get(handles.Contours,'Value');
|
---|
| 2916 | if val==2
|
---|
| 2917 | set(handles.interval_txt,'Visible','on')
|
---|
| 2918 | set(handles.IncrA,'Visible','on')
|
---|
| 2919 | else
|
---|
| 2920 | set(handles.interval_txt,'Visible','off')
|
---|
| 2921 | set(handles.IncrA,'Visible','off')
|
---|
| 2922 | end
|
---|
| 2923 | update_plot(handles)
|
---|
| 2924 |
|
---|
| 2925 | %-------------------------------------------------------------------
|
---|
| 2926 | function IncrA_Callback(hObject, eventdata, handles)
|
---|
| 2927 | %-------------------------------------------------------------------
|
---|
| 2928 | update_plot(handles)
|
---|
| 2929 |
|
---|
| 2930 | %-------------------------------------------------------------------
|
---|
| 2931 | function HideWarning_Callback(hObject, eventdata, handles)
|
---|
| 2932 | %-------------------------------------------------------------------
|
---|
| 2933 | update_plot(handles)
|
---|
| 2934 |
|
---|
| 2935 | %-------------------------------------------------------------------
|
---|
| 2936 | function HideFalse_Callback(hObject, eventdata, handles)
|
---|
| 2937 | %-------------------------------------------------------------------
|
---|
| 2938 | update_plot(handles)
|
---|
| 2939 |
|
---|
| 2940 | %-------------------------------------------------------------------
|
---|
| 2941 | function VecScale_Callback(hObject, eventdata, handles)
|
---|
| 2942 | %-------------------------------------------------------------------
|
---|
| 2943 | set(handles.AutoVec,'Value',1);
|
---|
| 2944 | set(handles.AutoVec,'BackgroundColor',[1 1 0])
|
---|
| 2945 | update_plot(handles)
|
---|
| 2946 |
|
---|
| 2947 | %-------------------------------------------------------------------
|
---|
| 2948 | function AutoVec_Callback(hObject, eventdata, handles)
|
---|
| 2949 | %-------------------------------------------------------------------
|
---|
| 2950 | test=get(handles.AutoVec,'Value');
|
---|
| 2951 | if test
|
---|
| 2952 | set(handles.AutoVec,'BackgroundColor',[1 1 0])
|
---|
| 2953 | else
|
---|
| 2954 | update_plot(handles);
|
---|
| 2955 | %set(handles.VecScale,'String',num2str(ScalOut.VecScale,3))
|
---|
| 2956 | set(handles.AutoVec,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2957 | end
|
---|
| 2958 |
|
---|
| 2959 | %-------------------------------------------------------
|
---|
| 2960 | % --- Executes on selection change in decimate4 (nb_vec/4).
|
---|
| 2961 | %-------------------------------------------------------
|
---|
| 2962 | function decimate4_Callback(hObject, eventdata, handles)
|
---|
| 2963 | update_plot(handles)
|
---|
| 2964 |
|
---|
| 2965 |
|
---|
| 2966 | %-------------------------------------------------------
|
---|
| 2967 | % --- Executes on selection change in color_code menu
|
---|
| 2968 | %-------------------------------------------------------
|
---|
| 2969 | function color_code_Callback(hObject, eventdata, handles)
|
---|
| 2970 | set_vec_col_bar(handles)
|
---|
| 2971 | update_plot(handles);
|
---|
| 2972 |
|
---|
| 2973 | %-------------------------------------------------------
|
---|
| 2974 | % --- Executes on button press in AutoVecColor.
|
---|
| 2975 | %-------------------------------------------------------
|
---|
| 2976 | function AutoVecColor_Callback(hObject, eventdata, handles)
|
---|
| 2977 | test=get(handles.AutoVecColor,'Value');
|
---|
| 2978 | if test
|
---|
| 2979 | set(handles.AutoVecColor,'BackgroundColor',[1 1 0])
|
---|
| 2980 | else
|
---|
| 2981 | update_plot(handles);
|
---|
| 2982 | %set(handles.VecScale,'String',num2str(ScalOut.VecScale,3))
|
---|
| 2983 | set(handles.AutoVecColor,'BackgroundColor',[0.7 0.7 0.7])
|
---|
| 2984 | end
|
---|
| 2985 | %set_vec_col_bar(handles)
|
---|
| 2986 |
|
---|
| 2987 | %-------------------------------------------------------
|
---|
| 2988 | % --- Executes on selection change in max_vec.
|
---|
| 2989 | %-------------------------------------------------------
|
---|
| 2990 | function min_vec_Callback(hObject, eventdata, handles)
|
---|
| 2991 | max_vec_Callback(hObject, eventdata, handles)
|
---|
| 2992 |
|
---|
| 2993 | % --- Executes on selection change in max_vec.
|
---|
| 2994 | function max_vec_Callback(hObject, eventdata, handles)
|
---|
| 2995 | set(handles.AutoVecColor,'Value',1)
|
---|
| 2996 | AutoVecColor_Callback(hObject, eventdata, handles)
|
---|
| 2997 | min_val=str2num(get(handles.min_vec,'String'));
|
---|
| 2998 | max_val=str2num(get(handles.max_vec,'String'));
|
---|
| 2999 | slider1=get(handles.slider1,'Value');
|
---|
| 3000 | slider2=get(handles.slider2,'Value');
|
---|
| 3001 | colcode1=min_val+(max_val-min_val)*slider1;
|
---|
| 3002 | colcode2=min_val+(max_val-min_val)*slider2;
|
---|
| 3003 | set(handles.colcode1,'String',num2str(colcode1))
|
---|
| 3004 | set(handles.colcode2,'String',num2str(colcode2))
|
---|
| 3005 | update_plot(handles);
|
---|
| 3006 |
|
---|
| 3007 | %-------------------------------------------------------------------
|
---|
| 3008 | %update the display of color code for vectors
|
---|
| 3009 | function set_vec_col_bar(handles)
|
---|
| 3010 | %-------------------------------------------------------------------
|
---|
| 3011 | %get the image of the color display button 'vec_col_bar' in pixels
|
---|
| 3012 | set(handles.vec_col_bar,'Unit','pixel');
|
---|
| 3013 | pos_vert=get(handles.vec_col_bar,'Position');
|
---|
| 3014 | set(handles.vec_col_bar,'Unit','Normalized');
|
---|
| 3015 | width=ceil(pos_vert(3));
|
---|
| 3016 | height=ceil(pos_vert(4));
|
---|
| 3017 |
|
---|
| 3018 | %get slider indications
|
---|
| 3019 | list=get(handles.color_code,'String');
|
---|
| 3020 | ichoice=get(handles.color_code,'Value');
|
---|
| 3021 | colcode.ColorCode=list{ichoice};
|
---|
| 3022 | colcode.MinC=str2num(get(handles.min_vec,'String'));
|
---|
| 3023 | colcode.MaxC=str2num(get(handles.max_vec,'String'));
|
---|
| 3024 | test3color=strcmp(colcode.ColorCode,'rgb') || strcmp(colcode.ColorCode,'bgr');
|
---|
| 3025 | if test3color
|
---|
| 3026 | colcode.colcode1=str2num(get(handles.colcode1,'String'));
|
---|
| 3027 | colcode.colcode2=str2num(get(handles.colcode2,'String'));
|
---|
| 3028 | end
|
---|
| 3029 | % colcode.option=get(handles.vec_col_bar,'Value');
|
---|
| 3030 | colcode.FixedCbounds=0;
|
---|
| 3031 | % list_code=get(handles.col_vec,'String');% list menu fields
|
---|
| 3032 | % index_code=get(handles.col_vec,'Value');% selected string index
|
---|
| 3033 | % colcode.CName= list_code{index_code(1)}; % selected field used for vector color
|
---|
| 3034 | colcode.FixedCbounds=1;
|
---|
| 3035 | vec_C=colcode.MinC+(colcode.MaxC-colcode.MinC)*[0.5:width-0.5]/width;%sample of vec_C values from min to max
|
---|
| 3036 | [colorlist,col_vec]=set_col_vec(colcode,vec_C);
|
---|
| 3037 | oneheight=ones(1,height);
|
---|
| 3038 | A1=colorlist(col_vec,1)*oneheight;
|
---|
| 3039 | A2=colorlist(col_vec,2)*oneheight;
|
---|
| 3040 | A3=colorlist(col_vec,3)*oneheight;
|
---|
| 3041 | A(:,:,1)=A1';
|
---|
| 3042 | A(:,:,2)=A2';
|
---|
| 3043 | A(:,:,3)=A3';
|
---|
| 3044 | set(handles.vec_col_bar,'Cdata',A)
|
---|
| 3045 |
|
---|
| 3046 |
|
---|
| 3047 | %-------------------------------------------------------------------
|
---|
| 3048 | function [PlotType,ScalOut]=update_plot(handles)
|
---|
| 3049 | %-------------------------------------------------------------------
|
---|
| 3050 | haxes= handles.axes3;
|
---|
| 3051 | AxeData=get(haxes,'UserData');
|
---|
| 3052 | PlotParam=read_plot_param(handles);
|
---|
| 3053 | [PlotType,PlotParamOut]= plot_field(AxeData,haxes,PlotParam,1);
|
---|
| 3054 | write_plot_param(handles,PlotParamOut); %update the auto plot parameters
|
---|
| 3055 |
|
---|
| 3056 |
|
---|
| 3057 |
|
---|
| 3058 | %------------------------------------------------------
|
---|
| 3059 | % --- Executes on button press in Menu/Export/field in workspace.
|
---|
| 3060 | %------------------------------------------------------
|
---|
| 3061 | function MenuExportField_Callback(hObject, eventdata, handles)
|
---|
| 3062 |
|
---|
| 3063 | global CurData
|
---|
| 3064 | huvmat=findobj(allchild(0),'Name','uvmat');
|
---|
| 3065 | CurData=get(huvmat,'UserData');
|
---|
| 3066 | evalin('base','global CurData')%make CurData global in the workspace
|
---|
| 3067 | display(['UserData of view_field :'])
|
---|
| 3068 | evalin('base','CurData') %display CurData in the workspace
|
---|
| 3069 | commandwindow;
|
---|
| 3070 |
|
---|
| 3071 | %------------------------------------------------------
|
---|
| 3072 | % --- Executes on button press in Menu/Export/extract figure.
|
---|
| 3073 | %------------------------------------------------------
|
---|
| 3074 | function MenuExport_plot_Callback(hObject, eventdata, handles)
|
---|
| 3075 | huvmat=get(handles.MenuExport_plot,'parent');
|
---|
| 3076 | UvData=get(huvmat,'UserData');
|
---|
| 3077 | hfig=figure;
|
---|
| 3078 | newaxes=copyobj(handles.axes3,hfig);
|
---|
| 3079 | map=colormap(handles.axes3);
|
---|
| 3080 | colormap(map);%transmit the current colormap to the zoom fig
|
---|
| 3081 | colorbar
|
---|
| 3082 |
|
---|
| 3083 |
|
---|
| 3084 |
|
---|
| 3085 | function edit84_Callback(hObject, eventdata, handles)
|
---|
| 3086 | % hObject handle to edit84 (see GCBO)
|
---|
| 3087 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3088 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3089 |
|
---|
| 3090 | % Hints: get(hObject,'String') returns contents of edit84 as text
|
---|
| 3091 | % str2double(get(hObject,'String')) returns contents of edit84 as a double
|
---|
| 3092 |
|
---|
| 3093 |
|
---|
| 3094 | % --- Executes during object creation, after setting all properties.
|
---|
| 3095 | function edit84_CreateFcn(hObject, eventdata, handles)
|
---|
| 3096 | % hObject handle to edit84 (see GCBO)
|
---|
| 3097 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3098 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3099 |
|
---|
| 3100 | % Hint: edit controls usually have a white background on Windows.
|
---|
| 3101 | % See ISPC and COMPUTER.
|
---|
| 3102 | if ispc && isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3103 | set(hObject,'BackgroundColor','white');
|
---|
| 3104 | end
|
---|
| 3105 |
|
---|
| 3106 |
|
---|
| 3107 |
|
---|
| 3108 | function edit85_Callback(hObject, eventdata, handles)
|
---|
| 3109 | % hObject handle to edit85 (see GCBO)
|
---|
| 3110 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3111 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3112 |
|
---|
| 3113 | % Hints: get(hObject,'String') returns contents of edit85 as text
|
---|
| 3114 | % str2double(get(hObject,'String')) returns contents of edit85 as a double
|
---|
| 3115 |
|
---|
| 3116 |
|
---|
| 3117 | % --- Executes during object creation, after setting all properties.
|
---|
| 3118 | function edit85_CreateFcn(hObject, eventdata, handles)
|
---|
| 3119 | % hObject handle to edit85 (see GCBO)
|
---|
| 3120 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3121 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3122 |
|
---|
| 3123 | % Hint: edit controls usually have a white background on Windows.
|
---|
| 3124 | % See ISPC and COMPUTER.
|
---|
| 3125 | if ispc && isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3126 | set(hObject,'BackgroundColor','white');
|
---|
| 3127 | end
|
---|
| 3128 |
|
---|
| 3129 |
|
---|
| 3130 |
|
---|
| 3131 | function edit86_Callback(hObject, eventdata, handles)
|
---|
| 3132 | % hObject handle to edit86 (see GCBO)
|
---|
| 3133 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3134 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3135 |
|
---|
| 3136 | % Hints: get(hObject,'String') returns contents of edit86 as text
|
---|
| 3137 | % str2double(get(hObject,'String')) returns contents of edit86 as a double
|
---|
| 3138 |
|
---|
| 3139 |
|
---|
| 3140 | % --- Executes during object creation, after setting all properties.
|
---|
| 3141 | function edit86_CreateFcn(hObject, eventdata, handles)
|
---|
| 3142 | % hObject handle to edit86 (see GCBO)
|
---|
| 3143 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3144 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3145 |
|
---|
| 3146 | % Hint: edit controls usually have a white background on Windows.
|
---|
| 3147 | % See ISPC and COMPUTER.
|
---|
| 3148 | if ispc && isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3149 | set(hObject,'BackgroundColor','white');
|
---|
| 3150 | end
|
---|
| 3151 |
|
---|
| 3152 |
|
---|
| 3153 |
|
---|
| 3154 | function edit87_Callback(hObject, eventdata, handles)
|
---|
| 3155 | % hObject handle to edit87 (see GCBO)
|
---|
| 3156 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3157 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3158 |
|
---|
| 3159 | % Hints: get(hObject,'String') returns contents of edit87 as text
|
---|
| 3160 | % str2double(get(hObject,'String')) returns contents of edit87 as a double
|
---|
| 3161 |
|
---|
| 3162 |
|
---|
| 3163 | % --- Executes during object creation, after setting all properties.
|
---|
| 3164 | function edit87_CreateFcn(hObject, eventdata, handles)
|
---|
| 3165 | % hObject handle to edit87 (see GCBO)
|
---|
| 3166 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3167 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3168 |
|
---|
| 3169 | % Hint: edit controls usually have a white background on Windows.
|
---|
| 3170 | % See ISPC and COMPUTER.
|
---|
| 3171 | if ispc && isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3172 | set(hObject,'BackgroundColor','white');
|
---|
| 3173 | end
|
---|
| 3174 |
|
---|
| 3175 |
|
---|
| 3176 | % --- Executes on button press in checkbox39.
|
---|
| 3177 | function checkbox39_Callback(hObject, eventdata, handles)
|
---|
| 3178 | % hObject handle to checkbox39 (see GCBO)
|
---|
| 3179 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3180 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3181 |
|
---|
| 3182 | % Hint: get(hObject,'Value') returns toggle state of checkbox39
|
---|
| 3183 |
|
---|
| 3184 |
|
---|
| 3185 |
|
---|
| 3186 | function edit88_Callback(hObject, eventdata, handles)
|
---|
| 3187 | % hObject handle to edit88 (see GCBO)
|
---|
| 3188 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3189 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3190 |
|
---|
| 3191 | % Hints: get(hObject,'String') returns contents of edit88 as text
|
---|
| 3192 | % str2double(get(hObject,'String')) returns contents of edit88 as a double
|
---|
| 3193 |
|
---|
| 3194 |
|
---|
| 3195 | % --- Executes during object creation, after setting all properties.
|
---|
| 3196 | function edit88_CreateFcn(hObject, eventdata, handles)
|
---|
| 3197 | % hObject handle to edit88 (see GCBO)
|
---|
| 3198 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3199 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3200 |
|
---|
| 3201 | % Hint: edit controls usually have a white background on Windows.
|
---|
| 3202 | % See ISPC and COMPUTER.
|
---|
| 3203 | if ispc && isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3204 | set(hObject,'BackgroundColor','white');
|
---|
| 3205 | end
|
---|
| 3206 |
|
---|
| 3207 |
|
---|
| 3208 | % --- Executes on button press in checkbox40.
|
---|
| 3209 | function checkbox40_Callback(hObject, eventdata, handles)
|
---|
| 3210 | % hObject handle to checkbox40 (see GCBO)
|
---|
| 3211 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3212 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3213 |
|
---|
| 3214 | % Hint: get(hObject,'Value') returns toggle state of checkbox40
|
---|
| 3215 |
|
---|
| 3216 |
|
---|
| 3217 |
|
---|
| 3218 | function edit82_Callback(hObject, eventdata, handles)
|
---|
| 3219 | % hObject handle to edit82 (see GCBO)
|
---|
| 3220 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3221 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3222 |
|
---|
| 3223 | % Hints: get(hObject,'String') returns contents of edit82 as text
|
---|
| 3224 | % str2double(get(hObject,'String')) returns contents of edit82 as a double
|
---|
| 3225 |
|
---|
| 3226 |
|
---|
| 3227 | % --- Executes during object creation, after setting all properties.
|
---|
| 3228 | function edit82_CreateFcn(hObject, eventdata, handles)
|
---|
| 3229 | % hObject handle to edit82 (see GCBO)
|
---|
| 3230 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3231 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3232 |
|
---|
| 3233 | % Hint: edit controls usually have a white background on Windows.
|
---|
| 3234 | % See ISPC and COMPUTER.
|
---|
| 3235 | if ispc && isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3236 | set(hObject,'BackgroundColor','white');
|
---|
| 3237 | end
|
---|
| 3238 |
|
---|
| 3239 |
|
---|
| 3240 |
|
---|
| 3241 | function edit83_Callback(hObject, eventdata, handles)
|
---|
| 3242 | % hObject handle to edit83 (see GCBO)
|
---|
| 3243 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3244 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3245 |
|
---|
| 3246 | % Hints: get(hObject,'String') returns contents of edit83 as text
|
---|
| 3247 | % str2double(get(hObject,'String')) returns contents of edit83 as a double
|
---|
| 3248 |
|
---|
| 3249 |
|
---|
| 3250 | % --- Executes during object creation, after setting all properties.
|
---|
| 3251 | function edit83_CreateFcn(hObject, eventdata, handles)
|
---|
| 3252 | % hObject handle to edit83 (see GCBO)
|
---|
| 3253 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3254 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3255 |
|
---|
| 3256 | % Hint: edit controls usually have a white background on Windows.
|
---|
| 3257 | % See ISPC and COMPUTER.
|
---|
| 3258 | if ispc && isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3259 | set(hObject,'BackgroundColor','white');
|
---|
| 3260 | end
|
---|
| 3261 |
|
---|
| 3262 |
|
---|
| 3263 | % --- Executes on slider movement.
|
---|
| 3264 | function slider9_Callback(hObject, eventdata, handles)
|
---|
| 3265 | % hObject handle to slider9 (see GCBO)
|
---|
| 3266 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3267 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3268 |
|
---|
| 3269 | % Hints: get(hObject,'Value') returns position of slider
|
---|
| 3270 | % get(hObject,'Min') and get(hObject,'Max') to determine range of slider
|
---|
| 3271 |
|
---|
| 3272 |
|
---|
| 3273 | % --- Executes during object creation, after setting all properties.
|
---|
| 3274 | function slider9_CreateFcn(hObject, eventdata, handles)
|
---|
| 3275 | % hObject handle to slider9 (see GCBO)
|
---|
| 3276 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3277 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3278 |
|
---|
| 3279 | % Hint: slider controls usually have a light gray background.
|
---|
| 3280 | if isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3281 | set(hObject,'BackgroundColor',[.9 .9 .9]);
|
---|
| 3282 | end
|
---|
| 3283 |
|
---|
| 3284 |
|
---|
| 3285 | % --- Executes on slider movement.
|
---|
| 3286 | function slider10_Callback(hObject, eventdata, handles)
|
---|
| 3287 | % hObject handle to slider10 (see GCBO)
|
---|
| 3288 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3289 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3290 |
|
---|
| 3291 | % Hints: get(hObject,'Value') returns position of slider
|
---|
| 3292 | % get(hObject,'Min') and get(hObject,'Max') to determine range of slider
|
---|
| 3293 |
|
---|
| 3294 |
|
---|
| 3295 | % --- Executes during object creation, after setting all properties.
|
---|
| 3296 | function slider10_CreateFcn(hObject, eventdata, handles)
|
---|
| 3297 | % hObject handle to slider10 (see GCBO)
|
---|
| 3298 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3299 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3300 |
|
---|
| 3301 | % Hint: slider controls usually have a light gray background.
|
---|
| 3302 | if isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3303 | set(hObject,'BackgroundColor',[.9 .9 .9]);
|
---|
| 3304 | end
|
---|
| 3305 |
|
---|
| 3306 |
|
---|
| 3307 | % --- Executes on button press in checkbox41.
|
---|
| 3308 | function checkbox41_Callback(hObject, eventdata, handles)
|
---|
| 3309 | % hObject handle to checkbox41 (see GCBO)
|
---|
| 3310 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3311 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3312 |
|
---|
| 3313 | % Hint: get(hObject,'Value') returns toggle state of checkbox41
|
---|
| 3314 |
|
---|
| 3315 |
|
---|
| 3316 |
|
---|
| 3317 | function edit89_Callback(hObject, eventdata, handles)
|
---|
| 3318 | % hObject handle to edit89 (see GCBO)
|
---|
| 3319 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3320 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3321 |
|
---|
| 3322 | % Hints: get(hObject,'String') returns contents of edit89 as text
|
---|
| 3323 | % str2double(get(hObject,'String')) returns contents of edit89 as a double
|
---|
| 3324 |
|
---|
| 3325 |
|
---|
| 3326 | % --- Executes during object creation, after setting all properties.
|
---|
| 3327 | function edit89_CreateFcn(hObject, eventdata, handles)
|
---|
| 3328 | % hObject handle to edit89 (see GCBO)
|
---|
| 3329 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3330 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3331 |
|
---|
| 3332 | % Hint: edit controls usually have a white background on Windows.
|
---|
| 3333 | % See ISPC and COMPUTER.
|
---|
| 3334 | if ispc && isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3335 | set(hObject,'BackgroundColor','white');
|
---|
| 3336 | end
|
---|
| 3337 |
|
---|
| 3338 |
|
---|
| 3339 |
|
---|
| 3340 | function edit90_Callback(hObject, eventdata, handles)
|
---|
| 3341 | % hObject handle to edit90 (see GCBO)
|
---|
| 3342 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3343 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3344 |
|
---|
| 3345 | % Hints: get(hObject,'String') returns contents of edit90 as text
|
---|
| 3346 | % str2double(get(hObject,'String')) returns contents of edit90 as a double
|
---|
| 3347 |
|
---|
| 3348 |
|
---|
| 3349 | % --- Executes during object creation, after setting all properties.
|
---|
| 3350 | function edit90_CreateFcn(hObject, eventdata, handles)
|
---|
| 3351 | % hObject handle to edit90 (see GCBO)
|
---|
| 3352 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3353 | % handles empty - handles not created until after all CreateFcns called
|
---|
| 3354 |
|
---|
| 3355 | % Hint: edit controls usually have a white background on Windows.
|
---|
| 3356 | % See ISPC and COMPUTER.
|
---|
| 3357 | if ispc && isequal(get(hObject,'BackgroundColor'), get(0,'defaultUicontrolBackgroundColor'))
|
---|
| 3358 | set(hObject,'BackgroundColor','white');
|
---|
| 3359 | end
|
---|
| 3360 |
|
---|
| 3361 |
|
---|
| 3362 | % --- Executes on button press in pushbutton35.
|
---|
| 3363 | function pushbutton35_Callback(hObject, eventdata, handles)
|
---|
| 3364 | % hObject handle to pushbutton35 (see GCBO)
|
---|
| 3365 | % eventdata reserved - to be defined in a future version of MATLAB
|
---|
| 3366 | % handles structure with handles and user data (see GUIDATA)
|
---|
| 3367 |
|
---|
| 3368 |
|
---|